DE1813232A1 - Elektrischer Leiter fuer elektrosystolische Stimulatoren - Google Patents
Elektrischer Leiter fuer elektrosystolische StimulatorenInfo
- Publication number
- DE1813232A1 DE1813232A1 DE19681813232 DE1813232A DE1813232A1 DE 1813232 A1 DE1813232 A1 DE 1813232A1 DE 19681813232 DE19681813232 DE 19681813232 DE 1813232 A DE1813232 A DE 1813232A DE 1813232 A1 DE1813232 A1 DE 1813232A1
- Authority
- DE
- Germany
- Prior art keywords
- covered
- conductor
- ladder
- elastomer
- diameter
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004020 conductor Substances 0.000 title claims description 22
- 229920001971 elastomer Polymers 0.000 claims description 7
- 239000000806 elastomer Substances 0.000 claims description 7
- 229920000049 Carbon (fiber) Polymers 0.000 claims description 4
- 239000004917 carbon fiber Substances 0.000 claims description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- 238000003825 pressing Methods 0.000 claims description 3
- 230000006835 compression Effects 0.000 claims description 2
- 238000007906 compression Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 238000009736 wetting Methods 0.000 claims description 2
- 230000001747 exhibiting effect Effects 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- 230000000638 stimulation Effects 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000000835 fiber Substances 0.000 description 4
- 229920000742 Cotton Polymers 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 210000001174 endocardium Anatomy 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 229920001202 Inulin Polymers 0.000 description 1
- 206010035148 Plague Diseases 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- RZOXEODOFNEZRS-UHFFFAOYSA-N Tramazoline hydrochloride Chemical compound [Cl-].N1CCN=C1[NH2+]C1=CC=CC2=C1CCCC2 RZOXEODOFNEZRS-UHFFFAOYSA-N 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000003575 carbonaceous material Substances 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000005087 graphitization Methods 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- JYJIGFIDKWBXDU-MNNPPOADSA-N inulin Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)OC[C@]1(OC[C@]2(OC[C@]3(OC[C@]4(OC[C@]5(OC[C@]6(OC[C@]7(OC[C@]8(OC[C@]9(OC[C@]%10(OC[C@]%11(OC[C@]%12(OC[C@]%13(OC[C@]%14(OC[C@]%15(OC[C@]%16(OC[C@]%17(OC[C@]%18(OC[C@]%19(OC[C@]%20(OC[C@]%21(OC[C@]%22(OC[C@]%23(OC[C@]%24(OC[C@]%25(OC[C@]%26(OC[C@]%27(OC[C@]%28(OC[C@]%29(OC[C@]%30(OC[C@]%31(OC[C@]%32(OC[C@]%33(OC[C@]%34(OC[C@]%35(OC[C@]%36(O[C@@H]%37[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O%37)O)[C@H]([C@H](O)[C@@H](CO)O%36)O)[C@H]([C@H](O)[C@@H](CO)O%35)O)[C@H]([C@H](O)[C@@H](CO)O%34)O)[C@H]([C@H](O)[C@@H](CO)O%33)O)[C@H]([C@H](O)[C@@H](CO)O%32)O)[C@H]([C@H](O)[C@@H](CO)O%31)O)[C@H]([C@H](O)[C@@H](CO)O%30)O)[C@H]([C@H](O)[C@@H](CO)O%29)O)[C@H]([C@H](O)[C@@H](CO)O%28)O)[C@H]([C@H](O)[C@@H](CO)O%27)O)[C@H]([C@H](O)[C@@H](CO)O%26)O)[C@H]([C@H](O)[C@@H](CO)O%25)O)[C@H]([C@H](O)[C@@H](CO)O%24)O)[C@H]([C@H](O)[C@@H](CO)O%23)O)[C@H]([C@H](O)[C@@H](CO)O%22)O)[C@H]([C@H](O)[C@@H](CO)O%21)O)[C@H]([C@H](O)[C@@H](CO)O%20)O)[C@H]([C@H](O)[C@@H](CO)O%19)O)[C@H]([C@H](O)[C@@H](CO)O%18)O)[C@H]([C@H](O)[C@@H](CO)O%17)O)[C@H]([C@H](O)[C@@H](CO)O%16)O)[C@H]([C@H](O)[C@@H](CO)O%15)O)[C@H]([C@H](O)[C@@H](CO)O%14)O)[C@H]([C@H](O)[C@@H](CO)O%13)O)[C@H]([C@H](O)[C@@H](CO)O%12)O)[C@H]([C@H](O)[C@@H](CO)O%11)O)[C@H]([C@H](O)[C@@H](CO)O%10)O)[C@H]([C@H](O)[C@@H](CO)O9)O)[C@H]([C@H](O)[C@@H](CO)O8)O)[C@H]([C@H](O)[C@@H](CO)O7)O)[C@H]([C@H](O)[C@@H](CO)O6)O)[C@H]([C@H](O)[C@@H](CO)O5)O)[C@H]([C@H](O)[C@@H](CO)O4)O)[C@H]([C@H](O)[C@@H](CO)O3)O)[C@H]([C@H](O)[C@@H](CO)O2)O)[C@@H](O)[C@H](O)[C@@H](CO)O1 JYJIGFIDKWBXDU-MNNPPOADSA-N 0.000 description 1
