DE2851729B2 - - Google Patents
Info
- Publication number
- DE2851729B2 DE2851729B2 DE2851729B2 DE 2851729 B2 DE2851729 B2 DE 2851729B2 DE 2851729 B2 DE2851729 B2 DE 2851729B2
- Authority
- DE
- Germany
- Prior art keywords
- gold
- dental prosthesis
- dental
- blend
- veneering
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000010931 gold Substances 0.000 claims description 46
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 45
- 229910052737 gold Inorganic materials 0.000 claims description 45
- 239000000203 mixture Substances 0.000 claims description 16
- 239000002670 dental porcelain Substances 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 11
- 229910045601 alloy Inorganic materials 0.000 claims description 10
- 239000000956 alloy Substances 0.000 claims description 10
- 239000002245 particle Substances 0.000 claims description 10
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 8
- 229910052738 indium Inorganic materials 0.000 claims description 6
- 229910052718 tin Inorganic materials 0.000 claims description 6
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 5
- 238000010304 firing Methods 0.000 claims description 5
- 229910052732 germanium Inorganic materials 0.000 claims description 5
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 5
- WUOACPNHFRMFPN-UHFFFAOYSA-N alpha-terpineol Chemical compound CC1=CCC(C(C)(C)O)CC1 WUOACPNHFRMFPN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- SQIFACVGCPWBQZ-UHFFFAOYSA-N delta-terpineol Natural products CC(C)(O)C1CCC(=C)CC1 SQIFACVGCPWBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- 229910052709 silver Inorganic materials 0.000 claims description 4
- 229940116411 terpineol Drugs 0.000 claims description 4
- 239000001856 Ethyl cellulose Substances 0.000 claims description 3
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 3
- 229920001249 ethyl cellulose Polymers 0.000 claims description 3
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 3
- 229910052733 gallium Inorganic materials 0.000 claims description 3
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 238000002156 mixing Methods 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims 2
- 239000004332 silver Substances 0.000 claims 2
- 239000010410 layer Substances 0.000 description 20
- 239000010953 base metal Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 229910052573 porcelain Inorganic materials 0.000 description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 240000006108 Allium ampeloprasum Species 0.000 description 1
- 235000005254 Allium ampeloprasum Nutrition 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000007767 bonding agent Substances 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000004313 glare Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910001092 metal group alloy Inorganic materials 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 229910000923 precious metal alloy Inorganic materials 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2851729C2 (de) | Blendgold, Verfahren zum Verblenden gegossener oder gesinterter metallischer Zahnprothesen oder Zahnprothesenteile und Anwendung des Blendgoldes | |
| DE2632871C3 (de) | Porzellanüberzogene Metallkrone und Verfahren zu ihrer Herstellung | |
| EP0115058A2 (de) | Pulverförmiger Dentalwerkstoff, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE4031169C1 (enExample) | ||
| CH648351A5 (de) | Legierung zum aufbrennen von porzellan sowie deren verwendung. | |
| CH652918A5 (de) | Goldhaltiges praeparat zum ueberziehen metallischer teile. | |
| EP0530697B1 (de) | Verwendung einer Palladiumlegierung für mit Dentalkeramik verblendbaren Zahnersatz | |
| DE3244802C2 (de) | Dental-Legierungen für Kronen und Prothesen | |
| DE3244803A1 (de) | Cobalt/chrom-legierungen fuer metallkeramik-zahnersatz | |
| DE904490C (de) | Metallische Formkoerper | |
| DE3406711C1 (de) | Goldarme Dental-Legierungen | |
| DE3209977C2 (de) | Dentalfuellmaterial | |
| DE2851729B2 (enExample) | ||
| EP0691123B1 (de) | Hochgoldhaltige Dentallegierung | |
| DE3830666C2 (enExample) | ||
| DE4419408C1 (de) | Dental-Goldlegierung für Zahnersatz | |
| DE2002886A1 (de) | Verfahren zur Herstellung eines durch innere Oxydation dispersionsgehaerteten Werkstoffes | |
| DE3812568C1 (en) | Use of palladium alloy, which can be cast on, in dental engineering | |
| EP0729739B1 (de) | Angiessbare Konstruktionselemente für die Dentaltechnik | |
| AT411324B (de) | Dentallegierung auf edelmetallbasis | |
| DE19640169B4 (de) | Goldhaltige gelbe Lotlegierung für Dentalteile | |
| DE2755913B2 (de) | Goldlegierung zum Aufbrennen von Porzellan für zahnärztliche Zwecke | |
| DE19646703A1 (de) | Beim Sintern von Dentalporzellan erforderliches Oberflächenbehandlungsmaterial, das aufgrund eines Oxidationshemmers die Abscheidung eines Belags verhindert, und Metallunterlage und Dentalporzellan fest miteinander verbindet | |
| DE4226484C3 (de) | Verwendung einer Palladiumlegierung für mit Dentalkeramik verblendbaren Zahnersatz | |
| DE4332335C2 (de) | Goldhaltiges Präparat |