DK134228B - Fremgangsmåde til fremstilling af 4-phenyl-2(1H)-quinazolinonderivater. - Google Patents
Fremgangsmåde til fremstilling af 4-phenyl-2(1H)-quinazolinonderivater.Info
- Publication number
- DK134228B DK134228B DK442474AA DK442474A DK134228B DK 134228 B DK134228 B DK 134228B DK 442474A A DK442474A A DK 442474AA DK 442474 A DK442474 A DK 442474A DK 134228 B DK134228 B DK 134228B
- Authority
- DK
- Denmark
- Prior art keywords
- phenyl
- preparation
- quinazolinone derivatives
- quinazolinone
- derivatives
- Prior art date
Links
- FHUBTSLLILWICW-UHFFFAOYSA-N 4-phenyl-1h-quinazolin-2-one Chemical class C12=CC=CC=C2NC(=O)N=C1C1=CC=CC=C1 FHUBTSLLILWICW-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C247/00—Compounds containing azido groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48093678A JPS5046680A (cg-RX-API-DMAC7.html) | 1973-08-20 | 1973-08-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK442474A DK442474A (cg-RX-API-DMAC7.html) | 1975-04-28 |
| DK134228B true DK134228B (da) | 1976-10-04 |
| DK134228C DK134228C (cg-RX-API-DMAC7.html) | 1977-03-07 |
Family
ID=14089055
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK442474AA DK134228B (da) | 1973-08-20 | 1974-08-19 | Fremgangsmåde til fremstilling af 4-phenyl-2(1H)-quinazolinonderivater. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3953446A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5046680A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1019329A (cg-RX-API-DMAC7.html) |
| CH (1) | CH601260A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2439454A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK134228B (cg-RX-API-DMAC7.html) |
| FR (1) | FR2245642B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1464033A (cg-RX-API-DMAC7.html) |
| NL (1) | NL7410775A (cg-RX-API-DMAC7.html) |
| SE (1) | SE409325B (cg-RX-API-DMAC7.html) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4202895A (en) * | 1971-06-04 | 1980-05-13 | Sumitomo Chemical Company, Limited | 1-Polyhaloalkyl-2(1H)-quinazolinone derivatives |
| US4067868A (en) * | 1973-04-17 | 1978-01-10 | Sumitomo Chemical Company, Limited | Production of quinazolinone compounds |
| AR038658A1 (es) | 2001-06-15 | 2005-01-26 | Novartis Ag | Derivados de 4-aril-2(1h) quinazolinona y 4-aril-quinazolina 2-sustituidas, un proceso para su preparacion, composiciones farmaceuticas y el uso de dichos derivados para la preparacion de un medicamento |
| GB0230015D0 (en) * | 2002-12-23 | 2003-01-29 | Novartis Ag | Organic compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3923803A (en) | 1968-07-18 | 1975-12-02 | Sumitomo Chemical Co | 2(1H)-Quinozalinones and process therefor |
| DE2037693C3 (de) * | 1969-08-02 | 1975-01-16 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 1-Cyclopropylmethyl-2(1 H)-chinazolinonderivate |
| US3859237A (en) * | 1970-04-20 | 1975-01-07 | Sumitomo Chemical Co | Quinazoline derivatives |
| JPS4948957B2 (cg-RX-API-DMAC7.html) * | 1971-10-26 | 1974-12-24 |
-
1973
- 1973-08-20 JP JP48093678A patent/JPS5046680A/ja active Pending
-
1974
- 1974-08-05 US US05/494,885 patent/US3953446A/en not_active Expired - Lifetime
- 1974-08-08 GB GB3507974A patent/GB1464033A/en not_active Expired
- 1974-08-12 NL NL7410775A patent/NL7410775A/xx not_active Application Discontinuation
- 1974-08-15 SE SE7410424A patent/SE409325B/xx unknown
- 1974-08-16 DE DE2439454A patent/DE2439454A1/de not_active Withdrawn
- 1974-08-19 FR FR7428416A patent/FR2245642B1/fr not_active Expired
- 1974-08-19 CA CA207,244A patent/CA1019329A/en not_active Expired
- 1974-08-19 DK DK442474AA patent/DK134228B/da not_active IP Right Cessation
- 1974-08-20 CH CH1135174A patent/CH601260A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2245642A1 (cg-RX-API-DMAC7.html) | 1975-04-25 |
| CH601260A5 (cg-RX-API-DMAC7.html) | 1978-06-30 |
| DK442474A (cg-RX-API-DMAC7.html) | 1975-04-28 |
| SE409325B (sv) | 1979-08-13 |
| SE7410424L (cg-RX-API-DMAC7.html) | 1975-02-21 |
| JPS5046680A (cg-RX-API-DMAC7.html) | 1975-04-25 |
| DK134228C (cg-RX-API-DMAC7.html) | 1977-03-07 |
| FR2245642B1 (cg-RX-API-DMAC7.html) | 1976-10-22 |
| CA1019329A (en) | 1977-10-18 |
| NL7410775A (nl) | 1975-02-24 |
| DE2439454A1 (de) | 1975-03-06 |
| US3953446A (en) | 1976-04-27 |
| GB1464033A (en) | 1977-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134345B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater. | |
| DK135376B (da) | Fremgangsmåde til fremstilling af piperazinylquinazolin-forbindelser. | |
| DK137534B (da) | Fremgangsmåde til fremstilling af 3,4-dihydro-2(1H)-quinazolinonderivater. | |
| DK135766B (da) | Analogifremgangsmåde til fremstilling af isoquinoliner. | |
| DK133673B (da) | Fremgangsmåde til fremstilling af 3,4-dihydro-2(1H)-quinazolinonderivater. | |
| DK133556B (da) | Analogifremgangsmåde til fremstilling af 9-substituerede aminoimidazo/4,5-f/kinoliner. | |
| DK138989B (da) | Fremgangsmåde til fremstilling af 2(1H)-quinazolinonderivater. | |
| DK131779B (da) | Fremgangsmåde til fremstilling af 4-phenyl-2(1H)-quinazolinonderivater. | |
| DK137389B (da) | Analogifremgangsmåde til fremstilling af 11beta-substituerede delta4-østrener. | |
| DK136469B (da) | Analogifremgangsmåde til fremstilling af 2-(phenoxyalkylthio)-imidazolderivater. | |
| DK134279B (da) | Analogifremgangsmåde til fremstilling af cycloalkylphenoxycarboxylsyrederivater. | |
| DK129350B (da) | Fremgangsmåde til fremstilling af 1-substituerede 2(1H)-quinazolinonderivater. | |
| DK134228B (da) | Fremgangsmåde til fremstilling af 4-phenyl-2(1H)-quinazolinonderivater. | |
| DK131633B (da) | Fremgangsmåde til fremstilling af 3-(17beta-4-androsten-3-on-17beta-yl)-propiolacton. | |
| DK139716B (da) | Analogifremgangsmåde til fremstilling af 4-aminoamfetaminderivater. | |
| DK137043B (da) | Analogifremgangsmåde til fremstilling af nitrocarbostyrilforbindelser. | |
| DK138319B (da) | Analogifremgangsmåde til fremstilling af 6-fluoralkyl-2(1H), 3(4H)-quinoxalindionforbindelser. | |
| DK132430B (da) | Fremgangsmåde til fremstilling af quinazolinonderivater. | |
| DK130972B (da) | Fremgangsmåde til fremstilling af 1-alkyl-4-phenyl-2(1H)-quinazolinoner. | |
| DK135943B (da) | Fremgangsmåde til fremstilling af propanolaminderivater. | |
| DK137182B (da) | Analogifremgangsmåde til fremstilling af anthranilsyrederivater. | |
| DK129996B (da) | Fremgangsmåde til fremstilling af 3,4-dihydro-2(1H)-quinazolinonderivater. | |
| DK136619B (da) | Fremgangsmåde til fremstilling af dihydrokanadensolid. | |
| DK135120B (da) | Analogifremgangsmåde til fremstilling af imidazolidinderivater. | |
| DK138895B (da) | Fremgangsmåde til fremstilling af 8-beta-(2'-pyrimidino-aminometyl)-ergolinderivater. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |