DK142417B - Fremgangsmåde til fremstilling af triazolobenzodiazepinderivater eller syreadditionssalte heraf. - Google Patents
Fremgangsmåde til fremstilling af triazolobenzodiazepinderivater eller syreadditionssalte heraf. Download PDFInfo
- Publication number
- DK142417B DK142417B DK487671A DK487671A DK142417B DK 142417 B DK142417 B DK 142417B DK 487671 A DK487671 A DK 487671A DK 487671 A DK487671 A DK 487671A DK 142417 B DK142417 B DK 142417B
- Authority
- DK
- Denmark
- Prior art keywords
- acid
- compound
- parts
- yield
- derivative
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 38
- 238000000034 method Methods 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 10
- 150000003839 salts Chemical class 0.000 title claims description 7
- KYTREVLPRJOBEM-UHFFFAOYSA-N triazolo[4,5-i][1,2]benzodiazepine Chemical class C1=CC2=CC=CN=NC2=C2C1=NN=N2 KYTREVLPRJOBEM-UHFFFAOYSA-N 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 63
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N quinoxaline Chemical class N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 53
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- 239000013078 crystal Substances 0.000 description 43
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 42
- 239000002904 solvent Substances 0.000 description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 38
- 238000006243 chemical reaction Methods 0.000 description 38
- 239000000203 mixture Substances 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 34
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 34
- 238000001953 recrystallisation Methods 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- -1 2-amino compound Chemical class 0.000 description 24
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 24
- 239000000243 solution Substances 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 19
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 18
- 238000001914 filtration Methods 0.000 description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 17
- 239000000047 product Substances 0.000 description 16
- 239000000460 chlorine Substances 0.000 description 14
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- 235000011054 acetic acid Nutrition 0.000 description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 9
- 235000017557 sodium bicarbonate Nutrition 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- 235000017550 sodium carbonate Nutrition 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- 238000001816 cooling Methods 0.000 description 8
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 7
- 150000004820 halides Chemical class 0.000 description 7
- 239000004312 hexamethylene tetramine Substances 0.000 description 7
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 6
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 229940126062 Compound A Drugs 0.000 description 5
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 5
- DNMANFUDPSVMBH-UHFFFAOYSA-N [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-phenylmethanone;hydrochloride Chemical compound Cl.ClCC1=NN=CN1C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 DNMANFUDPSVMBH-UHFFFAOYSA-N 0.000 description 5
- 235000011114 ammonium hydroxide Nutrition 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 229940106681 chloroacetic acid Drugs 0.000 description 5
- CDCHDCWJMGXXRH-UHFFFAOYSA-N estazolam Chemical compound C=1C(Cl)=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1 CDCHDCWJMGXXRH-UHFFFAOYSA-N 0.000 description 5
