DK138746B - Analogifremgangsmåde til fremstilling af 7-amino-cephalosporansyrederivater. - Google Patents
Analogifremgangsmåde til fremstilling af 7-amino-cephalosporansyrederivater.Info
- Publication number
- DK138746B DK138746B DK448971A DK448971A DK138746B DK 138746 B DK138746 B DK 138746B DK 448971 A DK448971 A DK 448971A DK 448971 A DK448971 A DK 448971A DK 138746 B DK138746 B DK 138746B
- Authority
- DK
- Denmark
- Prior art keywords
- amino
- preparation
- acid derivatives
- cephalosporanic acid
- analogous process
- Prior art date
Links
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical class S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
- C07D271/113—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/08—1,2,4-Thiadiazoles; Hydrogenated 1,2,4-thiadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7217270A | 1970-09-14 | 1970-09-14 | |
| US7217370A | 1970-09-14 | 1970-09-14 | |
| US9218870A | 1970-11-23 | 1970-11-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK138746B true DK138746B (da) | 1978-10-23 |
| DK138746C DK138746C (cg-RX-API-DMAC10.html) | 1979-03-26 |
Family
ID=27372031
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK448971A DK138746B (da) | 1970-09-14 | 1971-09-14 | Analogifremgangsmåde til fremstilling af 7-amino-cephalosporansyrederivater. |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS523948B1 (cg-RX-API-DMAC10.html) |
| BE (1) | BE772592A (cg-RX-API-DMAC10.html) |
| CH (1) | CH564025A5 (cg-RX-API-DMAC10.html) |
| DE (1) | DE2145928A1 (cg-RX-API-DMAC10.html) |
| DK (1) | DK138746B (cg-RX-API-DMAC10.html) |
| ES (1) | ES395083A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2106501B1 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1366098A (cg-RX-API-DMAC10.html) |
| NL (1) | NL7112483A (cg-RX-API-DMAC10.html) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2215942B1 (cg-RX-API-DMAC10.html) * | 1973-01-31 | 1978-12-22 | Bristol Myers Co |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK128745B (da) * | 1968-06-14 | 1974-06-24 | Glaxo Lab Ltd | Analogifremgangsmåde til fremstilling af cephalosporinforbindelser eller estere eller salte deraf. |
| ZA698494B (en) * | 1969-02-26 | 1971-07-28 | Lilly Co Eli | Sulfur-containing cephalosporing antibiotics |
-
1971
- 1971-09-10 NL NL7112483A patent/NL7112483A/xx not_active Application Discontinuation
- 1971-09-13 FR FR7132975A patent/FR2106501B1/fr not_active Expired
- 1971-09-13 CH CH1339271A patent/CH564025A5/xx not_active IP Right Cessation
- 1971-09-13 GB GB4261371A patent/GB1366098A/en not_active Expired
- 1971-09-14 ES ES395083A patent/ES395083A1/es not_active Expired
- 1971-09-14 JP JP46070983A patent/JPS523948B1/ja active Pending
- 1971-09-14 BE BE772592A patent/BE772592A/xx unknown
- 1971-09-14 DE DE19712145928 patent/DE2145928A1/de active Pending
- 1971-09-14 DK DK448971A patent/DK138746B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2145928A1 (de) | 1972-03-23 |
| GB1366098A (en) | 1974-09-11 |
| FR2106501A1 (cg-RX-API-DMAC10.html) | 1972-05-05 |
| BE772592A (fr) | 1972-03-14 |
| JPS523948B1 (cg-RX-API-DMAC10.html) | 1977-01-31 |
| ES395083A1 (es) | 1974-12-16 |
| DK138746C (cg-RX-API-DMAC10.html) | 1979-03-26 |
| FR2106501B1 (cg-RX-API-DMAC10.html) | 1975-08-01 |
| CH564025A5 (cg-RX-API-DMAC10.html) | 1975-07-15 |
| NL7112483A (cg-RX-API-DMAC10.html) | 1972-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK122965B (da) | Analogifremgangsmåde til fremstilling af derivater af thiazolylbenzoesyre. | |
| DK127927B (da) | Analogifremgangsmåde til fremstilling af kinolinderivater. | |
| DK122393B (da) | Analogifremgangsmåde til fremstilling af phenylthiazolyl-α-alkylmalonsyrederivater. | |
| DK132434B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK123471B (da) | Analogifremgangsmåde til fremstilling af benzyliden-amino-oxyalkylcarboxylsyrederivater. | |
| DK129707B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater. | |
| DK134279B (da) | Analogifremgangsmåde til fremstilling af cycloalkylphenoxycarboxylsyrederivater. | |
| DK134485B (da) | Analogifremgangsmåde til fremstilling af thiocarbaminsyrederivater. | |
| DK135127B (da) | Analogifremgangsmåde til fremstilling af derivater af 6-aminopenicillansyre. | |
| DK133667B (da) | Fremgangsmåde til fremstilling af 5-cyklohexyl-6-halogenindan-1-karboxylsyrederivater. | |
| DK126203B (da) | Analogifremgangsmåde til fremstilling af thiophenddikesyrederivater. | |
| DK134154B (da) | Analogifremgangsmåde til fremstilling af 5-cyklohexyl-1-indankarboxylsyrederivater. | |
| DK138490B (da) | Fremgangsmåde til fremstilling af prostadiensyrederivater. | |
| DK136975B (da) | Analogifremgangsmåde til fremstilling af phenazinderivater. | |
| DK129993B (da) | Analogifremgangsmåde til fremstilling af indoleddikesyrederivater. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK137192B (da) | Analogifremgangsmåde til fremstilling af cephalosporansyrederivater. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK135425B (da) | Analogifremgangsmåde til fremstilling af 2-imidazolidonderivater. | |
| DK129457B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK123527B (da) | Fremgangsmåde til fremstilling af lumilysergsyrederivater. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| DK140942B (da) | Fremgangsmåde til fremstilling af 7-aminocephalosporansyre. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK130742B (da) | Analogifremgangsmåde til fremstilling af 7-[(aminomethylphenylthio)-acetamido]cephalosporansyrederivater. |