DK131631C - Analogifremgangsmade til fremstilling af 4-oxo-benzo(4,5)cyclohepta(1,2-b)thiophen-2-eddikesyreforbindelser - Google Patents
Analogifremgangsmade til fremstilling af 4-oxo-benzo(4,5)cyclohepta(1,2-b)thiophen-2-eddikesyreforbindelserInfo
- Publication number
- DK131631C DK131631C DK173673A DK173673A DK131631C DK 131631 C DK131631 C DK 131631C DK 173673 A DK173673 A DK 173673A DK 173673 A DK173673 A DK 173673A DK 131631 C DK131631 C DK 131631C
- Authority
- DK
- Denmark
- Prior art keywords
- cyclohepta
- thiophen
- benzo
- oxo
- preparation
- Prior art date
Links
- YOGOVMCZEOOBCD-UHFFFAOYSA-N 2-(2-oxo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-5-yl)acetic acid Chemical class O=C1C2=C(C=CC=3SC(=CC31)CC(=O)O)C=CC=C2 YOGOVMCZEOOBCD-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/78—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems condensed with rings other than six-membered or with ring systems containing such rings
- C07D333/80—Seven-membered rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH513372A CH565171A5 (index.php) | 1972-04-07 | 1972-04-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK131631B DK131631B (da) | 1975-08-11 |
| DK131631C true DK131631C (da) | 1976-01-12 |
Family
ID=4288489
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK173673A DK131631C (da) | 1972-04-07 | 1973-03-29 | Analogifremgangsmade til fremstilling af 4-oxo-benzo(4,5)cyclohepta(1,2-b)thiophen-2-eddikesyreforbindelser |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3865843A (index.php) |
| JP (1) | JPS497268A (index.php) |
| AT (1) | ATA306573A (index.php) |
| AU (1) | AU5423173A (index.php) |
| BE (1) | BE797823A (index.php) |
| DD (1) | DD105228A5 (index.php) |
| DE (1) | DE2316844A1 (index.php) |
| DK (1) | DK131631C (index.php) |
| FR (1) | FR2183698B1 (index.php) |
| GB (1) | GB1424856A (index.php) |
| HU (1) | HU166486B (index.php) |
| NL (1) | NL7304547A (index.php) |
| SU (1) | SU504489A3 (index.php) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4025640A (en) * | 1975-08-26 | 1977-05-24 | American Hoechst Corporation | Oxothienobenzoxepin-acetic acids, precursors and derivatives thereof |
| JPS5325270A (en) * | 1976-08-20 | 1978-03-08 | Japan Exlan Co Ltd | Solidifying method for sludgy substance |
| JPS5515452A (en) * | 1978-07-19 | 1980-02-02 | Iic Kagaku Kogyo Kk | Aromatic composition |
| JPS57195174A (en) * | 1981-05-26 | 1982-11-30 | New Japan Chem Co Ltd | Composition for recovering organic material |
| US4502975A (en) * | 1981-05-26 | 1985-03-05 | New Japan Chemical Co., Ltd. | Compositions for recovering an organic material from an oily layer on a body of water |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3464983A (en) * | 1964-02-04 | 1969-09-02 | Sandoz Ag | 4h-benzo(4,5)cyclohepta(1,2-b)thiophenes |
| FR2138257B1 (index.php) * | 1971-05-21 | 1974-08-23 | Roussel Uclaf |
-
1973
- 1973-03-29 DK DK173673A patent/DK131631C/da active
- 1973-04-02 NL NL7304547A patent/NL7304547A/xx not_active Application Discontinuation
- 1973-04-02 US US347061A patent/US3865843A/en not_active Expired - Lifetime
- 1973-04-03 GB GB1581973A patent/GB1424856A/en not_active Expired
- 1973-04-04 DE DE2316844A patent/DE2316844A1/de active Pending
- 1973-04-05 BE BE129688A patent/BE797823A/xx unknown
- 1973-04-05 DD DD169969A patent/DD105228A5/xx unknown
- 1973-04-05 HU HUSA2481A patent/HU166486B/hu unknown
