CS228117B2 - Způsob výroby derivátů 3-nitropyrrolu - Google Patents
Způsob výroby derivátů 3-nitropyrrolu Download PDFInfo
- Publication number
- CS228117B2 CS228117B2 CS372579A CS372579A CS228117B2 CS 228117 B2 CS228117 B2 CS 228117B2 CS 372579 A CS372579 A CS 372579A CS 372579 A CS372579 A CS 372579A CS 228117 B2 CS228117 B2 CS 228117B2
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- nitro
- methylthio
- mol
- histamine
- solution
- Prior art date
Links
- 150000005244 3-nitropyrroles Chemical class 0.000 title claims 2
- 238000004519 manufacturing process Methods 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 12
- -1 4-imidazolyl Chemical group 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 36
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 26
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 23
- 229910052739 hydrogen Inorganic materials 0.000 description 21
- 229910052757 nitrogen Inorganic materials 0.000 description 21
- 239000000203 mixture Substances 0.000 description 19
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 229960001340 histamine Drugs 0.000 description 18
- 229910052717 sulfur Inorganic materials 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 13
- 229910052799 carbon Inorganic materials 0.000 description 12
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000741 silica gel Substances 0.000 description 8
- 229910002027 silica gel Inorganic materials 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 230000004071 biological effect Effects 0.000 description 6
- 230000008018 melting Effects 0.000 description 6
- 238000002844 melting Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000000739 antihistaminic agent Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 4
- 230000027119 gastric acid secretion Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- YDLUFXQFKDNJBT-UHFFFAOYSA-N 2-methylsulfanyl-3-nitro-1h-pyrrole Chemical compound CSC=1NC=CC=1[N+]([O-])=O YDLUFXQFKDNJBT-UHFFFAOYSA-N 0.000 description 3
- VNHRBDZDRWBDPB-UHFFFAOYSA-N 2-methylsulfinyl-3-nitro-1h-pyrrole Chemical compound CS(=O)C=1NC=CC=1[N+]([O-])=O VNHRBDZDRWBDPB-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000003480 eluent Substances 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- YECBIJXISLIIDS-UHFFFAOYSA-N mepyramine Chemical compound C1=CC(OC)=CC=C1CN(CCN(C)C)C1=CC=CC=N1 YECBIJXISLIIDS-UHFFFAOYSA-N 0.000 description 3
- 229960000582 mepyramine Drugs 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- XTBZYMOXUSCADZ-UHFFFAOYSA-N 1-methylsulfanyl-1-methylsulfinyl-2-nitroethene Chemical group CSC(S(C)=O)=C[N+]([O-])=O XTBZYMOXUSCADZ-UHFFFAOYSA-N 0.000 description 2
- JFGCGQJHMUYGLU-UHFFFAOYSA-N 2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethanamine Chemical compound CN(C)CC1=CC=C(CSCCN)O1 JFGCGQJHMUYGLU-UHFFFAOYSA-N 0.000 description 2
- ZUYBJAJYOKFDDQ-UHFFFAOYSA-N 2-methylsulfanyl-3-nitro-4-(2-phenylethyl)-1h-pyrrole Chemical compound [O-][N+](=O)C1=C(SC)NC=C1CCC1=CC=CC=C1 ZUYBJAJYOKFDDQ-UHFFFAOYSA-N 0.000 description 2
- PFPJOYOZALIOIC-UHFFFAOYSA-N 2-methylsulfanyl-3-nitro-4-phenyl-1h-pyrrole Chemical compound [O-][N+](=O)C1=C(SC)NC=C1C1=CC=CC=C1 PFPJOYOZALIOIC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 229940125715 antihistaminic agent Drugs 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- RIMGDBZXWSGBQN-UHFFFAOYSA-N burimamide Chemical compound CNC(=S)NCCCCC1=CN=C[N]1 RIMGDBZXWSGBQN-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 210000002837 heart atrium Anatomy 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 102000005962 receptors Human genes 0.000 description 2
