ES2300019T3 - Derivados de 2-piridinilcicloalquilcarboxamida utiles como fungicidas. - Google Patents
Derivados de 2-piridinilcicloalquilcarboxamida utiles como fungicidas. Download PDFInfo
- Publication number
- ES2300019T3 ES2300019T3 ES05742091T ES05742091T ES2300019T3 ES 2300019 T3 ES2300019 T3 ES 2300019T3 ES 05742091 T ES05742091 T ES 05742091T ES 05742091 T ES05742091 T ES 05742091T ES 2300019 T3 ES2300019 T3 ES 2300019T3
- Authority
- ES
- Spain
- Prior art keywords
- alkyl
- group
- halogen
- halogen atoms
- halogenoalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000417 fungicide Substances 0.000 title description 5
- 125000005843 halogen group Chemical group 0.000 claims abstract description 153
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 110
- 150000001875 compounds Chemical class 0.000 claims abstract description 86
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 84
- 125000004429 atom Chemical group 0.000 claims abstract description 79
- 150000002367 halogens Chemical class 0.000 claims abstract description 79
- 125000001188 haloalkyl group Chemical group 0.000 claims abstract description 72
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 68
- -1 formyloxy group Chemical group 0.000 claims abstract description 60
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 43
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 20
- 125000004438 haloalkoxy group Chemical group 0.000 claims abstract description 19
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 13
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 12
- 150000003839 salts Chemical class 0.000 claims abstract description 12
- 125000003277 amino group Chemical group 0.000 claims abstract description 9
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims abstract description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims abstract description 8
- 125000004103 aminoalkyl group Chemical group 0.000 claims abstract description 7
- 229910052752 metalloid Inorganic materials 0.000 claims abstract description 7
- 150000002738 metalloids Chemical class 0.000 claims abstract description 7
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 6
- 125000003396 thiol group Chemical group [H]S* 0.000 claims abstract description 6
- 125000003118 aryl group Chemical group 0.000 claims abstract description 5
- 125000004966 cyanoalkyl group Chemical group 0.000 claims abstract description 5
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 4
- 125000005842 heteroatom Chemical group 0.000 claims abstract description 4
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 4
- 125000001424 substituent group Chemical group 0.000 claims abstract description 4
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims abstract description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims abstract description 3
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 3
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 3
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims abstract description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims abstract description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims abstract description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract 7
- 239000000203 mixture Substances 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 42
- 125000003545 alkoxy group Chemical group 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 22
- 238000002360 preparation method Methods 0.000 claims description 13
- 239000003054 catalyst Substances 0.000 claims description 12
- 230000000855 fungicidal effect Effects 0.000 claims description 12
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 235000013399 edible fruits Nutrition 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 241000233866 Fungi Species 0.000 claims description 6
- 125000000171 (C1-C6) haloalkyl group Chemical group 0.000 claims description 4
