DK114904B - Fremgangsmåde til fremstilling af 3,5-diiodthyroniner. - Google Patents
Fremgangsmåde til fremstilling af 3,5-diiodthyroniner.Info
- Publication number
- DK114904B DK114904B DK609563AA DK609563A DK114904B DK 114904 B DK114904 B DK 114904B DK 609563A A DK609563A A DK 609563AA DK 609563 A DK609563 A DK 609563A DK 114904 B DK114904 B DK 114904B
- Authority
- DK
- Denmark
- Prior art keywords
- diiodothyronines
- preparation
- Prior art date
Links
- ZHSOTLOTTDYIIK-ZDUSSCGKSA-N (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodophenyl]propanoic acid Chemical class IC1=CC(C[C@H](N)C(O)=O)=CC(I)=C1OC1=CC=C(O)C=C1 ZHSOTLOTTDYIIK-ZDUSSCGKSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/14—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof
- C07C227/16—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing already amino and carboxyl groups or derivatives thereof by reactions not involving the amino or carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AT17363A AT243246B (de) | 1963-01-09 | 1963-01-09 | Verfahren zur Herstellung von racemischem oder optisch aktivem 3, 5-Dijodthyronin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK114904B true DK114904B (da) | 1969-08-18 |
Family
ID=3483501
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK609563AA DK114904B (da) | 1963-01-09 | 1963-12-30 | Fremgangsmåde til fremstilling af 3,5-diiodthyroniner. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3374269A (da) |
| AT (1) | AT243246B (da) |
| CH (1) | CH439328A (da) |
| DE (1) | DE1221646B (da) |
| DK (1) | DK114904B (da) |
| GB (1) | GB1040892A (da) |
| NL (2) | NL6400050A (da) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3477954A (en) * | 1966-06-29 | 1969-11-11 | Armour Pharma | Phosphonium iodide complexes of thyroxine,methods of preparing same,and methods of preparing 3,5,3'-l-triiodothyronine therefrom |
| EP3024326B1 (en) | 2013-07-24 | 2018-12-12 | Azico Biophore India Private Limited | Novel process for the preparation of levothyroxine sodium |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2895927A (en) * | 1957-07-05 | 1959-07-21 | Hoffmann La Roche | Synthesis of thyronine compounds |
-
0
- NL NL127987D patent/NL127987C/xx active
-
1963
- 1963-01-09 AT AT17363A patent/AT243246B/de active
- 1963-12-20 DE DES88831A patent/DE1221646B/de active Pending
- 1963-12-23 CH CH1584363A patent/CH439328A/de unknown
- 1963-12-30 DK DK609563AA patent/DK114904B/da unknown
-
1964
- 1964-01-02 GB GB246/64A patent/GB1040892A/en not_active Expired
- 1964-01-02 US US335387A patent/US3374269A/en not_active Expired - Lifetime
- 1964-01-07 NL NL6400050A patent/NL6400050A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CH439328A (de) | 1967-07-15 |
| NL6400050A (da) | 1964-07-10 |
| NL127987C (da) | |
| DE1221646B (de) | 1966-07-28 |
| GB1040892A (en) | 1966-09-01 |
| AT243246B (de) | 1965-10-25 |
| US3374269A (en) | 1968-03-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK106552C (da) | Fremgangsmåde til fremstilling af substituerede 6,7-benzomorphaner. | |
| DK108500C (da) | Fremgangsmåde til fremstilling af 1-glykosyl-5-azacytosiner. | |
| DK117957B (da) | Fremgangsmåde til fremstilling af 13β-alkyl-3-oxogona-4,9,11-triener. | |
| DK111889B (da) | Fremgangsmåde til fremstilling af 3-N-substituerede tricycloundecaner. | |
| DK106185C (da) | Fremgangsmåde til fremstilling af 17α-acyloxy-4,6-pregnadien-20-oner. | |
| DK120596B (da) | Fremgangsmåde til fremstilling af acetoxymethylbenzylpenicillinat. | |
| DK119107B (da) | Fremgangsmåde til fremstilling af 11β-hydroperoxy-3-oxo-13-alkyl-Δ<4,9>-gonadiener. | |
| DK104461C (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazoler. | |
| DK108004C (da) | Fremgangsmåde til fremstilling af 2,6-dichlorbenzonitril. | |
| DK107031C (da) | Fremgangsmåde til fremstilling af 2-halogenmethyl-quinazolin-3-oxider. | |
| DK106328C (da) | Fremgangsmåde til fremstilling af 17α-alkoxy-16-methylen-3,20-diketopregnanderivater. | |
| DK105592C (da) | Fremgangsmåde til fremstilling af substituerede 5-fluor-pyrimidiner. | |
| DK104571C (da) | Fremgangsmåde til fremstilling af trans-2-phenyl-3-methylmorpholin. | |
| DK115327B (da) | Fremgangsmåde til fremstilling af hydroxyphenylalkylphosphonater. | |
| DK106329C (da) | Fremgangsmåde til fremstilling af 3,20-dioxo-19-nor-4,9,11-pregnatrien. | |
| DK109260C (da) | Fremgangsmåde til fremstilling af 3,5-diklor-2, 6-dimetyl-4-pyridinol. | |
| DK120764B (da) | Fremgangsmåde til fremstilling af 2-amino-5-nitro-benzophenoner. | |
| DK122883B (da) | Fremgangsmåde til fremstilling af ω-lactamer. | |
| DK113991B (da) | Fremgangsmåde til fremstilling af 2-chlor-3-oxo-butanamider. | |
| DK109895C (da) | Fremgangsmåde til fremstilling af 1,3-dioxo-2-alkyl-cyclopentaner. | |
| DK114904B (da) | Fremgangsmåde til fremstilling af 3,5-diiodthyroniner. | |
| DK109264C (da) | Fremgangsmåde til fremstilling af 1-substituerede-2-cyan-5-nitroimidazoler. | |
| DK105983C (da) | Fremgangsmåde til fremstilling af 2-alkoxy-5-aryl-3H-1,4-benzodiazepin-4-oxider. | |
| DK105036C (da) | Fremgangsmåde til fremstilling af 7-desacetylamino-11,12-dihydrocolchicein. | |
| DK103081C (da) | Fremgangsmåde til fremstilling af 2,6-diketo-8-thiapuriner. |