DK131290B - Fremgangsmåde til fremstilling af alkalimetalsaltene af alfa-amino-benzylpenicillin og dets epimere. - Google Patents
Fremgangsmåde til fremstilling af alkalimetalsaltene af alfa-amino-benzylpenicillin og dets epimere.Info
- Publication number
- DK131290B DK131290B DK112567A DK112567A DK131290B DK 131290 B DK131290 B DK 131290B DK 112567 A DK112567 A DK 112567A DK 112567 A DK112567 A DK 112567A DK 131290 B DK131290 B DK 131290B
- Authority
- DK
- Denmark
- Prior art keywords
- benzylpenicillin
- epimers
- alpha
- amino
- preparation
- Prior art date
Links
- 229910052783 alkali metal Inorganic materials 0.000 title 1
- -1 alkali metal salts Chemical class 0.000 title 1
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical class C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB926066A GB1128235A (en) | 1966-03-03 | 1966-03-03 | Alkali metal salts of ª‡-aminobenzylpenicillin |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK131290B true DK131290B (da) | 1975-06-23 |
| DK131290C DK131290C (enExample) | 1975-11-17 |
Family
ID=9868558
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK112567A DK131290B (da) | 1966-03-03 | 1967-03-03 | Fremgangsmåde til fremstilling af alkalimetalsaltene af alfa-amino-benzylpenicillin og dets epimere. |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT272517B (enExample) |
| BE (1) | BE694859A (enExample) |
| CH (1) | CH485770A (enExample) |
| DK (1) | DK131290B (enExample) |
| ES (1) | ES337475A1 (enExample) |
| FI (1) | FI51355C (enExample) |
| FR (1) | FR1512943A (enExample) |
| GB (1) | GB1128235A (enExample) |
| NL (1) | NL155833C (enExample) |
| NO (1) | NO134258C (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1465694A (en) * | 1973-05-15 | 1977-02-23 | Beecham Group Ltd | Preparation of penicillin salts |
| US4024130A (en) * | 1975-03-31 | 1977-05-17 | Pfizer Inc. | Process for the manufacture of alkali metal salts of 6-[2-phenyl-2-(imidoylaminoalkanoylamino)acetamido]penicillanic acids |
-
1966
- 1966-03-03 GB GB926066A patent/GB1128235A/en not_active Expired
-
1967
- 1967-02-22 NL NL6702734A patent/NL155833C/xx not_active IP Right Cessation
- 1967-02-28 CH CH291667A patent/CH485770A/de not_active IP Right Cessation
- 1967-03-01 BE BE694859D patent/BE694859A/xx not_active IP Right Cessation
- 1967-03-02 NO NO16709867A patent/NO134258C/no unknown
- 1967-03-02 FI FI60967A patent/FI51355C/fi active
- 1967-03-02 FR FR97127A patent/FR1512943A/fr not_active Expired
- 1967-03-02 ES ES337475A patent/ES337475A1/es not_active Expired
- 1967-03-02 AT AT201067A patent/AT272517B/de active
- 1967-03-03 DK DK112567A patent/DK131290B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES337475A1 (es) | 1968-03-16 |
| GB1128235A (en) | 1968-09-25 |
| DE1670191B2 (de) | 1975-10-09 |
| AT272517B (de) | 1969-07-10 |
| DE1670191A1 (de) | 1971-03-25 |
| FI51355C (fi) | 1976-12-10 |
| NO134258B (enExample) | 1976-05-31 |
| BE694859A (enExample) | 1967-09-01 |
| FI51355B (enExample) | 1976-08-31 |
| NL155833B (nl) | 1978-02-15 |
| NL6702734A (enExample) | 1967-09-04 |
| DK131290C (enExample) | 1975-11-17 |
| NL155833C (nl) | 1982-04-16 |
| NO134258C (enExample) | 1976-09-08 |
| CH485770A (de) | 1970-02-15 |
| FR1512943A (fr) | 1968-02-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK108487C (da) | Fremgangsmåde til fremstilling af alkalifattigt cement. | |
| DK135593B (da) | Fremgangsmåde til fremstilling af legeringer af TiNi-typen. | |
| DK130355B (da) | Fremgangsmåde til fremstilling af stål. | |
| DK115108B (da) | Fremgangsmåde til fremstilling af 2-amino-benzophenon-β-oximer. | |
| DK117954B (da) | Fremgangsmåde til fremstilling af 3-amino-2-cyanoacrylamid. | |
| DK124886B (da) | Fremgangsnmåde til fremstilling af 1-hydroxy-benzimidazol-N-oxider. | |
| DK117832B (da) | Fremgangsmåde til fremstilling af ɛ-caprolactam og ω-decalactam. | |
| DK131290B (da) | Fremgangsmåde til fremstilling af alkalimetalsaltene af alfa-amino-benzylpenicillin og dets epimere. | |
| DK115551B (da) | Fremgangsmåde til fremstilling af 6-aminouracil-5-carbonamid-N-sulfonamider. | |
| DK114980B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyreamider. | |
| DK112318B (da) | Fremgangsmåde til fremstilling af 2-benzensulfonylamidopyrimidiner. | |
| DK115694B (da) | Fremgangsmåde til fremstilling af α-dithioler. | |
| DK111891B (da) | Fremgangsmåde til fremstilling af 5-oxo-17α-methyl-20-hydroxy-(des-A)-19-nor-pregna-9-en. | |
| DK120344B (da) | Fremgangsmåde til fremstilling af 5-benzyl-pyrimidiner. | |
| DK114063B (da) | Fremgangsmåde til fremstilling af 1-methyl-2-isopropyl-5-nitro-imidazol. | |
| DK117423B (da) | Fremgangsmåde til kontinuerlig fremstilling af lactamer. | |
| DK116865B (da) | Kontinuerlig fremgangsmåde til fremstilling af urinstoff. | |
| DK114626B (da) | Fremgangsmåde til fremstilling af 2-substitueret-4-amino-5-acylamidometylpyrimidin. | |
| DK118949B (da) | Fremgangsmåde til fremstilling af 2-alkyl-3-phenyl-4(3H)-quinazolinoner. | |
| DK117570B (da) | Analogifremgangsmåde til fremstilling af 5-cyanthiophen-2-aldehydthiosemicarbazon. | |
| DK109140C (da) | Fremgangsmåde til fremstilling af 1-hydroksy-3-aminopyrrolidon-2-derivater. | |
| DK109084C (da) | Fremgangsmåde til fremstilling af O-methy-N-methyl-heparinamid eller dets alkalimetalsalte. | |
| DK107287C (da) | Fremgangsmåde til fremstilling af N-benzylheparinamid eller dets alkalimetalsalte. | |
| DK117558B (da) | Fremgangsmåde til krystallisation af urinstof. | |
| DK113292B (da) | Fremgangsmåde til fremstilling af azabicycloalkaner. |