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 4
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- 150000008065 acid anhydrides Chemical group 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 229940024874 benzophenone Drugs 0.000 description 4
- 239000012965 benzophenone Substances 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 150000002905 orthoesters Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- PNVPNXKRAUBJGW-UHFFFAOYSA-N (2-chloroacetyl) 2-chloroacetate Chemical compound ClCC(=O)OC(=O)CCl PNVPNXKRAUBJGW-UHFFFAOYSA-N 0.000 description 3
- GUJAGMICFDYKNR-UHFFFAOYSA-N 1,4-benzodiazepine Chemical compound N1C=CN=CC2=CC=CC=C12 GUJAGMICFDYKNR-UHFFFAOYSA-N 0.000 description 3
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 3
- UZXMWIGOTGGWPU-UHFFFAOYSA-N 3-amino-2-methyl-6-nitro-4-phenylquinazolin-4-ol Chemical compound NN1C(=NC2=CC=C(C=C2C1(C1=CC=CC=C1)O)[N+](=O)[O-])C UZXMWIGOTGGWPU-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical class S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 description 2
- IEQYCNKKNGEMAN-UHFFFAOYSA-N 3-amino-6-chloro-2-methyl-4-phenylquinazolin-4-ol Chemical compound NN1C(C)=NC2=CC=C(Cl)C=C2C1(O)C1=CC=CC=C1 IEQYCNKKNGEMAN-UHFFFAOYSA-N 0.000 description 2
- BQFFHUASKUKCMD-UHFFFAOYSA-N 3-amino-6-chloro-4-(2-chlorophenyl)quinazolin-4-ol Chemical compound NN1C=NC2=CC=C(Cl)C=C2C1(O)C1=CC=CC=C1Cl BQFFHUASKUKCMD-UHFFFAOYSA-N 0.000 description 2
- ZAXFFQSOWYVGER-UHFFFAOYSA-N 3-amino-6-chloro-4-phenylquinazolin-4-ol Chemical compound NN1C=NC2=CC=C(Cl)C=C2C1(O)C1=CC=CC=C1 ZAXFFQSOWYVGER-UHFFFAOYSA-N 0.000 description 2
- GSIGZZKHXAAYOA-UHFFFAOYSA-N 6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C12=CC=CC=C2N2C=NN=C2CN=C1C1=CC=CC=C1 GSIGZZKHXAAYOA-UHFFFAOYSA-N 0.000 description 2
- NDKNGRSHIXOUBH-UHFFFAOYSA-N 6-phenyl-8-(trifluoromethyl)-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C=1C(C(F)(F)F)=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1 NDKNGRSHIXOUBH-UHFFFAOYSA-N 0.000 description 2
- BDQFWTZESHZRGW-UHFFFAOYSA-N 8-chloro-6-(2-chlorophenyl)-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C=1C(Cl)=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1Cl BDQFWTZESHZRGW-UHFFFAOYSA-N 0.000 description 2
- CMYYGJIURHQLIG-UHFFFAOYSA-N 8-chloro-6-(4-methoxyphenyl)-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C1=CC(OC)=CC=C1C1=NCC2=NN=CN2C2=CC=C(Cl)C=C12 CMYYGJIURHQLIG-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- CNCSRKWHUULEDB-UHFFFAOYSA-N [2-[3-(chloromethyl)-1,2,4-triazol-4-yl]-5-(trifluoromethyl)phenyl]-phenylmethanone Chemical compound FC(F)(F)C1=CC(C(=O)C2=CC=CC=C2)=C(C=C1)N1C=NN=C1CCl CNCSRKWHUULEDB-UHFFFAOYSA-N 0.000 description 2
- DVJBEKKCYUFDDM-UHFFFAOYSA-N [2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-phenylmethanone Chemical compound ClCC1=NN=CN1C1=C(C(=O)C2=CC=CC=C2)C=CC=C1 DVJBEKKCYUFDDM-UHFFFAOYSA-N 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 229940092714 benzenesulfonic acid Drugs 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003246 quinazolines Chemical class 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 1
- FUKOTTQGWQVMQB-UHFFFAOYSA-N (2-bromoacetyl) 2-bromoacetate Chemical compound BrCC(=O)OC(=O)CBr FUKOTTQGWQVMQB-UHFFFAOYSA-N 0.000 description 1
- RPAJSBKBKSSMLJ-DFWYDOINSA-N (2s)-2-aminopentanedioic acid;hydrochloride Chemical class Cl.OC(=O)[C@@H](N)CCC(O)=O RPAJSBKBKSSMLJ-DFWYDOINSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- QBGVARBIQGHVKR-UHFFFAOYSA-N 1,3-dichlorobutane Chemical compound CC(Cl)CCCl QBGVARBIQGHVKR-UHFFFAOYSA-N 0.000 description 1
