DK156659C - Analogifremgangsmaade til fremstilling af heterocycliske amider af 4-hydroxy-2h-1-benzothiopyran-3-carboxylsyre-1,1-dioxid - Google Patents
Analogifremgangsmaade til fremstilling af heterocycliske amider af 4-hydroxy-2h-1-benzothiopyran-3-carboxylsyre-1,1-dioxidInfo
- Publication number
- DK156659C DK156659C DK201673A DK201673A DK156659C DK 156659 C DK156659 C DK 156659C DK 201673 A DK201673 A DK 201673A DK 201673 A DK201673 A DK 201673A DK 156659 C DK156659 C DK 156659C
- Authority
- DK
- Denmark
- Prior art keywords
- benzothiopyrane
- analogy
- hydroxy
- dioxide
- preparation
- Prior art date
Links
- GRGDQCHPFKZXSA-UHFFFAOYSA-N 4-hydroxy-1,1-dioxo-2h-thiochromene-3-carboxylic acid Chemical compound C1=CC=C2S(=O)(=O)CC(C(=O)O)=C(O)C2=C1 GRGDQCHPFKZXSA-UHFFFAOYSA-N 0.000 title 1
- 150000001408 amides Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/62—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
- C07D333/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US24850972A | 1972-04-28 | 1972-04-28 | |
| US24850972 | 1972-04-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK156659B DK156659B (da) | 1989-09-18 |
| DK156659C true DK156659C (da) | 1990-02-05 |
Family
ID=22939461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK201673A DK156659C (da) | 1972-04-28 | 1973-04-12 | Analogifremgangsmaade til fremstilling af heterocycliske amider af 4-hydroxy-2h-1-benzothiopyran-3-carboxylsyre-1,1-dioxid |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3769292A (enExample) |
| JP (1) | JPS5128633B2 (enExample) |
| CA (1) | CA980780A (enExample) |
| DE (1) | DE2316641C3 (enExample) |
| DK (1) | DK156659C (enExample) |
| FR (1) | FR2183008B1 (enExample) |
| GB (1) | GB1365849A (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3868379A (en) * | 1972-04-28 | 1975-02-25 | Warner Lambert Co | Heterocyclic amides of 4-hydroxy-2H-1-benzothiopyran-3-carboxylic acid 1,1-dioxide |
| US3835156A (en) * | 1973-03-23 | 1974-09-10 | Warner Lambert Co | Acyl derivatives of 4-hydroxy-2h-1-benzothiopyran-3-carboxamide 1,1-dioxide |
| US3878198A (en) * | 1974-04-26 | 1975-04-15 | Warner Lambert Co | {62 -Ketoacyl derivatives of 6-aminopenicillanic acid and process thereof |
| US4166126A (en) * | 1974-09-26 | 1979-08-28 | Ciba-Geigy Corporation | 1-benzothiepin-4-carboxamides |
| US4226998A (en) * | 1974-09-26 | 1980-10-07 | Ciba-Geigy Corporation | 1-Benzothiepin-4-carboxamides |
| US4242266A (en) * | 1974-09-26 | 1980-12-30 | Ciba-Geigy Corporation | 1-Benzothiepin-4-carboxylic acid derivatives |
| SE420725B (sv) * | 1974-09-26 | 1981-10-26 | Ciba Geigy Ag | Sett att framstella 2,3-dihydro-1-benstiepin-4-karboxylsyraamider |
| US4074048A (en) * | 1976-05-10 | 1978-02-14 | Warner-Lambert Company | Process for the preparation of 4-hydroxy-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxides |
| US4329357A (en) * | 1980-02-08 | 1982-05-11 | Ciba-Geigy Corporation | 1-Benzothiepin-4-carboxyamides |
| SG186430A1 (en) * | 2010-07-09 | 2013-01-30 | Active Biotech Ab | Method for manufacturing of quinoline-3-carboxamides |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3591584A (en) * | 1968-08-27 | 1971-07-06 | Pfizer | Benzothiazine dioxides |
| DE2264938A1 (de) * | 1971-07-15 | 1975-06-12 | Warner Lambert Co | 3-arylaminocarbonyl-4-hydroxy-benzo eckige klammer auf b eckige klammer zu thiacyclohex(3)en-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
-
1972
- 1972-04-28 US US00248509A patent/US3769292A/en not_active Expired - Lifetime
-
1973
- 1973-04-03 DE DE2316641A patent/DE2316641C3/de not_active Expired
- 1973-04-04 GB GB1604373A patent/GB1365849A/en not_active Expired
- 1973-04-12 DK DK201673A patent/DK156659C/da not_active IP Right Cessation
- 1973-04-24 FR FR7314821A patent/FR2183008B1/fr not_active Expired
- 1973-04-27 CA CA169,747A patent/CA980780A/en not_active Expired
- 1973-04-27 JP JP48047340A patent/JPS5128633B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1365849A (en) | 1974-09-04 |
| US3769292A (en) | 1973-10-30 |
| FR2183008B1 (enExample) | 1976-12-31 |
| AU5376473A (en) | 1974-09-26 |
| CA980780A (en) | 1975-12-30 |
| DE2316641B2 (de) | 1980-01-17 |
| FR2183008A1 (enExample) | 1973-12-14 |
| DE2316641C3 (de) | 1980-09-11 |
| DK156659B (da) | 1989-09-18 |
| DE2316641A1 (de) | 1973-11-08 |
| JPS5128633B2 (enExample) | 1976-08-20 |
| JPS4947375A (enExample) | 1974-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137329B (da) | Analogifremgangsmåde til fremstilling af 2-karbalkoksyaminobenzimidazolderivater. | |
| DK134607B (da) | Fremgangsmåde til fremstilling af rapamycin. | |
| DK140340B (da) | Analogifremgangsmåde til fremstilling af benzoxazolderivater. | |
| DK139754B (da) | Analogifremgangsmåde til fremstilling af heterocyclisk acyl-substituered ampicillin-derivater. | |
| DK137327B (da) | Analogifremgangsmåde til fremstilling af olefiniske 4-substituerede piperidinoderivater eller salte deraf. | |
| DK152050C (da) | Analogifremgangsmaade til fremstilling af oxazolopyridiner | |
| DK136312B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinoalkanonoximderivater. | |
| DK135505B (da) | Analogifremgangsmåde til fremstilling af morpholinderivater. | |
| DK138492B (da) | Fremgangsmåde til fremstilling af morphinanderivater. | |
| DK135991B (da) | Analogifremgangsmåde til fremstilling af 2-oxazolinderivater. | |
| DK156659C (da) | Analogifremgangsmaade til fremstilling af heterocycliske amider af 4-hydroxy-2h-1-benzothiopyran-3-carboxylsyre-1,1-dioxid | |
| DK151628C (da) | Analogifremgangsmaade til fremstilling af benzimidazolderivater | |
| DK136360B (da) | Analogifremgangsmåde til fremstilling af isoindolinderivater. | |
| DK145878C (da) | Analogifremgangsmaade til fremstilling af alkylthiocyclopentanderivater | |
| DK138796B (da) | Analogifremgangsmåde til fremstilling af 2-carboxypyrazin-4-oxidderivater. | |
| DK146539C (da) | Analogifremgangsmaade til fremstilling af 7alfa-methoxycephalosporin-derivater | |
| DK138230B (da) | Analogifremgangsmåde til fremstilling af vincanolsalte. | |
| DK136361B (da) | Fremgangsmåde til fremstilling af quinolin-derivater. | |
| DK131864B (da) | Fremgangsmåde til fremstilling af pregnan-21-syrederivater. | |
| DK135122B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-5-aminoalkyl-4-oxazolin-2-onderivater. | |
| DK132430B (da) | Fremgangsmåde til fremstilling af quinazolinonderivater. | |
| DK131579B (da) | Fremgangsmåde til fremstilling af en amylaseinhibitor. | |
| DK135943B (da) | Fremgangsmåde til fremstilling af propanolaminderivater. | |
| DK155326C (da) | Fremgangsmaade til fremstilling af 1,4-benzodiazepin-2-on-derivater | |
| DK134013B (da) | Analogifremgangsmåde til fremstilling af isoquinolinderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |