FI59593C - Foerfarande foer framstaellning av nya prolaktinutsoendring foerhindrande och gonadotropinutsoendring stimulerande nbeta-substituerade 8-beta-aminoetylergolin-i-derivat och dessas salter - Google Patents
Foerfarande foer framstaellning av nya prolaktinutsoendring foerhindrande och gonadotropinutsoendring stimulerande nbeta-substituerade 8-beta-aminoetylergolin-i-derivat och dessas salter Download PDFInfo
- Publication number
- FI59593C FI59593C FI752086A FI752086A FI59593C FI 59593 C FI59593 C FI 59593C FI 752086 A FI752086 A FI 752086A FI 752086 A FI752086 A FI 752086A FI 59593 C FI59593 C FI 59593C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- general formula
- och
- formula
- hydrogen
- Prior art date
Links
- 241000277284 Salvelinus fontinalis Species 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 238000007792 addition Methods 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 9
- 239000000203 mixture Substances 0.000 claims description 9
- 230000028327 secretion Effects 0.000 claims description 9
- 102000003946 Prolactin Human genes 0.000 claims description 8
- 108010057464 Prolactin Proteins 0.000 claims description 8
- 229940097325 prolactin Drugs 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 229910052987 metal hydride Inorganic materials 0.000 claims description 6
- 150000004681 metal hydrides Chemical class 0.000 claims description 6
- 102000006771 Gonadotropins Human genes 0.000 claims description 5
- 108010086677 Gonadotropins Proteins 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 5
- 239000003638 chemical reducing agent Substances 0.000 claims description 5
- 239000002622 gonadotropin Substances 0.000 claims description 5
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 230000002829 reductive effect Effects 0.000 claims description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 238000001953 recrystallisation Methods 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 230000000144 pharmacologic effect Effects 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims 2
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 claims 1
- 239000000706 filtrate Substances 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- 230000011987 methylation Effects 0.000 claims 1
- 238000007069 methylation reaction Methods 0.000 claims 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 230000000694 effects Effects 0.000 description 13
- 239000002904 solvent Substances 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 239000008267 milk Substances 0.000 description 6
- 210000004080 milk Anatomy 0.000 description 6
- 235000013336 milk Nutrition 0.000 description 6
- -1 amino compound Chemical class 0.000 description 5
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000006722 reduction reaction Methods 0.000 description 2
- 238000005932 reductive alkylation reaction Methods 0.000 description 2
- 230000004584 weight gain Effects 0.000 description 2
- 235000019786 weight gain Nutrition 0.000 description 2
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- OZVBMTJYIDMWIL-AYFBDAFISA-N bromocriptine Chemical compound C1=CC(C=2[C@H](N(C)C[C@@H](C=2)C(=O)N[C@]2(C(=O)N3[C@H](C(N4CCC[C@H]4[C@]3(O)O2)=O)CC(C)C)C(C)C)C2)=C3C2=C(Br)NC3=C1 OZVBMTJYIDMWIL-AYFBDAFISA-N 0.000 description 1
- 229960002802 bromocriptine Drugs 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- QSKWJTXWJJOJFP-UHFFFAOYSA-N chloroform;ethoxyethane Chemical compound ClC(Cl)Cl.CCOCC QSKWJTXWJJOJFP-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- RHGUXDUPXYFCTE-ZWNOBZJWSA-N ergoline Chemical class C1=CC([C@@H]2[C@H](NCCC2)C2)=C3C2=CNC3=C1 RHGUXDUPXYFCTE-ZWNOBZJWSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 230000001817 pituitary effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 210000002307 prostate Anatomy 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000003248 secreting effect Effects 0.000 description 1