- 108020003175 receptors Proteins 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- OHKDDAKDIQTBBJ-UHFFFAOYSA-N 1-amino-4-phenylbutan-2-one;hydrochloride Chemical compound Cl.NCC(=O)CCC1=CC=CC=C1 OHKDDAKDIQTBBJ-UHFFFAOYSA-N 0.000 description 1
- RWCAZKKJQIFNJQ-UHFFFAOYSA-N 1-aminohexan-2-one;hydrochloride Chemical compound Cl.CCCCC(=O)CN RWCAZKKJQIFNJQ-UHFFFAOYSA-N 0.000 description 1
- CWJQOBWHGWRZIC-UHFFFAOYSA-N 1-phenylpropan-2-one;hydrochloride Chemical compound Cl.CC(=O)CC1=CC=CC=C1 CWJQOBWHGWRZIC-UHFFFAOYSA-N 0.000 description 1
- GPFVECHZBIVMOS-UHFFFAOYSA-N 2,2-diethoxy-n-(1-methylsulfanyl-2-nitroethenyl)ethanamine Chemical group CCOC(OCC)CNC(SC)=C[N+]([O-])=O GPFVECHZBIVMOS-UHFFFAOYSA-N 0.000 description 1
- MRGVUWNMTRFDSW-UHFFFAOYSA-N 2-(2-phenylethyl)-1h-pyrrole Chemical compound C=1C=CNC=1CCC1=CC=CC=C1 MRGVUWNMTRFDSW-UHFFFAOYSA-N 0.000 description 1
- YZKAGUHQYDCQOL-UHFFFAOYSA-N 2-benzyl-1h-pyrrole Chemical compound C=1C=CC=CC=1CC1=CC=CN1 YZKAGUHQYDCQOL-UHFFFAOYSA-N 0.000 description 1
- RUCLDQBBIJKQHO-UHFFFAOYSA-N 2-oxopropylazanium;chloride Chemical compound Cl.CC(=O)CN RUCLDQBBIJKQHO-UHFFFAOYSA-N 0.000 description 1
- PNAQFQQNFKUJCT-UHFFFAOYSA-N 4-benzyl-2-methylsulfanyl-3-nitro-1h-pyrrole Chemical compound [O-][N+](=O)C1=C(SC)NC=C1CC1=CC=CC=C1 PNAQFQQNFKUJCT-UHFFFAOYSA-N 0.000 description 1
- ZXBIXOCQHMQTFW-UHFFFAOYSA-N 4-benzyl-2-methylsulfinyl-3-nitro-1h-pyrrole Chemical compound [O-][N+](=O)C1=C(S(=O)C)NC=C1CC1=CC=CC=C1 ZXBIXOCQHMQTFW-UHFFFAOYSA-N 0.000 description 1
- UDCSEZKLZVOSMP-UHFFFAOYSA-N 4-benzyl-n-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]-3-nitro-1h-pyrrol-2-amine Chemical compound N1C=NC(CSCCNC2=C(C(CC=3C=CC=CC=3)=CN2)[N+]([O-])=O)=C1C UDCSEZKLZVOSMP-UHFFFAOYSA-N 0.000 description 1
- MPSOJYLNFNSPQQ-UHFFFAOYSA-N 4-butyl-2-methylsulfanyl-3-nitro-1h-pyrrole Chemical compound CCCCC1=CNC(SC)=C1[N+]([O-])=O MPSOJYLNFNSPQQ-UHFFFAOYSA-N 0.000 description 1
- CQVIHCSWIJOZAM-UHFFFAOYSA-N 4-butyl-2-methylsulfinyl-3-nitro-1h-pyrrole Chemical compound CCCCC1=CNC(S(C)=O)=C1[N+]([O-])=O CQVIHCSWIJOZAM-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- CBPMJSWKGZBBSW-UHFFFAOYSA-N CS(=O)(=O)C=1NC=C(C1[N+](=O)[O-])C Chemical compound CS(=O)(=O)C=1NC=C(C1[N+](=O)[O-])C CBPMJSWKGZBBSW-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 102000003710 Histamine H2 Receptors Human genes 0.000 description 1
- 108090000050 Histamine H2 Receptors Proteins 0.000 description 1
- 102000000543 Histamine Receptors Human genes 0.000 description 1
- 108010002059 Histamine Receptors Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- CJXFSHWDLBBVSZ-UHFFFAOYSA-N ethyl 2-acetamido-3-oxoheptanoate Chemical compound CCCCC(=O)C(NC(C)=O)C(=O)OCC CJXFSHWDLBBVSZ-UHFFFAOYSA-N 0.000 description 1
- CNDRGQIPNUJNEQ-UHFFFAOYSA-N ethyl 2-acetyl-3-oxoheptanoate Chemical compound CCCCC(=O)C(C(C)=O)C(=O)OCC CNDRGQIPNUJNEQ-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000003485 histamine H2 receptor antagonist Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- ZGGDLECHSNKHJF-UHFFFAOYSA-N n-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]-3-nitro-4-(2-phenylethyl)-1h-pyrrol-2-amine Chemical compound N1C=NC(CSCCNC2=C(C(CCC=3C=CC=CC=3)=CN2)[N+]([O-])=O)=C1C ZGGDLECHSNKHJF-UHFFFAOYSA-N 0.000 description 1
- KRAPUWBZRULVHM-UHFFFAOYSA-N n-[2-[(5-methyl-1h-imidazol-4-yl)methylsulfanyl]ethyl]-3-nitro-4-phenyl-1h-pyrrol-2-amine Chemical compound N1C=NC(CSCCNC2=C(C(=CN2)C=2C=CC=CC=2)[N+]([O-])=O)=C1C KRAPUWBZRULVHM-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002464 receptor antagonist Substances 0.000 description 1
- 229940044551 receptor antagonist Drugs 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid group Chemical group S(O)(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2411778 | 1978-05-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS228117B2 true CS228117B2 (cs) | 1984-05-14 |
