DK136314B - Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner. - Google Patents
Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner.Info
- Publication number
- DK136314B DK136314B DK259170AA DK259170A DK136314B DK 136314 B DK136314 B DK 136314B DK 259170A A DK259170A A DK 259170AA DK 259170 A DK259170 A DK 259170A DK 136314 B DK136314 B DK 136314B
- Authority
- DK
- Denmark
- Prior art keywords
- benzamidoethylpiperazines
- preparation
- analogous process
- analogous
- Prior art date
Links
- IBJBVEYYRONSKJ-UHFFFAOYSA-N n-(2-piperazin-1-ylethyl)benzamide Chemical class C=1C=CC=CC=1C(=O)NCCN1CCNCC1 IBJBVEYYRONSKJ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB26437/69A GB1279843A (en) | 1969-05-23 | 1969-05-23 | Benzamidoethyl-piperazines and process for their preparation |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK136314B true DK136314B (da) | 1977-09-26 |
| DK136314C DK136314C (enExample) | 1978-02-27 |
Family
ID=10243600
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK259170AA DK136314B (da) | 1969-05-23 | 1970-05-21 | Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner. |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3705899A (enExample) |
| AT (1) | AT294108B (enExample) |
| BE (1) | BE750766A (enExample) |
| BR (1) | BR7019217D0 (enExample) |
| CH (1) | CH527202A (enExample) |
| DK (1) | DK136314B (enExample) |
| ES (1) | ES379913A1 (enExample) |
| FR (1) | FR2051556B1 (enExample) |
| GB (1) | GB1279843A (enExample) |
| NL (1) | NL144276B (enExample) |
| NO (1) | NO127301B (enExample) |
| SE (1) | SE363631B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1345449A (en) * | 1971-05-14 | 1974-01-30 | Science Union & Cie | Pyridylpiperazines and process for their preparation |
| US3998828A (en) * | 1975-01-31 | 1976-12-21 | Pfizer Inc. | 4-[2-(1,3-Dialkyl-1,2,3,4-tetra-hydropyrimidine-2,4-dione-5-carboxamido)ethyl]-1-piperidine sulfonamide |
| US3936455A (en) * | 1975-01-31 | 1976-02-03 | Pfizer Inc. | Piperidinesulfonylurea derivatives |
| US4052507A (en) * | 1975-11-07 | 1977-10-04 | Pfizer Inc. | Piperidinesulfonylurea derivatives |
| ZA825719B (en) * | 1981-09-03 | 1983-06-29 | Recordati Chem Pharm | Alkanoylanilides |
| FR2535718A1 (fr) * | 1982-11-09 | 1984-05-11 | Sanofi Sa | (piperazinyl-1)-2 pyrimidines, leurs sels, procede pour leur preparation et compositions pharmaceutiques en contenant |
| JPS59118765A (ja) * | 1982-12-24 | 1984-07-09 | Fujisawa Pharmaceut Co Ltd | ピペラジン誘導体 |
| US4558129A (en) * | 1983-05-18 | 1985-12-10 | Syntex (U.S.A.) Inc. | Benzodioxanyl-hydroxyethylene-piperazinyl acetanilides which effect calcium entry and β-blockade |
| DE3321969A1 (de) * | 1983-06-18 | 1984-12-20 | Troponwerke GmbH & Co KG, 5000 Köln | 2-pyrimidinyl-1-piperazin-derivate, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| NZ209876A (en) * | 1983-10-17 | 1988-03-30 | Duphar Int Res | Piperazines and pharmaceutical compositions |
| US4778796A (en) * | 1985-07-19 | 1988-10-18 | Dainippon Pharmaceutical Co., Ltd. | ω-(3-pyridyl)alkenamide derivatives and anti-allergenic pharmaceutical compositions containing same |
| US4880930A (en) * | 1987-11-30 | 1989-11-14 | New James S | Psychotropic acyclic amide derivatives |
| IE911774A1 (en) * | 1990-06-11 | 1991-12-18 | Akzo Nv | Pyridinylpiperazine derivatives |
| AU645681B2 (en) * | 1991-05-02 | 1994-01-20 | John Wyeth & Brother Limited | Piperazine derivatives |
| US5659033A (en) * | 1995-09-13 | 1997-08-19 | Neurogen Corporation | N-aminoalkylfluorenecarboxamides; a new class of dopamine receptor subtype specific ligands |
| WO2003008559A2 (en) * | 2001-07-19 | 2003-01-30 | Medical College Of Georgia Research Institute | Novel analogs of choline for neuroprotection and cognitive enhancement in neurodegenerative disorders |
| US20060194814A1 (en) * | 2003-06-02 | 2006-08-31 | Vassilios Papadopoulos | Benzamide compounds |
| JP2006526633A (ja) * | 2003-06-02 | 2006-11-24 | サマリタン,ファーマスーティカルス,インク. | 抗hiv性ベンズアミド化合物 |
| BRPI0614577A2 (pt) * | 2005-08-15 | 2011-04-05 | Hoffmann La Roche | derivados de piperidina e piperazina como antagonistas de p2x3 |
| HUP0600810A3 (en) * | 2006-10-27 | 2008-09-29 | Richter Gedeon Nyrt | New sulfonamide derivatives as bradykinin antagonists, process and intermediates for their preparation and pharmaceutical compositions containing them |
| HUP0600808A3 (en) | 2006-10-27 | 2008-09-29 | Richter Gedeon Nyrt | New benzamide derivatives as bradykinin antagonists, process for their preparation and pharmaceutical compositions containing them |
| WO2010038948A2 (en) * | 2008-10-02 | 2010-04-08 | Green Cross Corporation | Arylpiperazine-containing pyrrole 3-carboxamide derivatives for treating depressive disorders |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2958694A (en) * | 1959-06-22 | 1960-11-01 | Janssen Paul Adriaan Jan | 1-(aroylalkyl)-4-(2'-pyridyl) piperazines |
| US2985657A (en) * | 1959-10-12 | 1961-05-23 | Paul A J Janssen | 1-(aroylalkyl)-4-heterocyclylpiperazines |
| NL297170A (enExample) * | 1963-04-04 | 1900-01-01 | ||
| NL129219C (enExample) * | 1965-12-16 |
-
1969
- 1969-05-23 GB GB26437/69A patent/GB1279843A/en not_active Expired
-
1970
- 1970-05-11 US US36486A patent/US3705899A/en not_active Expired - Lifetime
- 1970-05-15 NO NO01882/70A patent/NO127301B/no unknown
- 1970-05-21 BE BE750766D patent/BE750766A/xx unknown
- 1970-05-21 DK DK259170AA patent/DK136314B/da unknown
- 1970-05-21 FR FR707018538A patent/FR2051556B1/fr not_active Expired
- 1970-05-22 CH CH764570A patent/CH527202A/fr not_active IP Right Cessation
- 1970-05-22 NL NL707007407A patent/NL144276B/xx unknown
- 1970-05-22 BR BR219217/70A patent/BR7019217D0/pt unknown
- 1970-05-22 SE SE07095/70A patent/SE363631B/xx unknown
- 1970-05-25 AT AT466770A patent/AT294108B/de not_active IP Right Cessation
- 1970-06-21 ES ES379913A patent/ES379913A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH527202A (fr) | 1972-08-31 |
| GB1279843A (en) | 1972-06-28 |
| DK136314C (enExample) | 1978-02-27 |
| SE363631B (enExample) | 1974-01-28 |
| FR2051556A1 (enExample) | 1971-04-09 |
| NO127301B (enExample) | 1973-06-04 |
| BE750766A (fr) | 1970-11-23 |
| BR7019217D0 (pt) | 1973-03-07 |
| DE2024350B2 (de) | 1975-08-07 |
| DE2024350A1 (de) | 1970-11-26 |
| NL144276B (nl) | 1974-12-16 |
| FR2051556B1 (enExample) | 1973-08-10 |
| ES379913A1 (es) | 1972-09-16 |
| NL7007407A (enExample) | 1970-11-25 |
| US3705899A (en) | 1972-12-12 |
| AT294108B (de) | 1971-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK130306B (da) | Analogifremgangsmåde til fremstilling af S-trialkylphosphinguld-1-thio-β-D-glucopyranosider. | |
| DK136314B (da) | Analogifremgangsmåde til fremstilling af benzamidoethylpiperaziner. | |
| DK140697B (da) | Fremgangsmåde til fremstilling af 2-amino-4-hydroxy-6-hydroxymethyl-7,7-dimethyl-7,8-dihydropteridin. | |
| DK124195B (da) | Fremgangsmåde til fremstilling af cis-chrysantheminsyrer. | |
| DK133375B (da) | Analogifremgangsmåde til fremstilling af 1-carbamoyl-3-phenylpyrrolidiner. | |
| DK124946B (da) | Analogifremgangsmåde til fremstilling af evomonosidderivater. | |
| DK126944B (da) | Analogifremgangsmåde til fremstilling af hexahydrobenzindolderivater. | |
| DK128006B (da) | Analogifremgangsmåde til fremstilling af 11-desacetoxy-wortmannin. | |
| DK128778B (da) | Analogifremgangsmåde til fremstilling af bis-2-carboxy-chromonylderivater. | |
| DK131863B (da) | Analogifremgangsmåde til fremstilling af thiazolino- eller thiazidino-pyrimidinderivater. | |
| DK140010B (da) | Fremgangsmåde til fremstilling af peptider. | |
| DK123237B (da) | Analogifremgangsmåde til fremstilling af erythromycinasparter. | |
| DK128737B (da) | Analogifremgangsmåde til fremstilling af 6α-methyl-17α-caproyloxy-19-norprogesteron. | |
| DK123096B (da) | Analogifremgangsmåde til fremstilling af neriifolinderivater. | |
| DK125241B (da) | Analogifremgangsmåde til fremstilling af substituerede o-anilinophenethylalkoholer. | |
| DK125199B (da) | Analogifremgangsmåde til fremstilling af benzamidiner. | |
| DK123816B (da) | Analogifremgangsmåde til fremstilling af N-phenacylcarbamater. | |
| DK122127B (da) | Analogifremgangsmåde til fremstilling af 3-phenyl-4-acyloxycarbostyriler. | |
| DK122456B (da) | Fremgangsmåde til fremstilling af quinoxalin-di-N-oxid-aldehyd. | |
| DK124686B (da) | Analogifremgangsmåde til fremstilling af bis-thiachromonylforbindelser. | |
| DK126184B (da) | Fremgangsmåde til fremstilling af peptider. | |
| DK132026B (da) | Fremgangsmåde til fremstilling af 6-aminoacylamidopenicillansyrer. | |
| DK126991B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxy-3-amino-2-propanolderivater. | |
| DK135798B (da) | Analogifremgangsmåde til fremstilling af isobutyl-cyclohexenyl-derivater. | |
| DK125918B (da) | Fremgangsmåde til fremstilling af alkyl-7-0-methyl-l-thio-lincosaminider. |