DK102741C - Fremgangsmåde til fremstilling af substituerede nicotinsyre-phenylethylamider. - Google Patents
Fremgangsmåde til fremstilling af substituerede nicotinsyre-phenylethylamider.Info
- Publication number
- DK102741C DK102741C DK526762AA DK526762A DK102741C DK 102741 C DK102741 C DK 102741C DK 526762A A DK526762A A DK 526762AA DK 526762 A DK526762 A DK 526762A DK 102741 C DK102741 C DK 102741C
- Authority
- DK
- Denmark
- Prior art keywords
- phenylethylamides
- preparation
- nicotinic acid
- substituted nicotinic
- substituted
- Prior art date
Links
- IWAOAHRHJXBSFV-UHFFFAOYSA-N n-(2-phenylethyl)pyridine-3-carboxamide Chemical class C=1C=CN=CC=1C(=O)NCCC1=CC=CC=C1 IWAOAHRHJXBSFV-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF35483A DE1242618B (de) | 1961-12-06 | 1961-12-06 | Verfahren zur Herstellung von substituierten Nicotinsaeure-phenyl-aethylamiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK102741C true DK102741C (da) | 1965-10-04 |
Family
ID=7096020
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK526762AA DK102741C (da) | 1961-12-06 | 1962-12-05 | Fremgangsmåde til fremstilling af substituerede nicotinsyre-phenylethylamider. |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3166562A (enExample) |
| CH (1) | CH429725A (enExample) |
| DE (1) | DE1242618B (enExample) |
| DK (1) | DK102741C (enExample) |
| GB (1) | GB978288A (enExample) |
| NL (2) | NL286303A (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3272832A (en) * | 1963-07-03 | 1966-09-13 | Fujisawa Pharmaceutical Co | Nicotinic acid derivatives and process for the preparation thereof |
| US3520930A (en) * | 1964-12-31 | 1970-07-21 | Merck & Co Inc | Lower alkoxy-amino-benzylamines |
| US3541106A (en) * | 1967-12-28 | 1970-11-17 | Velsicol Chemical Corp | Certain substituted n-phenyl-n-hydroxy-nicotinamides,the corresponding isonicotinamines and picolinamides |
| NL7216661A (enExample) * | 1972-12-08 | 1974-06-11 | ||
| EP0098241B1 (de) * | 1982-06-16 | 1985-10-02 | Ciba-Geigy Ag | Hydrochinonäther und ein Verfahren zu deren Herstellung |
| IL69392A (en) * | 1982-08-13 | 1987-01-30 | Sanofi Sa | N-oxide nicotinamide derivatives,their preparation and pharmaceutical compositions containing them |
| IL103614A (en) * | 1991-11-22 | 1998-09-24 | Basf Ag | Carboxamides for controlling botrytis and certain novel such compounds |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2483250A (en) * | 1949-09-27 | Tt a it tt | ||
| US2681341A (en) * | 1952-08-19 | 1954-06-15 | S E Massengill Company | Solid acid salts of nu, nu-diethyl pyridine-3-carboxylic acid amide |
| US2721203A (en) * | 1953-07-13 | 1955-10-18 | Fellows Medical Mfg Co Inc | Chloral nicotinamide and method for preparing the same |
| US2976213A (en) * | 1959-11-18 | 1961-03-21 | Robins Co Inc A H | Injectable skeletal muscle relaxant |
| US3053736A (en) * | 1960-03-18 | 1962-09-11 | Abbott Lab | Treatment of mental disturbances by chemotherapeutic means |
-
0
- NL NL131190D patent/NL131190C/xx active
- NL NL286303D patent/NL286303A/xx unknown
-
1961
- 1961-12-06 DE DEF35483A patent/DE1242618B/de active Pending
-
1962
- 1962-12-04 US US242104A patent/US3166562A/en not_active Expired - Lifetime
- 1962-12-04 CH CH1420262A patent/CH429725A/de unknown
- 1962-12-05 DK DK526762AA patent/DK102741C/da active
- 1962-12-06 GB GB46118/62A patent/GB978288A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| US3166562A (en) | 1965-01-19 |
| NL131190C (enExample) | |
| DE1242618B (de) | 1967-06-22 |
| GB978288A (en) | 1964-12-23 |
| CH429725A (de) | 1967-02-15 |
| NL286303A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK104168C (da) | Fremgangsmåde til fremstilling af mono-biguanider. | |
| DK102957C (da) | Fremgangsmåde til fremstilling af salicylsyrearylamider. | |
| DK102736C (da) | Fremgangsmåde til fremstilling af phenylalkylcarboxylsyreamider. | |
| DK118242B (da) | Fremgangsmåde til fremstilling af anhydropenicilliner. | |
| DK108976C (da) | Fremgangsmåde til fremstilling af hendecapeptider. | |
| DK102741C (da) | Fremgangsmåde til fremstilling af substituerede nicotinsyre-phenylethylamider. | |
| DK130590B (da) | Fremgangsmåde til fremstilling af N-acyl-6-aminopenicillansyrer. | |
| DK107027C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-benzisoxazoler. | |
| DK105205C (da) | Fremgangsmåde til fremstilling af pyridyl- eller pyrazyloxyalkylaminoalkylaminer eller syreadditionssalte heraf. | |
| DK108455C (da) | Fremgangsmåde til fremstilling af i 5-stillingen usubstituerede 2-amino-benzophenoner. | |
| DK106184C (da) | Fremgangsmåde til fremstilling af alkylaralkylftalater. | |
| DK118082B (da) | Fremgangsmåde til fremstilling af 4-cyanthiazol. | |
| DK104791C (da) | Fremgangsmåde til fremstilling af di-N-dieddikesyreimider. | |
| DK114686B (da) | Fremgangsmåde til fremstilling af allencarboxylsyreestere. | |
| DK104055C (da) | Fremgangsmåde til fremstilling af 6-methoxytetraloner. | |
| DK104347C (da) | Fremgangsmåde til fremstilling af 16α-hydroxysteroider. | |
| DK104136C (da) | Fremgangsmåde til fremstilling af benzensulfonylsemicarbazider. | |
| DK109862C (da) | Fremgangsmåde til fremstilling af 1-glutaminsyre. | |
| DK100937C (da) | Fremgangsmåde til fremstilling af O,O-dimethyl-dithiophosphoryl-eddikesyre-monomethylamid. | |
| DK104740C (da) | Fremgangsmåde til fremstilling af di-N-dieddikesyreimider. | |
| DK102510C (da) | Fremgangsmåde til fremstilling af phenylalkylcarboxylsyreamider. | |
| DK104745C (da) | Fremgangsmåde til fremstilling af i 5-stillingen substituerede salicyl-syrederivater. | |
| DK101787C (da) | Fremgangsmåde til fremstilling af 2-amino-4-methyl-quinoliniumsalte. | |
| DK102400C (da) | Fremgangsmåde til fremstilling af pyrocarbonssyrreestere. | |
| DK105411C (da) | Fremgangsmåde til fremstilling af 5-alkoxy-2-sulfanilylaminopyrimidiner. |