Family
ID=10206663
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS372579A CS228117B2 (cs) | 1978-05-30 | 1979-05-30 | Způsob výroby derivátů 3-nitropyrrolu |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS54157556A (de) |
| AT (1) | AT375368B (de) |
| CS (1) | CS228117B2 (de) |
| HU (1) | HU180082B (de) |
| SU (1) | SU1003755A3 (de) |
| ZA (1) | ZA792607B (de) |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1419994A (en) * | 1973-05-03 | 1976-01-07 | Smith Kline French Lab | Heterocyclicalkylaminotheterocyclic compounds methods for their preparation and compositions comprising them |
| MW5076A1 (en) * | 1975-12-29 | 1978-02-08 | Smith Kline French Lab | Pharmacologicalle active compounds |
-
1979
- 1979-05-28 ZA ZA792607A patent/ZA792607B/xx unknown
- 1979-05-29 SU SU792772805A patent/SU1003755A3/ru active
- 1979-05-29 HU HUSI001695 patent/HU180082B/hu unknown
- 1979-05-29 JP JP6740079A patent/JPS54157556A/ja active Pending
- 1979-05-30 AT AT395279A patent/AT375368B/de not_active IP Right Cessation
- 1979-05-30 CS CS372579A patent/CS228117B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA792607B (en) | 1980-07-30 |
| AT375368B (de) | 1984-07-25 |
| ATA395279A (de) | 1983-12-15 |
| JPS54157556A (en) | 1979-12-12 |
| HU180082B (hu) | 1983-01-28 |
| SU1003755A3 (ru) | 1983-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3752826A (en) | Aroyl substituted pyrroles | |
| US3932644A (en) | H2 histamine receptor inhibitors | |
| FI66000C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 2-amino-4-pyrimidonderivat | |
| US4169154A (en) | Method of treating depression with thiourea derivatives | |
| DK157862B (da) | Analogifremgangsmaade til fremstilling af imidazolylphenylamidiner eller farmaceutisk acceptable syreadditionssalte deraf | |
| EP0172608B1 (de) | Triazin-Derivat, Verfahren zu seiner Herstellung und dieses enthaltende pharmazeutische Zubereitungen | |
| US4005205A (en) | Compositions and methods for inhibiting H2 histamine receptors | |
| FI68399B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 2-amino-3-nitropyrrolderivat | |
| IE48740B1 (en) | N-(2-thiazolyl)amides and their use as anti-inflammatory and immunoregulatory agents | |
| GB2061274A (en) | 3-benzoyl-2-nitrophenylacetic acids metal salts amides and esters | |
| JPS5946220B2 (ja) | 複素環化合物の製法 | |
| US4104381A (en) | Pharmacologically active compounds | |
| CS200543B2 (en) | Method of producing novel derivatives of pyrido-2,3-b-1,5-benzothiazepine | |
| CS228117B2 (cs) | Způsob výroby derivátů 3-nitropyrrolu | |
| US4153793A (en) | Imidazo alkylamino pyrimidones | |
| US4181730A (en) | Pharmacologically active compounds as inhibitors of H-2 histamine receptors | |
| NZ201642A (en) | 1-phenylindazol-3-one derivatives and pharmaceutical compositions | |
| Shafik et al. | Synthesis of novel 2-[2-(substituted amino) phenethyl]-1H-benzimidazoles; 3, 4-dihydro and 1, 2, 3, 4,-tetrahydropyrimido [1, 6-a]-benzimidazoles as potential antiulcer agents | |
| GB1592453A (en) | Aminoalkyl esters of carbarimidothioic acid and compositions having immunosuppressant activity | |
| AU5136700A (en) | Thiazolopyrimidines useful as tnfalpha inhibitors | |
| US4584384A (en) | Nitro pyrroles | |
| NO772669L (no) | Fremgangsm}te for fremstilling av farmakologisk aktive forbindelser | |
| US4259335A (en) | 1-Methyl-4-piperidinol esters of 4-quinolinylamino benzoates and antiinflammatory and analgesic compositions and methods employing them | |
| US4467087A (en) | 1,2,4-Triazines | |
| GB2063263A (en) | A 1-isopropyl-4-phenyl-2(1H)- quinazolinone Derivative |