- ZENKESXKWBIZCV-UHFFFAOYSA-N 2,2,4,4-tetrafluoro-1,3-benzodioxin-6-amine Chemical group O1C(F)(F)OC(F)(F)C2=CC(N)=CC=C21 ZENKESXKWBIZCV-UHFFFAOYSA-N 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 230000003032 phytopathogenic effect Effects 0.000 claims description 3
- 125000004217 4-methoxybenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C([H])([H])* 0.000 claims description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 2
- 231100001184 nonphytotoxic Toxicity 0.000 claims description 2
- 125000000538 pentafluorophenyl group Chemical group FC1=C(F)C(F)=C(*)C(F)=C1F 0.000 claims description 2
- 230000003449 preventive effect Effects 0.000 claims description 2
- 239000002689 soil Substances 0.000 claims description 2
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims 1
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims 1
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 abstract description 4
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 abstract description 3
- 229910052751 metal Inorganic materials 0.000 abstract description 3
- 239000002184 metal Chemical class 0.000 abstract description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 abstract description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 abstract 2
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 abstract 2
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 abstract 2
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 abstract 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 abstract 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 abstract 1
- 125000005347 halocycloalkyl group Chemical group 0.000 abstract 1
- 241000196324 Embryophyta Species 0.000 description 26
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 22
- 201000010099 disease Diseases 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 241000894007 species Species 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 240000005979 Hordeum vulgare Species 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000011149 active material Substances 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000002023 wood Substances 0.000 description 8
- 235000007340 Hordeum vulgare Nutrition 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 238000001819 mass spectrum Methods 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 241000221785 Erysiphales Species 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 241000813090 Rhizoctonia solani Species 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 239000003446 ligand Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 238000005507 spraying Methods 0.000 description 6
- 241000223221 Fusarium oxysporum Species 0.000 description 5
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000004094 surface-active agent Substances 0.000 description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- 241000221779 Fusarium sambucinum Species 0.000 description 4
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 4
- 241000520648 Pyrenophora teres Species 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 241000209140 Triticum Species 0.000 description 4
- 235000021307 Triticum Nutrition 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 4
- 150000002466 imines Chemical class 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 150000003222 pyridines Chemical class 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- WEPGXOXANCNGDB-UHFFFAOYSA-N 2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]cyclohexan-1-one Chemical compound ClC1=CC(C(F)(F)F)=CN=C1C1C(=O)CCCC1 WEPGXOXANCNGDB-UHFFFAOYSA-N 0.000 description 3
- 241001149961 Alternaria brassicae Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 244000061456 Solanum tuberosum Species 0.000 description 3