- OTNVGWMVOULBFZ-UHFFFAOYSA-N sodium;hydrochloride Chemical compound [Na].Cl OTNVGWMVOULBFZ-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS517874 | 1974-07-19 | ||
| CS745178A CS177530B1 (en) | 1974-07-19 | 1974-07-19 | New nbeta-substituted derivatives of b-beta-aminoethyl-ergoline-i their salts and methods for the production thereof |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI752086A7 FI752086A7 (en:Method) | 1976-01-20 |
| FI59593B FI59593B (fi) | 1981-05-29 |
| FI59593C true FI59593C (fi) | 1981-09-10 |
Family
ID=5396167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI752086A FI59593C (fi) | 1974-07-19 | 1975-07-18 | Foerfarande foer framstaellning av nya prolaktinutsoendring foerhindrande och gonadotropinutsoendring stimulerande nbeta-substituerade 8-beta-aminoetylergolin-i-derivat och dessas salter |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4064130A (en:Method) |
| JP (1) | JPS5134198A (en:Method) |
| AT (1) | AT346502B (en:Method) |
| BE (1) | BE831471A (en:Method) |
| CA (1) | CA1050532A (en:Method) |
| CS (1) | CS177530B1 (en:Method) |
| DD (1) | DD121514A1 (en:Method) |
| DE (1) | DE2532268A1 (en:Method) |
| DK (1) | DK143276C (en:Method) |
| FI (1) | FI59593C (en:Method) |
| FR (1) | FR2278339A1 (en:Method) |
| GB (1) | GB1500980A (en:Method) |
| HU (1) | HU170509B (en:Method) |
| NL (1) | NL7508692A (en:Method) |
| SE (1) | SE7507911L (en:Method) |
| SU (1) | SU632698A1 (en:Method) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS195905B1 (en) * | 1976-12-06 | 1980-02-29 | Milos Beran | 6-substituted derivatives of d-8-ergolin-i-ylacetic acid amide and process for preparing thereof |
| AU526764B2 (en) * | 1978-09-08 | 1983-01-27 | Farmitalia Carlo Erba S.P.A. | Ergoline derivatives |
| GB2120242A (en) * | 1982-04-30 | 1983-11-30 | Erba Farmitalia | Ergoline derivatives |
| JPS6130822U (ja) * | 1984-07-30 | 1986-02-24 | 敬介 本多 | 水中センサ− |
| IT1243782B (it) * | 1990-08-06 | 1994-06-28 | Maria Francesca Devoto | Composizione per il controllo della moltiplicazione di animali vertebrati per mezzo di mangimi od esche contenenti degli agonisti periferici di dopamina |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3228942A (en) * | 1966-01-11 | Methyl and i,g-dimeti-iyl ergoline i compounds | ||
| CA523781A (en) * | 1956-04-10 | Stoll Arthur | Compounds containing the lysergic acid skeleton, and the production thereof | |
| DE1695752C3 (de) * | 1966-07-29 | 1974-06-06 | Societa Farmaceutici Italia, Mailand (Italien) | 1 ,ö-Dimethyl-ebeta-N-carbobenzoxyaminomethyl-2,3-dihydro-1 Oalpha-ergolin und ein Verfahren zu seiner Herstellung |
| US3646046A (en) * | 1968-03-07 | 1972-02-29 | Farmaceutici Italia | 1 6-dimethyl-10alpha-ergoline derivatives |
| DE1942785A1 (de) * | 1968-08-27 | 1970-03-05 | Spofa Vereinigte Pharma Werke | D-6-Methyl-8-beta-hydroxyaethylergolen und Verfahren zur Herstellung desselben |
| NL7400790A (en:Method) * | 1973-02-02 | 1974-08-06 | ||
| US3996228A (en) * | 1973-12-21 | 1976-12-07 | Societa' Farmaceutici Italia S.P.A. | Pyrimidinoaminoethyl ergoline derivatives |
| CS171480B1 (en:Method) * | 1974-03-19 | 1976-10-29 |
-
1974
- 1974-07-19 CS CS745178A patent/CS177530B1/cs unknown
-
1975
- 1975-07-10 SE SE7507911A patent/SE7507911L/xx unknown
- 1975-07-10 AT AT533575A patent/AT346502B/de not_active IP Right Cessation
- 1975-07-15 HU HUSO1157A patent/HU170509B/hu unknown
- 1975-07-17 GB GB29966/75A patent/GB1500980A/en not_active Expired
- 1975-07-17 BE BE158389A patent/BE831471A/xx unknown
- 1975-07-17 DK DK326475A patent/DK143276C/da not_active Application Discontinuation
- 1975-07-18 DD DD187362A patent/DD121514A1/xx unknown
- 1975-07-18 SU SU752155222A patent/SU632698A1/ru active
- 1975-07-18 DE DE19752532268 patent/DE2532268A1/de not_active Withdrawn
- 1975-07-18 US US05/597,389 patent/US4064130A/en not_active Expired - Lifetime
- 1975-07-18 FI FI752086A patent/FI59593C/fi not_active IP Right Cessation
- 1975-07-18 CA CA231,770A patent/CA1050532A/en not_active Expired
- 1975-07-18 JP JP50087402A patent/JPS5134198A/ja active Pending
- 1975-07-21 NL NL7508692A patent/NL7508692A/xx not_active Application Discontinuation
- 1975-07-21 FR FR7522725A patent/FR2278339A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| CS177530B1 (en) | 1977-07-29 |
| FI59593B (fi) | 1981-05-29 |
| JPS5134198A (en) | 1976-03-23 |
| US4064130A (en) | 1977-12-20 |
| AT346502B (de) | 1978-11-10 |
| ATA533575A (de) | 1978-03-15 |
| FI752086A7 (en:Method) | 1976-01-20 |
| DK143276C (da) | 1981-11-30 |
| DE2532268A1 (de) | 1976-02-05 |
| CA1050532A (en) | 1979-03-13 |
| AU8314475A (en) | 1977-01-20 |
| DD121514A1 (en:Method) | 1976-08-05 |
| FR2278339A1 (fr) | 1976-02-13 |
| FR2278339B1 (en:Method) | 1979-08-10 |
| SU632698A1 (ru) | 1978-11-15 |
| DK326475A (da) | 1976-01-20 |
| HU170509B (en:Method) | 1977-06-28 |
| DK143276B (da) | 1981-08-03 |
| NL7508692A (nl) | 1976-01-21 |
| BE831471A (fr) | 1975-11-17 |
| GB1500980A (en) | 1978-02-15 |
| SE7507911L (sv) | 1976-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2609645A1 (de) | Aminoalkylheterocyclen | |
| SU1597096A3 (ru) | Способ получени производных дифенилпропиламина или их фармакологически приемлемых солей | |
| EP0028381B1 (en) | Azepinoindoles, process for their production and pharmaceutical compositions containing them | |
| FI59593C (fi) | Foerfarande foer framstaellning av nya prolaktinutsoendring foerhindrande och gonadotropinutsoendring stimulerande nbeta-substituerade 8-beta-aminoetylergolin-i-derivat och dessas salter | |
| CA1146563A (en) | Benzimidazole derivatives, their preparation and use, and compositions containing these derivatives | |
| GB1569251A (en) | Pyridobenzodiazepines | |
| GB1571781A (en) | Pyridobenzodiazepines | |
| DD149069A5 (de) | Verfahren zur herstellung neuer piperidinopropylerivate | |
| AU619344B2 (en) | Tetrahydronaphthalene and indane derivatives | |
| US4758559A (en) | Pyrrolo[1,2-a] [4,1]benzoxazepine derivatives useful as calmodulin and histamine inhibitors | |
| JP2690749B2 (ja) | ベンズイミダゾール誘導体、その製造方法およびその医薬への応用 | |
| US4228168A (en) | Azepino [1,2,3-lm]-β-carboline compounds and pharmaceutical composition thereof | |
| EP0336555A1 (en) | 4,5,6,7-Tetrahydroisothiazolo (4,5-c)pyridine derivatives and isomers | |
| US3505321A (en) | Basically substituted oximes of 5h-dibenzo-(a,d)10,11-dihydro-cycloheptenylidene and their preparation | |
| AU598034B2 (en) | 1,3-disubstituted imidazolium salts | |
| US6815449B2 (en) | LK6-A derivatives | |
| Edwards et al. | 1-Alkylamino-3-(2-thiazolyloxy)-2-propanols. Novel class of mixed myocardial. beta.-stimulants/. beta.-blockers | |
| US3093652A (en) | Alkyl 1-(2-aryl-2-oxoalkyl)-4-phenylpiperidine-4-carboxylates and their preparation | |
| CS266586B2 (en) | Method of new racemic or optically active berbane derivatives production | |
| SU1731047A3 (ru) | Способ получени производных карбазола или их физиологически приемлемых солей | |
| US4931449A (en) | 2-((4-piperidyl)methyl)benzofuro(2,3-C)pyridine derivatives, and their application in therapy | |
| US3377359A (en) | Amino derivatives, comprising heterocycles, their salts, and process for preparation | |
| US4152434A (en) | Morpholine containing imidzo[4,5-b]pyridines and use thereof | |
| US4122175A (en) | Morpholine containing benzimidazoles | |
| Finch et al. | Heterocyclic synthesis with 2-benzimidazoleacetic acid derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: SPOFA SPOJENé PODNIKY PRO ZDRAVOTNICKOU |