CH342783A - Verwendung einer selektiv herbiciden Mischung zur Unkrautbekämpfung - Google Patents
Verwendung einer selektiv herbiciden Mischung zur UnkrautbekämpfungInfo
- Publication number
- CH342783A CH342783A CH342783DA CH342783A CH 342783 A CH342783 A CH 342783A CH 342783D A CH342783D A CH 342783DA CH 342783 A CH342783 A CH 342783A
- Authority
- CH
- Switzerland
- Prior art keywords
- weed control
- herbicidal mixture
- selective herbicidal
- selective
- mixture
- Prior art date
Links
- 241000196324 Embryophyta Species 0.000 title 1
- 230000002363 herbicidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB19813/54A GB758980A (en) | 1954-07-06 | 1954-07-06 | Improvements in or relating to phenoxyaliphatic compounds and to plant-growth promoters and selective herbicidal compositions containing same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH342783A true CH342783A (de) | 1959-11-30 |
Family
ID=10135659
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH342783D CH342783A (de) | 1954-07-06 | 1955-07-06 | Verwendung einer selektiv herbiciden Mischung zur Unkrautbekämpfung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2863753A (cg-RX-API-DMAC7.html) |
| BE (1) | BE539519A (cg-RX-API-DMAC7.html) |
| CH (1) | CH342783A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1000632B (cg-RX-API-DMAC7.html) |
| FR (1) | FR1134052A (cg-RX-API-DMAC7.html) |
| GB (1) | GB758980A (cg-RX-API-DMAC7.html) |
| NL (2) | NL95401C (cg-RX-API-DMAC7.html) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3189430A (en) * | 1957-06-21 | 1965-06-15 | Dow Chemical Co | Herbicide composition and method |
| NL100595C (cg-RX-API-DMAC7.html) | 1958-05-16 | |||
| US3221048A (en) * | 1960-05-02 | 1965-11-30 | Hooker Chemical Corp | Polychlorophenylacetic acids and process for same |
| GR81524B (cg-RX-API-DMAC7.html) * | 1983-07-18 | 1984-12-11 | Lilly Co Eli | |
| US4764521A (en) * | 1983-07-18 | 1988-08-16 | Eli Lilly And Company | Leukotriene antagonists and a method of use there as |
| US4929268A (en) * | 1985-03-27 | 1990-05-29 | The Dow Chemical Company | Substituted oxirane compounds |
| US4749812A (en) * | 1985-05-27 | 1988-06-07 | Mitsui Toatsu Chemicals, Inc. | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| RO117587B1 (ro) * | 1991-07-12 | 2002-05-30 | Hoechst Ag | Compozitie erbicida, procedeu de obtinere a acesteia si metoda pentru controlul plantelor nedorite |
| EP2052607A1 (de) | 2007-10-24 | 2009-04-29 | Bayer CropScience AG | Herbizid-Kombination |
| DE102008037622A1 (de) * | 2008-08-14 | 2010-02-25 | Bayer Cropscience Ag | Herbizid-Kombination mit Dimethoxytriazinyl-substituierten Difluormethansulfonylaniliden |
| WO2010046422A2 (en) | 2008-10-22 | 2010-04-29 | Basf Se | Use of auxin type herbicides on cultivated plants |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US598484A (en) * | 1898-02-01 | Cigar-cell series | ||
| US591744A (en) * | 1897-10-12 | Animal-trap |
-
0
- BE BE539519D patent/BE539519A/xx unknown
- NL NL198280D patent/NL198280A/xx unknown
- NL NL95401D patent/NL95401C/xx active
-
1954
- 1954-07-06 GB GB19813/54A patent/GB758980A/en not_active Expired
-
1955
- 1955-04-22 US US503321A patent/US2863753A/en not_active Expired - Lifetime
- 1955-06-29 DE DEN10867A patent/DE1000632B/de active Pending
- 1955-07-05 FR FR1134052D patent/FR1134052A/fr not_active Expired
- 1955-07-06 CH CH342783D patent/CH342783A/de unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE539519A (cg-RX-API-DMAC7.html) | |
| NL95401C (cg-RX-API-DMAC7.html) | |
| NL198280A (cg-RX-API-DMAC7.html) | |
| FR1134052A (fr) | 1957-04-05 |
| DE1000632B (de) | 1957-01-10 |
| GB758980A (en) | 1956-10-10 |
| US2863753A (en) | 1958-12-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH342783A (de) | Verwendung einer selektiv herbiciden Mischung zur Unkrautbekämpfung | |
| FR1121049A (fr) | Composition herbicide | |
| FR1146573A (fr) | Instrument aratoire perfectionné | |
| FR1135439A (fr) | Perfectionnements aux compositions herbicides | |
| CH384280A (de) | Verwendung neuer organischer Phosphorverbindungen zur Schädlingsbekämpfung | |
| CH341193A (de) | Schaltungsanordnung zur Stabilisierung einer Impulsspannung | |
| FR1095917A (fr) | Relieur amovible | |
| AT185441B (de) | Mit einer Stufenregeleinrichtung zusammengebauter Transformator | |
| FR1130332A (fr) | Perfectionnements aux moulinets de pêche | |
| FR1137300A (fr) | Perfectionnements aux compositions herbicides | |
| CH329634A (fr) | Bineuse-désherbeuse | |
| FR1125260A (fr) | Perfectionnements relatifs aux peintures fongicides | |
| FR1145215A (fr) | Herbicide | |
| CH324403A (de) | Fliegenklatsche | |
| FR1099700A (fr) | Perfectionnements aux éclosoirs | |
| CH373218A (de) | Verwendung eines neuen Thiophosphorsäureesters zur Schädlingsbekämpfung | |
| CH354292A (de) | Verfahren zur Schädlingsbekämpfung | |
| FR66347E (fr) | Perfectionnements aux moulinets de pêche | |
| AT191193B (de) | Insektenvertilgungsmittel | |
| FR1098685A (fr) | Moulinet de pêche | |
| CH344910A (de) | Verwendung einer elektromagnetischen Steuerung | |
| CH327997A (de) | Tragbare Spritzvorrichtung zur Schädlingsbekämpfung | |
| AT189839B (de) | Angelgerät | |
| FR1103483A (fr) | Leurre | |
| AT186296B (de) | Anordnung zur automatischen Verstärkungsregelung mit Hilfe einer Pilotspannung |