DK115632B - Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol. - Google Patents
Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol.Info
- Publication number
- DK115632B DK115632B DK77867AA DK77867A DK115632B DK 115632 B DK115632 B DK 115632B DK 77867A A DK77867A A DK 77867AA DK 77867 A DK77867 A DK 77867A DK 115632 B DK115632 B DK 115632B
- Authority
- DK
- Denmark
- Prior art keywords
- benzofuranol
- dihydro
- dimethyl
- preparation
- Prior art date
Links
- WJGPNUBJBMCRQH-UHFFFAOYSA-N 2,2-dimethyl-2,3-dihydro-1-benzofuran-7-ol Chemical compound C1=CC(O)=C2OC(C)(C)CC2=C1 WJGPNUBJBMCRQH-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/79—Benzo [b] furans; Hydrogenated benzo [b] furans with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/86—Benzo [b] furans; Hydrogenated benzo [b] furans with an oxygen atom directly attached in position 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US529268A US3419579A (en) | 1966-02-23 | 1966-02-23 | Synthesis of 2,3-dihydro-2,2-dimethyl-7-benzofuranol |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK115632B true DK115632B (da) | 1969-10-27 |
Family
ID=24109191
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK77867AA DK115632B (da) | 1966-02-23 | 1967-02-13 | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3419579A (enExample) |
| BE (1) | BE694120A (enExample) |
| CH (1) | CH500963A (enExample) |
| DE (1) | DE1593855B1 (enExample) |
| DK (1) | DK115632B (enExample) |
| FR (1) | FR1511399A (enExample) |
| GB (1) | GB1170333A (enExample) |
| IL (1) | IL27333A (enExample) |
| NL (1) | NL6702645A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4118400A (en) * | 1977-09-22 | 1978-10-03 | Fmc Corporation | Process for preparing 2,3-dihydro-7-benzofuranols and benzodioxole intermediate therefor |
| DE2932458A1 (de) * | 1979-08-10 | 1981-02-26 | Bayer Ag | Herstellung von monoalkylethern von hydroxyphenolen und deren umwandlung zu hydroxycumaranen |
| US4380654A (en) * | 1982-02-18 | 1983-04-19 | Fmc Corporation | Process for preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxybenzofuran |
| US7174823B2 (en) | 2004-09-22 | 2007-02-13 | Irwin Industrial Tool Company | Saw blade having increased tooth stiffness and resistance to fatigue failure |
| WO2022207123A1 (de) * | 2021-04-03 | 2022-10-06 | Symrise Ag | Herstellungsverfahren für polycyclische riechstoffe |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2937188A (en) * | 1951-11-15 | 1960-05-17 | Gen Aniline & Film Corp | 2-methyl 2, 3-dihydrobenzofurancarboxylic acids and acid halides |
| NL131921C (enExample) * | 1963-06-28 | |||
| US3474170A (en) * | 1964-01-23 | 1969-10-21 | Fmc Corp | Pesticidal carbamates of dihydrobenzofuranols |
| US3356690A (en) * | 1965-02-04 | 1967-12-05 | Fmc Corp | Synthesis of 2, 3-dihydro-2, 2-dimethyl-7-benzofuranyl nu-methylcarbamate |
-
1966
- 1966-02-23 US US529268A patent/US3419579A/en not_active Expired - Lifetime
-
1967
- 1967-01-26 IL IL27333A patent/IL27333A/xx unknown
- 1967-02-13 DK DK77867AA patent/DK115632B/da unknown
- 1967-02-14 FR FR94932A patent/FR1511399A/fr not_active Expired
- 1967-02-15 BE BE694120D patent/BE694120A/xx unknown
- 1967-02-16 GB GB7459/67A patent/GB1170333A/en not_active Expired
- 1967-02-21 NL NL6702645A patent/NL6702645A/xx unknown
- 1967-02-22 CH CH257467A patent/CH500963A/de not_active IP Right Cessation
- 1967-02-23 DE DE19671593855 patent/DE1593855B1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3419579A (en) | 1968-12-31 |
| BE694120A (enExample) | 1967-08-16 |
| DE1593855B1 (de) | 1972-04-27 |
| GB1170333A (en) | 1969-11-12 |
| FR1511399A (fr) | 1968-01-26 |
| CH500963A (de) | 1970-12-31 |
| NL6702645A (enExample) | 1967-08-24 |
| IL27333A (en) | 1970-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK106552C (da) | Fremgangsmåde til fremstilling af substituerede 6,7-benzomorphaner. | |
| DK120546B (da) | Fremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidiner. | |
| DK118877B (da) | Analogifremgangsmåde til fremstilling af 3,1-benzoxazin-2-oner. | |
| DK119005B (da) | Fremgangsmåde til fremstilling af 3-alkoxy-13-alkylgona-1,3,5(10),8,14-penten-17-oner. | |
| DK112523B (da) | Fremgangsmåde til fremstilling af 2,3-pyridindiol. | |
| DK118885B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol. | |
| DK115632B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2-dimethyl-7-benzofuranol. | |
| DK116656B (da) | Analogifremgangsmåde til fremstilling af 11-oxygenerede 3-(2'-chlorethylthio)-6-formyl-9α-fluor-3,5-pregnadien-20-oner. | |
| DK114839B (da) | Fremgangsmåde til fremstilling af 1,4-benzodioxanderivater. | |
| DK106328C (da) | Fremgangsmåde til fremstilling af 17α-alkoxy-16-methylen-3,20-diketopregnanderivater. | |
| DK121759B (da) | Analogifremgangsmåde til fremstilling af 3-oxo-7α-methylgona-4,9-diener. | |
| DK120347B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepin-4-oxider. | |
| DK116357B (da) | Fremgangsmåde til fremstilling af 1,1,1,2,2-pentafluor-3-chlorpropan. | |
| DK116736B (da) | Fremgangsmåde til fremstilling af 5-chlor-2,3-pyridindiol. | |
| DK115184B (da) | Fremgangsmåde til fremstilling af 6,7-benzomorphaner. | |
| DK116368B (da) | Fremgangsmåde til fremstilling af 2,3-dihydro-2,2,4-trimethyl-7-benzofuranol. | |
| DK120131B (da) | Fremgangsmåde til fremstilling af 3-oxo-13β-alkylgona-4,9,11-triener. | |
| DK115622B (da) | Fremgangsmåde til fremstilling af 3-oxogona-4,9,11-triener. | |
| DK118406B (da) | Fremgangsmåde til fremstilling af 3-alkynyloxy- og 3-alkenyloxy-4-sulfanilamido-1,2,5-thiadiazoler. | |
| DK127418B (da) | Fremgangsmåde til fremstilling af 13-alkyl-gona-1,3,5(10),6,8,14-hexaener. | |
| DK116594B (da) | Fremgangsmåde til fremstilling af 4,1,5-benzoxadiazociner. | |
| DK120949B (da) | Analogifremgangsmåde til fremstilling af ethere af 3-oxygenerede-13β-alkyl-17β-hydroxygona-4,9,11-triener. | |
| DK106329C (da) | Fremgangsmåde til fremstilling af 3,20-dioxo-19-nor-4,9,11-pregnatrien. | |
| DK123770B (da) | Analogifremgangsmåde til fremstilling af benzofuranderivater. | |
| DK117955B (da) | Analogifremgangsmåde til fremstilling af N<4>-acrylerede 1-halogenbenzen-2,4-disulfonamider. |