DES0033841MA - - Google Patents
Info
- Publication number
- DES0033841MA DES0033841MA DES0033841MA DE S0033841M A DES0033841M A DE S0033841MA DE S0033841M A DES0033841M A DE S0033841MA
- Authority
- DE
- Germany
- Prior art keywords
- parts
- isopropenylbenzene
- hydroquinone
- hydrogen peroxide
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 18
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 239000003054 catalyst Substances 0.000 claims description 6
- ZENYUPUKNXGVDY-UHFFFAOYSA-N 1,4-bis(prop-1-en-2-yl)benzene Chemical compound CC(=C)C1=CC=C(C(C)=C)C=C1 ZENYUPUKNXGVDY-UHFFFAOYSA-N 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 229960000583 acetic acid Drugs 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000012362 glacial acetic acid Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229910015900 BF3 Inorganic materials 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- CGFYHILWFSGVJS-UHFFFAOYSA-N silicic acid;trioxotungsten Chemical compound O[Si](O)(O)O.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1.O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 CGFYHILWFSGVJS-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- CXLSYKCQTGRVAG-UHFFFAOYSA-N 1,4-di(propan-2-yl)benzene hydrogen peroxide Chemical compound OO.OO.CC(C)C1=CC=C(C(C)C)C=C1 CXLSYKCQTGRVAG-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1643146A1 (de) | Verfahren zur Herstellung von epsilon-Caprolactonen und bzw. oder 6-Formyloxycapronsaeuren | |
| EP0294685B1 (de) | Verfahren zur Herstellung von Chinolinen | |
| EP0025961A1 (de) | Verfahren zur Herstellung von 1,2-Diolen höherer Kohlenstoffzahl | |
| DE1593968C3 (de) | Verfahren zur Herstellung von Hydrochinon und Brenzcatechin | |
| EP0225850A1 (de) | Verfahren zur Herstellung von 1-(2-Hydroxyethyl)-2,2,6,6-tetramethyl-4-hydroxy-piperidin | |
| DE3850230T2 (de) | Verfahren zur Herstellung von Alkylthioethylaminsalzen. | |
| DE2658943C3 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon | |
| DE1229102B (de) | Verfahren zur Herstellung von Monochlor-9-thiabicyclo-2-nonenen sowie deren 9-Oxyden und 9, 9-Dioxyden | |
| DE2461503C3 (de) | Verfahren zur Herstellung von Pinakolin | |
| DES0033841MA (cg-RX-API-DMAC7.html) | ||
| EP1004564B1 (de) | Verfahren zur Herstellung von Hydroxyethylcyclohexanen und Hydroxyethylpiperidinen | |
| DE2548384B2 (de) | Verfahren zur Herstellung von Hydroxyphenyläthern | |
| DE2658866A1 (de) | Verfahren zur herstellung von mehrwertigen phenolen | |
| DE947308C (de) | Verfahren zur Herstellung von Hydrochinon | |
| EP0230625B1 (de) | Verfahren zur Herstellung von Brenzkatechin und Hydrochinon | |
| EP0101836B1 (de) | Verfahren zur Herstellung von reinem Diacetonitril | |
| EP0345688B1 (de) | Verfahren zur Herstellung von 4-Nitro-3-trifluormethyl-anilin | |
| DES0033842MA (cg-RX-API-DMAC7.html) | ||
| EP0417543B1 (de) | Verfahren zur Herstellung von 3-Methylchinolin-8-carbonsäure | |
| EP0581148A1 (de) | Verfahren zur Herstellung von 2,3-Dichlor-nitrobenzol | |
| DE3883353T2 (de) | Verfahren zur herstellung von dihydroxynaphthalen. | |
| DE906451C (de) | Verfahren zur Herstellung von Glykol | |
| EP0110239B1 (de) | Verfahren zur Herstellung von 2-Hydroxy-carbazol-1-carbonsäure | |
| WO2001096277A1 (de) | Verfahren zur herstellung von 2,3,4,6-tetramethylmandelsäure und 2,3,4,6-tetramethylmandelsäureacetat | |
| EP0090246B1 (de) | Verfahren zur Herstellung von Pinakolon |