DE2652863C3 - - Google Patents
Info
- Publication number
- DE2652863C3 DE2652863C3 DE2652863C3 DE 2652863 C3 DE2652863 C3 DE 2652863C3 DE 2652863 C3 DE2652863 C3 DE 2652863C3
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- reaction
- methylbutenol
- acetoacetic acid
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- HNVRRHSXBLFLIG-UHFFFAOYSA-N 3-hydroxy-3-methylbut-1-ene Chemical compound CC(C)(O)C=C HNVRRHSXBLFLIG-UHFFFAOYSA-N 0.000 claims description 57
- -1 acetoacetic acid ester Chemical class 0.000 claims description 37
- UHEPJGULSIKKTP-UHFFFAOYSA-N sulcatone Chemical compound CC(C)=CCCC(C)=O UHEPJGULSIKKTP-UHFFFAOYSA-N 0.000 claims description 34
- 238000006243 chemical reaction Methods 0.000 claims description 32
- 239000011541 reaction mixture Substances 0.000 claims description 23
- VBPSVYDSYVJIPX-UHFFFAOYSA-N methylbutenol Natural products CCC=C(C)O VBPSVYDSYVJIPX-UHFFFAOYSA-N 0.000 claims description 19
- 229910052782 aluminium Inorganic materials 0.000 claims description 16
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 claims description 13
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- BZAZNULYLRVMSW-UHFFFAOYSA-N 2-Methyl-2-buten-3-ol Natural products CC(C)=C(C)O BZAZNULYLRVMSW-UHFFFAOYSA-N 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 15
- 238000004821 distillation Methods 0.000 description 11
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 10
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- JPTOCTSNXXKSSN-UHFFFAOYSA-N methylheptenone Chemical compound CCCC=CC(=O)CC JPTOCTSNXXKSSN-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 4
- MKUWVMRNQOOSAT-UHFFFAOYSA-N methylvinylmethanol Natural products CC(O)C=C MKUWVMRNQOOSAT-UHFFFAOYSA-N 0.000 description 4
- PPCUBWWPGYHEJE-UHFFFAOYSA-N (3-chlorophenyl)urea Chemical compound NC(=O)NC1=CC=CC(Cl)=C1 PPCUBWWPGYHEJE-UHFFFAOYSA-N 0.000 description 3
- RTYRONIMTRDBLT-ONEGZZNKSA-N 5-Hepten-2-one Chemical compound C\C=C\CCC(C)=O RTYRONIMTRDBLT-ONEGZZNKSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- FVOALQOAKFPOCF-UHFFFAOYSA-N 3-methylpent-2-en-2-ol Chemical compound CCC(C)=C(C)O FVOALQOAKFPOCF-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 238000005194 fractionation Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- JYVLIDXNZAXMDK-UHFFFAOYSA-N pentan-2-ol Chemical compound CCCC(C)O JYVLIDXNZAXMDK-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- SSTODPPMEPQZQJ-UHFFFAOYSA-N 8-amino-1,2,3,4-tetrahydronaphthalen-2-ol Chemical compound C1CC(O)CC2=C1C=CC=C2N SSTODPPMEPQZQJ-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- DEVXQDKRGJCZMV-UHFFFAOYSA-K Aluminum acetoacetate Chemical compound [Al+3].CC(=O)CC([O-])=O.CC(=O)CC([O-])=O.CC(=O)CC([O-])=O DEVXQDKRGJCZMV-UHFFFAOYSA-K 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 101000722960 Onchocerca volvulus Onchocystatin Proteins 0.000 description 1
- IWAUTUCYWHZANT-UHFFFAOYSA-M [Al+3].CC(C)[O-].CC(C)[O-].CC(=O)CC([O-])=O Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(=O)CC([O-])=O IWAUTUCYWHZANT-UHFFFAOYSA-M 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- NTDURBZYFOSETC-UHFFFAOYSA-N pent-2-en-2-yl 3-oxobutanoate Chemical compound C(CC(=O)C)(=O)OC(=CCC)C NTDURBZYFOSETC-UHFFFAOYSA-N 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0008096B1 (de) | Verfahren zur Herstellung von 2-(Perfluoralkyl)-äthanolen | |
| EP0317909A2 (de) | Verfahren zur Herstellung von alpha-Alkylacroleinen | |
| CH634287A5 (de) | Verfahren zur herstellung von 2-methyl-2-hepten-6-on. | |
| EP0022955B1 (de) | Verbessertes Verfahren zur Herstellung von höheren ungesättigten Ketonen | |
| DE19840746A1 (de) | Verfahren zur Herstellung gamma,delta-ungesättigter Ketone durch Carroll-Reaktion | |
| DE2652863C3 (enExample) | ||
| DE1200281B (de) | Verfahren zur Herstellung von Acetessigsaeureestern | |
| DE3825119A1 (de) | Verfahren zur gemeinschaftlichen herstellung von 3-dialkylaminopropionitrilen, bis-(2-cyanoethyl)-ether und gewuenschtenfalls ethylencyanhydrin | |
| EP0186076A2 (de) | Verfahren zur Herstellung von 2,2,4-Trimethyl-1,3-pentandiolmonoisobutyrat | |
| EP1008582B1 (de) | Verfahren zur Herstellung von ungesättigten Ketonen | |
| EP1300387A1 (de) | Verfahren zum Herstellen von Estern einer Hydroxysäure | |
| EP0165521A1 (de) | Verfahren zur Herstellung eines Gemisches aus einem gegebenenfalls substituierten Zimtsäureester und einem gegebenenfalls substituierten Beta-Alkoxy-Beta-phenyl-propionsäureester sowie Verfahren zur Herstellung von gegebenenfalls substituierter Zimtsäure | |
| EP1636158A1 (de) | Verfahren zur destillativen trennung eines vinylether und alkohol enthaltenden gemischs | |
| EP1216979A1 (de) | Verfahren zur Herstellung von Trimethylolverbindungen und Ameisensäure | |
| DE19836698A1 (de) | Verfahren zur Herstellung von fluorierten Benzylalkoholen und -aldehyden | |
| DE2652863B1 (de) | Verfahren zur Herstellung von 2-Methyl-2-hepten-6-on | |
| EP1284954A1 (de) | Verfahren zur herstellung von estern ungesättigter carbonsäuren | |
| DE3933247C1 (enExample) | ||
| EP0806405A1 (de) | Verfahren zur Herstellung von Hexahydrofarnesylaceton aus 6.7-Dihydro-geraniol sowie neue Zwischenprodukte für dieses Verfahren | |
| EP0095611A1 (de) | 2-Methoxyethyl-cyclododecenylether, Verfahren zu seiner Herstellung sowie seine Verwendung zur Herstellung von 2-Methoxyethyl-cyclododecylether | |
| EP0009159B1 (de) | Verfahren zur Herstellung von Carbonsäureestern des Beta-Formyl-Crotylalkohols mittels einer Allylumlagerung | |
| EP0795538B1 (de) | Verfahren zur Herstellung von reinem Alkylacetessigsäurealkylestern | |
| EP0031108B1 (de) | Verfahren zur Herstellung von 5-Oxoalkansäuren | |
| EP0436860A1 (de) | Verfahren zur Herstellung von 2-(4-Chlorphenyl)-3-methyl-buttersäure | |
| EP0900777B1 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäureestern von C1-C4 Alkoholen |