- 235000002595 Solanum tuberosum Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 125000005097 aminocarbonylalkyl group Chemical group 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 235000013339 cereals Nutrition 0.000 description 3
- 239000003245 coal Substances 0.000 description 3
- 230000008878 coupling Effects 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000004678 hydrides Chemical class 0.000 description 3
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 102000004169 proteins and genes Human genes 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- BIGBIDRLXGVZET-UHFFFAOYSA-N 2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]cycloheptan-1-one Chemical compound ClC1=CC(C(F)(F)F)=CN=C1C1C(=O)CCCCC1 BIGBIDRLXGVZET-UHFFFAOYSA-N 0.000 description 2
- IBUACGIXYNTDPN-UHFFFAOYSA-N 2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]cyclohexan-1-amine Chemical compound NC1CCCCC1C1=NC=C(C(F)(F)F)C=C1Cl IBUACGIXYNTDPN-UHFFFAOYSA-N 0.000 description 2
- GDSROTVTTLUHCO-UHFFFAOYSA-N 3-chloro-2-fluoro-5-(trifluoromethyl)pyridine Chemical compound FC1=NC=C(C(F)(F)F)C=C1Cl GDSROTVTTLUHCO-UHFFFAOYSA-N 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 241000208838 Asteraceae Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 235000016068 Berberis vulgaris Nutrition 0.000 description 2
- 241000335053 Beta vulgaris Species 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- 241000190150 Bipolaris sorokiniana Species 0.000 description 2
- 241001480061 Blumeria graminis Species 0.000 description 2
- 241000123650 Botrytis cinerea Species 0.000 description 2
- 240000002791 Brassica napus Species 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- 241000219193 Brassicaceae Species 0.000 description 2
- 241000871189 Chenopodiaceae Species 0.000 description 2
- 229920000742 Cotton Polymers 0.000 description 2
- GKQLYSROISKDLL-UHFFFAOYSA-N EEDQ Chemical compound C1=CC=C2N(C(=O)OCC)C(OCC)C=CC2=C1 GKQLYSROISKDLL-UHFFFAOYSA-N 0.000 description 2
- 208000004770 Fusariosis Diseases 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001518729 Monilinia Species 0.000 description 2
- 241001459558 Monographella nivalis Species 0.000 description 2
- 240000005561 Musa balbisiana Species 0.000 description 2
- 208000031888 Mycoses Diseases 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 241001668536 Oculimacula yallundae Species 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 235000007164 Oryza sativa Nutrition 0.000 description 2
- 241000736122 Parastagonospora nodorum Species 0.000 description 2
- 244000088415 Raphanus sativus Species 0.000 description 2
- 235000004789 Rosa xanthina Nutrition 0.000 description 2
- 241000220222 Rosaceae Species 0.000 description 2
- 241000208292 Solanaceae Species 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical class [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 240000008042 Zea mays Species 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000003905 agrochemical Substances 0.000 description 2
- 230000009418 agronomic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000002723 alicyclic group Chemical group 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000003849 aromatic solvent Substances 0.000 description 2
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 2
- 235000021015 bananas Nutrition 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 150000001638 boron Chemical class 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- LHVQVTRNQNYQQT-KHZPMNTOSA-N cyclopenta-1,3-diene dicyclohexyl-[(1R)-1-(2-dicyclohexylphosphanylcyclopenta-1,4-dien-1-yl)ethyl]phosphane iron(2+) Chemical compound [Fe+2].C=1C=C[CH-]C=1.C1CCCCC1P([C@H](C)[C-]1C(=CC=C1)P(C1CCCCC1)C1CCCCC1)C1CCCCC1 LHVQVTRNQNYQQT-KHZPMNTOSA-N 0.000 description 2
- HGTBZFMPHBAUCQ-KHZPMNTOSA-N cyclopentane;dicyclohexyl-[(1r)-1-(2-diphenylphosphanylcyclopentyl)ethyl]phosphane;iron Chemical compound [Fe].[CH]1[CH][CH][CH][CH]1.[C]1([C@@H](C)P(C2CCCCC2)C2CCCCC2)[CH][CH][CH][C]1P(C=1C=CC=CC=1)C1=CC=CC=C1 HGTBZFMPHBAUCQ-KHZPMNTOSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- WHOBZBLBTZHMGY-UHFFFAOYSA-N ditert-butyl(ethyl)phosphane Chemical compound CCP(C(C)(C)C)C(C)(C)C WHOBZBLBTZHMGY-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- WUOIAOOSKMHJOV-UHFFFAOYSA-N ethyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(CC)C1=CC=CC=C1 WUOIAOOSKMHJOV-UHFFFAOYSA-N 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000000265 homogenisation Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- DVCFWWWSZLFHGN-UHFFFAOYSA-N n-[2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]cycloheptyl]-1-methyl-3-(trifluoromethyl)pyrazole-4-carboxamide Chemical compound FC(F)(F)C1=NN(C)C=C1C(=O)NC1C(C=2C(=CC(=CN=2)C(F)(F)F)Cl)CCCCC1 DVCFWWWSZLFHGN-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 150000002940 palladium Chemical class 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 150000002989 phenols Chemical group 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 235000009566 rice Nutrition 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical compound CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- WHOZNOZYMBRCBL-OUKQBFOZSA-N (2E)-2-Tetradecenal Chemical class CCCCCCCCCCC\C=C\C=O WHOZNOZYMBRCBL-OUKQBFOZSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- KTZNVZJECQAMBV-UHFFFAOYSA-N 1-(cyclohexen-1-yl)pyrrolidine Chemical compound C1CCCN1C1=CCCCC1 KTZNVZJECQAMBV-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- FZNKJQNEJGXCJH-UHFFFAOYSA-N 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid Chemical compound CN1C=C(C(O)=O)C(C(F)(F)F)=N1 FZNKJQNEJGXCJH-UHFFFAOYSA-N 0.000 description 1
- YOXKECMKGWHKMN-BXUZGUMPSA-N 2-chloro-n-[(1r,2r)-2-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]cyclohexyl]pyridine-3-carboxamide Chemical compound ClC1=CC(C(F)(F)F)=CN=C1[C@H]1[C@H](NC(=O)C=2C(=NC=CC=2)Cl)CCCC1 YOXKECMKGWHKMN-BXUZGUMPSA-N 0.000 description 1
- RXTRRIFWCJEMEL-UHFFFAOYSA-N 2-chloropyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1Cl RXTRRIFWCJEMEL-UHFFFAOYSA-N 0.000 description 1
- FOGYNLXERPKEGN-UHFFFAOYSA-N 3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfopropyl)phenoxy]propane-1-sulfonic acid Chemical compound COC1=CC=CC(CC(CS(O)(=O)=O)OC=2C(=CC(CCCS(O)(=O)=O)=CC=2)OC)=C1O FOGYNLXERPKEGN-UHFFFAOYSA-N 0.000 description 1
- HLVQJUUPEMTTIS-UHFFFAOYSA-N 4-(cyclohepten-1-yl)morpholine Chemical compound C1COCCN1C1=CCCCCC1 HLVQJUUPEMTTIS-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 241000223600 Alternaria Species 0.000 description 1
- 241001275965 Alternaria linicola Species 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 241001558165 Alternaria sp. Species 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 241000208223 Anacardiaceae Species 0.000 description 1
- 241000208173 Apiaceae Species 0.000 description 1
- 241001273451 Ascochyta pisi Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241001225321 Aspergillus fumigatus Species 0.000 description 1
- 241000228257 Aspergillus sp. Species 0.000 description 1
- 241000219495 Betulaceae Species 0.000 description 1
- 241001274890 Boeremia exigua Species 0.000 description 1
- 241000740945 Botrytis sp. Species 0.000 description 1
- 241000233685 Bremia lactucae Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000002853 C1-C4 hydroxyalkyl group Chemical group 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 206010007134 Candida infections Diseases 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 241001290235 Ceratobasidium cereale Species 0.000 description 1
- 241000530549 Cercospora beticola Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 240000000560 Citrus x paradisi Species 0.000 description 1
- 241001207508 Cladosporium sp. Species 0.000 description 1
- 241001480643 Colletotrichum sp. Species 0.000 description 1
- 241000219104 Cucurbitaceae Species 0.000 description 1
- 206010048768 Dermatosis Diseases 0.000 description 1
- 241001273467 Didymella pinodes Species 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 241000219428 Fagaceae Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 240000009088 Fragaria x ananassa Species 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241000223194 Fusarium culmorum Species 0.000 description 1
- 241000221778 Fusarium fujikuroi Species 0.000 description 1
- 241000223195 Fusarium graminearum Species 0.000 description 1
- 241000427940 Fusarium solani Species 0.000 description 1
- 241001149475 Gaeumannomyces graminis Species 0.000 description 1
- 241000896246 Golovinomyces cichoracearum Species 0.000 description 1
- 241000555709 Guignardia Species 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 241000592938 Helminthosporium solani Species 0.000 description 1
- 241000758791 Juglandaceae Species 0.000 description 1
- 241001293495 Lactuca virosa Species 0.000 description 1
- 241000218195 Lauraceae Species 0.000 description 1
- 241000228457 Leptosphaeria maculans Species 0.000 description 1
- 241000896221 Leveillula taurica Species 0.000 description 1
- 241000234280 Liliaceae Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241001344131 Magnaporthe grisea Species 0.000 description 1
- 244000070406 Malus silvestris Species 0.000 description 1
- 240000007679 Mandevilla laxa Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241001668538 Mollisia Species 0.000 description 1
- 241000218231 Moraceae Species 0.000 description 1
- 241000234615 Musaceae Species 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- 101100070530 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) het-6 gene Proteins 0.000 description 1
- 241000207834 Oleaceae Species 0.000 description 1
- 241000228168 Penicillium sp. Species 0.000 description 1
- 241000169463 Peronospora sp. Species 0.000 description 1
- 241000201565 Peronospora viciae f. sp. pisi Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 241000031556 Phytophthora sp. Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 241000317981 Podosphaera fuliginea Species 0.000 description 1
- 241001337928 Podosphaera leucotricha Species 0.000 description 1
- 244000018633 Prunus armeniaca Species 0.000 description 1
- 235000009827 Prunus armeniaca Nutrition 0.000 description 1
- 240000005809 Prunus persica Species 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 241001281802 Pseudoperonospora Species 0.000 description 1
- 241001123559 Puccinia hordei Species 0.000 description 1
- 241001123569 Puccinia recondita Species 0.000 description 1
- 241001123583 Puccinia striiformis Species 0.000 description 1
- 241000228454 Pyrenophora graminea Species 0.000 description 1
- 241000220324 Pyrus Species 0.000 description 1
- 241001385948 Pythium sp. Species 0.000 description 1
- 241000771943 Ramularia beticola Species 0.000 description 1
- 241000952054 Rhizopus sp. Species 0.000 description 1
- 241001515790 Rhynchosporium secalis Species 0.000 description 1
- 241001107098 Rubiaceae Species 0.000 description 1
- 241001093501 Rutaceae Species 0.000 description 1
- 241000221696 Sclerotinia sclerotiorum Species 0.000 description 1
- 241001207471 Septoria sp. Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical compound OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- 206010053615 Thermal burn Diseases 0.000 description 1
- 241000561282 Thielaviopsis basicola Species 0.000 description 1
- 241000722093 Tilletia caries Species 0.000 description 1
- 241000722096 Tilletia controversa Species 0.000 description 1
- 241000167577 Tilletia indica Species 0.000 description 1
- 241001557886 Trichoderma sp. Species 0.000 description 1
- 241000223238 Trichophyton Species 0.000 description 1
