CH617160A5 - - Google Patents
Download PDFInfo
- Publication number
- CH617160A5 CH617160A5 CH1412674A CH1412674A CH617160A5 CH 617160 A5 CH617160 A5 CH 617160A5 CH 1412674 A CH1412674 A CH 1412674A CH 1412674 A CH1412674 A CH 1412674A CH 617160 A5 CH617160 A5 CH 617160A5
- Authority
- CH
- Switzerland
- Prior art keywords
- chlorination
- salt
- tower
- mgcl2
- chamber
- Prior art date
Links
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 claims description 56
- 150000003839 salts Chemical class 0.000 claims description 35
- 238000005660 chlorination reaction Methods 0.000 claims description 33
- 229910001629 magnesium chloride Inorganic materials 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 239000007789 gas Substances 0.000 claims description 18
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 10
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 10
- 239000012535 impurity Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 9
- 239000001301 oxygen Substances 0.000 claims description 9
- 229910052760 oxygen Inorganic materials 0.000 claims description 9
- 239000007788 liquid Substances 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 7
- 239000000395 magnesium oxide Substances 0.000 claims description 6
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 6
- 238000002844 melting Methods 0.000 claims description 6
- 230000008018 melting Effects 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 238000000926 separation method Methods 0.000 claims description 5
- 230000005484 gravity Effects 0.000 claims description 3
- 229910001510 metal chloride Inorganic materials 0.000 claims description 3
- 238000004064 recycling Methods 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 238000001035 drying Methods 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000003575 carbonaceous material Substances 0.000 claims 3
- 239000007787 solid Substances 0.000 claims 2
- 238000007792 addition Methods 0.000 claims 1
- 238000010924 continuous production Methods 0.000 claims 1
- 150000004677 hydrates Chemical class 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- 239000012768 molten material Substances 0.000 claims 1
- 230000000717 retained effect Effects 0.000 claims 1
- 239000000571 coke Substances 0.000 description 11
- 239000000463 material Substances 0.000 description 6
- 229910000831 Steel Inorganic materials 0.000 description 5
- 239000010959 steel Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000011449 brick Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Inorganic materials [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- IQYKECCCHDLEPX-UHFFFAOYSA-N chloro hypochlorite;magnesium Chemical class [Mg].ClOCl IQYKECCCHDLEPX-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000005086 pumping Methods 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- KZHJGOXRZJKJNY-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Si]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O.O=[Al]O[Al]=O KZHJGOXRZJKJNY-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910021397 glassy carbon Inorganic materials 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Inorganic materials [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 1
- ZATZOOLBPDMARD-UHFFFAOYSA-N magnesium;hydrate Chemical class O.[Mg] ZATZOOLBPDMARD-UHFFFAOYSA-N 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 229910052863 mullite Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000013014 purified material Substances 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 229910052851 sillimanite Inorganic materials 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01D—COMPOUNDS OF ALKALI METALS, i.e. LITHIUM, SODIUM, POTASSIUM, RUBIDIUM, CAESIUM, OR FRANCIUM
- C01D3/00—Halides of sodium, potassium or alkali metals in general
- C01D3/14—Purification
- C01D3/20—Purification by melting
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01F—COMPOUNDS OF THE METALS BERYLLIUM, MAGNESIUM, ALUMINIUM, CALCIUM, STRONTIUM, BARIUM, RADIUM, THORIUM, OR OF THE RARE-EARTH METALS
