CS195829B1 - Deriváty močoviny a způsob jejich přípravy - Google Patents
Deriváty močoviny a způsob jejich přípravy Download PDFInfo
- Publication number
- CS195829B1 CS195829B1 CS764874A CS764874A CS195829B1 CS 195829 B1 CS195829 B1 CS 195829B1 CS 764874 A CS764874 A CS 764874A CS 764874 A CS764874 A CS 764874A CS 195829 B1 CS195829 B1 CS 195829B1
- Authority
- CS
- Czechoslovakia
- Prior art keywords
- derivatives
- sugar
- benzoyl
- chloroethylamine
- formula
- Prior art date
Links
- 150000003672 ureas Chemical class 0.000 title claims description 8
- 238000000034 method Methods 0.000 title claims description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- VKPPFDPXZWFDFA-UHFFFAOYSA-N 2-chloroethanamine Chemical compound NCCCl VKPPFDPXZWFDFA-UHFFFAOYSA-N 0.000 claims description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 3
- -1 aliphatic organic acid Chemical class 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 2
- ASJSAQIRZKANQN-CRCLSJGQSA-N 2-deoxy-D-ribose Chemical compound OC[C@@H](O)[C@@H](O)CC=O ASJSAQIRZKANQN-CRCLSJGQSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- HMFHBZSHGGEWLO-SOOFDHNKSA-N D-ribofuranose Chemical compound OC[C@H]1OC(O)[C@H](O)[C@@H]1O HMFHBZSHGGEWLO-SOOFDHNKSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- PYMYPHUHKUWMLA-LMVFSUKVSA-N Ribose Natural products OC[C@@H](O)[C@@H](O)[C@@H](O)C=O PYMYPHUHKUWMLA-LMVFSUKVSA-N 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims description 2
- HMFHBZSHGGEWLO-UHFFFAOYSA-N alpha-D-Furanose-Ribose Natural products OCC1OC(O)C(O)C1O HMFHBZSHGGEWLO-UHFFFAOYSA-N 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- 229910052788 barium Inorganic materials 0.000 claims description 2
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 2
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 4
- 244000309464 bull Species 0.000 description 3
- 230000000340 anti-metabolite Effects 0.000 description 2
- 229940100197 antimetabolite Drugs 0.000 description 2
- 239000002256 antimetabolite Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002777 nucleoside Substances 0.000 description 2
- 150000003833 nucleoside derivatives Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- RYLTXMGSVFOQKY-UHFFFAOYSA-N 1,3-thiazolidin-5-one Chemical compound O=C1CNCS1 RYLTXMGSVFOQKY-UHFFFAOYSA-N 0.000 description 1
- VSNHCAURESNICA-NJFSPNSNSA-N 1-oxidanylurea Chemical compound N[14C](=O)NO VSNHCAURESNICA-NJFSPNSNSA-N 0.000 description 1
- VSNHCAURESNICA-UHFFFAOYSA-N Hydroxyurea Chemical compound NC(=O)NO VSNHCAURESNICA-UHFFFAOYSA-N 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229960001330 hydroxycarbamide Drugs 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
Landscapes
- Saccharide Compounds (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS764874A CS195829B1 (cs) | 1974-11-11 | 1974-11-11 | Deriváty močoviny a způsob jejich přípravy |
| DD18538375A DD121508A1 (en:Method) | 1974-11-11 | 1975-04-11 | |
| HUCE001047 HU170389B (en:Method) | 1974-11-11 | 1975-05-20 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CS764874A CS195829B1 (cs) | 1974-11-11 | 1974-11-11 | Deriváty močoviny a způsob jejich přípravy |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CS195829B1 true CS195829B1 (cs) | 1980-02-29 |
Family
ID=5426001
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CS764874A CS195829B1 (cs) | 1974-11-11 | 1974-11-11 | Deriváty močoviny a způsob jejich přípravy |
Country Status (3)
| Country | Link |
|---|---|
| CS (1) | CS195829B1 (en:Method) |
| DD (1) | DD121508A1 (en:Method) |
| HU (1) | HU170389B (en:Method) |
-
1974
- 1974-11-11 CS CS764874A patent/CS195829B1/cs unknown
-
1975
- 1975-04-11 DD DD18538375A patent/DD121508A1/xx unknown
- 1975-05-20 HU HUCE001047 patent/HU170389B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DD121508A1 (en:Method) | 1976-08-05 |
| HU170389B (en:Method) | 1977-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI89804C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva 5'-deoxi-5-fluorcytidinderivat | |
| US9315523B2 (en) | Cyclic dinucleosides | |
| AU2020201369A1 (en) | Synthesis of polycyclic-carbamoylpyridone compounds | |
| US2515483A (en) | Diacylated pteroic acid and process for preparing same | |
| US3309359A (en) | N-mono-acyl-5-fluorocytosine derivatives and process | |
| SU452961A3 (ru) | Способ получени пиримидиннуклеозидов | |
| DK152134B (da) | Fremgangsmaade til fremstilling af 5-azapyrimidinnukleosider | |
| AU2017238918B2 (en) | Novel crystalline form of 1-(5-(2,4-difluorophenyl)-1-((3- fluorophenyl)sulfonyl)-4-methoxy-1H-pyrrol-3-yl)-N- methylmethanamine salt | |
| CZ278366B6 (en) | Novel 2', 3'-dideoxy-2'-fluoronucleosides, process of their preparation and pharmaceutical preparations in which they are comprised | |
| US20200375983A1 (en) | A process for the preparation of cariprazine hydrochloride | |
| Foye et al. | N‐glucopyranosyl‐5‐aralkylidenerhodanines: Synthesis and antibacterial and antiviral activities | |
| US4341769A (en) | 2,6-Diaminonebularines, their production and use | |
| CS195829B1 (cs) | Deriváty močoviny a způsob jejich přípravy | |
| US3635946A (en) | N1-(2'-furanidyl)-derivatives of 5-substituted uracils | |
| Abdurazakov et al. | Alternative and efficient method for the preparation of 2-acetamidobenzimidazoles | |
| US4954485A (en) | 2',3'-dideoxy-4-thio-uridine derivatives, process for their preparation and antivirus agents using them | |
| SU489310A3 (ru) | Способ получени производного бифенилацетамида или его соли | |
| JPH0121828B2 (en:Method) | ||
| KR880001105B1 (ko) | 1-벤질-4-[4-(2-피리미디닐아미노)벤질]-2,3-디옥소피페라진 유도체의 제조방법 | |
| US3939172A (en) | 4-Aminothiazole | |
| RU2785779C1 (ru) | Использование этил-4-(4-гидрокси-2-оксо-4-(тиофен-2-ил)бут-3-ентиоамидо)бензоат для лечения заболеваний, вызываемых золотистым стафилококком | |
| Maste et al. | Synthesis and Evaluation of Benzimidazole Derivatives for Anti-tubercular and Antimicrobial Activities. | |
| SU571187A3 (ru) | Способ получени производных 2аминометил-4,6-дигелоидофенола | |
| RU2770598C1 (ru) | ПРИМЕНЕНИЕ ПРОТИВОГРИБКОВОГО СРЕДСТВА НА ОСНОВЕ 2-((4-R1-5-R2-3-(ЭТОКСИКАРБОНИЛ)ТИОФЕН-2-ИЛ)АМИНО)-4-ОКСО-4-R3-БУТ-2-ЕНОВЫХ КИСЛОТ ПО ОТНОШЕНИЮ К Candida aldicans | |
| SU545259A3 (ru) | Способ получени -замещенных циклосериновых соединений или их солей |