DK122275B - Fremgangsmåde til fremstilling af 17α-ætynyl-17β-hydroksysteroider af androstan- eller østranrækken. - Google Patents
Fremgangsmåde til fremstilling af 17α-ætynyl-17β-hydroksysteroider af androstan- eller østranrækken.Info
- Publication number
- DK122275B DK122275B DK187367AA DK187367A DK122275B DK 122275 B DK122275 B DK 122275B DK 187367A A DK187367A A DK 187367AA DK 187367 A DK187367 A DK 187367A DK 122275 B DK122275 B DK 122275B
- Authority
- DK
- Denmark
- Prior art keywords
- hydroxysteroids
- androstane
- ethynyl
- preparation
- oestrane series
- Prior art date
Links
- QZLYKIGBANMMBK-UGCZWRCOSA-N 5α-Androstane Chemical compound C([C@@H]1CC2)CCC[C@]1(C)[C@@H]1[C@@H]2[C@@H]2CCC[C@@]2(C)CC1 QZLYKIGBANMMBK-UGCZWRCOSA-N 0.000 title 1
- GRXPVLPQNMUNNX-MHJRRCNVSA-N estrane Chemical class C1CC2CCCC[C@@H]2[C@@H]2[C@@H]1[C@@H]1CCC[C@@]1(C)CC2 GRXPVLPQNMUNNX-MHJRRCNVSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/36—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal
- C07C29/38—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones
- C07C29/42—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring increasing the number of carbon atoms by reactions with formation of hydroxy groups, which may occur via intermediates being derivatives of hydroxy, e.g. O-metal by reaction with aldehydes or ketones with compounds containing triple carbon-to-carbon bonds, e.g. with metal-alkynes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/40—Ortho- or ortho- and peri-condensed systems containing four condensed rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Steroid Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US54081566A | 1966-04-07 | 1966-04-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK122275B true DK122275B (da) | 1972-02-14 |
Family
ID=24157045
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK187367AA DK122275B (da) | 1966-04-07 | 1967-03-31 | Fremgangsmåde til fremstilling af 17α-ætynyl-17β-hydroksysteroider af androstan- eller østranrækken. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3470217A (enExample) |
| CH (1) | CH490358A (enExample) |
| DE (1) | DE1618868C3 (enExample) |
| DK (1) | DK122275B (enExample) |
| GB (1) | GB1176229A (enExample) |
| NL (1) | NL6704744A (enExample) |
| SE (1) | SE337588B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4614621A (en) * | 1984-04-20 | 1986-09-30 | The Upjohn Company | Ethynylation of 16-methylene-17-keto steroids |
| US4618456A (en) * | 1984-03-20 | 1986-10-21 | The Upjohn Company | Ethynylation of 16-methyl-17-keto steroids |
| CN107955052B (zh) | 2011-12-23 | 2024-07-05 | 晶体制药独资有限公司 | 炔基化16-取代-17-酮基类固醇的方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2806030A (en) * | 1954-03-20 | 1957-09-10 | Syntex Sa | Cyclopentanophenanthrene derivatives and process for the preparation thereof |
| US2888471A (en) * | 1955-03-25 | 1959-05-26 | Syntex Sa | Process for preparing 17alpha-ethinyl-delta1, 4-androstadiene-17 beta-ol-3-one |
| NL123455C (enExample) * | 1964-05-13 |
-
1966
- 1966-04-07 US US540815A patent/US3470217A/en not_active Expired - Lifetime
-
1967
- 1967-03-31 DK DK187367AA patent/DK122275B/da unknown
- 1967-04-04 NL NL6704744A patent/NL6704744A/xx unknown
- 1967-04-04 GB GB05411/67A patent/GB1176229A/en not_active Expired
- 1967-04-06 SE SE04814/67A patent/SE337588B/xx unknown
- 1967-04-06 DE DE1618868A patent/DE1618868C3/de not_active Expired
- 1967-04-07 CH CH495267A patent/CH490358A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1176229A (en) | 1970-01-01 |
| DE1618868C3 (de) | 1973-10-11 |
| DE1618868A1 (de) | 1972-07-06 |
| DE1618868B2 (de) | 1973-03-08 |
| US3470217A (en) | 1969-09-30 |
| SE337588B (enExample) | 1971-08-16 |
| CH490358A (de) | 1970-05-15 |
| NL6704744A (enExample) | 1967-10-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK133618B (da) | Analogifremgangsmåde til fremstilling af 1-hydroxyaryl-2-aminoalkanoler. | |
| DK117896B (da) | Analogifremgangsmåde til fremstilling af 17-estere af 21-desoxyprednisolon. | |
| DK129701B (da) | Fremgangsmåde til fremstilling af steroider af androstanrækken. | |
| DK124886B (da) | Fremgangsnmåde til fremstilling af 1-hydroxy-benzimidazol-N-oxider. | |
| DK117954B (da) | Fremgangsmåde til fremstilling af 3-amino-2-cyanoacrylamid. | |
| DK120540B (da) | Fremgangsmåde til fremstilling af 17α-alkynyl-17β-acyloxysteroider af androstan- eller estranrækken. | |
| DK129004B (da) | Analogifremgangsmåde til fremstilling af 9α-usubstituerede 11β-klor-19-norsteroider af østran- eller 19-norpregnanrækken. | |
| DK122275B (da) | Fremgangsmåde til fremstilling af 17α-ætynyl-17β-hydroksysteroider af androstan- eller østranrækken. | |
| DK115551B (da) | Fremgangsmåde til fremstilling af 6-aminouracil-5-carbonamid-N-sulfonamider. | |
| DK122882B (da) | Fremgangsmåde til fremstilling af kawain eller methysticin. | |
| DK119657B (da) | Fremgangsmåde til fremstilling af 17α-acyloxy-21-hydroxy-steroider af pregnanrækken. | |
| DK127107B (da) | Fremgangsmåde til fremstilling af 17α-propadienyl-17β-hydroxy-steroider. | |
| DK114063B (da) | Fremgangsmåde til fremstilling af 1-methyl-2-isopropyl-5-nitro-imidazol. | |
| DK120344B (da) | Fremgangsmåde til fremstilling af 5-benzyl-pyrimidiner. | |
| DK122761B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylurinstofderivater. | |
| DK119830B (da) | Analogifremgangsmåde til fremstilling af arylsulfonylsemicarbazider. | |
| DK126378B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-9α-chlor-11β-hydroxy-progesteroner. | |
| DK114626B (da) | Fremgangsmåde til fremstilling af 2-substitueret-4-amino-5-acylamidometylpyrimidin. | |
| DK131820B (da) | Analogifremgangsmåde til fremstilling af 4-aminoquinazoliner eller 1-aminoisoquinoliner. | |
| DK121165B (da) | Fremgangsmåde til fremstilling af 1-aminoalkyl-1-arylindenar eller 3-aminoalkyl-3-arylindan-1-oler. | |
| DK128241B (da) | Fremgangsmåde til fremstilling af 18-methylensteroider af pregnan- eller 19-nor-pregnanrækken. | |
| DK118944B (da) | Fremgangsmåde til fremstilling af 17α-acyloxysteroider af pregnanrækken. | |
| DK119210C (da) | Analogifremgangsmåde til fremstilling af ketoximethere. | |
| DK121166B (da) | Analogifremgangsmåde til fremstilling af 16-methyl-4-pregnen-3β-ol-20-oner. | |
| DK123866B (da) | Fremgangsmåde til fremstilling af 17-ethyliden-steroider eller 17-ethyliden-desA-steroider. |