DK125390B - Analogifremgangsmåde til fremstilling af amidoxim-O-(N-alkylcabamater) eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af amidoxim-O-(N-alkylcabamater) eller syreadditionssalte deraf.Info
- Publication number
- DK125390B DK125390B DK6170AA DK6170A DK125390B DK 125390 B DK125390 B DK 125390B DK 6170A A DK6170A A DK 6170AA DK 6170 A DK6170 A DK 6170A DK 125390 B DK125390 B DK 125390B
- Authority
- DK
- Denmark
- Prior art keywords
- alkylcabamates
- amidoxime
- preparation
- acid addition
- addition salts
- Prior art date
Links
- 239000002253 acid Substances 0.000 title 1
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/60—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups having oxygen atoms of carbamate groups bound to nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US78995969A | 1969-01-08 | 1969-01-08 | |
| US88473769A | 1969-12-12 | 1969-12-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK125390B true DK125390B (da) | 1973-02-12 |
Family
ID=27120978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK6170AA DK125390B (da) | 1969-01-08 | 1970-01-07 | Analogifremgangsmåde til fremstilling af amidoxim-O-(N-alkylcabamater) eller syreadditionssalte deraf. |
Country Status (12)
| Country | Link |
|---|---|
| AR (1) | AR192723A1 (enExample) |
| BE (1) | BE743784A (enExample) |
| CH (1) | CH534135A (enExample) |
| DE (1) | DE2000492B2 (enExample) |
| DK (1) | DK125390B (enExample) |
| ES (2) | ES375236A1 (enExample) |
| FR (1) | FR2034457B1 (enExample) |
| GB (1) | GB1244592A (enExample) |
| IL (1) | IL33612A (enExample) |
| LU (1) | LU60149A1 (enExample) |
| NL (1) | NL7000156A (enExample) |
| SE (1) | SE350032B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA731406B (en) * | 1972-04-18 | 1974-10-30 | Du Pont | New antihypertensive agents |
| NL7908922A (nl) * | 1979-12-12 | 1981-07-16 | Akzo Nv | Carboximidamide derivaten. |
-
1969
- 1969-12-26 IL IL33612A patent/IL33612A/en unknown
- 1969-12-29 BE BE743784D patent/BE743784A/xx not_active IP Right Cessation
-
1970
- 1970-01-06 CH CH6170A patent/CH534135A/de not_active IP Right Cessation
- 1970-01-07 GB GB885/70A patent/GB1244592A/en not_active Expired
- 1970-01-07 DE DE19702000492 patent/DE2000492B2/de active Pending
- 1970-01-07 DK DK6170AA patent/DK125390B/da unknown
- 1970-01-07 LU LU60149D patent/LU60149A1/xx unknown
- 1970-01-07 ES ES375236A patent/ES375236A1/es not_active Expired
- 1970-01-07 SE SE00113/70A patent/SE350032B/xx unknown
- 1970-01-07 NL NL7000156A patent/NL7000156A/xx unknown
- 1970-01-08 FR FR707000586A patent/FR2034457B1/fr not_active Expired
-
1971
- 1971-10-20 AR AR238570A patent/AR192723A1/es active
- 1971-11-26 ES ES397400A patent/ES397400A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH534135A (de) | 1973-02-28 |
| GB1244592A (en) | 1971-09-02 |
| DE2000492A1 (de) | 1970-07-16 |
| ES375236A1 (es) | 1972-08-01 |
| FR2034457A1 (enExample) | 1970-12-11 |
| DE2000492B2 (de) | 1976-03-04 |
| NL7000156A (enExample) | 1970-07-10 |
| IL33612A0 (en) | 1970-03-22 |
| BE743784A (enExample) | 1970-05-28 |
| AR192723A1 (es) | 1973-03-14 |
| ES397400A1 (es) | 1975-03-16 |
| IL33612A (en) | 1973-06-29 |
| SE350032B (enExample) | 1972-10-16 |
| LU60149A1 (enExample) | 1970-03-09 |
| FR2034457B1 (enExample) | 1973-04-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134984B (da) | Analogifremgangsmåde til fremstilling af alfa-alkylaminopropiophenoner eller syreadditionssalte heraf. | |
| DK124884B (da) | Analogifremgangsmåde til fremstilling af 2-brom-α-ergokryptin eller syreadditionssalte deraf. | |
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK125417B (da) | Analogifremgangsmåde til fremstilling af amino-dihalogenphenylethylaminer eller syreadditionssalte deraf. | |
| DK139717B (da) | Analogifremgangsmåde til fremstilling af beta-aryl-2-aminoalkoxystyroler eller syreadditionssalte heraf. | |
| DK129581B (da) | Analogifremgangsmåde til fremstilling af substituerede N-allyl-2-arylamino-imidazolin-(2)-forbindelser eller syreadditionssalte deraf. | |
| DK135278B (da) | Analogifremgangsmåde til fremstilling af fenoksyisopropanolaminderivater eller syreadditionssalte deraf. | |
| DK136526B (da) | Analogifremgangsmåde til fremstilling af substituerede naphthylalkylaminer eller syreadditionssalte deraf. | |
| DK130410B (da) | Fremgangsmåde til fremstilling af substituerede N-aminoalkyl-arylaminoimidazolin-(2)-forbindelser eller syreadditionssalte deraf. | |
| DK129577B (da) | Analogifremgangsmåde til fremstilling af phenacetylguanidiner eller syreadditionssalte deraf. | |
| DK127644B (da) | Analogifremgangsmåde til fremstilling af ergopeptiner eller syreadditionssalte deraf. | |
| DK125245B (da) | Fremgangsmåde til fremstilling af γpiperidinobutyrophenonderivater eller syreadditionssalte deraf. | |
| DK138015B (da) | Fremgangsmåde til fremstilling af substituerede N-cycloalkyl-arylamino-imidazoliner-(2) eller syreadditionssalte deraf. | |
| DK125472B (da) | Analogifremgangsmåde til fremstilling af pyrimidopyridazinderivater eller syreadditionssalte deraf. | |
| DK120155B (da) | Analogifremgangsmåde til fremstilling af aminopropiofenoner eller syreadditionssalte deraf. | |
| DK126426B (da) | Analogifremgangsmåde til fremstilling af hydroxylaminderivater eller syreadditionssalte deraf. | |
| DK129454B (da) | Analogifremgangsmåde til fremstilling af ergonorcornin eller syreadditionssalte deraf. | |
| DK127424B (da) | Analogifremgangsmåde til fremstilling af 4-aryl-1-(4,4-diarylbutyl)-4-hydroxypiperidiner eller syreadditionssalte deraf. | |
| DK136151B (da) | Analogifremgangsmåde til fremstilling af basisk substituerede tertiære butanoler eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK134014B (da) | Analogifremgangsmåde til fremstilling af cycloalkyllactamimider eller syreadditionssalte deraf. | |
| DK131727B (da) | Analogifremgangsmåde til fremstilling af oxazinobenzoxaziner eller syreadditionssalte deraf. | |
| DK125390B (da) | Analogifremgangsmåde til fremstilling af amidoxim-O-(N-alkylcabamater) eller syreadditionssalte deraf. | |
| DK134023B (da) | Analogifremgangsmåde til fremstilling af acyloxypiperazinylforbindelser eller syreadditionssalte deraf. | |
| DK130830B (da) | Analogifremgangsmåde til fremstilling af diphenylmethoxyethylaminer eller syreadditionssalte deraf. |