DK140548B - Fremgangsmåde til fremstilling af usubstitueret 2,2'-, 2,4'- eller 4,4'-bipyridyl. - Google Patents
Fremgangsmåde til fremstilling af usubstitueret 2,2'-, 2,4'- eller 4,4'-bipyridyl.Info
- Publication number
- DK140548B DK140548B DK402671AA DK402671A DK140548B DK 140548 B DK140548 B DK 140548B DK 402671A A DK402671A A DK 402671AA DK 402671 A DK402671 A DK 402671A DK 140548 B DK140548 B DK 140548B
- Authority
- DK
- Denmark
- Prior art keywords
- bipyridyl
- unsubstituted
- preparation
- Prior art date
Links
- MWVTWFVJZLCBMC-UHFFFAOYSA-N 4,4'-bipyridine Chemical group C1=NC=CC(C=2C=CN=CC=2)=C1 MWVTWFVJZLCBMC-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3948170A GB1338399A (en) | 1970-08-17 | 1970-08-17 | Manufacture of bipyridyls |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK140548B true DK140548B (da) | 1979-10-01 |
| DK140548C DK140548C (cs) | 1980-02-25 |
Family
ID=10409786
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK402671AA DK140548B (da) | 1970-08-17 | 1971-08-17 | Fremgangsmåde til fremstilling af usubstitueret 2,2'-, 2,4'- eller 4,4'-bipyridyl. |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3787427A (cs) |
| JP (1) | JPS5637226B1 (cs) |
| AT (1) | AT311346B (cs) |
| AU (1) | AU450859B2 (cs) |
| BE (1) | BE771430A (cs) |
| BR (1) | BR7105298D0 (cs) |
| CA (1) | CA962683A (cs) |
| CH (2) | CH583727A5 (cs) |
| CS (3) | CS171237B2 (cs) |
| DE (1) | DE2140529A1 (cs) |
| DK (1) | DK140548B (cs) |
| ES (1) | ES394301A1 (cs) |
| FR (1) | FR2102296B1 (cs) |
| GB (1) | GB1338399A (cs) |
| HU (1) | HU163559B (cs) |
| IE (1) | IE35486B1 (cs) |
| IL (1) | IL37468A (cs) |
| NL (1) | NL7111252A (cs) |
| PL (1) | PL87152B1 (cs) |
| RO (1) | RO56865A (cs) |
| SE (1) | SE368008B (cs) |
| YU (1) | YU35761B (cs) |
| ZA (1) | ZA715125B (cs) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1399099A (en) * | 1971-11-15 | 1975-06-25 | Ici Ltd | Manufacture of bipyridyls |
| GB1445367A (en) * | 1973-10-25 | 1976-08-11 | Birkbeck College | Electrochemical production of substituted pyridines |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3040052A (en) * | 1962-06-19 | Preparation of z | ||
| US2962502A (en) * | 1958-01-24 | 1960-11-29 | Ici Ltd | Preparation of 2, 2'-bipyridyl |
| FR1236734A (fr) * | 1958-09-18 | 1960-07-22 | Ici Ltd | Procédé de production de polypyridyles |
-
1970
- 1970-08-17 GB GB3948170A patent/GB1338399A/en not_active Expired
-
1971
- 1971-08-02 ZA ZA715125A patent/ZA715125B/xx unknown
- 1971-08-03 IE IE978/71A patent/IE35486B1/xx unknown
- 1971-08-03 CA CA119,693A patent/CA962683A/en not_active Expired
- 1971-08-05 PL PL1971149861A patent/PL87152B1/pl unknown
- 1971-08-06 IL IL37468A patent/IL37468A/en unknown
- 1971-08-11 HU HUIE463A patent/HU163559B/hu unknown
- 1971-08-12 US US00171349A patent/US3787427A/en not_active Expired - Lifetime
- 1971-08-12 DE DE19712140529 patent/DE2140529A1/de not_active Ceased
- 1971-08-16 NL NL7111252A patent/NL7111252A/xx not_active Application Discontinuation
- 1971-08-16 RO RO67975A patent/RO56865A/ro unknown
- 1971-08-16 FR FR7129822A patent/FR2102296B1/fr not_active Expired
- 1971-08-16 AU AU32383/71A patent/AU450859B2/en not_active Expired
- 1971-08-16 YU YU2103/71A patent/YU35761B/xx unknown
- 1971-08-17 JP JP6207571A patent/JPS5637226B1/ja active Pending
- 1971-08-17 AT AT717571A patent/AT311346B/de not_active IP Right Cessation
- 1971-08-17 CS CS5938A patent/CS171237B2/cs unknown
- 1971-08-17 ES ES394301A patent/ES394301A1/es not_active Expired
- 1971-08-17 CH CH1202671A patent/CH583727A5/xx not_active IP Right Cessation
- 1971-08-17 DK DK402671AA patent/DK140548B/da unknown
- 1971-08-17 SE SE10464/71A patent/SE368008B/xx unknown
- 1971-08-17 BE BE771430A patent/BE771430A/xx unknown
- 1971-08-17 BR BR5298/71A patent/BR7105298D0/pt unknown
- 1971-08-17 CS CS3147*[A patent/CS171238B2/cs unknown
- 1971-08-17 CS CS3148*[A patent/CS171239B2/cs unknown
-
1976
- 1976-09-22 CH CH1202671A patent/CH592063A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| RO56865A (cs) | 1974-09-01 |
| FR2102296B1 (cs) | 1975-07-11 |
| PL87152B1 (cs) | 1976-06-30 |
| YU35761B (en) | 1981-06-30 |
| HU163559B (cs) | 1973-09-27 |
| ES394301A1 (es) | 1973-12-16 |
| SE368008B (cs) | 1974-06-17 |
| IE35486L (en) | 1972-02-17 |
| IE35486B1 (en) | 1976-03-03 |
| NL7111252A (cs) | 1972-02-21 |
| AU3238371A (en) | 1973-02-22 |
| BE771430A (fr) | 1972-02-17 |
| IL37468A0 (en) | 1971-12-29 |
| IL37468A (en) | 1974-09-10 |
| ZA715125B (en) | 1972-04-26 |
| CS171237B2 (cs) | 1976-10-29 |
| YU210371A (en) | 1980-12-31 |
| CS171239B2 (cs) | 1976-10-29 |
| DE2140529A1 (de) | 1972-03-23 |
| US3787427A (en) | 1974-01-22 |
| CH592063A5 (cs) | 1977-10-14 |
| JPS5637226B1 (cs) | 1981-08-29 |
| GB1338399A (en) | 1973-11-21 |
| DK140548C (cs) | 1980-02-25 |
| CH583727A5 (cs) | 1977-01-14 |
| AT311346B (de) | 1973-11-12 |
| CA962683A (en) | 1975-02-11 |
| FR2102296A1 (cs) | 1972-04-07 |
| CS171238B2 (cs) | 1976-10-29 |
| BR7105298D0 (pt) | 1973-02-15 |
| AU450859B2 (en) | 1974-07-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK135454B (da) | Analogifremgangsmåde til fremstilling af 2,1,3-benzothiadiazolderivater. | |
| DK132174B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimider. | |
| FI49503C (fi) | Analogiamenetelmä 1,2,3,4-tetrahydro-4-fenyyli-isokinoliinijohdannaist en valmistamiseksi. | |
| DK134490B (da) | Analogifremgangsmåde til fremstilling af 2,6-diaminonebularin-derivater. | |
| DK127640B (da) | Fremgangsmåde til fremstilling af 3,20-dioxo-17α-21-dimethyl-19-norpregna-4,9-dien. | |
| DK123357B (da) | Analogifremgangsmåde til fremstilling af N(6)-benzyl-adenosin-derivater. | |
| DK140842B (da) | Fremgangsmåde til fremstilling af 8,9-didebydro-10alfa-alkoxy-ergolener. | |
| DK130295B (da) | Fremgangsmåde til fremstilling af 5-imino-1,2,4-triazinderivater. | |
| DK128496B (da) | Fremgangsmåde til fremstilling af 5-fluoruracilderivater. | |
| DK127812B (da) | Analogifremgangsmåde til fremstilling af 3,5-dibrom-zearalan. | |
| DK127778B (da) | Fremgangsmåde til fremstilling af 3',4'-dideoxy-kenamycin B. | |
| DK131855B (da) | Fremgangsmåde til fremstilling af 3,4-dihydropyridoner. | |
| DK134486B (da) | Analogifremgangsmåde til fremstilling af 3-hydrazonomethyl-rifamycin-derivater eller 25-desacetyl- eller 16, 17, 18, 19, 28, 29-hexahydroderivater deraf. | |
| DK132221B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimider. | |
| DK137754B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK140548B (da) | Fremgangsmåde til fremstilling af usubstitueret 2,2'-, 2,4'- eller 4,4'-bipyridyl. | |
| DK137900B (da) | Analogifremgangsmåde til fremstilling af 1,2-benzisothiazol-1,1-dioxydderivater. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK132329B (da) | Fremgangsmåde til fremstilling af cardenolid-3,alfa-/2'-desoxy-glycosider/. | |
| DK130308B (da) | Fremgangsmåde til fremstilling af 13β-alkylgona-4,9,11-triener. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK127115B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. | |
| DK127110B (da) | Fremgangsmåde til fremstilling af pyranosider af 3β-hydroxy-4-chlor-carda-4,20(22)-dienolider. | |
| DK125790B (da) | Fremgangsmåde til fremstilling af L-β-3,4-dihydroxyphenyl-α-alanin. |