FI54283C - Foerfarande foer framstaellning av slitagebestaendiga natriumperkarbonatkorn - Google Patents
Foerfarande foer framstaellning av slitagebestaendiga natriumperkarbonatkornInfo
- Publication number
- FI54283C FI54283C FI3059/72A FI305972A FI54283C FI 54283 C FI54283 C FI 54283C FI 3059/72 A FI3059/72 A FI 3059/72A FI 305972 A FI305972 A FI 305972A FI 54283 C FI54283 C FI 54283C
- Authority
- FI
- Finland
- Prior art keywords
- slitagebestaendiga
- percarbonated
- framstaellning
- corner
- sodium
- Prior art date
Links
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title 1
- 229910052708 sodium Inorganic materials 0.000 title 1
- 239000011734 sodium Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/10—Peroxyhydrates; Peroxyacids or salts thereof containing carbon
- C01B15/103—Peroxyhydrates; Peroxyacids or salts thereof containing carbon containing only alkali metals as metals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7140860A FR2160251B1 (fr) | 1971-11-15 | 1971-11-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI54283B FI54283B (fi) | 1978-07-31 |
| FI54283C true FI54283C (fi) | 1978-11-10 |
Family
ID=9085794
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3059/72A FI54283C (fi) | 1971-11-15 | 1972-11-02 | Foerfarande foer framstaellning av slitagebestaendiga natriumperkarbonatkorn |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3917663A (fr) |
| JP (1) | JPS5623921B2 (fr) |
| AT (1) | AT333698B (fr) |
| AU (1) | AU461141B2 (fr) |
| BE (1) | BE790351A (fr) |
| BR (1) | BR7208002D0 (fr) |
| CA (1) | CA975133A (fr) |
| CH (1) | CH540196A (fr) |
| DE (1) | DE2250720C2 (fr) |
| ES (1) | ES408219A1 (fr) |
| FI (1) | FI54283C (fr) |
| FR (1) | FR2160251B1 (fr) |
| GB (1) | GB1403449A (fr) |
| IT (1) | IT969808B (fr) |
| NL (1) | NL7215252A (fr) |
| NO (1) | NO137318C (fr) |
| SE (1) | SE384014B (fr) |
| ZA (1) | ZA727761B (fr) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4020148A (en) * | 1975-07-15 | 1977-04-26 | Fmc Corporation | Process for drying sodium carbonate peroxide |
| LU73751A1 (fr) * | 1975-11-06 | 1977-06-03 | ||
| LU75466A1 (fr) * | 1976-07-27 | 1978-02-08 | ||
| LU76548A1 (fr) * | 1977-01-10 | 1978-09-18 | ||
| JPS606881B2 (ja) * | 1977-09-13 | 1985-02-21 | 花王株式会社 | 発泡性過炭酸ナトリウムの製造方法 |
| US4428914A (en) | 1977-12-23 | 1984-01-31 | Interox | Process for making sodium percarbonate granules |
| FR2471222A1 (fr) * | 1979-12-12 | 1981-06-19 | Interox | Procede pour la stabilisation de particules contenant des composes peroxygenes et compositions de blanchiment contenant des particules stabilisees selon ce procede |
| US4410444A (en) | 1981-03-24 | 1983-10-18 | Degussa Aktiengesellschaft | Process for the production of a stable per salt |
| JPS58162932A (ja) * | 1982-03-23 | 1983-09-27 | Hitachi Ltd | 液晶表示素子 |
| DE4338401A1 (de) † | 1993-11-10 | 1995-05-11 | Degussa | Verfahren zur Herstellung von abriebfestem Natriumpercarbonat mit hoher Lösegeschwindigkeit |
| US6071431A (en) * | 1994-10-07 | 2000-06-06 | Eka Chemicals Ab | Bleaching agent |
| DE19533524A1 (de) * | 1995-09-11 | 1997-03-13 | Solvay Interox Gmbh | Verfahren zur Herstellung von Natriumpercarbonat |
| GB2313368B (en) * | 1996-02-29 | 2000-06-14 | Oriental Chem Ind | Process for manufacturing granular sodium percarbonate |
| FR2746386B1 (fr) * | 1996-03-19 | 1998-04-24 | Atochem Elf Sa | Nouveau percarbonate de sodium et son procede d'obtention |
| DE10035287A1 (de) * | 2000-07-18 | 2002-01-31 | Solvay Interox Gmbh | Gecoatete Metallperoxide |
| DE10065953A1 (de) * | 2000-12-23 | 2002-07-04 | Degussa | Verfahren zur Erhöhung der inneren Stabilität von Natriumpercarbonat |
| FR2821344B1 (fr) * | 2001-02-26 | 2003-04-25 | Solvay | Granule de substance minerale agglomeree, resistant a l'abrasion, poudre comprenant de tels granules et procede pour sa fabrication |
| DE10140838A1 (de) * | 2001-08-21 | 2003-03-06 | Degussa | Verfahren zur Herstellung von Natriumpercarbonat |
| EP1612186A1 (fr) * | 2004-06-29 | 2006-01-04 | SOLVAY (Société Anonyme) | Particules de percarbonate de sodium, leur procede de production, leur utilisation et compositions detergentes les contenant |
| EP1612185A1 (fr) * | 2004-06-29 | 2006-01-04 | SOLVAY (Société Anonyme) | Particules de percarbonate de sodium enrobées, procédé de fabrication et utilisation de celles-ci. |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1950320A (en) * | 1932-05-10 | 1934-03-06 | Muller Josef | Process for the manufacture of high-percentage per compounds |
| US2986448A (en) * | 1958-12-18 | 1961-05-30 | Allied Chem | Preparation of sodium percarbonate |
| US3441388A (en) * | 1965-12-14 | 1969-04-29 | Fmc Corp | Effervescent compounds and process for producing same |
| FR2076430A5 (fr) * | 1970-01-14 | 1971-10-15 | Solvay | Procede de fabrication du percarbonate de sodium |
| CA916665A (en) * | 1970-02-17 | 1972-12-12 | Cominco Ltd. | Potash granulation |
| US3677697A (en) * | 1970-10-07 | 1972-07-18 | Gni I Pi Osnovnoi Khim | Method of producing sodium percarbonate |
| US3701737A (en) * | 1970-10-30 | 1972-10-31 | Fmc Corp | Sodium carbonate-sodium bicarbonate agglomerates |
| US3748103A (en) * | 1971-06-25 | 1973-07-24 | Allied Chem | Process for the production of hydrous granular sodium silicate |
-
0
- BE BE790351D patent/BE790351A/fr not_active IP Right Cessation
-
1971
- 1971-11-15 FR FR7140860A patent/FR2160251B1/fr not_active Expired
-
1972
- 1972-10-12 CH CH1490972A patent/CH540196A/fr not_active IP Right Cessation
- 1972-10-16 DE DE2250720A patent/DE2250720C2/de not_active Expired
- 1972-10-23 IT IT30807/72A patent/IT969808B/it active
- 1972-11-01 AU AU48391/72A patent/AU461141B2/en not_active Expired
- 1972-11-01 ZA ZA727761A patent/ZA727761B/xx unknown
- 1972-11-02 FI FI3059/72A patent/FI54283C/fi active
- 1972-11-03 ES ES408219A patent/ES408219A1/es not_active Expired
- 1972-11-09 CA CA156,255A patent/CA975133A/en not_active Expired
- 1972-11-10 NL NL7215252A patent/NL7215252A/xx not_active Application Discontinuation
- 1972-11-10 GB GB5197972A patent/GB1403449A/en not_active Expired
- 1972-11-14 AT AT966872A patent/AT333698B/de not_active IP Right Cessation
- 1972-11-14 SE SE7214777A patent/SE384014B/xx unknown
- 1972-11-14 BR BR8002/72A patent/BR7208002D0/pt unknown
- 1972-11-14 NO NO4129/72A patent/NO137318C/no unknown
- 1972-11-14 US US306219A patent/US3917663A/en not_active Expired - Lifetime
- 1972-11-14 JP JP11355772A patent/JPS5623921B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| BR7208002D0 (pt) | 1973-10-09 |
| ZA727761B (en) | 1973-07-25 |
| CA975133A (en) | 1975-09-30 |
| JPS4890993A (fr) | 1973-11-27 |
| BE790351A (fr) | 1973-04-20 |
| DE2250720C2 (de) | 1981-12-03 |
| SE384014B (sv) | 1976-04-12 |
| FI54283B (fi) | 1978-07-31 |
| GB1403449A (en) | 1975-08-28 |
| ES408219A1 (es) | 1975-11-16 |
| US3917663A (en) | 1975-11-04 |
| FR2160251A1 (fr) | 1973-06-29 |
| NL7215252A (fr) | 1973-05-17 |
| AT333698B (de) | 1976-12-10 |
| ATA966872A (de) | 1976-04-15 |
| DE2250720A1 (de) | 1973-05-24 |
| JPS5623921B2 (fr) | 1981-06-03 |
| NO137318C (no) | 1978-02-08 |
| NO137318B (no) | 1977-10-31 |
| CH540196A (fr) | 1973-08-15 |
| FR2160251B1 (fr) | 1974-05-31 |
| IT969808B (it) | 1974-04-10 |
| AU4839172A (en) | 1974-05-02 |
| AU461141B2 (en) | 1975-05-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE382958B (sv) | Lasring for behallarlock | |
| FI53919B (fi) | Laekemedelsbaerare av silikongummi | |
| SE383601B (sv) | Liktornshyvel | |
| FI54323C (fi) | Foerfarande foer framstaellning av foertyngningsaemnen foer spolmedel foer borrhaol | |
| IT952854B (it) | Filtropressa | |
| FI54027B (fi) | Vaermevaexlare av avdunstningstyp | |
| FI54283C (fi) | Foerfarande foer framstaellning av slitagebestaendiga natriumperkarbonatkorn | |
| FI54623B (fi) | Foerfarande foer vaotoxidering av svartlut fraon alkalisk kokningsprocess | |
| FI54622B (fi) | Foerfarande foer avlaegsnande av natriumklorid fraon kemikalieaotervinningssystemet av sulfatcellulosakok | |
| FI54146B (fi) | Foerfarande foer framstaellning av en koncentrerad laktulossirap | |
| SE373315B (sv) | Slitlenk for deckkedjor | |
| SE396102B (sv) | Berband for blixtlas | |
| BR7208328D0 (pt) | Fresa | |
| DE2120704B2 (de) | Eckverbindung | |
| FI53736C (fi) | Platta foer skydd av grundmur | |
| BE772644A (nl) | Hoekverbinding | |
| SE396101B (sv) | Berband for blixtlas | |
| SE391327B (sv) | Leggsten for planglasugn | |
| SE390682B (sv) | Anslutningsdosa | |
| IT957186B (it) | Triglicidil composti eterociclici | |
| BR7201811D0 (pt) | Fresa | |
| FI54305C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva isoindolinderivat | |
| IT974096B (it) | Composti fenilstilbeniltriazolici | |
| AT320520B (de) | Plombe | |
| FI46484B (fi) | Av plastfolie framstaelld baerkasse |