DK135382C - Fremgangsmade til efterbehandling af det ud fra 1-amino-2-nitro-4-chlorbenzen og 5-acetoacetylaminobenzimidazolon fremstillede monoazopigment - Google Patents
Fremgangsmade til efterbehandling af det ud fra 1-amino-2-nitro-4-chlorbenzen og 5-acetoacetylaminobenzimidazolon fremstillede monoazopigmentInfo
- Publication number
- DK135382C DK135382C DK28974A DK28974A DK135382C DK 135382 C DK135382 C DK 135382C DK 28974 A DK28974 A DK 28974A DK 28974 A DK28974 A DK 28974A DK 135382 C DK135382 C DK 135382C
- Authority
- DK
- Denmark
- Prior art keywords
- monoazopigment
- acetoacetylaminobenzimidazolone
- chlorobenzene
- nitro
- finishing
- Prior art date
Links
- KQNZKBRSEJLVEO-UHFFFAOYSA-N 3-oxo-n-(2-oxobenzimidazol-5-yl)butanamide Chemical compound C1=C(NC(=O)CC(=O)C)C=CC2=NC(=O)N=C21 KQNZKBRSEJLVEO-UHFFFAOYSA-N 0.000 title 1
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B67/00—Influencing the physical, e.g. the dyeing or printing properties of dyestuffs without chemical reactions, e.g. by treating with solvents grinding or grinding assistants, coating of pigments or dyes; Process features in the making of dyestuff preparations; Dyestuff preparations of a special physical nature, e.g. tablets, films
- C09B67/0001—Post-treatment of organic pigments or dyes
- C09B67/0014—Influencing the physical properties by treatment with a liquid, e.g. solvents
- C09B67/0015—Influencing the physical properties by treatment with a liquid, e.g. solvents of azoic pigments
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- Paints Or Removers (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732302516 DE2302516C3 (de) | 1973-01-19 | Verfahren zur Nachbehandlung eines Azopigmentes |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK135382B DK135382B (da) | 1977-04-18 |
| DK135382C true DK135382C (da) | 1977-10-03 |
Family
ID=5869379
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK28974A DK135382C (da) | 1973-01-19 | 1974-01-18 | Fremgangsmade til efterbehandling af det ud fra 1-amino-2-nitro-4-chlorbenzen og 5-acetoacetylaminobenzimidazolon fremstillede monoazopigment |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4476052A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS6020421B2 (cg-RX-API-DMAC7.html) |
| AR (1) | AR197437A1 (cg-RX-API-DMAC7.html) |
| BE (1) | BE809991A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7400299D0 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1027941A (cg-RX-API-DMAC7.html) |
| CH (1) | CH587322A5 (cg-RX-API-DMAC7.html) |
| DK (1) | DK135382C (cg-RX-API-DMAC7.html) |
| FR (1) | FR2214733B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1451259A (cg-RX-API-DMAC7.html) |
| IN (1) | IN140296B (cg-RX-API-DMAC7.html) |
| IT (1) | IT1006963B (cg-RX-API-DMAC7.html) |
| NL (1) | NL176473C (cg-RX-API-DMAC7.html) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3412731A1 (de) * | 1984-04-05 | 1985-10-17 | Hoechst Ag, 6230 Frankfurt | Aminoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| US5863459A (en) * | 1997-05-09 | 1999-01-26 | Sun Chemical Corporation | Fluorescent yellow azo pigments |
| US5904878A (en) * | 1997-05-14 | 1999-05-18 | Sun Chemical Corporation | Fluorescent orange azo pigments |
| US7019121B2 (en) * | 2003-12-31 | 2006-03-28 | Sun Chemical Corporation | Process for conditioning azo pigments |
| US7134159B2 (en) * | 2004-01-13 | 2006-11-14 | Rite-Hite Holding Corporation | Stump-out apparatus for a dock leveler |
| KR100596717B1 (ko) | 2005-01-19 | 2006-07-10 | 대한스위스화학 주식회사 | 낮은 점도를 가지는 디아릴리드계 황색 유기 안료의제조방법 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3124565A (en) * | 1964-03-10 | Water-insoluble benzimidazolone mono- | ||
| DE1155755B (de) * | 1960-05-28 | 1963-10-17 | Hoechst Ag | Verfahren zur Herstellung von Azopigmenten mit verbesserter Fliessbarkeit |
| BE622476A (cg-RX-API-DMAC7.html) * | 1961-09-14 | |||
| US3137686A (en) * | 1962-04-10 | 1964-06-16 | Hoechst Ag | Water-insoluble benzimidazolone monoazo-dyestuffs |
| FR1333570A (fr) * | 1962-09-14 | 1963-07-26 | Hoechst Ag | Colorants azoïques insolubles dans l'eau et leur préparation |
| GB1140836A (en) * | 1966-02-22 | 1969-01-22 | Geigy Uk Ltd | Treatment of phthalocyanine pigments |
| US3849394A (en) * | 1968-01-03 | 1974-11-19 | Ciba Geigy Ag | Monoazo pigments containing a hydroxynaphthoylaminoacridone radical |
