CH513952A - Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen - Google Patents
Verfahren zur Herstellung von wasserunlöslichen MonoazofarbstoffenInfo
- Publication number
- CH513952A CH513952A CH992069A CH992069A CH513952A CH 513952 A CH513952 A CH 513952A CH 992069 A CH992069 A CH 992069A CH 992069 A CH992069 A CH 992069A CH 513952 A CH513952 A CH 513952A
- Authority
- CH
- Switzerland
- Prior art keywords
- preparation
- water
- monoazo dyes
- insoluble monoazo
- insoluble
- Prior art date
Links
- 239000000975 dye Substances 0.000 title 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
- C09B29/363—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O) from diazotized amino carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3076168 | 1968-06-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH513952A true CH513952A (de) | 1971-10-15 |
Family
ID=10312732
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH992069A CH513952A (de) | 1968-06-27 | 1969-06-27 | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3657214A (enExample) |
| CH (1) | CH513952A (enExample) |
| DE (1) | DE1932808A1 (enExample) |
| FR (1) | FR2014338B1 (enExample) |
| GB (1) | GB1256714A (enExample) |
| NL (1) | NL6909862A (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4001205A (en) * | 1968-07-15 | 1977-01-04 | Ciba-Geigy Ag | Water-soluble, fiber-reactive phenylazodihydroxy, methyl, cyanopyridine dyestuffs |
| US3957749A (en) * | 1968-12-07 | 1976-05-18 | Cassella Farbwerke Mainkur Aktiengesellschaft | Water-insoluble monoazo pyridine dyes |
| US3936436A (en) * | 1969-12-22 | 1976-02-03 | Imperial Chemical Industries Limited | Water-soluble azo dyestuffs containing triazine and 3-azo-2,6-dihydroxypyrid-6-one radicals |
| US4067864A (en) * | 1970-05-15 | 1978-01-10 | Ciba-Geigy Ag | Fiber-reactive 2-hydroxy-pyrid-6-on-(3)-yl azo dyestuffs |
| US4017477A (en) * | 1970-08-19 | 1977-04-12 | Ciba-Geigy Ag | 3-Halogeno-6-hydroxy-pyridone-(2) azo dyestuffs |
| DE2251719A1 (de) * | 1972-10-21 | 1974-04-25 | Basf Ag 6700 Ludwigshafen | Dispersionsfarbstoffe der 2,6diaminopyridinreihe |
| US4039523A (en) * | 1970-12-22 | 1977-08-02 | Ciba-Geigy Ag | 3-Sulfoalkyl-6-hydroxy-pyrid-(2)-one-containing azo dyestuffs |
| GB1377613A (en) * | 1971-01-04 | 1974-12-18 | Ici Ltd | Azo dyestuffs containing hydroxy pyridone residues |
| US3954396A (en) * | 1971-09-24 | 1976-05-04 | Cassella Farbwerke Mainkur Aktiengesellschaft | Dyeing synthetic materials with a dodecyl benzoicacid ester-azo-(3-cyano-4-methyl-6-hydroxy-2-pyridone) |
| GB1412757A (en) * | 1972-04-17 | 1975-11-05 | Ici Ltd | Azo dyestuffs |
| US4005069A (en) * | 1972-05-15 | 1977-01-25 | Sandoz Ltd. | Azo dyes having a 3-halo-4-cyano or acyl-6-hydroxypyridone-2 coupling component radical |
| US4092308A (en) * | 1972-10-05 | 1978-05-30 | Ciba-Geigy Corporation | 4-Sulphomethyl substituted hydroxypyridone azo dyestuffs |
| GB1441096A (en) * | 1972-12-27 | 1976-06-30 | Ici Ltd | Hydroxy pyridone azo dyestuffs |
| US4038268A (en) * | 1973-02-14 | 1977-07-26 | Bayer Aktiengesellschaft | Process for preparing azo dyestuffs containing 2,4,6-tri-amino-3-(cyano ester or carbonamide)pyridine |
| DE2307168A1 (de) * | 1973-02-14 | 1974-08-22 | Bayer Ag | Azofarbstoffe |
| US4066637A (en) * | 1974-06-18 | 1978-01-03 | Ciba-Geigy Corporation | Basic diaminopyridine-(3)-azo dyestuffs |
| US4247456A (en) * | 1976-11-19 | 1981-01-27 | Cassella Aktiengesellschaft | Water-insoluble monoazo pyridone dye |
| LU76304A1 (enExample) * | 1976-12-01 | 1978-07-10 | ||
| DE2930481A1 (de) * | 1979-07-27 | 1981-02-12 | Bayer Ag | Anthrachinonazo-verbindungen, verfahren zu ihrer herstellung sowie ihre verwendung als pigmente |
| EP0239533B1 (de) * | 1986-03-17 | 1992-09-16 | Ciba-Geigy Ag | Pyridin-Derivate |
-
1968
- 1968-06-27 GB GB3076168A patent/GB1256714A/en not_active Expired
-
1969
- 1969-06-23 US US835752A patent/US3657214A/en not_active Expired - Lifetime
- 1969-06-26 NL NL6909862A patent/NL6909862A/xx unknown
- 1969-06-27 CH CH992069A patent/CH513952A/de not_active IP Right Cessation
- 1969-06-27 DE DE19691932808 patent/DE1932808A1/de active Pending
- 1969-06-27 FR FR696921752A patent/FR2014338B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2014338A1 (enExample) | 1970-04-17 |
| GB1256714A (enExample) | 1971-12-15 |
| FR2014338B1 (enExample) | 1974-06-14 |
| US3657214A (en) | 1972-04-18 |
| NL6909862A (enExample) | 1969-12-30 |
| DE1932808A1 (de) | 1970-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH540962A (de) | Verfahren zur Herstellung von wasserunlöslichen Azofarbstoffen | |
| CH518338A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH513952A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH519557A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH473188A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH517146A (de) | Verfahren zur Herstellung von wasserunlöslichen Disazofarbstoffen | |
| CH508702A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH520180A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH465091A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH478884A (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH481982A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH524670A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH504508A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH515971A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH522708A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH487976A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH477533A (de) | Verfahren zur Herstellung von wasserlöslichen Monoazofarbstoffen | |
| CH497502A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH540961A (de) | Verfahren zur Herstellung von wasserunlöslichen Monoazofarbstoffen | |
| CH502424A (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| CH513950A (de) | Verfahren zur Herstellung wasserunlöslicher p-Aminoazofarbstoffe | |
| CH540321A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| CH478206A (de) | Verfahren zur Herstellung von wasserlöslichen Monoazofarbstoffen | |
| CH532115A (de) | Verfahren zur Herstellung wasserlöslicher Monoazofarbstoffe | |
| CH471876A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |