DE3006226A1 - N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukte - Google Patents
N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukteInfo
- Publication number
- DE3006226A1 DE3006226A1 DE19803006226 DE3006226A DE3006226A1 DE 3006226 A1 DE3006226 A1 DE 3006226A1 DE 19803006226 DE19803006226 DE 19803006226 DE 3006226 A DE3006226 A DE 3006226A DE 3006226 A1 DE3006226 A1 DE 3006226A1
- Authority
- DE
- Germany
- Prior art keywords
- ester
- radical
- substituted
- imido
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 26
- 238000004519 manufacturing process Methods 0.000 title description 3
- 239000013067 intermediate product Substances 0.000 title description 2
- BUZRUIZTMOKRPB-UHFFFAOYSA-N carboxycarbamic acid Chemical class OC(=O)NC(O)=O BUZRUIZTMOKRPB-UHFFFAOYSA-N 0.000 title 1
- -1 heterocyclic radical Chemical class 0.000 claims description 90
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 239000004305 biphenyl Substances 0.000 claims description 18
- 235000010290 biphenyl Nutrition 0.000 claims description 17
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 239000003085 diluting agent Substances 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 8
- 150000002367 halogens Chemical class 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 150000003254 radicals Chemical class 0.000 claims description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- 229910052731 fluorine Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000006413 ring segment Chemical group 0.000 claims description 2
- 125000003107 substituted aryl group Chemical group 0.000 claims description 2
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- 150000001733 carboxylic acid esters Chemical class 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 28
- YEXIGDOOPPENOC-UHFFFAOYSA-N phenyl hydrogen carbonate;hydrochloride Chemical compound Cl.OC(=O)OC1=CC=CC=C1 YEXIGDOOPPENOC-UHFFFAOYSA-N 0.000 description 28
- 238000009835 boiling Methods 0.000 description 26
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 16
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- 239000003208 petroleum Substances 0.000 description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 239000007789 gas Substances 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 230000002363 herbicidal effect Effects 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 238000004817 gas chromatography Methods 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- BFGQTWYXWNCTSX-UHFFFAOYSA-N triazine-4,5-dione Chemical class O=C1C=NN=NC1=O BFGQTWYXWNCTSX-UHFFFAOYSA-N 0.000 description 4
- XDIAMRVROCPPBK-UHFFFAOYSA-N 2,2-dimethylpropan-1-amine Chemical compound CC(C)(C)CN XDIAMRVROCPPBK-UHFFFAOYSA-N 0.000 description 3
- BIMQAPNNPHDKKS-UHFFFAOYSA-N 2,2-dimethylpropyl(phenyl)carbamic acid Chemical compound CC(C)(C)CN(C(O)=O)C1=CC=CC=C1 BIMQAPNNPHDKKS-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- ROORDVPLFPIABK-UHFFFAOYSA-N diphenyl carbonate Chemical compound C=1C=CC=CC=1OC(=O)OC1=CC=CC=C1 ROORDVPLFPIABK-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910000039 hydrogen halide Inorganic materials 0.000 description 3
- 239000012433 hydrogen halide Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- RSHDHBSLQNAYDI-UHFFFAOYSA-N phenyl n-(2,2-dimethylpropyl)carbamate Chemical compound CC(C)(C)CNC(=O)OC1=CC=CC=C1 RSHDHBSLQNAYDI-UHFFFAOYSA-N 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- KOKBUARVIJVMMM-UHFFFAOYSA-N 1-amino-3-(2,2-dimethylpropyl)-6-ethylsulfanyl-1,3,5-triazine-2,4-dione Chemical compound CCSC1=NC(=O)N(CC(C)(C)C)C(=O)N1N KOKBUARVIJVMMM-UHFFFAOYSA-N 0.000 description 2
- USXSCBCCYNVIPN-UHFFFAOYSA-N 1-isocyanato-2,2-dimethylpropane Chemical compound CC(C)(C)CN=C=O USXSCBCCYNVIPN-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- GEWRKGDRYZIFNP-UHFFFAOYSA-N 1h-1,3,5-triazine-2,4-dione Chemical class OC1=NC=NC(O)=N1 GEWRKGDRYZIFNP-UHFFFAOYSA-N 0.000 description 2
- MHPHRPMWKGGYAV-UHFFFAOYSA-N 2,2-dimethylpropylcarbamic acid Chemical compound CC(C)(C)CNC(O)=O MHPHRPMWKGGYAV-UHFFFAOYSA-N 0.000 description 2
- RITGKOLSPOYSAU-UHFFFAOYSA-N 3-(2-methylpropyl)-6-methylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazine-2,4-dione Chemical compound CSC1=NC(=O)N(CC(C)C)C(=O)N1N=C(C)C RITGKOLSPOYSAU-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000002516 radical scavenger Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical class ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- MYNKPRUQPQVVFZ-UHFFFAOYSA-N 1,3-benzothiazol-2-ylcarbamic acid Chemical compound C1=CC=C2SC(NC(=O)O)=NC2=C1 MYNKPRUQPQVVFZ-UHFFFAOYSA-N 0.000 description 1
- XEFUJGURFLOFAN-UHFFFAOYSA-N 1,3-dichloro-5-isocyanatobenzene Chemical compound ClC1=CC(Cl)=CC(N=C=O)=C1 XEFUJGURFLOFAN-UHFFFAOYSA-N 0.000 description 1
- HIUSJCCJQZSYRQ-UHFFFAOYSA-N 1-amino-1,3,5-triazine-2,4-dione Chemical class NN1C=NC(=O)NC1=O HIUSJCCJQZSYRQ-UHFFFAOYSA-N 0.000 description 1
- KCOOXDULDWALIO-UHFFFAOYSA-N 1-amino-3-(2-methylpropyl)-6-methylsulfanyl-1,3,5-triazine-2,4-dione Chemical compound CSC1=NC(=O)N(CC(C)C)C(=O)N1N KCOOXDULDWALIO-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000003229 2-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- HQQGZFFHYJZCGS-UHFFFAOYSA-N 3-(2,2-dimethylpropyl)-6-ethylsulfanyl-1-(propan-2-ylideneamino)-1,3,5-triazine-2,4-dione Chemical compound CCSC1=NC(=O)N(CC(C)(C)C)C(=O)N1N=C(C)C HQQGZFFHYJZCGS-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- IYRWEQXVUNLMAY-UHFFFAOYSA-N carbonyl fluoride Chemical compound FC(F)=O IYRWEQXVUNLMAY-UHFFFAOYSA-N 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- CRRXSTLTDTYOCO-UHFFFAOYSA-N cyclohexyl(phenyl)carbamic acid Chemical compound C=1C=CC=CC=1N(C(=O)O)C1CCCCC1 CRRXSTLTDTYOCO-UHFFFAOYSA-N 0.000 description 1
- JQSCXPJYAOUXEO-UHFFFAOYSA-N cyclopentyl(phenyl)carbamic acid Chemical compound C=1C=CC=CC=1N(C(=O)O)C1CCCC1 JQSCXPJYAOUXEO-UHFFFAOYSA-N 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042396 direct acting antivirals thiosemicarbazones Drugs 0.000 description 1
- 238000007700 distillative separation Methods 0.000 description 1
- ZOBFJDJPRVLPIQ-UHFFFAOYSA-N ethyl n'-(propan-2-ylideneamino)carbamimidothioate Chemical compound CCS\C(N)=N\N=C(C)C ZOBFJDJPRVLPIQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- RKPDHXGEFVRONA-UHFFFAOYSA-N methyl n'-(propan-2-ylideneamino)carbamimidothioate Chemical compound CSC(N)=NN=C(C)C RKPDHXGEFVRONA-UHFFFAOYSA-N 0.000 description 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 1
- CBAJZWKIPVVYAH-UHFFFAOYSA-N naphthalen-2-yl hydrogen carbonate Chemical compound C1=CC=CC2=CC(OC(=O)O)=CC=C21 CBAJZWKIPVVYAH-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- PDOAODRXHYFPDV-UHFFFAOYSA-N phenyl hydrogen carbonate hydrofluoride Chemical class OC(OC1=CC=CC=C1)=O.F PDOAODRXHYFPDV-UHFFFAOYSA-N 0.000 description 1
- BAFCHDGEGUNIRS-UHFFFAOYSA-N phenyl n-(2,2,2-trifluoroethyl)carbamate Chemical compound FC(F)(F)CNC(=O)OC1=CC=CC=C1 BAFCHDGEGUNIRS-UHFFFAOYSA-N 0.000 description 1
- ICGNCPZDLALZBU-UHFFFAOYSA-N phenyl n-butylcarbamate Chemical compound CCCCNC(=O)OC1=CC=CC=C1 ICGNCPZDLALZBU-UHFFFAOYSA-N 0.000 description 1
- HZTQTHXAQORTJA-UHFFFAOYSA-N phenyl n-pentan-3-ylcarbamate Chemical compound CCC(CC)NC(=O)OC1=CC=CC=C1 HZTQTHXAQORTJA-UHFFFAOYSA-N 0.000 description 1
- RJUVFGTVVVYSFK-UHFFFAOYSA-N phenyl n-propan-2-ylcarbamate Chemical compound CC(C)NC(=O)OC1=CC=CC=C1 RJUVFGTVVVYSFK-UHFFFAOYSA-N 0.000 description 1
- BKVUXKJWTVANMM-UHFFFAOYSA-N phenyl n-tert-butylcarbamate Chemical compound CC(C)(C)NC(=O)OC1=CC=CC=C1 BKVUXKJWTVANMM-UHFFFAOYSA-N 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003584 thiosemicarbazones Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/38—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803006226 DE3006226A1 (de) | 1980-02-20 | 1980-02-20 | N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukte |
| EP81100921A EP0034750B1 (de) | 1980-02-20 | 1981-02-10 | N-substituierte Imido-dicarbonsäure-diarylester und Verfahren zu ihrer Herstellung |
| DE8181100921T DE3161906D1 (en) | 1980-02-20 | 1981-02-10 | N-substituted imidodicarboxylic acid diaryl esters and a process for their preparation |
| IL62147A IL62147A0 (en) | 1980-02-20 | 1981-02-17 | N-substituted imido-dicarboxylic acid diaryl esters and their preparation |
| JP2098081A JPS56128748A (en) | 1980-02-20 | 1981-02-17 | N-substituted imido-dicarboxylic acid diaryl ester |
| CA000371153A CA1153007A (en) | 1980-02-20 | 1981-02-18 | N-substituted imido-dicarboxylic acid diaryl esters, a process for their preparation and their use as intermediate products |
| BR8101009A BR8101009A (pt) | 1980-02-20 | 1981-02-19 | Processo para a preparacao de diarilesteres do acido imido-dicarboxilico n-substituidos |
| DK74281A DK74281A (da) | 1980-02-20 | 1981-02-19 | N-substituerede imido-dicarboxylsyre-diarylestere fremgangsmaade til fremstilling deraf samt deres anvendelse som mellemprodukter |
| US06/393,572 US4447635A (en) | 1980-02-20 | 1982-06-30 | N-Substituted imido-dicarboxylic acid diaryl ester compounds and herbicide intermediates |
| US06/520,704 US4451406A (en) | 1980-02-20 | 1983-08-05 | N-Substituted imido-dicarboxylic acid diaryl ester method of preparation |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803006226 DE3006226A1 (de) | 1980-02-20 | 1980-02-20 | N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukte |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3006226A1 true DE3006226A1 (de) | 1981-08-27 |
Family
ID=6095023
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803006226 Withdrawn DE3006226A1 (de) | 1980-02-20 | 1980-02-20 | N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukte |
| DE8181100921T Expired DE3161906D1 (en) | 1980-02-20 | 1981-02-10 | N-substituted imidodicarboxylic acid diaryl esters and a process for their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181100921T Expired DE3161906D1 (en) | 1980-02-20 | 1981-02-10 | N-substituted imidodicarboxylic acid diaryl esters and a process for their preparation |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4447635A (enExample) |
| EP (1) | EP0034750B1 (enExample) |
| JP (1) | JPS56128748A (enExample) |
| BR (1) | BR8101009A (enExample) |
| CA (1) | CA1153007A (enExample) |
| DE (2) | DE3006226A1 (enExample) |
| DK (1) | DK74281A (enExample) |
| IL (1) | IL62147A0 (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3006263A1 (de) * | 1980-02-20 | 1981-08-27 | Bayer Ag, 5090 Leverkusen | Verfahren und herstellung von 1-amino-1,3,5-triazin-2,4(1h, 3h)-dionen |
| DE3333447A1 (de) * | 1982-11-06 | 1985-03-21 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4 (1h, 3h)-dionen |
| US5189058A (en) * | 1991-04-09 | 1993-02-23 | Warner-Lambert Company | Iminodicarbonic, iminodicarbonodithioic, and thiocarbonylcarbamic acid esters useful as ACAT inhibitors |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB484683A (en) * | 1935-11-08 | 1938-05-09 | Ig Farbenindustrie Ag | Improvements in the manufacture and production of urethanes containing carboxyl or sulphonic acid groups |
| US4014923A (en) * | 1971-07-02 | 1977-03-29 | Bayer Aktiengesellschaft | N-carboxylated N-methylcarbamic acid aryl esters |
| BE785784A (fr) * | 1971-07-02 | 1973-01-03 | Bayer Ag | Nouveaux esters aryliques d'acides n-methyl-carbamiques n-carboxyles, leur procede de preparation et leurs applications commeinsecticides et acaricides |
-
1980
- 1980-02-20 DE DE19803006226 patent/DE3006226A1/de not_active Withdrawn
-
1981
- 1981-02-10 DE DE8181100921T patent/DE3161906D1/de not_active Expired
- 1981-02-10 EP EP81100921A patent/EP0034750B1/de not_active Expired
- 1981-02-17 JP JP2098081A patent/JPS56128748A/ja active Granted
- 1981-02-17 IL IL62147A patent/IL62147A0/xx not_active IP Right Cessation
- 1981-02-18 CA CA000371153A patent/CA1153007A/en not_active Expired
- 1981-02-19 DK DK74281A patent/DK74281A/da not_active Application Discontinuation
- 1981-02-19 BR BR8101009A patent/BR8101009A/pt unknown
-
1982
- 1982-06-30 US US06/393,572 patent/US4447635A/en not_active Expired - Fee Related
-
1983
- 1983-08-05 US US06/520,704 patent/US4451406A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0034750A3 (en) | 1982-05-05 |
| US4451406A (en) | 1984-05-29 |
| JPH032857B2 (enExample) | 1991-01-17 |
| US4447635A (en) | 1984-05-08 |
| DK74281A (da) | 1981-08-21 |
| EP0034750A2 (de) | 1981-09-02 |
| EP0034750B1 (de) | 1984-01-18 |
| CA1153007A (en) | 1983-08-30 |
| IL62147A0 (en) | 1981-03-31 |
| DE3161906D1 (en) | 1984-02-23 |
| BR8101009A (pt) | 1981-08-25 |
| JPS56128748A (en) | 1981-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0595130B1 (de) | N-Phenylacetaminonitrile und ihre Verwendung als Zwischenprodukte zur Synthese von Insektiziden und Herbiziden 3-Aryl-pyrrolidin-2,4-dionen | |
| EP0201030B1 (de) | Verfahren zur Herstellung von 1,3,5-Triazintrionen | |
| EP0463464B1 (de) | Verfahren zur Herstellung von 2-Chlor-5-methyl-pyridin | |
| EP0034751B1 (de) | Verfahren zur Herstellung von 1-Amino-1,3,5-triazin-2,4(1H, 3H)-dionen | |
| EP0132733A2 (de) | Neue Fluorpivalsäurefluoride und Verfahren zu ihrer Herstellung | |
| DE3006226A1 (de) | N-substituierte imido-dicarbonsaeure-diarylester, verfahren zun ihrer herstellung und ihre verwendung als zwischenprodukte | |
| EP0653423B1 (de) | Verfahren zur Herstellung von substituierten Chinazolin-2,4-dionen | |
| EP0378046B1 (de) | Verfahren zur Herstellung von 3-Phenylpyrrolderivaten | |
| EP0478994B1 (de) | Verfahren zur Herstellung von 5-Hydroxy-3,4,5,6-tetrahydro-pyrimidin-Derivaten | |
| EP0048376B1 (de) | Verfahren zur Herstellung von N-substituierten Imido-dicarbonsäure-diarylestern | |
| EP0358018A2 (de) | Verfahren zur Herstellung von Oxyguanidinen | |
| EP0156198B1 (de) | Verfahren zur Herstellung von Isocyanaten | |
| EP0403889B1 (de) | Verfahren zur Herstellung von 4-Amino-1,2,4-triazol-5-onen | |
| EP0132734B1 (de) | Neopentylisocyanate und ihre Herstellung | |
| EP0222210B1 (de) | Verfahren zur Herstellung von Phosphorsäurederivaten und Zwischenprodukten | |
| DE3106724A1 (de) | "verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4 (1h, 3h)-dionen" | |
| EP0626379B1 (de) | Verfahren zur Herstellung von 2-Chlor-benzothiazolen oder 2-Chlor-benzoxazolen | |
| DE2852924A1 (de) | Substituierte spiro-derivate von 3- (3,5-dihalogenphenyl)-oxazolidin-2,4-dionen (thion-onen), verfahren zu ihrer herstellung sowie ihre verwendung als fungizide | |
| EP1070706B1 (de) | Verfahren zur Herstellung von 1-substituierten 5-Hydroxy-imidazolin-2,4-dionen und 1-substituierten 5-Alkoxy-imidazolin-2,4-dionen | |
| DE3241114A1 (de) | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4-(1h,3h)dionen | |
| DE4201709A1 (de) | (alpha)-aryl-(alpha)-hydroxy-ss-imidazolinyl-propionsaeureamide | |
| EP0264020A2 (de) | Verfahren zur Herstellung von 0-Aryl-N'-pyrimidin-2-yl-isoharnstoffen | |
| DE3147735A1 (de) | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4(1h,3h)dionen | |
| EP0238792A1 (de) | Verfahren zur Herstellung von Halogenalkoxy-diphenylethern | |
| DE3035393A1 (de) | Verfahren zur herstellung vonn-substituierten imidodicarbonsaeurediarylestern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8125 | Change of the main classification | ||
| 8130 | Withdrawal |