DK127102B - Fremgangsmåde til fremstilling af 1-nitroanthraquinon. - Google Patents
Fremgangsmåde til fremstilling af 1-nitroanthraquinon.Info
- Publication number
- DK127102B DK127102B DK40771AA DK40771A DK127102B DK 127102 B DK127102 B DK 127102B DK 40771A A DK40771A A DK 40771AA DK 40771 A DK40771 A DK 40771A DK 127102 B DK127102 B DK 127102B
- Authority
- DK
- Denmark
- Prior art keywords
- nitroanthraquinone
- preparation
- Prior art date
Links
- YCANAXVBJKNANM-UHFFFAOYSA-N 1-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] YCANAXVBJKNANM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/45—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group
- C07C205/46—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by at least one doubly—bound oxygen atom, not being part of a —CHO group the carbon skeleton containing carbon atoms of quinone rings
- C07C205/47—Anthraquinones containing nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C201/00—Preparation of esters of nitric or nitrous acid or of compounds containing nitro or nitroso groups bound to a carbon skeleton
- C07C201/06—Preparation of nitro compounds
- C07C201/08—Preparation of nitro compounds by substitution of hydrogen atoms by nitro groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/22—Ortho- or ortho- and peri-condensed systems containing three rings containing only six-membered rings
- C07C2603/24—Anthracenes; Hydrogenated anthracenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH131070A CH526484A (de) | 1970-01-30 | 1970-01-30 | Verfahren zur Herstellung von 1-Nitroanthrachinonen |
| CH1274170 | 1970-08-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK127102B true DK127102B (da) | 1973-09-24 |
Family
ID=25687282
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK40771AA DK127102B (da) | 1970-01-30 | 1971-01-29 | Fremgangsmåde til fremstilling af 1-nitroanthraquinon. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3836546A (esLanguage) |
| AU (1) | AU2470071A (esLanguage) |
| BE (1) | BE761865A (esLanguage) |
| DE (1) | DE2103360A1 (esLanguage) |
| DK (1) | DK127102B (esLanguage) |
| ES (1) | ES387713A1 (esLanguage) |
| FR (1) | FR2077087A5 (esLanguage) |
| GB (1) | GB1324061A (esLanguage) |
| NL (1) | NL7101122A (esLanguage) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2256644C2 (de) * | 1972-11-18 | 1983-10-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von reinem 1-Nitro-anthrachinon |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU473703B2 (en) * | 1971-06-10 | 1976-07-01 | Sandoz Patents Limited | Nitration process for nitrating anthraquinone |
| BE794823A (fr) * | 1972-02-01 | 1973-07-31 | Sandoz Sa | Procede de purification de la 1-nitroanthraquinone |
-
1971
- 1971-01-14 GB GB192071A patent/GB1324061A/en not_active Expired
- 1971-01-14 US US00106594A patent/US3836546A/en not_active Expired - Lifetime
- 1971-01-21 BE BE761865A patent/BE761865A/xx unknown
- 1971-01-26 AU AU24700/71A patent/AU2470071A/en not_active Expired
- 1971-01-26 DE DE19712103360 patent/DE2103360A1/de active Granted
- 1971-01-28 FR FR7102803A patent/FR2077087A5/fr not_active Expired
- 1971-01-28 NL NL7101122A patent/NL7101122A/xx unknown
- 1971-01-28 ES ES387713A patent/ES387713A1/es not_active Expired
- 1971-01-29 DK DK40771AA patent/DK127102B/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3836546A (en) | 1974-09-17 |
| FR2077087A5 (esLanguage) | 1971-10-15 |
| ES387713A1 (es) | 1974-01-01 |
| BE761865A (fr) | 1971-07-01 |
| DE2103360A1 (de) | 1971-08-05 |
| AU2470071A (en) | 1972-07-27 |
| NL7101122A (esLanguage) | 1971-08-03 |
| GB1324061A (en) | 1973-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134601B (da) | Analogifremgangsmåde til fremstilling af benzylimidazolidioner. | |
| DK129339B (da) | Analogifremgangsmåde til fremstilling af N-aminophenylamidiner. | |
| DK135455B (da) | Fremgangsmåde til fremstilling af 7-halogen-7-desoxythiolincosaminider. | |
| DK134489B (da) | Fremgangsmåde til fremstilling af alkyl-7-desoxy-7(S)-substituerede-alfa-thiolincosaminider. | |
| DK130467B (da) | Fremgangsmåde til fremstilling af erythromycylaminer. | |
| DK136975B (da) | Analogifremgangsmåde til fremstilling af phenazinderivater. | |
| DK127977B (da) | Fremgangsmåde til fremstilling af 6α-methyl-19-nor-pregnener. | |
| DK126998B (da) | Analogifremgangsmåde til fremstilling af amino-s-triazolylbenzensulfonamidforbindelser. | |
| DK128205B (da) | Fremgangsmåde til fremstilling af 1-aryloxy-2-propanoler. | |
| DK129453B (da) | Analogifremgangsmåde til fremstilling af 1-aminoisoquinoliner. | |
| DK126323B (da) | Fremgangsmåde til fremstilling af 3β-hydroxy-5α-cardenolider eller -bufadienolider. | |
| DK137181B (da) | Analogifremgangsmåde til fremstilling af 3-amino-kinolinderivater. | |
| DK135425B (da) | Analogifremgangsmåde til fremstilling af 2-imidazolidonderivater. | |
| DK133682B (da) | Analogifremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-pregn-1-en-20-oner eller 3alfa-hydroxy-17beta-alkoxykarbonyl-5alfa-androst-1-ener. | |
| DK125388B (da) | Fremgangsmåde til fremstilling af phenylaminoethanolderivater. | |
| DK137860B (da) | Analogifremgangsmåde til fremstilling af triazolobenzodiazepin-5N-oxydderivater. | |
| DK131786B (da) | Fremgangsmåde til fremstilling af delta4-3-oxo-1alfa-methylsteroider. | |
| DK122456B (da) | Fremgangsmåde til fremstilling af quinoxalin-di-N-oxid-aldehyd. | |
| DK129138B (da) | Fremgangsmåde til fremstilling af tuberactinomycin-N. | |
| DK127852B (da) | Analogifremgangsmåde til fremstilling af 22-substituerede cardenolidrhamnosider. | |
| DK127414B (da) | Analogifremgangsmåde til fremstilling af phenylhydrazider. | |
| DK127102B (da) | Fremgangsmåde til fremstilling af 1-nitroanthraquinon. | |
| DK128209B (da) | Analogifremgangsmåde til fremstilling af 19-nor-14-dehydrotestosteronderivater. | |
| DK129049B (da) | Analogifremgangsmåde til fremstilling af α-aminobenzylpenicillinderivater. | |
| DK131568B (da) | Fremgangsmåde til fremstilling af oxaziridiner. |