DK155475A - Fremgangsmade til fremstilling af 2-(4-isobutylphenyl)-propiohydroxamsyre - Google Patents
Fremgangsmade til fremstilling af 2-(4-isobutylphenyl)-propiohydroxamsyreInfo
- Publication number
- DK155475A DK155475A DK155475A DK155475A DK155475A DK 155475 A DK155475 A DK 155475A DK 155475 A DK155475 A DK 155475A DK 155475 A DK155475 A DK 155475A DK 155475 A DK155475 A DK 155475A
- Authority
- DK
- Denmark
- Prior art keywords
- isobutylphenyl
- preparing
- procedure
- propiohydroxamic acid
- propiohydroxamic
- Prior art date
Links
- BYPIURIATSUHDW-UHFFFAOYSA-N ibuproxam Chemical compound CC(C)CC1=CC=C(C(C)C(=O)NO)C=C1 BYPIURIATSUHDW-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT5440074A IT1046338B (it) | 1974-12-06 | 1974-12-06 | Procedimento per preparare aoido 2,4 isoputil fenil propioidros sanico e combusto intermerio beriesso |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK155475A true DK155475A (da) | 1976-06-07 |
Family
ID=11287260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK155475A DK155475A (da) | 1974-12-06 | 1975-04-10 | Fremgangsmade til fremstilling af 2-(4-isobutylphenyl)-propiohydroxamsyre |
Country Status (14)
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4792560A (en) * | 1985-04-03 | 1988-12-20 | Rorer Pharmaceutical Corporation | Quinoline hydroxamates and their use as modulators of arachidonic acid metabolic pathways |
-
1974
- 1974-12-06 IT IT5440074A patent/IT1046338B/it active
-
1975
- 1975-04-09 GB GB1449375A patent/GB1472012A/en not_active Expired
- 1975-04-10 DK DK155475A patent/DK155475A/da not_active IP Right Cessation
- 1975-04-14 DE DE19752516267 patent/DE2516267C2/de not_active Expired
- 1975-04-17 ES ES436706A patent/ES436706A1/es not_active Expired
- 1975-04-22 ZA ZA00752571A patent/ZA752571B/xx unknown
- 1975-05-27 JP JP6340675A patent/JPS5168537A/ja active Granted
- 1975-06-19 FR FR7519211A patent/FR2293423A2/fr active Granted
- 1975-06-30 BE BE157834A patent/BE830825R/xx not_active IP Right Cessation
- 1975-10-08 AT AT769475A patent/AT339881B/de not_active IP Right Cessation
- 1975-10-09 NL NL7511903A patent/NL161138C/xx active
- 1975-10-09 CA CA237,341A patent/CA1062728A/en not_active Expired
- 1975-10-09 YU YU257775A patent/YU257775A/xx unknown
- 1975-10-14 CH CH1332175A patent/CH595318A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH595318A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-02-15 |
| YU257775A (en) | 1982-05-31 |
| AT339881B (de) | 1977-11-10 |
| ATA769475A (de) | 1977-03-15 |
| GB1472012A (en) | 1977-04-27 |
| CA1062728A (en) | 1979-09-18 |
| JPS548668B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1979-04-17 |
| ES436706A1 (es) | 1977-01-16 |
| JPS5168537A (en) | 1976-06-14 |
| DE2516267A1 (de) | 1976-06-10 |
| FR2293423B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1977-07-22 |
| BE830825R (fr) | 1975-10-16 |
| FR2293423A2 (fr) | 1976-07-02 |
| IT1046338B (it) | 1980-06-30 |
| NL161138C (nl) | 1980-01-15 |
| NL7511903A (nl) | 1976-06-09 |
| ZA752571B (en) | 1976-05-26 |
| AU8563475A (en) | 1977-04-21 |
| DE2516267C2 (de) | 1982-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK552377A (da) | Fremgangsmaade til fremstilling af alfa-beskyttede oxyimino-beta-oxo-gamma-halogen-smoersyrederivater | |
| DK487475A (da) | Fremgangsmade til fremstilling af vandkveldende polyalkylenoxid | |
| DK572975A (da) | Fremgangsmade til fremstilling af hidtil ukendte pyridylguanidiner | |
| DK289175A (da) | Fremgangsmade til fremstilling af cyclohexylestere af vincaminsyrederivater | |
| DK156272C (da) | Fremgangsmaade til fremstilling af 7-d-(-)-alpha-amino-alpha-(p-hydroxyphenylacetamido)desacetoxycephalosporansyre | |
| DK415676A (da) | Fremgangsmade til fremstilling af pilocarpiniumsalte | |
| DK573475A (da) | Fremgangsmade til fremstilling af substituerede phenyleddikesyrer | |
| DK292475A (da) | Fremgangsmade til fremstilling af derivater af 3-amino-2-hydroxy-1-phenoxy-propan | |
| DK351875A (da) | Fremgangsmade til fremstilling af 7-methoxy-6-thiatetracyliner | |
| DK455877A (da) | Fremgangsmaade til fremstilling af phenyleddikesyrederivater | |
| DK163075A (da) | Fremgangsmade til fremstilling af aryloxoheptansyrer | |
| DK223175A (da) | Fremgangsmade til fremstilling af pyridobenzodiazepinoner | |
| DK591975A (da) | Fremgangsmade til fremstilling af phenyleddikesyrederivater | |
| DK431176A (da) | Fremgangsmade til fremstilling af hypolipemiske phenyleddikesyrederivater | |
| DK153489C (da) | Analogifremgangsmaade til fremstilling af 7-aminothiazolylacetamidocephalosporansyrederivater | |
| DK247175A (da) | Fremgangsmade til fremstilling af decahydroisoquinolin-forbindelser | |
| DK150484C (da) | Analogifremgangsmaade til fremstilling af 4-amino-3-thiophencarboxylsyrederivater | |
| DK245783A (da) | Analogifremgangsmaade til fremstilling af aminosyrederivater | |
| DK416975A (da) | Fremgangsmade til fremstilling af 5-fluor-2-methyl-1-(paramethylsulfinylbenzyliden)-indenyl-3-eddikesyre | |
| DK456077A (da) | Fremgangsmade til fremstilling af nicotinsyre | |
| DK143133C (da) | Analogifremgangsmaade til fremstilling af dibenzofuranalkansyreforbindelser | |
| DK154890C (da) | Fremgangsmaade til fremstilling af 7beta-acylamino-7alfa-alkoxycephalosporiner | |
| DK216275A (da) | Fremgangsmade til fremstilling af salpetersyre | |
| DK138227B (da) | Analogifremgangsmåde til fremstilling af substituerede xanthon-2-carboxylsyreforbindelser. | |
| DK309075A (da) | Fremgangsmade til fremstilling af benzopyran-carboxylsyreforbindelser |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AHB | Application shelved due to non-payment | ||
| PBP | Patent lapsed |