CA982125A - 4,4'-diaminostilbene-2,2'-disulfonic acid derivatives and use thereof - Google Patents
4,4'-diaminostilbene-2,2'-disulfonic acid derivatives and use thereofInfo
- Publication number
- CA982125A CA982125A CA161,212A CA161212A CA982125A CA 982125 A CA982125 A CA 982125A CA 161212 A CA161212 A CA 161212A CA 982125 A CA982125 A CA 982125A
- Authority
- CA
- Canada
- Prior art keywords
- diaminostilbene
- acid derivatives
- disulfonic acid
- disulfonic
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- REJHVSOVQBJEBF-OWOJBTEDSA-N 5-azaniumyl-2-[(e)-2-(4-azaniumyl-2-sulfonatophenyl)ethenyl]benzenesulfonate Chemical class OS(=O)(=O)C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1S(O)(=O)=O REJHVSOVQBJEBF-OWOJBTEDSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/48—Two nitrogen atoms
- C07D251/52—Two nitrogen atoms with an oxygen or sulfur atom attached to the third ring carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP47078139A JPS5116060B2 (oth) | 1972-08-04 | 1972-08-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA982125A true CA982125A (en) | 1976-01-20 |
Family
ID=13653535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA161,212A Expired CA982125A (en) | 1972-08-04 | 1973-01-15 | 4,4'-diaminostilbene-2,2'-disulfonic acid derivatives and use thereof |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3905964A (oth) |
| JP (1) | JPS5116060B2 (oth) |
| CA (1) | CA982125A (oth) |
| DE (1) | DE2301531C3 (oth) |
| SE (1) | SE396750B (oth) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH617315B5 (oth) * | 1973-11-29 | 1980-05-30 | Ciba Geigy Ag | |
| USRE30227E (en) * | 1973-11-29 | 1980-03-11 | Ciba-Geigy Corporation | Agent for brightening and removing greyness from textiles |
| DE10149313A1 (de) * | 2001-10-05 | 2003-04-17 | Bayer Ag | Verwendung wässriger Aufhellerpräparationen zum Aufhellen von natürlichen und synthetischen Materialien |
| FI20085345L (fi) * | 2008-04-22 | 2009-10-23 | Kemira Oyj | Menetelmä valon aikaansaaman ligniinipitoisen materiaalin kellertymisen vähentämiseksi |
| CN103205134B (zh) * | 2013-03-14 | 2014-04-23 | 浙江传化华洋化工有限公司 | 一种dsd酸三嗪类荧光增白剂的合成方法 |
| EP4196793A1 (en) | 2020-08-11 | 2023-06-21 | Université de Strasbourg | H2 blockers targeting liver macrophages for the prevention and treatment of liver disease and cancer |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE551712A (oth) * | 1955-10-12 | |||
| DE1965585A1 (de) * | 1969-12-30 | 1971-07-15 | Bayer Ag | Stilbenverbindungen |
-
1972
- 1972-08-04 JP JP47078139A patent/JPS5116060B2/ja not_active Expired
-
1973
- 1973-01-12 DE DE2301531A patent/DE2301531C3/de not_active Expired
- 1973-01-15 SE SE7300498A patent/SE396750B/xx unknown
- 1973-01-15 CA CA161,212A patent/CA982125A/en not_active Expired
- 1973-01-15 US US323431A patent/US3905964A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3905964A (en) | 1975-09-16 |
| DE2301531B2 (de) | 1981-05-21 |
| DE2301531A1 (de) | 1974-02-21 |
| SE396750B (sv) | 1977-10-03 |
| JPS4931983A (oth) | 1974-03-23 |
| JPS5116060B2 (oth) | 1976-05-21 |
| DE2301531C3 (de) | 1982-05-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA999589A (en) | 2,2,6,6-tetramethylpiperidinyl-4-acetic acid derivatives | |
| CA1011741A (en) | 5,6,7,8-tetrahydroquinoline-8-thiocarboxamides and related compounds | |
| CA1002049A (en) | 3,5-dioxopiperazinyl derivatives | |
| CA1012534A (en) | 2,6-diaminonebularine derivatives | |
| CA999588A (en) | 2,2,6,6-tetramethylpiperidinyl-4-acetic acid derivatives | |
| CA1004677A (en) | 3,4-substituted-5-sulfamoyl benzoic acid derivatives | |
| CA982125A (en) | 4,4'-diaminostilbene-2,2'-disulfonic acid derivatives and use thereof | |
| AU465121B2 (en) | Assymetrically substituted 4,4'-bis-triazinylamino-stilbene-2, 2'-disulphonic acids | |
| CA991175A (en) | Bis-s-triazinylamino-stilbene-2,2'-disulphonic acids | |
| CA1010036A (en) | 2,2,6,6-tetramethylpiperidinyl-4-acetic acid derivatives | |
| CA996936A (en) | 1,4-dihydro-1-substituted-4-oxo-3-quinoline-carboxylic acid derivative | |
| CA984838A (en) | N,n'-diphenyl-n-(n"-alkylcarbamoyl) formamidine derivatives | |
| CA935154A (en) | 2,2'-diacylamino-1,1'-dianthraquinonyls | |
| AU469505B2 (en) | 1,4-ethano-2,3-dihydroquinoline derivatives | |
| AU474523B2 (en) | Substituted 9,10-dihydroanthracenes | |
| CA898248A (en) | Bistriazinyl derivatives of 4,4'-diaminostilbene-2,2'-disulphonic acid | |
| CA1026746A (en) | 2,3-lower alkylenepenam-3-carboxylic acid derivatives and processes for the preparation thereof | |
| CA1012164A (en) | N-aroyl-n'-(alkylhydroxyphenyl)alkanoylhydrazines | |
| AU1650470A (en) | 1, 1'methylene-bis-piperazine | |
| CA1000272A (en) | 2',3',5'-tri-o-nicotinoyl-4-thiouridine | |
| CA905961A (en) | Certain 2-hydroxymethyl-3-carboxylic acid amidoquinoxaline-di-n-oxides (1,4) | |
| CA907616A (en) | 2,2-diaryl-4-(4'-aryl-4'-hydroxypiperidino)-butyramides | |
| CA896567A (en) | 1,1'-peroxydicyclohexylamine | |
| CA836581A (en) | 2'3'-di-deoxyriboside-2',3'-olefins | |
| CA909778A (en) | 5-imino-1,2,4-triazine derivatives |