DE69626229T2 - Waschmittelzusammensetzungen enthaltend schmutzlösende polymere - Google Patents
Waschmittelzusammensetzungen enthaltend schmutzlösende polymereInfo
- Publication number
- DE69626229T2 DE69626229T2 DE69626229T DE69626229T DE69626229T2 DE 69626229 T2 DE69626229 T2 DE 69626229T2 DE 69626229 T DE69626229 T DE 69626229T DE 69626229 T DE69626229 T DE 69626229T DE 69626229 T2 DE69626229 T2 DE 69626229T2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- detergent composition
- water
- monomer
- detergent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000203 mixture Substances 0.000 title claims description 64
- 239000003599 detergent Substances 0.000 title claims description 55
- 229920000642 polymer Polymers 0.000 title claims description 33
- 239000000178 monomer Substances 0.000 claims description 49
- 229920000728 polyester Polymers 0.000 claims description 37
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 30
- -1 alkylbenzene sulfonate Chemical class 0.000 claims description 26
- 125000003118 aryl group Chemical group 0.000 claims description 21
- 239000004094 surface-active agent Substances 0.000 claims description 19
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 18
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims description 18
- 239000003945 anionic surfactant Substances 0.000 claims description 17
- 239000002689 soil Substances 0.000 claims description 17
- 239000002736 nonionic surfactant Substances 0.000 claims description 16
- 238000005406 washing Methods 0.000 claims description 16
- 229920005862 polyol Polymers 0.000 claims description 14
- 150000003077 polyols Chemical class 0.000 claims description 13
- 125000001931 aliphatic group Chemical group 0.000 claims description 11
- ARXKVVRQIIOZGF-UHFFFAOYSA-N 1,2,4-butanetriol Chemical compound OCCC(O)CO ARXKVVRQIIOZGF-UHFFFAOYSA-N 0.000 claims description 8
- 235000011187 glycerol Nutrition 0.000 claims description 8
- 239000004615 ingredient Substances 0.000 claims description 8
- 239000004753 textile Substances 0.000 claims description 7
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 6
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 6
- YAXKTBLXMTYWDQ-UHFFFAOYSA-N 1,2,3-butanetriol Chemical compound CC(O)C(O)CO YAXKTBLXMTYWDQ-UHFFFAOYSA-N 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 230000003578 releasing effect Effects 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims 2
- 239000011593 sulfur Substances 0.000 claims 2
- YZTJKOLMWJNVFH-UHFFFAOYSA-N 2-sulfobenzene-1,3-dicarboxylic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1S(O)(=O)=O YZTJKOLMWJNVFH-UHFFFAOYSA-N 0.000 description 27
- 150000008064 anhydrides Chemical class 0.000 description 26
- 239000010457 zeolite Substances 0.000 description 19
- 238000004061 bleaching Methods 0.000 description 17
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 17
- 108091005804 Peptidases Proteins 0.000 description 16
- 102000035195 Peptidases Human genes 0.000 description 16
- 229910021536 Zeolite Inorganic materials 0.000 description 16
- 239000003795 chemical substances by application Substances 0.000 description 16
- 150000005690 diesters Chemical class 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 14
- 239000004365 Protease Substances 0.000 description 13
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 13
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 239000007844 bleaching agent Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 8
- 238000000034 method Methods 0.000 description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 8
- 108010020132 microbial serine proteinases Proteins 0.000 description 8
- 239000002304 perfume Substances 0.000 description 8
- 235000019832 sodium triphosphate Nutrition 0.000 description 8
- 102000004882 Lipase Human genes 0.000 description 7
- 108090001060 Lipase Proteins 0.000 description 7
- 239000004367 Lipase Substances 0.000 description 7
- 235000019421 lipase Nutrition 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 6
- 102000004190 Enzymes Human genes 0.000 description 6
- 108090000790 Enzymes Proteins 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 229940088598 enzyme Drugs 0.000 description 6
- 229920000139 polyethylene terephthalate Polymers 0.000 description 6
- 239000005020 polyethylene terephthalate Substances 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- GBFLZEXEOZUWRN-VKHMYHEASA-N S-carboxymethyl-L-cysteine Chemical compound OC(=O)[C@@H](N)CSCC(O)=O GBFLZEXEOZUWRN-VKHMYHEASA-N 0.000 description 5
- 108010056079 Subtilisins Proteins 0.000 description 5
- 102000005158 Subtilisins Human genes 0.000 description 5
- 229910000323 aluminium silicate Inorganic materials 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 125000000524 functional group Chemical group 0.000 description 5
- 239000008187 granular material Substances 0.000 description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- 108010065511 Amylases Proteins 0.000 description 4
- 102000013142 Amylases Human genes 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 229920002125 Sokalan® Polymers 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 235000019418 amylase Nutrition 0.000 description 4
- 239000002518 antifoaming agent Substances 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 4
- 229920001577 copolymer Polymers 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000011976 maleic acid Substances 0.000 description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 4
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 4
- 238000002791 soaking Methods 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- 239000004382 Amylase Substances 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- 229910000503 Na-aluminosilicate Inorganic materials 0.000 description 3
- 239000004115 Sodium Silicate Substances 0.000 description 3
- 239000005864 Sulphur Substances 0.000 description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000004996 alkyl benzenes Chemical class 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 229940077388 benzenesulfonate Drugs 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 229940071106 ethylenediaminetetraacetate Drugs 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 239000012535 impurity Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 3
- 229920005646 polycarboxylate Polymers 0.000 description 3
- 238000006068 polycondensation reaction Methods 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 229940024999 proteolytic enzymes for treatment of wounds and ulcers Drugs 0.000 description 3
- 229920002545 silicone oil Polymers 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- 229910052911 sodium silicate Inorganic materials 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 3
- 108010075550 termamyl Proteins 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 2
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 2
- BAECOWNUKCLBPZ-HIUWNOOHSA-N Triolein Natural products O([C@H](OCC(=O)CCCCCCC/C=C\CCCCCCCC)COC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)CCCCCCC/C=C\CCCCCCCC BAECOWNUKCLBPZ-HIUWNOOHSA-N 0.000 description 2
- PHYFQTYBJUILEZ-UHFFFAOYSA-N Trioleoylglycerol Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCC=CCCCCCCCC PHYFQTYBJUILEZ-UHFFFAOYSA-N 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000005056 compaction Methods 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- 238000005469 granulation Methods 0.000 description 2
- 230000003179 granulation Effects 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- 108010003855 mesentericopeptidase Proteins 0.000 description 2
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical group C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 2
- 239000004006 olive oil Substances 0.000 description 2
- 235000008390 olive oil Nutrition 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 239000003352 sequestering agent Substances 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000000429 sodium aluminium silicate Substances 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 2
- 229940045872 sodium percarbonate Drugs 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 2
- 229940117972 triolein Drugs 0.000 description 2
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 2
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- CFPOJWPDQWJEMO-UHFFFAOYSA-N 2-(1,2-dicarboxyethoxy)butanedioic acid Chemical class OC(=O)CC(C(O)=O)OC(C(O)=O)CC(O)=O CFPOJWPDQWJEMO-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical class OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- HWXBTNAVRSUOJR-UHFFFAOYSA-N 2-hydroxyglutaric acid Chemical class OC(=O)C(O)CCC(O)=O HWXBTNAVRSUOJR-UHFFFAOYSA-N 0.000 description 1
- WEHZNZTWKUYVIY-UHFFFAOYSA-N 3-oxabicyclo[3.2.2]nona-1(7),5,8-triene-2,4-dione Chemical compound O=C1OC(=O)C2=CC=C1C=C2 WEHZNZTWKUYVIY-UHFFFAOYSA-N 0.000 description 1
- LNYYKKTXWBNIOO-UHFFFAOYSA-N 3-oxabicyclo[3.3.1]nona-1(9),5,7-triene-2,4-dione Chemical compound C1=CC(C(=O)OC2=O)=CC2=C1 LNYYKKTXWBNIOO-UHFFFAOYSA-N 0.000 description 1
- HSSYVKMJJLDTKZ-UHFFFAOYSA-N 3-phenylphthalic acid Chemical class OC(=O)C1=CC=CC(C=2C=CC=CC=2)=C1C(O)=O HSSYVKMJJLDTKZ-UHFFFAOYSA-N 0.000 description 1
- HBLRZDACQHNPJT-UHFFFAOYSA-N 4-sulfonaphthalene-2,7-dicarboxylic acid Chemical class OS(=O)(=O)C1=CC(C(O)=O)=CC2=CC(C(=O)O)=CC=C21 HBLRZDACQHNPJT-UHFFFAOYSA-N 0.000 description 1
- XSVSPKKXQGNHMD-UHFFFAOYSA-N 5-bromo-3-methyl-1,2-thiazole Chemical compound CC=1C=C(Br)SN=1 XSVSPKKXQGNHMD-UHFFFAOYSA-N 0.000 description 1
- XELRKSQZWHNTCF-UHFFFAOYSA-N 5-phenoxy-2-sulfobenzene-1,3-dicarboxylic acid Chemical class OC(=O)C1=C(S(O)(=O)=O)C(C(=O)O)=CC(OC=2C=CC=CC=2)=C1 XELRKSQZWHNTCF-UHFFFAOYSA-N 0.000 description 1
- 241000193830 Bacillus <bacterium> Species 0.000 description 1
- 241000194108 Bacillus licheniformis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 102000005701 Calcium-Binding Proteins Human genes 0.000 description 1
- 108010045403 Calcium-Binding Proteins Proteins 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 108010059892 Cellulase Proteins 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 1
- OCUCCJIRFHNWBP-IYEMJOQQSA-L Copper gluconate Chemical class [Cu+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O OCUCCJIRFHNWBP-IYEMJOQQSA-L 0.000 description 1
- 102000016559 DNA Primase Human genes 0.000 description 1
- 108010092681 DNA Primase Proteins 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 101001001478 Homo sapiens Importin subunit alpha-3 Proteins 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 102100036188 Importin subunit alpha-3 Human genes 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- JYXGIOKAKDAARW-UHFFFAOYSA-N N-(2-hydroxyethyl)iminodiacetic acid Chemical class OCCN(CC(O)=O)CC(O)=O JYXGIOKAKDAARW-UHFFFAOYSA-N 0.000 description 1
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 229920006243 acrylic copolymer Polymers 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 159000000032 aromatic acids Chemical class 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 229940106157 cellulase Drugs 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 125000006840 diphenylmethane group Chemical group 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 description 1
- 235000011180 diphosphates Nutrition 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920005996 polystyrene-poly(ethylene-butylene)-polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 150000003138 primary alcohols Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 229940048084 pyrophosphate Drugs 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000003504 terephthalic acids Chemical class 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/0005—Other compounding ingredients characterised by their effect
- C11D3/0036—Soil deposition preventing compositions; Antiredeposition agents
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3703—Macromolecular compounds obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3715—Polyesters or polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GBGB9524494.3A GB9524494D0 (en) | 1995-11-30 | 1995-11-30 | Detergent compositions containing soil release polymers |
| PCT/EP1996/005002 WO1997020023A1 (en) | 1995-11-30 | 1996-11-11 | Detergent compositions containing soil release polymers |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69626229D1 DE69626229D1 (de) | 2003-03-20 |
| DE69626229T2 true DE69626229T2 (de) | 2003-07-10 |
Family
ID=10784702
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69626229T Expired - Lifetime DE69626229T2 (de) | 1995-11-30 | 1996-11-11 | Waschmittelzusammensetzungen enthaltend schmutzlösende polymere |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US5789365A (cg-RX-API-DMAC7.html) |
| EP (1) | EP1019476B1 (cg-RX-API-DMAC7.html) |
| CN (1) | CN1120227C (cg-RX-API-DMAC7.html) |
| AR (1) | AR004812A1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU698616B2 (cg-RX-API-DMAC7.html) |
| BR (1) | BR9611797A (cg-RX-API-DMAC7.html) |
| CA (1) | CA2238481C (cg-RX-API-DMAC7.html) |
| CZ (1) | CZ167098A3 (cg-RX-API-DMAC7.html) |
| DE (1) | DE69626229T2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2191774T3 (cg-RX-API-DMAC7.html) |
| GB (1) | GB9524494D0 (cg-RX-API-DMAC7.html) |
| HU (1) | HUP9903708A3 (cg-RX-API-DMAC7.html) |
| IN (1) | IN188293B (cg-RX-API-DMAC7.html) |
| PL (1) | PL327041A1 (cg-RX-API-DMAC7.html) |
| SK (1) | SK71598A3 (cg-RX-API-DMAC7.html) |
| TR (1) | TR199800962T2 (cg-RX-API-DMAC7.html) |
| WO (1) | WO1997020023A1 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA969726B (cg-RX-API-DMAC7.html) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19515072A1 (de) * | 1995-04-28 | 1996-10-31 | Cognis Bio Umwelt | Cellulasehaltiges Waschmittel |
| US5962389A (en) * | 1995-11-17 | 1999-10-05 | The Dial Corporation | Detergent having improved color retention properties |
| US5948745A (en) * | 1995-12-29 | 1999-09-07 | Colgate-Palmolive Co. | Detergent composition having improved cleaning power |
| US6576716B1 (en) | 1999-12-01 | 2003-06-10 | Rhodia, Inc | Process for making sulfonated polyester compounds |
| MXPA03000793A (es) * | 2000-07-28 | 2003-06-04 | Henkel Kgaa | Enzima amilolitica novedosa, extraida de bacilo sp a 7-7 (dsm 12368) y agentes de lavado y limpiadores que contienen esta enzima amilolitica novedosa. |
| DE10062008B4 (de) * | 2000-12-13 | 2012-09-20 | Henkel Ag & Co. Kgaa | Farbschonendes Waschmittel |
| WO2003012024A1 (en) | 2001-07-27 | 2003-02-13 | Rhodia Inc. | Sulfonated polyester compounds with enhanced shelf stability and processes of making the same |
| DE10160319B4 (de) * | 2001-12-07 | 2008-05-15 | Henkel Kgaa | Tensidgranulate und Verfahren zur Herstellung von Tensidgranulaten |
| GB0229147D0 (en) | 2002-12-13 | 2003-01-15 | Unilever Plc | Polymers and laundry detergent compositions containing them |
| GB0229146D0 (en) | 2002-12-13 | 2003-01-15 | Unilever Plc | Polymers and laundry detergent compositions containing them |
| US9926514B1 (en) * | 2009-01-09 | 2018-03-27 | Ascent Ip Holdings, Llc | Cleaning compositions |
| US8080506B2 (en) * | 2009-07-14 | 2011-12-20 | MSI Technology LLC. | Reactive purge compound for polymer purging |
| US9828571B2 (en) | 2015-06-05 | 2017-11-28 | Illinois Tool Works, Inc. | Heavy duty laundry detergent |
| US11884899B2 (en) * | 2018-06-01 | 2024-01-30 | Amtex Innovations Llc | Methods of laundering stitchbonded nonwoven towels using a soil release polymer |
| US10822578B2 (en) * | 2018-06-01 | 2020-11-03 | Amtex Innovations Llc | Methods of washing stitchbonded nonwoven towels using a soil release polymer |
| CN111040889B (zh) * | 2018-10-15 | 2022-04-12 | 重庆海尔洗衣机有限公司 | 一种清洗用组合物及其应用和一种清洗剂 |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1088984A (en) * | 1963-06-05 | 1967-10-25 | Ici Ltd | Modifying treatment of shaped articles derived from polyesters |
| GB1437950A (en) * | 1972-08-22 | 1976-06-03 | Unilever Ltd | Detergent compositions |
| AT330930B (de) * | 1973-04-13 | 1976-07-26 | Henkel & Cie Gmbh | Verfahren zur herstellung von festen, schuttfahigen wasch- oder reinigungsmitteln mit einem gehalt an calcium bindenden substanzen |
| DE2433485A1 (de) * | 1973-07-16 | 1975-02-06 | Procter & Gamble | Zur verwendung in waschmitteln geeignete aluminosilikat-ionenaustauscher |
| US3962152A (en) * | 1974-06-25 | 1976-06-08 | The Procter & Gamble Company | Detergent compositions having improved soil release properties |
| US4116885A (en) * | 1977-09-23 | 1978-09-26 | The Procter & Gamble Company | Anionic surfactant-containing detergent compositions having soil-release properties |
| JPS57143400A (en) * | 1981-02-27 | 1982-09-04 | Nippon Synthetic Chem Ind | Detergent composition |
| DE3413571A1 (de) * | 1984-04-11 | 1985-10-24 | Hoechst Ag, 6230 Frankfurt | Verwendung von kristallinen schichtfoermigen natriumsilikaten zur wasserenthaertung und verfahren zur wasserenthaertung |
| DE3427078A1 (de) * | 1984-07-23 | 1986-01-23 | Henkel KGaA, 4000 Düsseldorf | Waschverfahren fuer empfindliche textilien |
| ATE73150T1 (de) * | 1984-12-21 | 1992-03-15 | Procter & Gamble | Blockpolyester und aehnliche verbindungen, verwendbar als verschmutzungsentferner in waschmittelzusammensetzungen. |
| US4711730A (en) * | 1986-04-15 | 1987-12-08 | The Procter & Gamble Company | Capped 1,2-propylene terephthalate-polyoxyethylene terephthalate polyesters useful as soil release agents |
| US4713194A (en) * | 1986-04-15 | 1987-12-15 | The Procter & Gamble Company | Block polyester and like compounds having branched hydrophilic capping groups useful as soil release agents in detergent compositions |
| GB8629936D0 (en) * | 1986-12-15 | 1987-01-28 | Procter & Gamble | Laundry compositions |
| US4721580A (en) * | 1987-01-07 | 1988-01-26 | The Procter & Gamble Company | Anionic end-capped oligomeric esters as soil release agents in detergent compositions |
| US4976879A (en) * | 1987-10-05 | 1990-12-11 | The Procter & Gamble Company | Sulfoaroyl end-capped ester oligomers suitable as soil-release agents in detergent compositions and fabric-conditioner articles |
| US4877896A (en) * | 1987-10-05 | 1989-10-31 | The Procter & Gamble Company | Sulfoaroyl end-capped ester of oligomers suitable as soil-release agents in detergent compositions and fabric-conditioner articles |
| GB8810193D0 (en) * | 1988-04-29 | 1988-06-02 | Unilever Plc | Detergent compositions & process for preparing them |
| US4968451A (en) * | 1988-08-26 | 1990-11-06 | The Procter & Gamble Company | Soil release agents having allyl-derived sulfonated end caps |
| SG76454A1 (en) * | 1988-08-26 | 2000-11-21 | Procter & Gamble | Soil release agents having allyl-derived sulfonated end caps |
| ES2085273T3 (es) * | 1988-11-02 | 1996-06-01 | Unilever Nv | Procedimiento para preparar una composicion detergente granular de alta densidad aparente. |
| CA2001927C (en) * | 1988-11-03 | 1999-12-21 | Graham Thomas Brown | Aluminosilicates and detergent compositions |
| US5047165A (en) * | 1989-01-25 | 1991-09-10 | Colgate-Palmolive Co. | Fine fabric laundry detergent with sugar esters as softening and whitening agents |
| GB8907187D0 (en) * | 1989-03-30 | 1989-05-10 | Unilever Plc | Detergent compositions and process for preparing them |
| JPH0321698A (ja) * | 1989-06-20 | 1991-01-30 | Sanyo Chem Ind Ltd | 高分子電解質ビルダー及び洗剤組成物 |
| GB8922018D0 (en) * | 1989-09-29 | 1989-11-15 | Unilever Plc | Detergent compositions and process for preparing them |
| US5182043A (en) * | 1989-10-31 | 1993-01-26 | The Procter & Gamble Company | Sulfobenzoyl end-capped ester oligomers useful as soil release agents in granular detergent compositions |
| US5196133A (en) * | 1989-10-31 | 1993-03-23 | The Procter & Gamble Company | Granular detergent compositions containing peroxyacid bleach and sulfobenzoyl end-capped ester oligomers useful as soil-release agents |
| EP0547106B1 (en) * | 1990-09-07 | 1995-12-27 | The Procter & Gamble Company | Improved soil release agents for granular laundry detergents |
| HUT69329A (en) * | 1992-04-13 | 1995-09-28 | Procter & Gamble | Modified polyester-containing composition for the washing of cotton-containing fabrics |
| EP0698049A4 (en) * | 1993-04-07 | 1998-04-29 | Procter & Gamble | ESUL SULFONE OLIGOMERS THAT CAN BE USED AS DISPERSING AGENTS IN DETERSIVE COMPOSITIONS |
| CA2166274A1 (en) * | 1993-07-08 | 1995-01-19 | Eugene Paul Gosselink | Detergent compositions comprising soil release agents |
| US5415807A (en) * | 1993-07-08 | 1995-05-16 | The Procter & Gamble Company | Sulfonated poly-ethoxy/propoxy end-capped ester oligomers suitable as soil release agents in detergent compositions |
| FR2720400B1 (fr) * | 1994-05-30 | 1996-06-28 | Rhone Poulenc Chimie | Nouveaux polyesters sulfones et leur utilisation comme agent anti-salissure dans les compositions détergentes, de rinçage, d'adoucissage et de traitement des textiles. |
-
1995
- 1995-11-30 GB GBGB9524494.3A patent/GB9524494D0/en active Pending
-
1996
- 1996-11-11 PL PL96327041A patent/PL327041A1/xx unknown
- 1996-11-11 CN CN96199759A patent/CN1120227C/zh not_active Expired - Lifetime
- 1996-11-11 EP EP96939042A patent/EP1019476B1/en not_active Expired - Lifetime
- 1996-11-11 CA CA002238481A patent/CA2238481C/en not_active Expired - Fee Related
- 1996-11-11 TR TR1998/00962T patent/TR199800962T2/xx unknown
- 1996-11-11 BR BR9611797A patent/BR9611797A/pt not_active IP Right Cessation
- 1996-11-11 DE DE69626229T patent/DE69626229T2/de not_active Expired - Lifetime
- 1996-11-11 CZ CZ981670A patent/CZ167098A3/cs unknown
- 1996-11-11 HU HU9903708A patent/HUP9903708A3/hu unknown
- 1996-11-11 SK SK715-98A patent/SK71598A3/sk unknown
- 1996-11-11 ES ES96939042T patent/ES2191774T3/es not_active Expired - Lifetime
- 1996-11-11 WO PCT/EP1996/005002 patent/WO1997020023A1/en not_active Ceased
- 1996-11-11 AU AU76247/96A patent/AU698616B2/en not_active Ceased
- 1996-11-19 IN IN551BO1996 patent/IN188293B/en unknown
- 1996-11-20 ZA ZA9609726A patent/ZA969726B/xx unknown
- 1996-11-22 US US08/755,509 patent/US5789365A/en not_active Expired - Lifetime
- 1996-11-29 AR ARP960105420A patent/AR004812A1/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PL327041A1 (en) | 1998-11-09 |
| ZA969726B (en) | 1998-05-20 |
| TR199800962T2 (xx) | 1998-09-21 |
| CA2238481C (en) | 2006-01-24 |
| HUP9903708A2 (hu) | 2000-03-28 |
| DE69626229D1 (de) | 2003-03-20 |
| HUP9903708A3 (en) | 2002-04-29 |
| CA2238481A1 (en) | 1997-06-05 |
| EP1019476B1 (en) | 2003-02-12 |
| BR9611797A (pt) | 1999-07-13 |
| AR004812A1 (es) | 1999-03-10 |
| EP1019476A1 (en) | 2000-07-19 |
| GB9524494D0 (en) | 1996-01-31 |
| US5789365A (en) | 1998-08-04 |
| CN1207765A (zh) | 1999-02-10 |
| AU7624796A (en) | 1997-06-19 |
| WO1997020023A1 (en) | 1997-06-05 |
| AU698616B2 (en) | 1998-11-05 |
| CZ167098A3 (cs) | 1998-11-11 |
| SK71598A3 (en) | 1998-12-02 |
| ES2191774T3 (es) | 2003-09-16 |
| CN1120227C (zh) | 2003-09-03 |
| IN188293B (cg-RX-API-DMAC7.html) | 2002-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69626229T2 (de) | Waschmittelzusammensetzungen enthaltend schmutzlösende polymere | |
| US11884775B2 (en) | Renewably sourced soil release polyesters | |
| DE69926385T2 (de) | Behandlung von geweben | |
| EP0991743B1 (de) | Wasch- und reinigungsmittel | |
| DE69629631T2 (de) | Schmutzabweisende Polyetherester und diese enthaltende Waschmittelzusammensetzungen | |
| DE19826356A1 (de) | Schmutzablösevermögende Oligoester | |
| EP1035194A2 (de) | Verwendung von Kammpolymeren als Schmutzablösepolymere | |
| DE69624014T2 (de) | Waschmittel mit schmutzlösenden polymeren | |
| JP5678084B2 (ja) | 灰色化防止(vergrauungsinhibierender)効果および高い溶液安定性を有するソイルリリースポリマー | |
| DE69607651T2 (de) | Waschmittel mit schmutzlösenden polymeren | |
| GB2307695A (en) | Detergent compositions containing soil release polymers | |
| AU698202B2 (en) | Detergent compositions containing soil release polymers | |
| GB2307693A (en) | Detergent compositions containing soil release polymers | |
| GB2307694A (en) | Detergent compositions containing soil release polymers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |