CA956315A - 4-benzoyl-4-hydroxy-3-phenyl pyridine derivatives - Google Patents
4-benzoyl-4-hydroxy-3-phenyl pyridine derivativesInfo
- Publication number
- CA956315A CA956315A CA109,831A CA109831A CA956315A CA 956315 A CA956315 A CA 956315A CA 109831 A CA109831 A CA 109831A CA 956315 A CA956315 A CA 956315A
- Authority
- CA
- Canada
- Prior art keywords
- benzoyl
- hydroxy
- pyridine derivatives
- phenyl pyridine
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- AIVSSPKMPVOTTM-UHFFFAOYSA-N (4-hydroxy-3-phenyl-3H-pyridin-4-yl)-phenylmethanone Chemical class C(C1=CC=CC=C1)(=O)C1(C(C=NC=C1)C1=CC=CC=C1)O AIVSSPKMPVOTTM-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/38—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/18—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D211/30—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom
- C07D211/32—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with substituted hydrocarbon radicals attached to ring carbon atoms with hydrocarbon radicals, substituted by doubly bound oxygen or sulfur atoms or by two oxygen or sulfur atoms singly bound to the same carbon atom by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/48—Oxygen atoms attached in position 4 having an acyclic carbon atom attached in position 4
- C07D211/50—Aroyl radical
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH516970A CH527817A (de) | 1970-04-08 | 1970-04-08 | Verfahren zur Herstellung neuer Phenylpiperidinderivate |
| CH516870A CH527190A (de) | 1970-04-08 | 1970-04-08 | Verfahren zur Herstellung neuer Phenylpiperidinderivate |
| CH1793970A CH542207A (de) | 1970-12-04 | 1970-12-04 | Verfahren zur Herstellung neuer Phenylpiperidinderivate |
| CH516770A CH528506A (de) | 1972-03-30 | 1972-03-30 | Verfahren zur Herstellung neuer Phenylpiperidinverbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA956315A true CA956315A (en) | 1974-10-15 |
Family
ID=27428866
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA109,831A Expired CA956315A (en) | 1970-04-08 | 1971-04-07 | 4-benzoyl-4-hydroxy-3-phenyl pyridine derivatives |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3793334A (enFirst) |
| BE (1) | BE765443A (enFirst) |
| CA (1) | CA956315A (enFirst) |
| DE (1) | DE2116316A1 (enFirst) |
| FR (1) | FR2092019B1 (enFirst) |
| IE (1) | IE35162B1 (enFirst) |
| IL (1) | IL36559A (enFirst) |
| NL (1) | NL7104735A (enFirst) |
| OA (1) | OA03703A (enFirst) |
| SE (1) | SE365214B (enFirst) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1535791A (en) * | 1975-05-07 | 1978-12-13 | Ferrosan Ab | Derivatives of 4-piperidinol |
| US4024264A (en) * | 1974-08-15 | 1977-05-17 | Ab Ferrosan | Diphenylbutylpiperidines |
| US4312876A (en) * | 1979-02-23 | 1982-01-26 | Hoechst-Roussel Pharmaceuticals Incorporated | Antidepressive and analgesic 4-aryloxy- and 4-arylthio-3-phenylpiperidines |
| US4216218A (en) * | 1979-02-23 | 1980-08-05 | American Hoechst Corporation | Antidepressant and analgesic 4-aryloxy- and 4-arylthio-3-phenylpiperidines |
| EP1748984A1 (en) * | 2004-05-12 | 2007-02-07 | Pfizer Products Inc. | Piperidine derivatives as nk1 and nk3 antagonists |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3029244A (en) * | 1959-08-31 | 1962-04-10 | Research Corp | Aroylpiperidinols and esters thereof |
| GB963639A (en) * | 1960-10-20 | 1964-07-15 | Arnold Heyworth Beckett | New piperidine derivatives and processes for preparing the same |
| US3350403A (en) * | 1964-04-07 | 1967-10-31 | Aldrich Chem Co Inc | Nu-phenyl amides of 4-phenyl-4-hydroxypiperidino alkyl acids |
-
1971
- 1971-04-03 DE DE19712116316 patent/DE2116316A1/de active Pending
- 1971-04-06 IE IE437/71A patent/IE35162B1/xx unknown
- 1971-04-06 FR FR7112074A patent/FR2092019B1/fr not_active Expired
- 1971-04-06 IL IL36559A patent/IL36559A/xx unknown
- 1971-04-07 SE SE04520/71A patent/SE365214B/xx unknown
- 1971-04-07 OA OA54219A patent/OA03703A/xx unknown
- 1971-04-07 CA CA109,831A patent/CA956315A/en not_active Expired
- 1971-04-07 BE BE765443A patent/BE765443A/xx unknown
- 1971-04-08 NL NL7104735A patent/NL7104735A/xx unknown
-
1972
- 1972-09-01 US US00285747A patent/US3793334A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL36559A0 (en) | 1971-06-23 |
| FR2092019A1 (enFirst) | 1972-01-21 |
| BE765443A (fr) | 1971-10-07 |
| IL36559A (en) | 1974-05-16 |
| DE2116316A1 (de) | 1971-10-28 |
| IE35162L (en) | 1971-10-08 |
| OA03703A (fr) | 1971-12-24 |
| NL7104735A (enFirst) | 1971-10-12 |
| FR2092019B1 (enFirst) | 1975-04-18 |
| SE365214B (enFirst) | 1974-03-18 |
| IE35162B1 (en) | 1975-11-26 |
| US3793334A (en) | 1974-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1008859A (en) | Pyridine derivatives | |
| AU451793B2 (en) | Pyridoquinoline derivatives | |
| AU453008B2 (en) | Triazolobenzodiazepine derivatives | |
| AU464406B2 (en) | Pyridine oxide derivatives | |
| AU3519871A (en) | Ergolene derivatives | |
| CA956315A (en) | 4-benzoyl-4-hydroxy-3-phenyl pyridine derivatives | |
| CA1014574A (en) | Phenylisopropylamine derivatives | |
| AU448423B2 (en) | Triazolobenzodiazepine derivatives | |
| AU3306971A (en) | Leucauramine derivatives | |
| AU450076B2 (en) | Halogenated pyridine derivatives | |
| AU450077B2 (en) | Halogenated pyridine derivatives | |
| AU455296B2 (en) | Halogenated pyridine derivatives | |
| AU446117B2 (en) | Dihydropyrimidopyridazine derivatives | |
| CA834197A (en) | 6-phenylbenzazolyl derivatives | |
| AU443255B2 (en) | Evomonoside derivatives | |
| CA845126A (en) | Indole-3-ethanol derivatives | |
| CA843449A (en) | Indenopyridine derivatives | |
| CA842821A (en) | Triphenyl-tin derivatives | |
| CA841046A (en) | Piperidinoalkanol derivatives | |
| CA839728A (en) | Bis-isoquinolinium derivatives | |
| CA838134A (en) | Dianisylimidazole derivatives | |
| AU442249B2 (en) | Terahydrocyclopropadibenzazepine derivatives | |
| CA838131A (en) | Benzepine derivatives | |
| CA837631A (en) | Sulfonamidoindole derivatives | |
| CA837137A (en) | Penta-chlorobenzylidenamine derivatives |