- 1973-04-06 JP JP48038815A patent/JPS497268A/ja active Pending
- 1973-04-06 SU SU1905030A patent/SU504489A3/ru active
- 1973-04-06 AU AU54231/73A patent/AU5423173A/en not_active Expired
- 1973-04-06 FR FR7312503A patent/FR2183698B1/fr not_active Expired
- 1973-04-06 AT AT733065A patent/ATA306573A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2183698A1 (index.php) | 1973-12-21 |
| BE797823A (fr) | 1973-10-05 |
| DE2316844A1 (de) | 1973-10-18 |
| JPS497268A (index.php) | 1974-01-22 |
| NL7304547A (index.php) | 1973-10-09 |
| DD105228A5 (index.php) | 1974-04-12 |
| GB1424856A (en) | 1976-02-11 |
| ATA306573A (de) | 1976-06-15 |
| AU5423173A (en) | 1974-10-10 |
| DK131631B (da) | 1975-08-11 |
| FR2183698B1 (index.php) | 1977-09-09 |
| HU166486B (index.php) | 1975-03-28 |
| US3865843A (en) | 1975-02-11 |
| SU504489A3 (ru) | 1976-02-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK136312B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidinoalkanonoximderivater. | |
| DK133051C (da) | Analogifremgangsmade til fremstilling af 1,3-oxygenerede 8alfa-ostratriener | |
| DK132707B (da) | Analogifremgangsmade til fremstilling af 1,3,16,17-tetraoxygenerede 8alfa-ostratriener | |
| DK136612C (da) | Analogifremgangsmaade til fremstilling af 3,20-dioxo-4-pregnen-21-syrederivater | |
| DK133050C (da) | Analogifremgangsmade til fremstilling af 3,17,18-trihydroxy-1,3,5(10)-ostratriener | |
| DK139751B (da) | Analogifremgangsmaade til fremstilling af n-benzhydryl-n!-p-hydroxybenzyl-piperaziner | |
| DK131631C (da) | Analogifremgangsmade til fremstilling af 4-oxo-benzo(4,5)cyclohepta(1,2-b)thiophen-2-eddikesyreforbindelser | |
| DK132273C (da) | Fremgangsmade til fremstilling af trans-chrysanthemsyre | |
| DK135380C (da) | Analogifremgangsmade til fremstilling af pregnan-21-syrederivater | |
| DK139524B (da) | Fremgangsmaade til fremstilling af poly-alfahydroxy-acrylsyre | |
| DK133667B (da) | Fremgangsmåde til fremstilling af 5-cyklohexyl-6-halogenindan-1-karboxylsyrederivater. | |
| DK131855C (da) | Fremgangsmade til fremstilling af 3,4-dihydropyridoner | |
| DK137924C (da) | Fremgangsmaade til fremstilling af 1,4-dihydroquinoliner | |
| DK133297C (da) | Analogifremgangsmade til fremstilling af 6-halogen-6-cyklohexylindan-1-karbohydroxamsyre | |
| DK132831C (da) | Analogifremgangsmade til fremstilling af 17beta-hydroxy-2,2,17-trimethyl-4-androsten-3-on | |
| DK138895B (da) | Fremgangsmåde til fremstilling af 8-beta-(2'-pyrimidino-aminometyl)-ergolinderivater. | |
| DK132329C (da) | Fremgangsmade til fremstilling af cardenolid-3,alfa-(2'-desoxy-glycosider) | |
| DK133468B (da) | Analogifremgangsmade til fremstilling af 1-benzyl-3-amino-pyrazoloner-(5) | |
| DK137383B (da) | Analogifremgangsmåde til fremstilling af 5-carboxyalkyl-2-iminobarbitur- eller 2-thioxobarbitursyrederivater. | |
| DK132941C (da) | Fremgangsmade til fremstilling af 5-cykloalkyl-6-halogen-indan-1-karboxylsyrederivater | |
| DK582575A (da) | Fremgangsmade til fremstilling af 3-benzyl-1,2,3,4,5,6-hexahydro-8-hydroxy-2,6-metan-6,11-dimetylbenzazocin | |
| DK139428C (da) | Analogifremgangsmaade til fremstilling af delvis hydrogenerede1h-indeno-(1,2-b)-pyridin-derivater | |
| DK138323B (da) | Fremgangsmåde til fremstilling af bis-chromonylforbindelser. | |
| DK132283C (da) | Analogifremgangsmade til fremstilling af 15-oxasteroider | |
| DK132832C (da) | Analogifremgangsmade til fremstilling af alfa-acyldigitoxiner |