DK112727B - Fremgangsmåde til fremstilling af isophthalsyre og terephthalsyre. - Google Patents
Fremgangsmåde til fremstilling af isophthalsyre og terephthalsyre.Info
- Publication number
- DK112727B DK112727B DK242864AA DK242864A DK112727B DK 112727 B DK112727 B DK 112727B DK 242864A A DK242864A A DK 242864AA DK 242864 A DK242864 A DK 242864A DK 112727 B DK112727 B DK 112727B
- Authority
- DK
- Denmark
- Prior art keywords
- acid
- preparation
- terephthalic acid
- isophthalic acid
- isophthalic
- Prior art date
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 title 2
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quick-Acting Or Multi-Walled Pipe Joints (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US28181963A | 1963-05-20 | 1963-05-20 | |
| US624136A US3361803A (en) | 1963-05-20 | 1967-03-20 | Process for the production of isophthalic and terephthalic acids |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK112727B true DK112727B (da) | 1969-01-13 |
Family
ID=26961094
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK242864AA DK112727B (da) | 1963-05-20 | 1964-05-14 | Fremgangsmåde til fremstilling af isophthalsyre og terephthalsyre. |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3361803A (https=) |
| BE (1) | BE648155A (https=) |
| CH (1) | CH440250A (https=) |
| DE (1) | DE1276628C2 (https=) |
| DK (1) | DK112727B (https=) |
| GB (1) | GB1004895A (https=) |
| NL (1) | NL6405607A (https=) |
| NO (1) | NO117027B (https=) |
| SE (1) | SE313554B (https=) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852342A (en) * | 1972-09-01 | 1974-12-03 | Labofina Sa | Process for the liquid phase oxidation of methylaromatic compounds into polycarboxylic acids |
| US4230882A (en) * | 1978-05-19 | 1980-10-28 | Asahi Kasei Kogyo Kabushiki Kaisha | Process for the production of a high purity terephthalic acid |
| DE2822728C3 (de) * | 1978-05-24 | 1981-08-27 | Asahi Kasei Kogyo K.K., Osaka | Verfahren zur Herstellung von Terephthalsäure |
| WO2001038279A1 (en) * | 1999-11-26 | 2001-05-31 | Chemintel (India) Private Limited | Process for preparation of benzene dicarboxylic acids |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7692037B2 (en) | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) * | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) * | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060116531A1 (en) * | 2004-11-29 | 2006-06-01 | Wonders Alan G | Modeling of liquid-phase oxidation |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
-
1964
- 1964-05-13 DE DE1964R0037891 patent/DE1276628C2/de not_active Expired
- 1964-05-14 DK DK242864AA patent/DK112727B/da unknown
- 1964-05-15 SE SE6008/64A patent/SE313554B/xx unknown
- 1964-05-15 GB GB20370/64A patent/GB1004895A/en not_active Expired
- 1964-05-15 NO NO153276A patent/NO117027B/no unknown
- 1964-05-19 CH CH647564A patent/CH440250A/fr unknown
- 1964-05-20 BE BE648155D patent/BE648155A/xx unknown
- 1964-05-20 NL NL6405607A patent/NL6405607A/xx unknown
-
1967
- 1967-03-20 US US624136A patent/US3361803A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1276628B (https=) | 1975-01-16 |
| NL6405607A (https=) | 1964-11-23 |
| BE648155A (https=) | 1964-11-20 |
| CH440250A (fr) | 1967-07-31 |
| DE1276628C2 (de) | 1975-01-16 |
| US3361803A (en) | 1968-01-02 |
| GB1004895A (en) | 1965-09-15 |
| NO117027B (https=) | 1969-06-23 |
| SE313554B (https=) | 1969-08-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK112727B (da) | Fremgangsmåde til fremstilling af isophthalsyre og terephthalsyre. | |
| DK125421B (da) | Analogifremgangsmåde til fremstilling af 5-substituerede-aza-dibenzo-cycloheptener eller syreadditionssalte deraf. | |
| DK108972C (da) | Fremgangsmåde til fremstilling af lipoylpyridoxamin eller syreadditionssalte deraf. | |
| DK106733C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-5-aminomethyl-isoxazol eller syreadditionssalte deraf. | |
| DK125197B (da) | Fremgangsmåde til fremstilling af taveren tereftalsyre. | |
| DK108500C (da) | Fremgangsmåde til fremstilling af 1-glykosyl-5-azacytosiner. | |
| DK128489B (da) | Fremgangsmåde til udvinding af terephthalsyre af høj renhedsgrad. | |
| DK111113B (da) | Fremgangsmåde til fremstilling af 3-methylflavon-8-carboxylsyre. | |
| DK116000B (da) | Fremgangsmåde til fremstilling af amino-halogen-benzylaminer eller syreadditionssalte heraf. | |
| DK111889B (da) | Fremgangsmåde til fremstilling af 3-N-substituerede tricycloundecaner. | |
| DK126584B (da) | Fremgangsmåde til fremstilling af D-2-phenoxypropionsyrer. | |
| DK104461C (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazoler. | |
| DK107031C (da) | Fremgangsmåde til fremstilling af 2-halogenmethyl-quinazolin-3-oxider. | |
| DK121022B (da) | Analogifremgangsmåde til fremstilling af γ -resorcylsyreanilider. | |
| DK104571C (da) | Fremgangsmåde til fremstilling af trans-2-phenyl-3-methylmorpholin. | |
| DK113149B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyrer. | |
| DK122756B (da) | Analogifremgangsmåde til fremstilling af 2-alkoxy-5-trifluormethylbenzoesyrer. | |
| DK111957B (da) | Fremgangsmåde til fremstilling af adamantylderivater af αhydroxy-carboxylsyrer. | |
| DK122880B (da) | Fremgangsmåde til fremstilling af sulfamylanthranilsyrer. | |
| DK108153C (da) | Fremgangsmåde til fremstilling af 1-alkyl-5-nitroimidazol-2-carboxylater. | |
| DK114692B (da) | Analogifremgangsmåde til fremstilling af di-19-nor-terstosterondicarboxylsyreestere. | |
| NL140508B (nl) | Werkwijze ter bereiding van aromatische carbonzuren. | |
| DK131288B (da) | Fremgangsmåde til fremstilling af 6-acylaminopenicillansyrer. | |
| DK113649B (da) | Fremgangsmåde til fremstilling af α-amino-ω-nitrosohydroxylaminosyrer. | |
| DK105649C (da) | Fremgangsmåde til fremstilling af 2-dimethylaminopyrazin eller syreadditionssalte deraf. |