- C01F5/00—Compounds of magnesium
- C01F5/26—Magnesium halides
- C01F5/30—Chlorides
- C01F5/32—Preparation of anhydrous magnesium chloride by chlorinating magnesium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
- Electrolytic Production Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT30784/73A IT999123B (it) | 1973-10-31 | 1973-10-31 | Processo per produrre cloruro di magnesic anidro ed apparecchia tura relativa |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH617160A5 true CH617160A5 (show.php) | 1980-05-14 |
Family
ID=11232011
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1412674A CH617160A5 (show.php) | 1973-10-31 | 1974-10-22 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4302433A (show.php) |
| BE (1) | BE821672A (show.php) |
| CH (1) | CH617160A5 (show.php) |
| DE (1) | DE2451840C3 (show.php) |
| ES (1) | ES431679A1 (show.php) |
| FR (1) | FR2249830B1 (show.php) |
| GB (1) | GB1478864A (show.php) |
| IT (1) | IT999123B (show.php) |
| NL (1) | NL173512C (show.php) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4415538A (en) * | 1981-04-06 | 1983-11-15 | Ivanov Andrei B | Apparatus for chlorination of molten magnesium chloride salts |
| US4526761A (en) * | 1981-04-06 | 1985-07-02 | Ivanov Andrei B | Apparatus for chlorination of molten magnesium chloride salts |
| US4943426A (en) * | 1988-06-20 | 1990-07-24 | Aluminum Company Of America | Method for regulating reaction temperature |
| US4981674A (en) * | 1988-12-13 | 1991-01-01 | Noranda, Inc. | Production of anhydrous magnesium chloride |
| US5565080A (en) * | 1994-05-17 | 1996-10-15 | Noranda Metallurgy Inc. | Preparation of anhydrous magnesium chloride-containing melts from hydrated magnesium chloride |
| RU2165887C1 (ru) * | 1999-08-09 | 2001-04-27 | Открытое акционерное общество "АВИСМА титано-магниевый комбинат" | Способ получения безводного карналлита и устройство для его осуществления |
| RU2175998C1 (ru) * | 2000-04-07 | 2001-11-20 | Открытое акционерное общество "АВИСМА титано-магниевый комбинат" | Способ подготовки хлормагниевого сырья к электролизу |
| RU2186878C2 (ru) * | 2000-07-04 | 2002-08-10 | Открытое акционерное общество "АВИСМА титано-магниевый комбинат" | Способ подготовки хлормагниевого сырья к электролизу и устройство для его осуществления |
| RU2332526C2 (ru) * | 2006-07-21 | 2008-08-27 | Открытое Акционерное Общество "Российский научно-исследовательский и проектный институт титана и магния" (ОАО "РИТМ") | Способ подготовки хлормагниевого сырья к электролитическому производству магния и устройство для его осуществления |
| RU2473467C1 (ru) * | 2011-05-20 | 2013-01-27 | Федеральное государственное автономное образовательное учреждение высшего профессионального образования Уральский федеральный университет имени первого Президента России Б.Н. Ельцина | Способ получения синтетического карналлита |
| RU2503749C1 (ru) * | 2012-07-20 | 2014-01-10 | Открытое Акционерное Общество "Корпорация Всмпо-Ависма" | Устройство подготовки карналлита для электролитического получения магния и хлора |
| RU2677448C1 (ru) * | 2018-02-05 | 2019-01-16 | Публичное Акционерное Общество "Корпорация Всмпо-Ависма" | Способ подготовки электролита для электролитического получения магния и хлора и устройство для его осуществления |
| KR102063810B1 (ko) * | 2018-06-07 | 2020-01-08 | 재단법인 포항산업과학연구원 | 염화 리튬 제조방법 및 그 장치 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB108920A (en) * | 1916-09-19 | 1917-08-30 | Edgar Arthur Ashcroft | Improvements in the Manufacture of Anhydrous Magnesium Chloride alone or conjointly with other Metal Chlorides. |
| US1457493A (en) * | 1922-01-11 | 1923-06-05 | Donald B Bradner | Process of making phosgene |
| US1702301A (en) * | 1926-01-15 | 1929-02-19 | Firm I G Farbenindustrie Ag | Process for producing metal chlorides free from water and oxides |
| US2165284A (en) * | 1938-01-25 | 1939-07-11 | Samuel L Madorsky | Process for producing electrolytic magnesium |
| US3067006A (en) * | 1959-05-05 | 1962-12-04 | Knapsack Ag | Process and apparatus for the manufacture of anhydrous magnesium chloride which is substantially free from magnesium oxide |
