DK117424B - Fremgangsmåde til fremstilling af 2,4,5-trichlorpyrimidin og 2,4,5,6-tetrachlorpyrimidin. - Google Patents
Fremgangsmåde til fremstilling af 2,4,5-trichlorpyrimidin og 2,4,5,6-tetrachlorpyrimidin.Info
- Publication number
- DK117424B DK117424B DK556767AA DK556767A DK117424B DK 117424 B DK117424 B DK 117424B DK 556767A A DK556767A A DK 556767AA DK 556767 A DK556767 A DK 556767A DK 117424 B DK117424 B DK 117424B
- Authority
- DK
- Denmark
- Prior art keywords
- tetrachloropyrimidine
- trichloropyrimidine
- preparation
- Prior art date
Links
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 title 1
- GIKMWFAAEIACRF-UHFFFAOYSA-N 2,4,5-trichloropyrimidine Chemical compound ClC1=NC=C(Cl)C(Cl)=N1 GIKMWFAAEIACRF-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF0052633 | 1967-06-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK117424B true DK117424B (da) | 1970-04-27 |
Family
ID=7105602
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK556767AA DK117424B (da) | 1967-06-08 | 1967-11-08 | Fremgangsmåde til fremstilling af 2,4,5-trichlorpyrimidin og 2,4,5,6-tetrachlorpyrimidin. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3506551A (OSRAM) |
| AT (1) | AT276399B (OSRAM) |
| BE (1) | BE706761A (OSRAM) |
| CH (1) | CH505114A (OSRAM) |
| DK (1) | DK117424B (OSRAM) |
| ES (1) | ES346898A1 (OSRAM) |
| GB (1) | GB1153096A (OSRAM) |
| NL (1) | NL6715445A (OSRAM) |
| NO (1) | NO120992B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2307863A1 (de) * | 1973-02-17 | 1974-08-22 | Bayer Ag | Verfahren zur herstellung von chlorpyrimidinen |
| US3997554A (en) * | 1975-03-05 | 1976-12-14 | The Dow Chemical Company | N,N-di(carbonyl chlorides) of N,N'-alkylene ureas |
| DE2725888A1 (de) * | 1977-06-08 | 1978-12-21 | Bayer Ag | Verfahren zur herstellung von 2,4,5-trichlorpyrimidin |
| US20060282051A1 (en) * | 2005-06-13 | 2006-12-14 | Susan Reichheld | Surgical towel having radiopaque element and methods for making same |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1164418B (de) * | 1960-11-26 | 1964-03-05 | Basf Ag | Verfahren zur Herstellung heterocyclischer Chlorverbindungen |
-
1967
- 1967-10-23 CH CH1478567A patent/CH505114A/de not_active IP Right Cessation
- 1967-10-26 GB GB48688/67A patent/GB1153096A/en not_active Expired
- 1967-10-27 AT AT972267A patent/AT276399B/de active
- 1967-10-31 US US679553A patent/US3506551A/en not_active Expired - Lifetime
- 1967-11-08 ES ES346898A patent/ES346898A1/es not_active Expired
- 1967-11-08 DK DK556767AA patent/DK117424B/da unknown
- 1967-11-14 NL NL6715445A patent/NL6715445A/xx unknown
- 1967-11-20 BE BE706761D patent/BE706761A/xx unknown
- 1967-11-22 NO NO170634A patent/NO120992B/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH505114A (de) | 1971-03-31 |
| BE706761A (OSRAM) | 1968-05-20 |
| DE1670877B2 (de) | 1975-08-07 |
| US3506551A (en) | 1970-04-14 |
| AT276399B (de) | 1969-11-25 |
| GB1153096A (en) | 1969-05-21 |
| NO120992B (OSRAM) | 1971-01-04 |
| ES346898A1 (es) | 1969-01-16 |
| NL6715445A (OSRAM) | 1968-12-09 |
| DE1670877A1 (de) | 1971-02-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK118660B (da) | Analogifremgangsmåde til fremstilling af 1-(3',4'-dimethoxyphenyl)-3-methyl-4-ethyl-6,7-dimethoxy-isoquinolin-N-imid. | |
| DK115114B (da) | Fremgangsmåde til fremstilling af bakteriostatisk og fungistatisk virksomme 1,2,3,4-tetrahydro-9-aminoacridiner. | |
| DK120546B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidiner. | |
| DK117312B (da) | Heterofilamenter og fremgangsmåde til fremstilling af samme. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK129234B (da) | Fremgangsmåde til fremstilling af levo-1-n-butyl-2',6'-pipecoloxylidid. | |
| DK120590B (da) | Fremgangsmåde til fremstilling af 1-(2-tetralyl)-4-fenylbutan, 1,2,3,4,5,6,7,8-oktahydroantracen og 1,2,3,4,5,6,7,8-oktahydrofenantren udfra tetralin. | |
| DK117424B (da) | Fremgangsmåde til fremstilling af 2,4,5-trichlorpyrimidin og 2,4,5,6-tetrachlorpyrimidin. | |
| DK123232B (da) | Analogifremgangsmåde til fremstilling af 3-alkoxy-17α-propinylestra-1,3,5(10)-trien-17β-oler. | |
| DK123239B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydro-4,4-dialkylquinazoliner. | |
| DK127553B (da) | Fremgangsmåde til fremstilling af susbstituerede salicylanilider og thiosalicylanilider. | |
| DK119166B (da) | Fremgangsmåde til fremstilling af 1,4-bezodiazepinderivater. | |
| DK122129B (da) | Analogifremgangsmåde til fremstilling af N,N'-dialkyl-4-phenylimidazolin-2-thioner. | |
| DK115184B (da) | Fremgangsmåde til fremstilling af 6,7-benzomorphaner. | |
| DK126936B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK124882B (da) | Analogifremgangsmåde til fremstilling af 17α-acyloxy-11β-methyl-19-norpregn-4-en-3,20-dioner. | |
| DK116594B (da) | Fremgangsmåde til fremstilling af 4,1,5-benzoxadiazociner. | |
| DK123818B (da) | Fremgangsmåde til fremstilling af 14β-hydroxy-card-20(22)-enolider eller -bufa-20,20-dienolider. | |
| DK114962B (da) | Fremgangsmåde til fremstilling af α, α, α', α'-tetramethyl-xylylen-dicarbinoler. | |
| DK131994B (da) | Analogifremgangsmåde til fremstilling af 6alfa,9alfa-difluorprednisolon 17, 21-diestere. | |
| DK129842B (da) | Fremgangsmåde til fremstilling af 3-imino-1,2-benzisothiazoliner. | |
| DK121440B (da) | Analogifremgangsmåde til fremstilling af 2,4-bis-morpholino- eller-thiomorpholino-5-carbalkoxy-pyrimidiner. | |
| DK120994B (da) | Analogifremgangsmåde til fremstilling af N,N-dimethylaminoætyl-14β-hydroksy-5β-pregn-20-en-21-karboksylater. | |
| DK135310B (da) | Analogifremgangsmåde til fremstilling af 1-(2-ethinylphenoxy)-2-hydroxy-3-butylaminopropaner. | |
| DK137494B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater. |