| US3555002A (en) * | 1968-10-22 | 1971-01-12 | Hoechst Ag | Water-insoluble benzimidazolone containing monoazo dyestuffs |
| DE1955808A1 (de) * | 1969-11-06 | 1971-06-09 | Hoechst Ag | Neue wasserunloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |
| US4003886A (en) * | 1970-09-11 | 1977-01-18 | Ciba-Geigy Ag | Tetracarboxylic acid ester substituted disazo pigments |
| US3991044A (en) * | 1972-09-26 | 1976-11-09 | Hercules Incorporated | Process for improving lightfastness of an azo pigment by heat treatment |
-
1974
- 1974-01-14 NL NLAANVRAGE7400483,A patent/NL176473C/xx not_active IP Right Cessation
- 1974-01-16 CH CH58474A patent/CH587322A5/xx not_active IP Right Cessation
- 1974-01-16 BR BR74299A patent/BR7400299D0/pt unknown
- 1974-01-16 IN IN113/CAL/74A patent/IN140296B/en unknown
- 1974-01-17 IT IT19525/74A patent/IT1006963B/it active
- 1974-01-17 AR AR251970A patent/AR197437A1/es active
- 1974-01-18 DK DK28974A patent/DK135382C/da active
- 1974-01-18 GB GB242174A patent/GB1451259A/en not_active Expired
- 1974-01-18 CA CA190,476A patent/CA1027941A/en not_active Expired
- 1974-01-18 JP JP49007957A patent/JPS6020421B2/ja not_active Expired
- 1974-01-21 FR FR7401873A patent/FR2214733B1/fr not_active Expired
- 1974-01-21 BE BE140030A patent/BE809991A/xx not_active IP Right Cessation
-
1982
- 1982-03-11 US US06/357,287 patent/US4476052A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH587322A5 (cg-RX-API-DMAC7.html) | 1977-04-29 |
| IN140296B (cg-RX-API-DMAC7.html) | 1976-10-09 |
| BR7400299D0 (pt) | 1974-08-22 |
| AR197437A1 (es) | 1974-04-05 |
| CA1027941A (en) | 1978-03-14 |
| FR2214733A1 (cg-RX-API-DMAC7.html) | 1974-08-19 |
| JPS49116131A (cg-RX-API-DMAC7.html) | 1974-11-06 |
| BE809991A (fr) | 1974-07-22 |
| JPS6020421B2 (ja) | 1985-05-22 |
| NL7400483A (cg-RX-API-DMAC7.html) | 1974-07-23 |
| NL176473C (nl) | 1985-04-16 |
| IT1006963B (it) | 1976-10-20 |
| US4476052A (en) | 1984-10-09 |
| DK135382B (da) | 1977-04-18 |
| FR2214733B1 (cg-RX-API-DMAC7.html) | 1978-01-13 |
| GB1451259A (en) | 1976-09-29 |
| DE2302516A1 (de) | 1974-08-15 |
| AU6459774A (en) | 1975-07-17 |
| NL176473B (nl) | 1984-11-16 |
| DE2302516B2 (de) | 1974-12-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137835B (da) | Analogifremgangsmåde til fremstilling af thienothiazinderivater. | |
| DK136692C (da) | Fremgangsmaade og anlaeg til toerring af baerme | |
| DK139846B (da) | Analogifremgangsmåde til fremstilling af 3-alkoxypyrazin-2-carboxamider. | |
| DK136999B (da) | Indretning til udforelse af boolske sammenknytninger | |
| DK135382C (da) | Fremgangsmade til efterbehandling af det ud fra 1-amino-2-nitro-4-chlorbenzen og 5-acetoacetylaminobenzimidazolon fremstillede monoazopigment | |
| DK146163C (da) | Fremgangsmaade til regenerering af brugt papir | |
| DK137389B (da) | Analogifremgangsmåde til fremstilling af 11beta-substituerede delta4-østrener. | |
| DK136313B (da) | Analogifremgangsmåde til fremstilling af N-substituerede m-trifluormethylbenzylaminer. | |
| DK139682B (da) | Analogifremgangsmåde til fremstilling af eburnameninderivater. | |
| DK138399B (da) | Fremgangsmåde til fremstilling af purpuromycin og derivater deraf. | |
| DK145156C (da) | Fremgangsmaade til fremstilling af sulfonylmethyl-perhydroindan-5-oner | |
| DK140670B (da) | Analogifremgangsmåde til fremstilling af ergopeptinderivater. | |
| DK143028C (da) | Fremgangsmaade til fremstilling af n5-methyltetrahydro-homofolinsyre ud fra homofolinsyre | |
| DK134303C (da) | Fremgangsmade til malkning og malkemaskine til udovelse af fremgangsmaden | |
| DK139910B (da) | Analogifremgangsmåde til fremstilling af substituerede triazoler. | |
| DK136619B (da) | Fremgangsmåde til fremstilling af dihydrokanadensolid. | |
| DK136652B (da) | Fremgangsmåde til fremstilling af thieno-pyridinderivater. | |
| DK132890C (da) | Fremgangsmade til fremstilling af 2(1h)-quinazolinonderivater | |
| DK132369B (da) | Profilliste til fremstilling af rammer og karme. | |
| DK130333B (da) | Apparat til fremstilling af kuffertrammer. | |
| DK136979B (da) | Fremgangsmåde til fremstilling af dibenzofuran. | |
| DK134240B (da) | Fremgangsmåde til fremstilling af bicyclomycin. | |
| DK136603B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| SU472163A1 (ru) | Сталь | |
| DK138014B (da) | Analogifremgangsmåde til fremstilling af N-substituerede 3-nitronaphthalimider. |