| GB886212A (en) * | 1959-05-05 | 1962-01-03 | Knapsack Ag | Process for the manufacture of anhydrous magnesium chloride |
| US3317414A (en) * | 1964-03-17 | 1967-05-02 | Magnalith Corp | Production of magnesium chloride and magnesium metal |
| US3369864A (en) * | 1965-07-28 | 1968-02-20 | Exxon Research Engineering Co | Production of anhydrous magnesium chloride |
| AU430466B2 (en) * | 1969-11-17 | 1972-11-27 | The Dow Chemical Company | Preparation of anhydrous magnesium chloride |
| NL168197C (nl) * | 1970-03-31 | 1982-03-16 | Shell Int Research | Werkwijze voor de bereiding van watervrij magnesiumchloride. |
-
1973
- 1973-10-31 IT IT30784/73A patent/IT999123B/it active
- 1973-12-27 FR FR7346600A patent/FR2249830B1/fr not_active Expired
-
1974
- 1974-10-22 CH CH1412674A patent/CH617160A5/it not_active IP Right Cessation
- 1974-10-28 GB GB46609/74A patent/GB1478864A/en not_active Expired
- 1974-10-30 NL NLAANVRAGE7414207,A patent/NL173512C/xx not_active IP Right Cessation
- 1974-10-30 ES ES431679A patent/ES431679A1/es not_active Expired
- 1974-10-30 BE BE150049A patent/BE821672A/xx not_active IP Right Cessation
- 1974-10-31 DE DE2451840A patent/DE2451840C3/de not_active Expired
-
1977
- 1977-05-02 US US05/792,911 patent/US4302433A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2249830A1 (show.php) | 1975-05-30 |
| DE2451840B2 (de) | 1978-01-12 |
| NL173512C (nl) | 1984-02-01 |
| DE2451840A1 (de) | 1975-09-25 |
| DE2451840C3 (de) | 1978-09-21 |
| NL173512B (nl) | 1983-09-01 |
| ES431679A1 (es) | 1977-04-16 |
| NL7414207A (nl) | 1975-05-02 |
| FR2249830B1 (show.php) | 1977-08-12 |
| IT999123B (it) | 1976-02-20 |
| GB1478864A (en) | 1977-07-06 |
| US4302433A (en) | 1981-11-24 |
| BE821672A (fr) | 1975-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH617160A5 (show.php) | ||
| AU2002335251B2 (en) | Method and apparatus for smelting titanium metal | |
| CA1245178A (en) | Combination diaphragm and fractional crystallization cell | |
| RU96123709A (ru) | Способ получения расплава или электролита, содержащих безводный хлорид магния, из гидрохлорида магния и получения металлического магния | |
| NO790412L (no) | E fremgangsmaate til fremstilling av aluminium ved elektrolys | |
| UA65558C2 (en) | A process for the electrolytic production of metals | |
| US3502553A (en) | Process and apparatus for the electrolytic continuous direct production of refined aluminum and of aluminum alloys | |
| Shekhovtsov et al. | Magnesium electrolytic production process | |
| US5665220A (en) | Electrolytic magnesium production process | |
| US4617098A (en) | Continuous electrolysis of lithium chloride into lithium metal | |
| US3405043A (en) | Method of producing silicon and electrolytic cell therefor | |
| Aghion et al. | Production technologies of magnesium | |
| Habashi | Extractive metallurgy of aluminum | |
| US3418223A (en) | Continuous process for producing magnesium metal from magnesium chloride including fused bath electrolysis | |
| US2468022A (en) | Electrolytic apparatus for producing magnesium | |
| RU2457285C1 (ru) | Электролизер для производства алюминия | |
| US2859160A (en) | Electrolytic cell for producing aluminum | |
| RU2128730C1 (ru) | Способ получения магния и хлора, поточная линия для его осуществления и ее части | |
| US2055359A (en) | Electrolytic process for producing magnesium | |
| RU2503749C1 (ru) | Устройство подготовки карналлита для электролитического получения магния и хлора | |
| EP0109953B1 (en) | Method for electrolytically obtaining magnesium metal | |
| US3616439A (en) | Continuous process for the electrolytic production of aluminum and apparatus therefor | |
| US5660710A (en) | Method and apparatus for electrolyzing light metals | |
| JP2004143557A (ja) | 金属チタン製錬用の消耗性炭素陽極 | |
| US2451491A (en) | Enriching the alumina content of recirculated cryolite fusions in aluminum production |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PFA | Name/firm changed |
Owner name: ENICHEM ANIC S.P.A. |
|
| PL | Patent ceased | ||
| PL | Patent ceased |