DK128076B - Fremgangsmåde til reduktion af zearalenon til zearalanol. - Google Patents
Fremgangsmåde til reduktion af zearalenon til zearalanol.Info
- Publication number
- DK128076B DK128076B DK154471AA DK154471A DK128076B DK 128076 B DK128076 B DK 128076B DK 154471A A DK154471A A DK 154471AA DK 154471 A DK154471 A DK 154471A DK 128076 B DK128076 B DK 128076B
- Authority
- DK
- Denmark
- Prior art keywords
- zearalanol
- zearalenone
- reducing
- reducing zearalenone
- Prior art date
Links
- FPQFYIAXQDXNOR-QDKLYSGJSA-N alpha-Zearalenol Chemical compound O=C1O[C@@H](C)CCC[C@H](O)CCC\C=C\C2=CC(O)=CC(O)=C21 FPQFYIAXQDXNOR-QDKLYSGJSA-N 0.000 title 1
- MBMQEIFVQACCCH-UHFFFAOYSA-N trans-Zearalenon Natural products O=C1OC(C)CCCC(=O)CCCC=CC2=CC(O)=CC(O)=C21 MBMQEIFVQACCCH-UHFFFAOYSA-N 0.000 title 1
- MBMQEIFVQACCCH-QBODLPLBSA-N zearalenone Chemical compound O=C1O[C@@H](C)CCCC(=O)CCC\C=C\C2=CC(O)=CC(O)=C21 MBMQEIFVQACCCH-QBODLPLBSA-N 0.000 title 1
- 229960002300 zeranol Drugs 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D313/00—Heterocyclic compounds containing rings of more than six members having one oxygen atom as the only ring hetero atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Fodder In General (AREA)
- Pyrane Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US2526570A | 1970-04-02 | 1970-04-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK128076B true DK128076B (da) | 1974-02-25 |
Family
ID=21825011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK154471AA DK128076B (da) | 1970-04-02 | 1971-03-31 | Fremgangsmåde til reduktion af zearalenon til zearalanol. |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3697548A (fa) |
| JP (1) | JPS4921152B1 (fa) |
| AT (1) | AT310767B (fa) |
| AU (1) | AU490537B2 (fa) |
| BE (1) | BE765130A (fa) |
| CH (1) | CH554329A (fa) |
| DE (1) | DE2111606C3 (fa) |
| DK (1) | DK128076B (fa) |
| FR (1) | FR2092489A5 (fa) |
| GB (1) | GB1298316A (fa) |
| IL (1) | IL36349A (fa) |
| NL (1) | NL161447C (fa) |
| SE (1) | SE359540B (fa) |
| ZA (1) | ZA711329B (fa) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3818044A (en) * | 1972-01-17 | 1974-06-18 | Commercial Solvents Corp | Preparation of zearalanone or of racemic mixtures of zearalanol diamers |
| US3808233A (en) * | 1972-09-26 | 1974-04-30 | Commercial Solvents Corp | Zearalenone reduction |
| JPS6071191U (ja) * | 1983-10-24 | 1985-05-20 | 富士通テン株式会社 | 印刷配線基板の接続構造 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL131475C (fa) * | 1965-02-15 | |||
| US3239345A (en) * | 1965-02-15 | 1966-03-08 | Estrogenic compounds and animal growth promoters |
-
1970
- 1970-04-02 US US25265A patent/US3697548A/en not_active Expired - Lifetime
-
1971
- 1971-03-02 ZA ZA711329A patent/ZA711329B/xx unknown
- 1971-03-04 IL IL36349A patent/IL36349A/en unknown
- 1971-03-11 DE DE2111606A patent/DE2111606C3/de not_active Expired
- 1971-03-19 CH CH405271A patent/CH554329A/xx not_active IP Right Cessation
- 1971-03-24 AT AT254071A patent/AT310767B/de not_active IP Right Cessation
- 1971-03-25 FR FR7110556A patent/FR2092489A5/fr not_active Expired
- 1971-03-29 NL NL7104198.A patent/NL161447C/xx not_active IP Right Cessation
- 1971-03-30 JP JP46018450A patent/JPS4921152B1/ja active Pending
- 1971-03-31 DK DK154471AA patent/DK128076B/da unknown
- 1971-04-01 SE SE04259/71A patent/SE359540B/xx unknown
- 1971-04-01 BE BE765130A patent/BE765130A/xx not_active IP Right Cessation
- 1971-04-19 GB GB23143/71A patent/GB1298316A/en not_active Expired
-
1975
- 1975-10-20 AU AU85868/75A patent/AU490537B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1298316A (en) | 1972-11-29 |
| NL161447C (nl) | 1980-02-15 |
| DE2111606C3 (de) | 1982-01-07 |
| SE359540B (fa) | 1973-09-03 |
| FR2092489A5 (fa) | 1972-01-21 |
| IL36349A0 (en) | 1971-05-26 |
| DE2111606B2 (de) | 1981-01-29 |
| BE765130A (fr) | 1971-08-30 |
| AU8586875A (en) | 1975-12-18 |
| NL7104198A (fa) | 1971-10-05 |
| DE2111606A1 (de) | 1971-10-21 |
| JPS4921152B1 (fa) | 1974-05-30 |
| IL36349A (en) | 1973-07-30 |
| AT310767B (de) | 1973-10-10 |
| NL161447B (nl) | 1979-09-17 |
| US3697548A (en) | 1972-10-10 |
| ZA711329B (en) | 1971-12-29 |
| CH554329A (de) | 1974-09-30 |
| AU490537B2 (en) | 1975-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES203624Y (es) | Armazon de entramado. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK135455B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxythiolincosaminider. | |
| DK134489B (da) | Fremgangsmåde til fremstilling af alkyl-7-desoxy-7(S)-substituerede-alfa-thiolincosaminider. | |
| DK128076B (da) | Fremgangsmåde til reduktion af zearalenon til zearalanol. | |
| DK128538B (da) | Fremgangsmåde til reduktion af zearalenon til zearalanol. | |
| DK130467B (da) | Fremgangsmåde til fremstilling af erythromycylaminer. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK126509B (da) | Fremgangsmåde til fremstilling af zearalenon. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK129450B (da) | Fremgangsmåde til ætinylering af 17-ketosteroider. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| ES196914Y (es) | Convertidos. | |
| DK130464B (da) | Fremgangsmåde til reduktion af zearalenon til zearalanol. | |
| DK135994B (da) | Analogifremgangsmåde til fremstilling af benzopyranforbindelser. | |
| DK128016B (da) | Fremgangsmåde til fremstilling af zearalenon. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK129138B (da) | Fremgangsmåde til fremstilling af tuberactinomycin-N. | |
| DK127852B (da) | Analogifremgangsmåde til fremstilling af 22-substituerede cardenolidrhamnosider. | |
| DK127414B (da) | Analogifremgangsmåde til fremstilling af phenylhydrazider. | |
| DK137006B (da) | Fremgangsmåde til fremstilling af 1-chlor-3-methyl-2-buten. | |
| DK125790B (da) | Fremgangsmåde til fremstilling af L-β-3,4-dihydroxyphenyl-α-alanin. | |
| DK126186B (da) | Fremgangsmåde til fremstilling af 13β-alkylgona-4,9-diener. | |
| BE764783A (fr) | (1-beta-alanyl, 15-ornithyl)-corticotropines peptidiques | |
| DK127930B (da) | Fremgangsmåde til fremstilling af zearalenon. |