- 241000007070 Ustilago nuda Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 241001360088 Zymoseptoria tritici Species 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 229940091771 aspergillus fumigatus Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 210000000988 bone and bone Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 201000003984 candidiasis Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229950005499 carbon tetrachloride Drugs 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 235000019506 cigar Nutrition 0.000 description 1
- 239000004524 cold fogging concentrate Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 239000004487 encapsulated granule Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000004503 fine granule Substances 0.000 description 1
- 235000004426 flaxseed Nutrition 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 208000024386 fungal infectious disease Diseases 0.000 description 1
- 244000053095 fungal pathogen Species 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 235000021374 legumes Nutrition 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- BSAQKHKYJMRZFK-UHFFFAOYSA-N n-(2-pyridin-2-ylethyl)formamide Chemical class O=CNCCC1=CC=CC=N1 BSAQKHKYJMRZFK-UHFFFAOYSA-N 0.000 description 1
- 229960003966 nicotinamide Drugs 0.000 description 1
- 239000011570 nicotinamide Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000007764 o/w emulsion Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 235000021017 pears Nutrition 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229940044654 phenolsulfonic acid Drugs 0.000 description 1
- 239000003016 pheromone Substances 0.000 description 1
- 125000002467 phosphate group Chemical group [H]OP(=O)(O[H])O[*] 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- NAYYNDKKHOIIOD-UHFFFAOYSA-N phthalamide Chemical compound NC(=O)C1=CC=CC=C1C(N)=O NAYYNDKKHOIIOD-UHFFFAOYSA-N 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000011120 plywood Substances 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 235000012015 potatoes Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- IVRIRQXJSNCSPQ-UHFFFAOYSA-N propan-2-yl carbonochloridate Chemical compound CC(C)OC(Cl)=O IVRIRQXJSNCSPQ-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 208000017520 skin disease Diseases 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000004550 soluble concentrate Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 235000021012 strawberries Nutrition 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000004546 suspension concentrate Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 239000013008 thixotropic agent Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 230000017105 transposition Effects 0.000 description 1
- 239000004560 ultra-low volume (ULV) liquid Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000003612 virological effect Effects 0.000 description 1
- 239000004552 water soluble powder Substances 0.000 description 1
- 239000004554 water soluble tablet Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D411/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen and sulfur atoms as the only ring hetero atoms
- C07D411/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen and sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D411/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen and sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP04356057 | 2004-04-26 | ||
| EP04356057 | 2004-04-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2300019T3 true ES2300019T3 (es) | 2008-06-01 |
Family
ID=34931749
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES05742091T Expired - Lifetime ES2300019T3 (es) | 2004-04-26 | 2005-04-25 | Derivados de 2-piridinilcicloalquilcarboxamida utiles como fungicidas. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US7687067B2 (esLanguage) |
| EP (1) | EP1740544B1 (esLanguage) |
| JP (1) | JP4774043B2 (esLanguage) |
| KR (1) | KR101276929B1 (esLanguage) |
| CN (1) | CN1946695B (esLanguage) |
| AT (1) | ATE373643T1 (esLanguage) |
| BR (1) | BRPI0508738B1 (esLanguage) |
| CA (1) | CA2560373C (esLanguage) |
| DE (1) | DE602005002553T2 (esLanguage) |
| DK (1) | DK1740544T3 (esLanguage) |
| ES (1) | ES2300019T3 (esLanguage) |
| IL (1) | IL178771A (esLanguage) |
| IN (1) | IN2012DN02609A (esLanguage) |
| MX (1) | MXPA06012159A (esLanguage) |
| PL (1) | PL1740544T3 (esLanguage) |
| PT (1) | PT1740544E (esLanguage) |
| WO (1) | WO2005103006A1 (esLanguage) |
| ZA (1) | ZA200608359B (esLanguage) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP2008545637A (ja) * | 2005-05-18 | 2008-12-18 | バイエル・クロツプサイエンス・エス・アー | 2−ピリジニルシクロアルキルベンズアミド誘導体及び殺菌剤としてのそれらの使用 |
| EP1885712B1 (en) * | 2005-05-18 | 2011-02-23 | Bayer CropScience AG | New 2-pyridinylcycloalkylcarboxamide derivatives as fungicides. |
| ATE449068T1 (de) * | 2006-05-18 | 2009-12-15 | Syngenta Participations Ag | Neue mikrobiozide |
| EP2128139B1 (en) * | 2007-02-20 | 2013-08-07 | Mitsui Chemicals Agro, Inc. | Fluorine-containing pyrazolecarbonitrile derivative and method for producing the same, and fluorine-containing pyrazolecarboxylic acid derivative obtained by using the fluorine-containing pyrazolecarbonitrile derivative and method for producing the same |
| BRPI1006006B1 (pt) * | 2009-02-17 | 2018-05-22 | Bayer Intellectual Property Gmbh | Compostos, composição fungicida e método para o controle de fungos fitopatogênicos de culturas |
| EP2289880A1 (en) * | 2009-07-08 | 2011-03-02 | Bayer CropScience AG | 2-Pyridinylcyclopropylbenzamide fungicides |
| ES2533026T3 (es) | 2010-06-03 | 2015-04-07 | Bayer Intellectual Property Gmbh | N-[(het)arilalquil)]pirazol (tio)carboxamidas y sus análogos heterosustituidos |
| WO2012093100A1 (en) * | 2011-01-05 | 2012-07-12 | Syngenta Participations Ag | Pyrazol-4-yl carboxamide derivatives as microbiocides |
| EP2606728A1 (en) | 2011-12-21 | 2013-06-26 | Bayer CropScience AG | Compounds with nematicidal activity |
| MX2014004849A (es) | 2011-11-02 | 2014-08-27 | Bayer Ip Gmbh | Compuesto con actividad nematicida. |
| EP2606727A1 (en) | 2011-12-21 | 2013-06-26 | Bayer CropScience AG | Compounds with nematicidal activity |
| RU2608217C2 (ru) | 2011-11-02 | 2017-01-17 | Байер Интеллектуэль Проперти Гмбх | Соединения с нематоцидной активностью |
| EP2589294A1 (en) | 2011-11-02 | 2013-05-08 | Bayer CropScience AG | Compounds with nematicidal activity |
| EP2589292A1 (en) | 2011-11-02 | 2013-05-08 | Bayer CropScience AG | Compounds with nematicidal activity |
| EP2644595A1 (en) | 2012-03-26 | 2013-10-02 | Syngenta Participations AG. | N-Cyclylamides as nematicides |
| AU2014289431B2 (en) | 2013-07-08 | 2018-01-18 | Syngenta Crop Protection Ag | 4-membered ring carboxamides used as nematicides |
| WO2015040141A1 (en) | 2013-09-23 | 2015-03-26 | Syngenta Participations Ag | Cyclobutylcarboxamides as nematicides |
| UY35772A (es) | 2013-10-14 | 2015-05-29 | Bayer Cropscience Ag | Nuevos compuestos plaguicidas |
| EP3283476B1 (en) | 2015-04-13 | 2019-08-14 | Bayer Cropscience AG | N-cycloalkyl-n-(biheterocyclyethylene)-(thio)carboxamide derivatives |
| BR112019012322A2 (pt) | 2016-12-20 | 2019-11-19 | Syngenta Participations Ag | n-ciclobutil-tiazol-5-carboxamidas com atividade nematicida |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR880011105A (ko) * | 1986-05-02 | 1988-10-26 | 죤 알. 페넬 | 살균제 피리딜 스클로프로판 카르복스아미드와 이를 이용한 살균제 조성물 및 억제방법 |
| EP0314427A3 (en) * | 1987-10-29 | 1990-08-01 | Ici Americas Inc. | Fungicidal pyridyl amides |
| JPH0892223A (ja) * | 1994-09-27 | 1996-04-09 | Mitsui Toatsu Chem Inc | ヘテロ環置換アニリン誘導体およびこれを有効成分とする農園芸用殺菌剤 |
| JPH09132567A (ja) * | 1995-11-08 | 1997-05-20 | Mitsui Toatsu Chem Inc | ピラゾールカルボン酸アニリド誘導体およびこれを有効成分とする農園芸用殺菌剤 |
| JP3844533B2 (ja) * | 1995-12-15 | 2006-11-15 | 日本曹達株式会社 | 2,6−ジクロロイソニコチン酸フェネチルアミド誘導体及び植物病害防除剤 |
| DE19629825A1 (de) * | 1996-07-24 | 1998-01-29 | Bayer Ag | Dihydrofuran-carboxamide |
| DE19629826A1 (de) * | 1996-07-24 | 1998-01-29 | Bayer Ag | 1,3-Dimethyl-5-fluor-pyrazol-4-carboxamide |
| AU771975B2 (en) * | 1998-11-04 | 2004-04-08 | Meiji Seika Kaisha Ltd. | Picolinamide derivatives and pest controllers containing the same as the active ingredient |
| ES2220533T3 (es) * | 1999-08-18 | 2004-12-16 | Aventis Cropscience Gmbh | Fungicidas. |
| GB0001447D0 (en) * | 2000-01-21 | 2000-03-08 | Novartis Ag | Organic compounds |
| AU2002211233A1 (en) * | 2000-09-18 | 2002-03-26 | E.I. Du Pont De Nemours And Company | Pyridinyl amides and imides for use as fungicides |
| DE10204391A1 (de) * | 2002-02-04 | 2003-08-14 | Bayer Cropscience Ag | Difluormethylthiazolylcarboxanilide |
| DE10218231A1 (de) * | 2002-04-24 | 2003-11-06 | Bayer Cropscience Ag | Methylthiophencarboxanilide |
| DE10222884A1 (de) * | 2002-05-23 | 2003-12-04 | Bayer Cropscience Ag | Furancarboxamide |
| DE10222886A1 (de) * | 2002-05-23 | 2003-12-11 | Bayer Cropscience Ag | Oxathiincarboxamide |
-
2005
- 2005-04-25 MX MXPA06012159A patent/MXPA06012159A/es active IP Right Grant
- 2005-04-25 KR KR1020067024501A patent/KR101276929B1/ko not_active Expired - Fee Related
- 2005-04-25 IN IN2609DEN2012 patent/IN2012DN02609A/en unknown
- 2005-04-25 CA CA2560373A patent/CA2560373C/en not_active Expired - Fee Related
- 2005-04-25 JP JP2007509998A patent/JP4774043B2/ja not_active Expired - Fee Related
- 2005-04-25 PT PT05742091T patent/PT1740544E/pt unknown
- 2005-04-25 CN CN2005800127209A patent/CN1946695B/zh not_active Expired - Fee Related
- 2005-04-25 BR BRPI0508738-4A patent/BRPI0508738B1/pt not_active IP Right Cessation
- 2005-04-25 ES ES05742091T patent/ES2300019T3/es not_active Expired - Lifetime
- 2005-04-25 AT AT05742091T patent/ATE373643T1/de not_active IP Right Cessation
- 2005-04-25 PL PL05742091T patent/PL1740544T3/pl unknown
- 2005-04-25 WO PCT/EP2005/005796 patent/WO2005103006A1/en not_active Ceased
- 2005-04-25 DE DE602005002553T patent/DE602005002553T2/de not_active Expired - Lifetime
- 2005-04-25 DK DK05742091T patent/DK1740544T3/da active
- 2005-04-25 EP EP05742091A patent/EP1740544B1/en not_active Expired - Lifetime
- 2005-04-25 US US11/587,909 patent/US7687067B2/en not_active Expired - Fee Related
-
2006
- 2006-10-06 ZA ZA200608359A patent/ZA200608359B/en unknown
- 2006-10-19 IL IL178771A patent/IL178771A/en active IP Right Grant
Also Published As
| Publication number | Publication date |
|---|---|
| IN2012DN02609A (esLanguage) | 2015-09-04 |
| DK1740544T3 (da) | 2007-11-05 |
| CN1946695B (zh) | 2012-04-04 |
| JP2007534720A (ja) | 2007-11-29 |
| JP4774043B2 (ja) | 2011-09-14 |
| DE602005002553T2 (de) | 2008-06-12 |
| US20070232655A1 (en) | 2007-10-04 |
| BRPI0508738B1 (pt) | 2015-01-06 |
| PL1740544T3 (pl) | 2007-11-30 |
| BRPI0508738A (pt) | 2007-08-14 |
| ZA200608359B (en) | 2008-06-25 |
| MXPA06012159A (es) | 2007-01-31 |
| PT1740544E (pt) | 2007-11-06 |
| US7687067B2 (en) | 2010-03-30 |
| IL178771A0 (en) | 2007-02-11 |
| DE602005002553D1 (en) | 2007-10-31 |
| WO2005103006A1 (en) | 2005-11-03 |
| ATE373643T1 (de) | 2007-10-15 |
| EP1740544B1 (en) | 2007-09-19 |
| CA2560373A1 (en) | 2005-11-03 |
| KR101276929B1 (ko) | 2013-06-19 |
| IL178771A (en) | 2011-10-31 |
| EP1740544A1 (en) | 2007-01-10 |
| CA2560373C (en) | 2014-01-28 |
| CN1946695A (zh) | 2007-04-11 |
| KR20070008704A (ko) | 2007-01-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2300019T3 (es) | Derivados de 2-piridinilcicloalquilcarboxamida utiles como fungicidas. | |
| ES2547717T3 (es) | Derivados de 2-piridiniletilbenzamida | |
| ES2457750T3 (es) | Derivados de 2-piridiniletilcarboxamida y su uso como fungicidas | |
| ES2529569T3 (es) | Compuestos de N-[2-(2-piridinil)etil]benzamida y su uso como fungicidas | |
| DK1720865T3 (en) | 2-PYRIDINYLETHYL CARBOXAMIDE DERIVATIVES AND THEIR USE AS FUNGICIDES | |
| US7524968B2 (en) | 2-pyridinylcycloalkylbenzamide derivatives and their use as fungicides | |
| MXPA06009828A (en) | 2-pyridinylethylcarboxamide derivatives and their use as fungicides |