DK133373B - Analogifremgangsmåde til fremstilling af 2-phenyl-cyclohexen-3-carboxylsyre-derivater. - Google Patents
Analogifremgangsmåde til fremstilling af 2-phenyl-cyclohexen-3-carboxylsyre-derivater.Info
- Publication number
- DK133373B DK133373B DK482068AA DK482068A DK133373B DK 133373 B DK133373 B DK 133373B DK 482068A A DK482068A A DK 482068AA DK 482068 A DK482068 A DK 482068A DK 133373 B DK133373 B DK 133373B
- Authority
- DK
- Denmark
- Prior art keywords
- cyclohexene
- phenyl
- preparation
- carboxylic acid
- acid derivatives
- Prior art date
Links
- FPXFKRJXSSAIMJ-UHFFFAOYSA-N 2-phenylcyclohex-2-ene-1-carboxylic acid Chemical class OC(=O)C1CCCC=C1C1=CC=CC=C1 FPXFKRJXSSAIMJ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/42—Oxygen atoms attached in position 3 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
- C07D451/06—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
- C07D451/06—Oxygen atoms
- C07D451/10—Oxygen atoms acylated by aliphatic or araliphatic carboxylic acids, e.g. atropine, scopolamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT2136767 | 1967-10-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK133373B true DK133373B (da) | 1976-05-10 |
| DK133373C DK133373C (enExample) | 1976-10-11 |
Family
ID=11180736
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK482068AA DK133373B (da) | 1967-10-07 | 1968-10-07 | Analogifremgangsmåde til fremstilling af 2-phenyl-cyclohexen-3-carboxylsyre-derivater. |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT289751B (enExample) |
| BE (1) | BE721948A (enExample) |
| BR (1) | BR6802854D0 (enExample) |
| CH (1) | CH533082A (enExample) |
| DE (1) | DE1800974B2 (enExample) |
| DK (1) | DK133373B (enExample) |
| ES (1) | ES358926A1 (enExample) |
| FR (1) | FR8246M (enExample) |
| GB (1) | GB1194280A (enExample) |
| IL (1) | IL30816A (enExample) |
| NL (1) | NL161132C (enExample) |
| SE (1) | SE356973B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4229207A (en) * | 1975-08-15 | 1980-10-21 | Ciba-Geigy Corporation | Esters of 1,2-diphenyl-cyclohex-1-ene-4-carboxylic acid |
| IT1213033B (it) * | 1986-02-11 | 1989-12-07 | Guidotti & C Spa Labor | Esteri di n-alchil-nortropine eloro derivati ammonioquaternari aventi attivita'anti-broncospastica, procedimento per la loro preparazione e composizioni farmaceutiche che licontengono. |
-
1968
- 1968-10-03 CH CH1476868A patent/CH533082A/it not_active IP Right Cessation
- 1968-10-03 DE DE19681800974 patent/DE1800974B2/de active Granted
- 1968-10-03 IL IL30816A patent/IL30816A/xx unknown
- 1968-10-04 FR FR42000198A patent/FR8246M/fr not_active Expired
- 1968-10-04 BR BR202854/68A patent/BR6802854D0/pt unknown
- 1968-10-04 SE SE13423/68A patent/SE356973B/xx unknown
- 1968-10-07 NL NL6814330.A patent/NL161132C/xx not_active IP Right Cessation
- 1968-10-07 ES ES358926A patent/ES358926A1/es not_active Expired
- 1968-10-07 BE BE721948A patent/BE721948A/xx unknown
- 1968-10-07 GB GB47358/68A patent/GB1194280A/en not_active Expired
- 1968-10-07 DK DK482068AA patent/DK133373B/da unknown
- 1968-10-07 AT AT09793/68A patent/AT289751B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BR6802854D0 (pt) | 1973-02-22 |
| DE1800974B2 (de) | 1973-01-25 |
| NL161132C (nl) | 1980-01-15 |
| NL6814330A (enExample) | 1969-04-09 |
| BE721948A (enExample) | 1969-03-14 |
| NL161132B (nl) | 1979-08-15 |
| SE356973B (enExample) | 1973-06-12 |
| DK133373C (enExample) | 1976-10-11 |
| CH533082A (it) | 1973-01-31 |
| GB1194280A (en) | 1970-06-10 |
| AT289751B (de) | 1971-03-15 |
| FR8246M (enExample) | 1970-10-12 |
| IL30816A0 (en) | 1968-12-26 |
| ES358926A1 (es) | 1970-05-16 |
| IL30816A (en) | 1973-04-30 |
| DE1800974A1 (de) | 1969-06-04 |
| DE1800974C3 (enExample) | 1973-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137232B (da) | Analogifremgangsmåde til fremstilling af phenylethanolaminer. | |
| DK120698B (da) | Analogifremgangsmåde til fremstilling af acetylguanidiner. | |
| DK136901B (da) | Analogifremgangsmåde til fremstilling af 2-anilinonikotinsyrederivater. | |
| DK118820B (da) | Analogifremgangsmåde til fremstilling af derivater af 5-nitro-2-furyl-isoxazoliner. | |
| DK122766B (da) | Analogifremgangsmåde til fremstilling af oksazolalkansyrederivater. | |
| DK118021B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyrederivater. | |
| DK122965B (da) | Analogifremgangsmåde til fremstilling af derivater af thiazolylbenzoesyre. | |
| DK125251B (da) | Analogifremgangsmåde til fremstilling af thiazolylmalonsyrederivater. | |
| DK124536B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-3-hydroxybutyrohydroxamsyre. | |
| DK123471B (da) | Analogifremgangsmåde til fremstilling af benzyliden-amino-oxyalkylcarboxylsyrederivater. | |
| DK119307B (da) | Fremgangsmåde til fremstilling af ketonitriler. | |
| DK123868B (da) | Analogifremgangsmåde til fremstilling af 3-hydroxycumarin-derivater. | |
| DK136033B (da) | Fremgangsmåde til fremstilling af indolyl-3-eddikesyrer. | |
| DK125321B (da) | Analogifremgangsmåde til fremstilling af fluorholdige derivater af phenoxyisosmørsyre. | |
| DK118507B (da) | Fremgangsmåde til fremstilling af 3-dimethylsulfamoylphenthiazinderivater. | |
| DK124825B (da) | Analogifremgangsmåde til fremstilling af pyrazinderivater. | |
| DK130347B (da) | Fremgangsmåde til fremstilling af 6-aminopenicillansyre. | |
| DK135287B (da) | Analogifremgangsmåde til fremstilling af styrylthiazoliumsalte. | |
| DK133373B (da) | Analogifremgangsmåde til fremstilling af 2-phenyl-cyclohexen-3-carboxylsyre-derivater. | |
| DK119976B (da) | Analogifremgangsmåde til fremstilling af 18-methyl-19-nor-17α-hydroxyprogesteroner og -17-estere deraf. | |
| DK117568B (da) | Analogifremgangsmåde til fremstilling af ftalazino-ftalazindioner. | |
| DK122666B (da) | Analogifremgangsmåde til fremstilling af hydrocortison-17-cyclopentancorboxylat. | |
| DK120948B (da) | Fremgangsmåde til fremstilling af (androst-17β-yl)-α-pyroner. | |
| DK119012B (da) | Analogifremgangsmåde til fremstilling af thebainderivater. | |
| DK117231B (da) | Fremgangsmåde til fremstilling af kinazolin-3-oxydderivater. |