- QHQABIOXGVWGPA-UHFFFAOYSA-N 1,8-dimethyl-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C12=CC(C)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 QHQABIOXGVWGPA-UHFFFAOYSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- OYRPNABWTHDOFK-UHFFFAOYSA-N 1-methyl-8-nitro-6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C12=CC([N+]([O-])=O)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 OYRPNABWTHDOFK-UHFFFAOYSA-N 0.000 description 1
- PDJLMAZISYOWKB-UHFFFAOYSA-N 1-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C1(=CC=CC=C1)C1=NN=C2N1C1=C(C=NC2)C=CC=C1 PDJLMAZISYOWKB-UHFFFAOYSA-N 0.000 description 1
- LGNWUMGEJQAWQD-UHFFFAOYSA-N 1h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound N1=CC2=CC=CC=C2N2CN=NC2=C1 LGNWUMGEJQAWQD-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- LSTRKXWIZZZYAS-UHFFFAOYSA-N 2-bromoacetyl bromide Chemical compound BrCC(Br)=O LSTRKXWIZZZYAS-UHFFFAOYSA-N 0.000 description 1
- VWHPCNYXEBGHQF-UHFFFAOYSA-N 3-amino-2,6-dimethyl-4-phenylquinazolin-4-ol Chemical compound NN1C(C)=NC2=CC=C(C)C=C2C1(O)C1=CC=CC=C1 VWHPCNYXEBGHQF-UHFFFAOYSA-N 0.000 description 1
- AXPOBLRMPCKWIT-UHFFFAOYSA-N 3-amino-4-phenyl-6-(trifluoromethyl)quinazolin-4-ol Chemical compound NN1C=NC2=CC=C(C=C2C1(C1=CC=CC=C1)O)C(F)(F)F AXPOBLRMPCKWIT-UHFFFAOYSA-N 0.000 description 1
- BXBSDHSVTCGOFC-UHFFFAOYSA-N 3-amino-4-phenylquinazolin-4-ol Chemical compound NN1C=NC2=CC=CC=C2C1(O)C1=CC=CC=C1 BXBSDHSVTCGOFC-UHFFFAOYSA-N 0.000 description 1
- IIEZZJWHRMCMML-UHFFFAOYSA-N 3-amino-6-chloro-4-(2-fluorophenyl)quinazolin-4-ol Chemical compound NN1C=NC2=CC=C(C=C2C1(O)C1=C(C=CC=C1)F)Cl IIEZZJWHRMCMML-UHFFFAOYSA-N 0.000 description 1
- WQXVDQYPSMONGQ-UHFFFAOYSA-N 3-amino-6-chloro-4-(4-methoxyphenyl)quinazolin-4-ol Chemical compound NN1C=NC2=CC=C(C=C2C1(C1=CC=C(C=C1)OC)O)Cl WQXVDQYPSMONGQ-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- AHFSVSXBGSYAKI-UHFFFAOYSA-N 8-chloro-6-(2-fluorophenyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound FC1=CC=CC=C1C1=NCC2=NN=CN2C2=CC=C(Cl)C=C12 AHFSVSXBGSYAKI-UHFFFAOYSA-N 0.000 description 1
- MBWHYICJBGVYJE-UHFFFAOYSA-N 8-nitro-6-phenyl-4h-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine Chemical compound C=1C([N+](=O)[O-])=CC=C(N2C=NN=C2CN=2)C=1C=2C1=CC=CC=C1 MBWHYICJBGVYJE-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 102100026459 POU domain, class 3, transcription factor 2 Human genes 0.000 description 1
- 101710133394 POU domain, class 3, transcription factor 2 Proteins 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- JIGCTXHIECXYRJ-ILWBRPEASA-N [(e,7r,11r)-3,7,11,15-tetramethylhexadec-2-enyl] acetate Chemical compound CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC\C(C)=C\COC(C)=O JIGCTXHIECXYRJ-ILWBRPEASA-N 0.000 description 1
- WADQPAMHVOGKMH-UHFFFAOYSA-N [2-[3-(chloromethyl)-1,2,4-triazol-4-yl]-5-nitrophenyl]-phenylmethanone Chemical compound ClCC1=NN=CN1C1=C(C(=O)C2=CC=CC=C2)C=C(C=C1)[N+](=O)[O-] WADQPAMHVOGKMH-UHFFFAOYSA-N 0.000 description 1
- CANJTJOHPYRKBL-UHFFFAOYSA-N [2-[3-(chloromethyl)-5-methyl-1,2,4-triazol-4-yl]-5-methylphenyl]-phenylmethanone Chemical compound CC1=NN=C(CCl)N1C1=CC=C(C)C=C1C(=O)C1=CC=CC=C1 CANJTJOHPYRKBL-UHFFFAOYSA-N 0.000 description 1
- RBWJIUYBFAQPHB-UHFFFAOYSA-N [2-[3-(chloromethyl)-5-methyl-1,2,4-triazol-4-yl]-5-nitrophenyl]-phenylmethanone Chemical compound CC1=NN=C(CCl)N1C1=C(C=C(C=C1)[N+]([O-])=O)C(=O)C1=CC=CC=C1 RBWJIUYBFAQPHB-UHFFFAOYSA-N 0.000 description 1
- IGAVJXNWXRLHDP-UHFFFAOYSA-N [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-(2-chlorophenyl)methanone Chemical compound ClCC1=NN=CN1C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1Cl IGAVJXNWXRLHDP-UHFFFAOYSA-N 0.000 description 1
- ZFAYQBSOGTUALH-UHFFFAOYSA-N [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-(2-fluorophenyl)methanone Chemical compound ClC=1C=CC(=C(C(=O)C2=C(C=CC=C2)F)C1)N1C(=NN=C1)CCl ZFAYQBSOGTUALH-UHFFFAOYSA-N 0.000 description 1
- OCFIFDKHQAXLOL-UHFFFAOYSA-N [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-(4-methoxyphenyl)methanone Chemical compound COC1=CC=C(C=C1)C(=O)C1=C(C=CC(Cl)=C1)N1C=NN=C1CCl OCFIFDKHQAXLOL-UHFFFAOYSA-N 0.000 description 1
- KBWXJZXYNPXORC-UHFFFAOYSA-N [5-chloro-2-[3-(chloromethyl)-1,2,4-triazol-4-yl]phenyl]-phenylmethanone Chemical compound ClCC1=NN=CN1C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 KBWXJZXYNPXORC-UHFFFAOYSA-N 0.000 description 1
- CPBUCUDVFXOMHN-UHFFFAOYSA-N [5-chloro-2-[3-(chloromethyl)-5-methyl-1,2,4-triazol-4-yl]phenyl]-phenylmethanone Chemical compound CC1=NN=C(CCl)N1C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 CPBUCUDVFXOMHN-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- XFEIRVZQVUQECX-UHFFFAOYSA-N bromo ethyl carbonate Chemical compound CCOC(=O)OBr XFEIRVZQVUQECX-UHFFFAOYSA-N 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 1
- OQNGCCWBHLEQFN-UHFFFAOYSA-N chloroform;hexane Chemical compound ClC(Cl)Cl.CCCCCC OQNGCCWBHLEQFN-UHFFFAOYSA-N 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 238000010575 fractional recrystallization Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000004701 malic acid derivatives Chemical class 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- IBIKHMZPHNKTHM-RDTXWAMCSA-N merck compound 25 Chemical compound C1C[C@@H](C(O)=O)[C@H](O)CN1C(C1=C(F)C=CC=C11)=NN1C(=O)C1=C(Cl)C=CC=C1C1CC1 IBIKHMZPHNKTHM-RDTXWAMCSA-N 0.000 description 1
- 229940035363 muscle relaxants Drugs 0.000 description 1
- 239000003158 myorelaxant agent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000004672 propanoic acids Chemical class 0.000 description 1
- 229940095574 propionic acid Drugs 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
- 230000002936 tranquilizing effect Effects 0.000 description 1
- JIGCTXHIECXYRJ-UHFFFAOYSA-N trans-phytol acetate Natural products CC(C)CCCC(C)CCCC(C)CCCC(C)=CCOC(C)=O JIGCTXHIECXYRJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP8867570 | 1970-10-07 | ||
| JP8867570A JPS4925952B1 (enExample) | 1970-10-07 | 1970-10-07 | |
| JP4362471A JPS5421352B1 (enExample) | 1971-06-17 | 1971-06-17 | |
| JP4362471 | 1971-06-17 | ||
| JP6994971 | 1971-09-08 | ||
| JP6994971A JPS5246959B2 (enExample) | 1971-09-08 | 1971-09-08 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK142417B true DK142417B (da) | 1980-10-27 |
| DK142417C DK142417C (enExample) | 1981-03-23 |
Family
ID=27291614
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK487671A DK142417B (da) | 1970-10-07 | 1971-10-07 | Fremgangsmåde til fremstilling af triazolobenzodiazepinderivater eller syreadditionssalte heraf. |
Country Status (9)
| Country | Link |
|---|---|
| CA (1) | CA925865A (enExample) |
| CH (1) | CH563392A5 (enExample) |
| DK (1) | DK142417B (enExample) |
| ES (1) | ES395776A1 (enExample) |
| FI (1) | FI52728C (enExample) |
| NL (1) | NL172954C (enExample) |
| NO (1) | NO133671C (enExample) |
| SE (2) | SE392469B (enExample) |
| YU (2) | YU251571A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH570403A5 (en) * | 1972-08-08 | 1975-12-15 | Ciba Geigy Ag | 4-H s-Triazolo (4,3-a) (1,4) benzodiazepins - CNS inhibitors psychosed-atives, and anticonvulsants |
-
1971
- 1971-10-05 YU YU251571A patent/YU251571A/xx unknown
- 1971-10-05 YU YU252571A patent/YU35024B/xx unknown
- 1971-10-06 NO NO367271A patent/NO133671C/no unknown
- 1971-10-06 SE SE1265871A patent/SE392469B/xx unknown
- 1971-10-06 ES ES395776A patent/ES395776A1/es not_active Expired
- 1971-10-06 CA CA124552A patent/CA925865A/en not_active Expired
- 1971-10-07 CH CH1463671A patent/CH563392A5/de not_active IP Right Cessation
- 1971-10-07 DK DK487671A patent/DK142417B/da not_active IP Right Cessation
- 1971-10-07 FI FI281371A patent/FI52728C/fi active
- 1971-10-07 NL NL7113800A patent/NL172954C/xx not_active IP Right Cessation
-
1974
- 1974-11-20 SE SE7414579A patent/SE421000B/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL7113800A (enExample) | 1972-04-11 |
| SE7414579L (enExample) | 1974-11-20 |
| CA925865A (en) | 1973-05-08 |
| FI52728B (enExample) | 1977-08-01 |
| SE392469B (sv) | 1977-03-28 |
| DK142417C (enExample) | 1981-03-23 |
| NL172954C (nl) | 1983-11-16 |
| FI52728C (fi) | 1977-11-10 |
| NL172954B (nl) | 1983-06-16 |
| YU35024B (en) | 1980-06-30 |
| CH563392A5 (en) | 1975-06-30 |
| NO133671B (enExample) | 1976-03-01 |
| SE421000B (sv) | 1981-11-16 |
| NO133671C (enExample) | 1976-06-09 |
| ES395776A1 (es) | 1974-10-16 |
| YU251571A (en) | 1979-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3398159A (en) | Aminophenyl heterocyclic ketones | |
| SE449098B (sv) | Fenyl-/2-(5-hydroxi-1-imidazolyl)fenyl/-metanonderivat till anvendning som mellanprodukter for framstellning av imidazo/1,5-a//1,4/bensodiazepinderivat | |
| Thomas | A concise route to triazolobenzodiazepine derivatives via a one-pot alkyne-azide cycloaddition reaction | |
| NO118914B (enExample) | ||
| Ardakani et al. | 1 H-and 2 H-indazoles by thermal and photolytic decomposition of o-azidobenzoic acid and o-azidobenzaldehyde derivatives | |
| DK145577B (da) | Analogifremgangsmaade til fremstilling af s-triazolo(4,3-a)-(1,4)-benzodiazepiner eller 5n-oxyder eller syreadditionssalte deraf | |
| DK142417B (da) | Fremgangsmåde til fremstilling af triazolobenzodiazepinderivater eller syreadditionssalte heraf. | |
| Mizuno et al. | Process development of a disease-modifying antirheumatic drug, TAK-603, based on optimization of Friedel–Crafts reaction and selective substitution of a triazole ring | |
| US3557095A (en) | Pyrazolodiazepinone compounds | |
| Ogata et al. | 5-Aryl-1, 5-dihydro-2H-1, 4-benzodiazepin-2-one derivatives as antianxiety agents | |
| US3872089A (en) | Substituted thienodiazepines | |
| US3751412A (en) | 2-amino-1,5-benzodiazocine derivatives | |
| US3513158A (en) | Process for preparing 5-aryl benzodiazepines and intermediates | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| US3501460A (en) | Dehydration process for forming benzodiazepines | |
| US3849434A (en) | Process for preparing triazolobenzodiazepines | |
| NO134910B (enExample) | ||
| US3413346A (en) | 2-(2-haloethylamino)-5-halo-benzophenones | |
| US3625957A (en) | 4-aryl (or alkyl) sulfonyl derivatives of tetrahydro-benzodiazepines | |
| Szabó et al. | Ring‐closure reaction of N‐arylthiomethylaroylamides to 1, 3‐benzothiazines | |
| US3746701A (en) | Method for the production of benzodiazepine derivatives | |
| US3297685A (en) | Process for the preparation of 2-oxo benzodiazepines | |
| NO122070B (enExample) | ||
| US3517061A (en) | 5h-1,4-benzodiazepin-5-ones | |
| FI57938B (fi) | Foerfarande foer framstaellning av 2-hydrazino-5-fenyl-3h-1,4-benzodiazepinderivat |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |