DK120198B - Fremgangsmåde til fremstilling af kunstgødning til korn ud fra dolomit og phosphorsyre eller superphosphater. - Google Patents
Fremgangsmåde til fremstilling af kunstgødning til korn ud fra dolomit og phosphorsyre eller superphosphater.Info
- Publication number
- DK120198B DK120198B DK195968AA DK195968A DK120198B DK 120198 B DK120198 B DK 120198B DK 195968A A DK195968A A DK 195968AA DK 195968 A DK195968 A DK 195968A DK 120198 B DK120198 B DK 120198B
- Authority
- DK
- Denmark
- Prior art keywords
- superphosphates
- dolomite
- cereals
- fertilizers
- production
- Prior art date
Links
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 title 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 title 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical class [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 title 1
- 235000013339 cereals Nutrition 0.000 title 1
- 229910000514 dolomite Inorganic materials 0.000 title 1
- 239000010459 dolomite Substances 0.000 title 1
- 239000003337 fertilizer Substances 0.000 title 1
- 239000002426 superphosphate Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B3/00—Fertilisers based essentially on di-calcium phosphate
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE6124/67*A SE310370B (cs) | 1967-04-28 | 1967-04-28 | |
| SE16925/67A SE328317B (cs) | 1967-12-08 | 1967-12-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK120198B true DK120198B (da) | 1971-04-26 |
Family
ID=26654687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK195968AA DK120198B (da) | 1967-04-28 | 1968-04-26 | Fremgangsmåde til fremstilling af kunstgødning til korn ud fra dolomit og phosphorsyre eller superphosphater. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3573893A (cs) |
| AT (1) | AT281880B (cs) |
| BE (1) | BE713622A (cs) |
| DE (1) | DE1767329A1 (cs) |
| DK (1) | DK120198B (cs) |
| ES (1) | ES353512A1 (cs) |
| FR (1) | FR1562506A (cs) |
| GB (1) | GB1207612A (cs) |
| IE (1) | IE32126B1 (cs) |
| NL (1) | NL140502B (cs) |
| NO (1) | NO118070B (cs) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2396730A1 (fr) * | 1977-07-07 | 1979-02-02 | Samm A Sarl | Engrais organo-biologique |
| EP0084196A3 (en) * | 1981-12-30 | 1983-08-03 | Engrais Rosier | Fertilisers in suspension and their preparation |
| DE4132620C2 (de) * | 1991-10-01 | 1994-07-28 | Pro Mineral Ges | Verfahren zur Herstellung eines Düngemittels |
| FI117973B (fi) * | 2001-04-17 | 2007-05-15 | Kemira Growhow Oyj | Parannettu metsälannoite |
| AU2002301717B2 (en) * | 2002-10-01 | 2011-02-10 | Calix Limited | Dolomite Based Quick Release Organic Broad Acre Fertiliser |
| CA2626497C (en) | 2005-10-21 | 2018-05-15 | Calix Pty Ltd. | A material compound comprising a solid solution of mgo and caco3 and a method of fabricating the same |
| AU2006303830B2 (en) * | 2005-10-21 | 2010-12-09 | Calix Limited | A material compound and a method of fabricating the same |
| CN101466461B (zh) | 2006-03-31 | 2012-06-20 | Calix有限公司 | 用于矿物煅烧的系统和方法 |
-
1968
- 1968-04-04 IE IE393/68A patent/IE32126B1/xx unknown
- 1968-04-05 GB GB06503/68A patent/GB1207612A/en not_active Expired
- 1968-04-12 BE BE713622D patent/BE713622A/xx unknown
- 1968-04-15 US US721166A patent/US3573893A/en not_active Expired - Lifetime
- 1968-04-23 FR FR1562506D patent/FR1562506A/fr not_active Expired
- 1968-04-25 ES ES353512A patent/ES353512A1/es not_active Expired
- 1968-04-26 DK DK195968AA patent/DK120198B/da unknown
- 1968-04-27 NO NO1641/68A patent/NO118070B/no unknown
- 1968-04-27 DE DE19681767329 patent/DE1767329A1/de active Pending
- 1968-04-29 NL NL686806085A patent/NL140502B/xx unknown
- 1968-04-29 AT AT414568A patent/AT281880B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| FR1562506A (cs) | 1969-04-04 |
| US3573893A (en) | 1971-04-06 |
| DE1767329A1 (de) | 1972-04-13 |
| GB1207612A (en) | 1970-10-07 |
| IE32126L (en) | 1968-10-28 |
| ES353512A1 (es) | 1969-10-01 |
| NO118070B (cs) | 1969-11-03 |
| IE32126B1 (en) | 1973-04-18 |
| NL6806085A (cs) | 1968-10-29 |
| NL140502B (nl) | 1973-12-17 |
| BE713622A (cs) | 1968-08-16 |
| AT281880B (de) | 1970-06-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK117064B (da) | Fremgangsmåde til fremstilling af dicalciumphosphatdihydrat. | |
| DK117289B (da) | Kontinuerlig fremgangsmåde til fremstilling af phosphorsyre. | |
| DK120198B (da) | Fremgangsmåde til fremstilling af kunstgødning til korn ud fra dolomit og phosphorsyre eller superphosphater. | |
| BG20328A3 (bg) | Метод за получаване на стабилизирани амониево-нитратни-калциево карбонатни торове | |
| DK116601B (da) | Fremgangsmåde til fremstilling af gødningsmidler bestående af alkalipyrophosphater. | |
| DK133143C (da) | Fremgangsmade til fremstilling af godningsjord | |
| DK121162B (da) | Fremgangsmåde til fremstilling af phosphorsyre og gips. | |
| DK113296B (da) | Fremgangsmåde til fremstilling af kalium- og fosforholdig kunstgødning af råfosfat og kaliumklorid. | |
| DK136858B (da) | Fremgangsmåde til fremstilling af aliphatiske delta-hydroxycarboxylsyreestere. | |
| DK116795B (da) | Fremgangsmåde til fremstilling af γ-chloraceteddikesyreestere. | |
| DK131850B (da) | Fremgangsmåde og anlæg til fremstilling af phosphorpentasulfid. | |
| DK121827B (da) | Fremgangsmåde til mindskelse af toksiciteten over for varmblodede dyr af dithiophosphorsyreestere. | |
| DK130303B (da) | 2-Chlorethan-(thiono)-phosphonsyre-derivater med plantevækstregulerende virkning. | |
| DK131110B (da) | Anlæg til svovlsyreproduktion. | |
| AT281081B (de) | Verfahren zur Herstellung von granulierten Düngemitteln | |
| FI52845C (fi) | Metsäkasveille tarkoitettu lannoitetabletti | |
| DK139725B (da) | Fremgangsmåde til fremstilling af delta2-cephem-4-carboxylsyreestere. | |
| DK121903B (da) | Fremgangsmåde til fremstilling af N-carbonhydridsubstituerede N-isocyanatomethyl-carbaminsyreestere eller thioanaloge deraf. | |
| DK116369B (da) | Fremgangsmåde til fremstilling af cycliske thiono- eller thionothiolphosphorsyreestere. | |
| DK119454B (da) | Fremgangsmåde til fremstilling af phosphorsyre ad våd vej og anlæg til fremgangsmådens udførelse. | |
| AT284172B (de) | Verfahren zur Herstellung von körnigen, Ammoniumphosphat enthaltenden Düngemiteln | |
| DK111569B (da) | Fremgangsmåde til fremstilling af heterocycliske thionothiolphosphor- eller -phosphonsyreestere. | |
| DK82929C (da) | Fremgangsmåde til fremstilling af dimethylthiolphosphorsyreestere. | |
| DK86713C (da) | Fremgangsmåde til fremstilling af phosphorsyre- eller thionophosphorsyreestere. | |
| DK126035B (da) | Analogifremgangsmåde til fremstilling af karbaminsyreestere. |