- 229940029339 inulin Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 230000010412 perfusion Effects 0.000 description 1
- 230000010152 pollination Effects 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B7/00—Insulated conductors or cables characterised by their form
- H01B7/0009—Details relating to the conductive cores
Landscapes
- Electrotherapy Devices (AREA)
- Materials For Medical Uses (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR132536 | 1967-12-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1813232A1 true DE1813232A1 (de) | 1969-06-26 |
Family
ID=8643314
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681813232 Pending DE1813232A1 (de) | 1967-12-15 | 1968-12-06 | Elektrischer Leiter fuer elektrosystolische Stimulatoren |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE724943A (en:Method) |
| DE (1) | DE1813232A1 (en:Method) |
| FR (1) | FR1557087A (en:Method) |
| GB (1) | GB1219017A (en:Method) |
| NL (1) | NL6817868A (en:Method) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5509411A (en) * | 1993-01-29 | 1996-04-23 | Cardima, Inc. | Intravascular sensing device |
| US5549109A (en) * | 1993-10-01 | 1996-08-27 | Target Therapeutics, Inc. | Sheathed multipolar catheter and multipolar guidewire for sensing cardiac electrical activity |
| US5645064A (en) * | 1992-01-29 | 1997-07-08 | Cardima, Inc. | High resolution intravascular signal detection |
| US5645082A (en) * | 1993-01-29 | 1997-07-08 | Cardima, Inc. | Intravascular method and system for treating arrhythmia |
| US6088610A (en) * | 1993-01-29 | 2000-07-11 | Cardima, Inc. | Method and system for using multiple intravascular sensing devices to detect electrical activity |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3902501A (en) * | 1973-06-21 | 1975-09-02 | Medtronic Inc | Endocardial electrode |
| US3964470A (en) * | 1974-07-25 | 1976-06-22 | Medtronic, Inc. | Percutaneous intradermal electrical connection system and implant device |
| US4033357A (en) * | 1975-02-07 | 1977-07-05 | Medtronic, Inc. | Non-fibrosing cardiac electrode |
| GB1542859A (en) * | 1975-12-18 | 1979-03-28 | Nat Res Dev | Electrode assemblies |
| DE2613072C3 (de) * | 1976-03-26 | 1987-07-30 | Siemens AG, 1000 Berlin und 8000 München | Implantierbare Elektrode |
| US4102331A (en) * | 1976-09-21 | 1978-07-25 | Datascope Corporation | Device for transmitting electrical energy |
| US4125116A (en) * | 1977-02-14 | 1978-11-14 | The Johns Hopkins University | Human tissue stimulation electrode structure |
| US4248237A (en) * | 1978-03-07 | 1981-02-03 | Needle Industries Limited | Cardiac pacemakers |
| US4198991A (en) * | 1978-05-17 | 1980-04-22 | Cordis Corporation | Cardiac pacer lead |
| DE2842318C2 (de) * | 1978-09-28 | 1985-05-23 | Siemens AG, 1000 Berlin und 8000 München | Implantierbare Kohlenstoffelektrode |
| FR2446001A1 (fr) * | 1979-01-03 | 1980-08-01 | Cardiofrance Co | Conducteur electrique pour stimulateur cardiaque |
| US4417581A (en) * | 1979-05-23 | 1983-11-29 | The University Of Florida | Corneal electrode for electroretinography |
| US4280507A (en) * | 1979-06-27 | 1981-07-28 | Hewlett-Packard Company | Patient cable with distributed resistance protection in conductors |
| US4585013A (en) * | 1981-04-20 | 1986-04-29 | Cordis Corporation | Lumenless pervenous electrical lead and method of implantation |
| US4721118A (en) * | 1981-04-20 | 1988-01-26 | Cordis Leads, Inc. | Pervenous electrical pacing lead with foldable fins |
| EP0080536A1 (en) * | 1981-12-02 | 1983-06-08 | Walter Spaa | Cardiac stimulator |
| US4534366A (en) * | 1983-08-03 | 1985-08-13 | Soukup Thomas M | Carbon fiber pacing electrode |
| US4685467A (en) * | 1985-07-10 | 1987-08-11 | American Hospital Supply Corporation | X-ray transparent medical electrodes and lead wires and assemblies thereof |
| EP0312495A3 (de) * | 1987-10-16 | 1989-08-30 | Institut Straumann Ag | Elektrisches Kabel für die Durchführung mindestens einer Stimulation und/oder Messung in einem menschlichen oder tierischen Körper |
| US5411527A (en) * | 1989-05-03 | 1995-05-02 | Intermedics, Inc. | Difibrillation electrodes and implantation |
| DE3914662A1 (de) * | 1989-05-03 | 1990-11-08 | Alt Eckhard | Vorrichtung zum uebertragen elektrischer signale zwischen einem implantierbaren medizinischen geraet und elektrisch erregbarem menschlichen gewebe |
| US5336254A (en) * | 1992-09-23 | 1994-08-09 | Medtronic, Inc. | Defibrillation lead employing electrodes fabricated from woven carbon fibers |
| US5957967A (en) * | 1998-02-19 | 1999-09-28 | Medtronic, Inc. | Implantable medical lead using stamped conductor and distal loop |
| DE102006029864A1 (de) * | 2006-06-28 | 2008-01-03 | Biotronik Crm Patent Ag | Elektrodeneinrichtung für die Elektrodaignose und/oder -therapie |
| JP2014073233A (ja) * | 2012-10-04 | 2014-04-24 | 3M Innovative Properties Co | 生体電極用リード線及び生体電極 |
-
1967
- 1967-12-15 FR FR132536A patent/FR1557087A/fr not_active Expired
-
1968
- 1968-12-05 BE BE724943D patent/BE724943A/xx unknown
- 1968-12-05 GB GB57901/68A patent/GB1219017A/en not_active Expired
- 1968-12-06 DE DE19681813232 patent/DE1813232A1/de active Pending
- 1968-12-12 NL NL6817868A patent/NL6817868A/xx unknown
Cited By (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5645064A (en) * | 1992-01-29 | 1997-07-08 | Cardima, Inc. | High resolution intravascular signal detection |
| US5706809A (en) * | 1993-01-29 | 1998-01-13 | Cardima, Inc. | Method and system for using multiple intravascular sensing devices to detect electrical activity |
| US5645082A (en) * | 1993-01-29 | 1997-07-08 | Cardima, Inc. | Intravascular method and system for treating arrhythmia |
| US5685322A (en) * | 1993-01-29 | 1997-11-11 | Cardima, Inc. | Intravascular system for treating arrhythmia |
| US5699796A (en) * | 1993-01-29 | 1997-12-23 | Cardima, Inc. | High resolution intravascular signal detection |
| US5509411A (en) * | 1993-01-29 | 1996-04-23 | Cardima, Inc. | Intravascular sensing device |
| US5881732A (en) * | 1993-01-29 | 1999-03-16 | Cardima, Inc. | Intravascular method and system for treating arrhythmia |
| US5960796A (en) * | 1993-01-29 | 1999-10-05 | Cardima, Inc. | Intravascular method and device for occluding a body lumen |
| US5967978A (en) * | 1993-01-29 | 1999-10-19 | Cardima, Inc. | Intravascular sensing device |
| US6088610A (en) * | 1993-01-29 | 2000-07-11 | Cardima, Inc. | Method and system for using multiple intravascular sensing devices to detect electrical activity |
| US6141576A (en) * | 1993-01-29 | 2000-10-31 | Cardima, Inc. | Intravascular sensing device |
| US5549109A (en) * | 1993-10-01 | 1996-08-27 | Target Therapeutics, Inc. | Sheathed multipolar catheter and multipolar guidewire for sensing cardiac electrical activity |
| US5711298A (en) * | 1994-01-27 | 1998-01-27 | Cardima, Inc. | High resolution intravascular signal detection |
| US5957842A (en) * | 1994-01-27 | 1999-09-28 | Cardima, Inc. | High resolution intravascular signal detection |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1557087A (en:Method) | 1969-02-14 |
| GB1219017A (en) | 1971-01-13 |
| BE724943A (en:Method) | 1969-06-05 |
| NL6817868A (en:Method) | 1969-06-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1813232A1 (de) | Elektrischer Leiter fuer elektrosystolische Stimulatoren | |
| DE69618028T2 (de) | Medizinische zuleitung mit kompressionslumen | |
| DE69426814T2 (de) | Herzschrittmacher- und defibrillationselektrodenleitung, die die erfassung von signalen ermöglicht | |
| DE69114173T2 (de) | Mit positiver Verankerung, zurückziehbarer, dreipoliger Katheter für endokardische Herzschrittmacherelektroden. | |
| DE112011102168B4 (de) | Medizinische elektrische Kabelanordnung und deren Verwendung, EKG-Kabel und Elektrokardiographie (EKG)-Anordnung | |
| DE2652195B2 (de) | Herzschrittmacherelektrodenanordnung | |
| DE1589507A1 (de) | Elektrode | |
| DE2319500A1 (de) | Implantable leitungsanordnung | |
| DE1466768B2 (de) | Bewegungsfehlerfreie Elektrodenanordnung | |
| DE2319054A1 (de) | Endocardelektrode | |
| CH662669A5 (de) | Leitvorrichtung zum mindestens teilweisen einsetzen in einen menschlichen oder tierischen koerper, mit einer zumindest aus einem leiter gebildeten wendel. | |
| DE3122812A1 (de) | Elektrodenanordnung zum einfuehren in einen katheter | |
| DE2319499A1 (de) | Implantable leitungsanordnung | |
| DE3223152A1 (de) | Vorrichtung zum pruefen der befestigung einer ekg-elektrode | |
| DE2157137A1 (de) | Vorrichtung zur Stimulierung einer Muskeltätigkeit oder zur Abfuhr von elektrischer Energie infolge einet Muskeltätigkeit | |
| DE1498612B1 (de) | Messsonde fuer Untersuchungen im Koerperinneren mit einer elektrochemischen Messzelle | |
| DE19800697A1 (de) | Einzel-Elektrodensonde, insbesondere für implantierbare Defibrillatoren | |
| EP2166940B1 (de) | Elektrodenanordnung und messvorrichtung zur messung der elektrischen aktivität in einem elektrisch aktiven gewebe | |
| EP0369044A1 (de) | Elektrodenanordnung | |
| DE2950022A1 (de) | Elektrischer leiter zur implantation in den meschlichen koerper | |
| DE102015204207B4 (de) | Elektrode zum Herstellen eines elektrischen Kontakts mit Haut | |
| Hannerz | An electrode for recording single motor unit activity during strong muscle contractions | |
| EP0017953B1 (de) | Garnitur für das Ende eines Mittelspannungs- oder Hochspannungskabels | |
| EP2446922B1 (de) | Implantierbare Leiter mit zusätzlichen Leitern zur Feldentkopplung | |
| DE69225783T2 (de) | Reizungssonde, insbesonders herzschrittmachende, versehen mit einem zusätzlichen Pol als elektrische Schaltverbindung |