CA2576189A1 - Hair dyes comprising 1,4-diamino-2-methoxymethylbenzene - Google Patents
Hair dyes comprising 1,4-diamino-2-methoxymethylbenzene Download PDFInfo
- Publication number
- CA2576189A1 CA2576189A1 CA 2576189 CA2576189A CA2576189A1 CA 2576189 A1 CA2576189 A1 CA 2576189A1 CA 2576189 CA2576189 CA 2576189 CA 2576189 A CA2576189 A CA 2576189A CA 2576189 A1 CA2576189 A1 CA 2576189A1
- Authority
- CA
- Canada
- Prior art keywords
- amino
- phenylenediamine
- methoxymethyl
- aminophenol
- resorcinol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- AVKBLCWBDLLVRL-UHFFFAOYSA-N 2-(methoxymethyl)benzene-1,4-diamine Chemical compound COCC1=CC(N)=CC=C1N AVKBLCWBDLLVRL-UHFFFAOYSA-N 0.000 title claims abstract description 10
- 239000000118 hair dye Substances 0.000 title claims description 30
- 239000000203 mixture Substances 0.000 claims abstract description 133
- 150000001875 compounds Chemical class 0.000 claims abstract description 45
- 150000003839 salts Chemical class 0.000 claims abstract description 27
- 238000004043 dyeing Methods 0.000 claims abstract description 15
- 239000000835 fiber Substances 0.000 claims abstract description 15
- 238000000034 method Methods 0.000 claims abstract description 14
- 102000011782 Keratins Human genes 0.000 claims abstract description 11
- 108010076876 Keratins Proteins 0.000 claims abstract description 11
- 239000000975 dye Substances 0.000 claims description 76
- 239000002243 precursor Substances 0.000 claims description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 28
- 239000007800 oxidant agent Substances 0.000 claims description 23
- 230000003647 oxidation Effects 0.000 claims description 22
- 238000007254 oxidation reaction Methods 0.000 claims description 22
- 238000009967 direct dyeing Methods 0.000 claims description 8
- 238000002156 mixing Methods 0.000 claims description 8
- 239000004615 ingredient Substances 0.000 claims description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 843
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical class NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 832
- PQFIEYSXOCKPTP-UHFFFAOYSA-N 4-n-(methoxymethyl)benzene-1,4-diamine Chemical compound COCNC1=CC=C(N)C=C1 PQFIEYSXOCKPTP-UHFFFAOYSA-N 0.000 description 773
- 229960001755 resorcinol Drugs 0.000 description 421
- 229940018563 3-aminophenol Drugs 0.000 description 417
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 347
- DBFYESDCPWWCHN-UHFFFAOYSA-N 5-amino-2-methylphenol Chemical compound CC1=CC=C(N)C=C1O DBFYESDCPWWCHN-UHFFFAOYSA-N 0.000 description 303
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical class NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 275
- ZTMADXFOCUXMJE-UHFFFAOYSA-N 2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=CC=C1O ZTMADXFOCUXMJE-UHFFFAOYSA-N 0.000 description 178
- YGRFRBUGAPOJDU-UHFFFAOYSA-N 5-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=CC=C(NCCO)C=C1O YGRFRBUGAPOJDU-UHFFFAOYSA-N 0.000 description 178
- BMTSZVZQNMNPCT-UHFFFAOYSA-N 2-aminopyridin-3-ol Chemical compound NC1=NC=CC=C1O BMTSZVZQNMNPCT-UHFFFAOYSA-N 0.000 description 175
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 171
- OQWWMUWGSBRNMA-UHFFFAOYSA-N 1-(2,4-diaminophenoxy)ethanol Chemical compound CC(O)OC1=CC=C(N)C=C1N OQWWMUWGSBRNMA-UHFFFAOYSA-N 0.000 description 169
- 229940113489 2,4-diaminophenoxyethanol Drugs 0.000 description 169
- SBUMIGFDXJIPLE-UHFFFAOYSA-N 2-(3-amino-4-methoxyanilino)ethanol Chemical compound COC1=CC=C(NCCO)C=C1N SBUMIGFDXJIPLE-UHFFFAOYSA-N 0.000 description 168
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 134
- PIDZGPMVKVVCGG-UHFFFAOYSA-N 1-(3,4-diamino-1h-pyrazol-5-yl)ethanol Chemical compound CC(O)C1=NNC(N)=C1N PIDZGPMVKVVCGG-UHFFFAOYSA-N 0.000 description 130
- -1 1,4-diamino-methoxymethylbenzene Chemical compound 0.000 description 116
- ISCYHXYLVTWDJT-UHFFFAOYSA-N 2-[4-amino-n-(2-hydroxyethyl)anilino]ethanol Chemical compound NC1=CC=C(N(CCO)CCO)C=C1 ISCYHXYLVTWDJT-UHFFFAOYSA-N 0.000 description 110
- 229920000642 polymer Polymers 0.000 description 89
- 239000000047 product Substances 0.000 description 77
- 229920001577 copolymer Polymers 0.000 description 51
- 210000004209 hair Anatomy 0.000 description 46
- OSCJHTSDLYVCQC-UHFFFAOYSA-N 2-ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate Chemical compound C1=CC(C(=O)OCC(CC)CCCC)=CC=C1NC1=NC(NC=2C=CC(=CC=2)C(=O)NC(C)(C)C)=NC(NC=2C=CC(=CC=2)C(=O)OCC(CC)CCCC)=N1 OSCJHTSDLYVCQC-UHFFFAOYSA-N 0.000 description 39
- 239000002253 acid Substances 0.000 description 39
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 37
- 125000004432 carbon atom Chemical group C* 0.000 description 31
- 125000000217 alkyl group Chemical group 0.000 description 29
- 229920002472 Starch Polymers 0.000 description 24
- 150000003254 radicals Chemical class 0.000 description 23
- 235000019698 starch Nutrition 0.000 description 23
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 19
- 239000007864 aqueous solution Substances 0.000 description 19
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 18
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 17
- 125000000129 anionic group Chemical group 0.000 description 17
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 16
- 239000000178 monomer Substances 0.000 description 16
- 239000000126 substance Substances 0.000 description 16
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 15
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 15
- 239000008107 starch Substances 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 14
- 244000303965 Cyamopsis psoralioides Species 0.000 description 14
- 125000002091 cationic group Chemical group 0.000 description 14
- 229920002678 cellulose Polymers 0.000 description 13
- 125000005842 heteroatom Chemical group 0.000 description 13
- 239000002562 thickening agent Substances 0.000 description 13
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 235000010980 cellulose Nutrition 0.000 description 12
- 239000002516 radical scavenger Substances 0.000 description 12
- 239000002453 shampoo Substances 0.000 description 12
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 10
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 10
- 150000003863 ammonium salts Chemical class 0.000 description 10
- 229920001296 polysiloxane Polymers 0.000 description 10
- 229910019142 PO4 Inorganic materials 0.000 description 9
- 125000003118 aryl group Chemical group 0.000 description 9
- 235000010323 ascorbic acid Nutrition 0.000 description 9
- 239000011668 ascorbic acid Substances 0.000 description 9
- 229960005070 ascorbic acid Drugs 0.000 description 9
- 239000008188 pellet Substances 0.000 description 9
- 235000021317 phosphate Nutrition 0.000 description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 9
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 8
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 8
- 229920004482 WACKER® Polymers 0.000 description 8
- 229910021529 ammonia Inorganic materials 0.000 description 8
- 239000001099 ammonium carbonate Substances 0.000 description 8
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Natural products OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 8
- 150000002191 fatty alcohols Chemical class 0.000 description 8
- 125000000623 heterocyclic group Chemical group 0.000 description 8
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 8
- 238000005507 spraying Methods 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- MHOFGBJTSNWTDT-UHFFFAOYSA-M 2-[n-ethyl-4-[(6-methoxy-3-methyl-1,3-benzothiazol-3-ium-2-yl)diazenyl]anilino]ethanol;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC(N(CCO)CC)=CC=C1N=NC1=[N+](C)C2=CC=C(OC)C=C2S1 MHOFGBJTSNWTDT-UHFFFAOYSA-M 0.000 description 7
- SWZVJOLLQTWFCW-UHFFFAOYSA-N 2-chlorobenzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1Cl SWZVJOLLQTWFCW-UHFFFAOYSA-N 0.000 description 7
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 7
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 7
- 150000001450 anions Chemical class 0.000 description 7
- 239000000839 emulsion Substances 0.000 description 7
- 235000013305 food Nutrition 0.000 description 7
- 229920001519 homopolymer Polymers 0.000 description 7
- 230000002209 hydrophobic effect Effects 0.000 description 7
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 7
- 230000001590 oxidative effect Effects 0.000 description 7
- 229920001282 polysaccharide Polymers 0.000 description 7
- 239000005017 polysaccharide Substances 0.000 description 7
- NXLOLUFNDSBYTP-UHFFFAOYSA-N retene Chemical compound C1=CC=C2C3=CC=C(C(C)C)C=C3C=CC2=C1C NXLOLUFNDSBYTP-UHFFFAOYSA-N 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- OMXMKKGMMMQICI-UHFFFAOYSA-N 2-(2-amino-3-methoxyanilino)ethanol Chemical compound COC1=CC=CC(NCCO)=C1N OMXMKKGMMMQICI-UHFFFAOYSA-N 0.000 description 6
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- UXEAWNJALIUYRH-UHFFFAOYSA-N [8-[(4-aminophenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].C12=CC([N+](C)(C)C)=CC=C2C=CC(=O)\C1=N/NC1=CC=C(N)C=C1 UXEAWNJALIUYRH-UHFFFAOYSA-N 0.000 description 6
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- 125000002877 alkyl aryl group Chemical group 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 229920006317 cationic polymer Polymers 0.000 description 6
- 239000002537 cosmetic Substances 0.000 description 6
- 239000006185 dispersion Substances 0.000 description 6
- 125000004404 heteroalkyl group Chemical group 0.000 description 6
- ASHGTJPOSUFTGB-UHFFFAOYSA-N methyl resorcinol Natural products COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 6
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 6
- 229920000768 polyamine Polymers 0.000 description 6
- 229920001223 polyethylene glycol Polymers 0.000 description 6
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 6
- 229960004063 propylene glycol Drugs 0.000 description 6
- 235000010265 sodium sulphite Nutrition 0.000 description 6
- SBYDCEZCBVBMSI-UHFFFAOYSA-N 1,2-diamino-1-phenoxyethanol Chemical compound NCC(N)(O)OC1=CC=CC=C1 SBYDCEZCBVBMSI-UHFFFAOYSA-N 0.000 description 5
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 5
- ICIDSZQHPUZUHC-UHFFFAOYSA-N 2-octadecoxyethanol Chemical compound CCCCCCCCCCCCCCCCCCOCCO ICIDSZQHPUZUHC-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 5
- 239000002202 Polyethylene glycol Substances 0.000 description 5
- CQPFMGBJSMSXLP-UHFFFAOYSA-M acid orange 7 Chemical compound [Na+].OC1=CC=C2C=CC=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 CQPFMGBJSMSXLP-UHFFFAOYSA-M 0.000 description 5
- 235000012501 ammonium carbonate Nutrition 0.000 description 5
- 239000000908 ammonium hydroxide Substances 0.000 description 5
- 239000003945 anionic surfactant Substances 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 239000003093 cationic surfactant Substances 0.000 description 5
- ONTQJDKFANPPKK-UHFFFAOYSA-L chembl3185981 Chemical compound [Na+].[Na+].CC1=CC(C)=C(S([O-])(=O)=O)C=C1N=NC1=CC(S([O-])(=O)=O)=C(C=CC=C2)C2=C1O ONTQJDKFANPPKK-UHFFFAOYSA-L 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 235000019864 coconut oil Nutrition 0.000 description 5
- 239000003240 coconut oil Substances 0.000 description 5
- 230000003750 conditioning effect Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- 235000013804 distarch phosphate Nutrition 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 5
- 229960004592 isopropanol Drugs 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical class C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 5
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 235000013772 propylene glycol Nutrition 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 4
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical class NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 4
- LOHQCFQTSKIVIT-UHFFFAOYSA-N 2-(3,4-diamino-1h-pyrazol-5-yl)ethanol Chemical compound NC=1NN=C(CCO)C=1N LOHQCFQTSKIVIT-UHFFFAOYSA-N 0.000 description 4
- SVTBMSDMJJWYQN-UHFFFAOYSA-N 2-methylpentane-2,4-diol Chemical compound CC(O)CC(C)(C)O SVTBMSDMJJWYQN-UHFFFAOYSA-N 0.000 description 4
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 4
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical group C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 4
- BOERSBWEZNENLR-UHFFFAOYSA-N 5-(cyclobutylamino)-2-methylphenol Chemical compound C1=C(O)C(C)=CC=C1NC1CCC1 BOERSBWEZNENLR-UHFFFAOYSA-N 0.000 description 4
- YPCKNWKFTPCRJF-UHFFFAOYSA-N 5-[(3-aminoanilino)methyl]benzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2C=C(N)C=C(N)C=2)=C1 YPCKNWKFTPCRJF-UHFFFAOYSA-N 0.000 description 4
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 4
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 4
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 239000005642 Oleic acid Substances 0.000 description 4
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 4
- 229920000289 Polyquaternium Polymers 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 150000003926 acrylamides Chemical class 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 230000003113 alkalizing effect Effects 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 4
- 229940101006 anhydrous sodium sulfite Drugs 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- WPKYZIPODULRBM-UHFFFAOYSA-N azane;prop-2-enoic acid Chemical compound N.OC(=O)C=C WPKYZIPODULRBM-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 4
- 238000004040 coloring Methods 0.000 description 4
- XXJWXESWEXIICW-UHFFFAOYSA-N diethylene glycol monoethyl ether Chemical compound CCOCCOCCO XXJWXESWEXIICW-UHFFFAOYSA-N 0.000 description 4
- FPVGTPBMTFTMRT-UHFFFAOYSA-L disodium;2-amino-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-UHFFFAOYSA-L 0.000 description 4
- 239000001245 distarch phosphate Substances 0.000 description 4
- GMSCBRSQMRDRCD-UHFFFAOYSA-N dodecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCOC(=O)C(C)=C GMSCBRSQMRDRCD-UHFFFAOYSA-N 0.000 description 4
- 235000019233 fast yellow AB Nutrition 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 4
- 125000002950 monocyclic group Chemical group 0.000 description 4
- 150000007524 organic acids Chemical class 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 4
- 239000010452 phosphate Substances 0.000 description 4
- 150000004804 polysaccharides Chemical class 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 239000011736 potassium bicarbonate Substances 0.000 description 4
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 4
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 description 4
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 4
- WVOAPRDRMLHUMI-UHFFFAOYSA-N (2-methylnaphthalen-1-yl) acetate Chemical compound C1=CC=C2C(OC(=O)C)=C(C)C=CC2=C1 WVOAPRDRMLHUMI-UHFFFAOYSA-N 0.000 description 3
- VKZRWSNIWNFCIQ-WDSKDSINSA-N (2s)-2-[2-[[(1s)-1,2-dicarboxyethyl]amino]ethylamino]butanedioic acid Chemical compound OC(=O)C[C@@H](C(O)=O)NCCN[C@H](C(O)=O)CC(O)=O VKZRWSNIWNFCIQ-WDSKDSINSA-N 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 3
- SYEYEGBZVSWYPK-UHFFFAOYSA-N 2,5,6-triamino-4-hydroxypyrimidine Chemical compound NC1=NC(N)=C(N)C(O)=N1 SYEYEGBZVSWYPK-UHFFFAOYSA-N 0.000 description 3
- ZFFAFXDAFACVBX-UHFFFAOYSA-N 2-(2,4-diamino-5-methylphenoxy)ethanol Chemical compound CC1=CC(OCCO)=C(N)C=C1N ZFFAFXDAFACVBX-UHFFFAOYSA-N 0.000 description 3
- WCPGNFONICRLCL-UHFFFAOYSA-N 2-(2,4-diaminophenoxy)ethanol Chemical compound NC1=CC=C(OCCO)C(N)=C1 WCPGNFONICRLCL-UHFFFAOYSA-N 0.000 description 3
- KWSVXCAQFTWTEF-UHFFFAOYSA-N 2-(2,5-diaminophenyl)ethanol Chemical compound NC1=CC=C(N)C(CCO)=C1 KWSVXCAQFTWTEF-UHFFFAOYSA-N 0.000 description 3
- OABRBVCUJIJMOB-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-4,6-dinitrophenol Chemical compound OCCNC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O OABRBVCUJIJMOB-UHFFFAOYSA-N 0.000 description 3
- MGYUQZIGNZFZJS-KTKRTIGZSA-N 2-[2-[(z)-octadec-9-enoxy]ethoxy]ethanol Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCOCCO MGYUQZIGNZFZJS-KTKRTIGZSA-N 0.000 description 3
- DMUXRIHPNREBPF-UHFFFAOYSA-N 2-[2-[2-[2-(2,5-diaminophenoxy)ethoxy]ethoxy]ethoxy]benzene-1,4-diamine Chemical compound NC1=CC=C(N)C(OCCOCCOCCOC=2C(=CC=C(N)C=2)N)=C1 DMUXRIHPNREBPF-UHFFFAOYSA-N 0.000 description 3
- NJZCRXQWPNNJNB-UHFFFAOYSA-N 2-[2-nitro-4-(trifluoromethyl)anilino]ethanol Chemical compound OCCNC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O NJZCRXQWPNNJNB-UHFFFAOYSA-N 0.000 description 3
- FGYCMSFOZIRDLN-UHFFFAOYSA-N 2-[3-(2-hydroxyethylamino)-2-methylanilino]ethanol Chemical compound CC1=C(NCCO)C=CC=C1NCCO FGYCMSFOZIRDLN-UHFFFAOYSA-N 0.000 description 3
- OYINQIKIQCNQOX-UHFFFAOYSA-M 2-hydroxybutyl(trimethyl)azanium;chloride Chemical compound [Cl-].CCC(O)C[N+](C)(C)C OYINQIKIQCNQOX-UHFFFAOYSA-M 0.000 description 3
- HWWIVWKTKZAORO-UHFFFAOYSA-N 3,4-dihydro-2h-1,4-benzoxazin-6-ol Chemical compound O1CCNC2=CC(O)=CC=C21 HWWIVWKTKZAORO-UHFFFAOYSA-N 0.000 description 3
- XYRDGCCCBJITBH-UHFFFAOYSA-N 3-amino-2-chloro-6-methylphenol Chemical compound CC1=CC=C(N)C(Cl)=C1O XYRDGCCCBJITBH-UHFFFAOYSA-N 0.000 description 3
- UXKLYBMQAHYULT-UHFFFAOYSA-N 4-(2-hydroxyethylamino)-3-nitrophenol Chemical compound OCCNC1=CC=C(O)C=C1[N+]([O-])=O UXKLYBMQAHYULT-UHFFFAOYSA-N 0.000 description 3
- MWKPYVXITDAZLL-UHFFFAOYSA-N 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OCCCOC1=CC=C(N)C=C1N MWKPYVXITDAZLL-UHFFFAOYSA-N 0.000 description 3
- HDGMAACKJSBLMW-UHFFFAOYSA-N 4-amino-2-methylphenol Chemical compound CC1=CC(N)=CC=C1O HDGMAACKJSBLMW-UHFFFAOYSA-N 0.000 description 3
- AYAKPRUPZTWPLK-UHFFFAOYSA-N 4-ethoxy-6-methylbenzene-1,3-diamine Chemical compound CCOC1=CC(C)=C(N)C=C1N AYAKPRUPZTWPLK-UHFFFAOYSA-N 0.000 description 3
- ATCBPVDYYNJHSG-UHFFFAOYSA-N 6-methoxy-2-n-methylpyridine-2,3-diamine Chemical compound CNC1=NC(OC)=CC=C1N ATCBPVDYYNJHSG-UHFFFAOYSA-N 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 3
- 239000005695 Ammonium acetate Substances 0.000 description 3
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 description 3
- 229920000945 Amylopectin Polymers 0.000 description 3
- 229920000856 Amylose Polymers 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- KKBFCPLWFWQNFB-UHFFFAOYSA-M CI Acid Orange 3 Chemical compound [Na+].[O-][N+](=O)C1=CC([N+](=O)[O-])=CC=C1NC(C=C1S([O-])(=O)=O)=CC=C1NC1=CC=CC=C1 KKBFCPLWFWQNFB-UHFFFAOYSA-M 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical class [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 229920000926 Galactomannan Polymers 0.000 description 3
- 229920002907 Guar gum Polymers 0.000 description 3
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 3
- 241000282372 Panthera onca Species 0.000 description 3
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical group CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 3
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical compound OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- 241000209149 Zea Species 0.000 description 3
- OYDQPYUVQAHEJH-UHFFFAOYSA-N [3-(dimethylamino)phenyl]urea Chemical compound CN(C)C1=CC=CC(NC(N)=O)=C1 OYDQPYUVQAHEJH-UHFFFAOYSA-N 0.000 description 3
- KZENBFUSKMWCJF-UHFFFAOYSA-N [5-[5-[5-(hydroxymethyl)-2-thiophenyl]-2-furanyl]-2-thiophenyl]methanol Chemical compound S1C(CO)=CC=C1C1=CC=C(C=2SC(CO)=CC=2)O1 KZENBFUSKMWCJF-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000011149 active material Substances 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000005250 alkyl acrylate group Chemical group 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- XIWMTQIUUWJNRP-UHFFFAOYSA-N amidol Chemical compound NC1=CC=C(O)C(N)=C1 XIWMTQIUUWJNRP-UHFFFAOYSA-N 0.000 description 3
- 229940043376 ammonium acetate Drugs 0.000 description 3
- 235000019257 ammonium acetate Nutrition 0.000 description 3
- 235000012538 ammonium bicarbonate Nutrition 0.000 description 3
- BVCZEBOGSOYJJT-UHFFFAOYSA-N ammonium carbamate Chemical compound [NH4+].NC([O-])=O BVCZEBOGSOYJJT-UHFFFAOYSA-N 0.000 description 3
- 239000002280 amphoteric surfactant Substances 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 235000006708 antioxidants Nutrition 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- OIQPTROHQCGFEF-UHFFFAOYSA-L chembl1371409 Chemical compound [Na+].[Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=CC2=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 OIQPTROHQCGFEF-UHFFFAOYSA-L 0.000 description 3
- MRUAUOIMASANKQ-UHFFFAOYSA-N cocamidopropyl betaine Chemical compound CCCCCCCCCCCC(=O)NCCC[N+](C)(C)CC([O-])=O MRUAUOIMASANKQ-UHFFFAOYSA-N 0.000 description 3
- 229940073507 cocamidopropyl betaine Drugs 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 238000004132 cross linking Methods 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 239000000982 direct dye Substances 0.000 description 3
- TUXJTJITXCHUEL-UHFFFAOYSA-N disperse red 11 Chemical compound C1=CC=C2C(=O)C3=C(N)C(OC)=CC(N)=C3C(=O)C2=C1 TUXJTJITXCHUEL-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 3
- 235000010417 guar gum Nutrition 0.000 description 3
- 239000000665 guar gum Substances 0.000 description 3
- 229960002154 guar gum Drugs 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical class CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 3
- 125000005395 methacrylic acid group Chemical class 0.000 description 3
- 239000002480 mineral oil Substances 0.000 description 3
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 235000019198 oils Nutrition 0.000 description 3
- 229940099570 oleth-2 Drugs 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 3
- 229920000435 poly(dimethylsiloxane) Polymers 0.000 description 3
- 229920000058 polyacrylate Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000000518 rheometry Methods 0.000 description 3
- 229910052710 silicon Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- AXMCIYLNKNGNOT-UHFFFAOYSA-N sodium;3-[[4-[(4-dimethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)-[4-[ethyl-[(3-sulfophenyl)methyl]amino]phenyl]methyl]-n-ethylanilino]methyl]benzenesulfonate Chemical compound [Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](C)C)C=2C=CC(=CC=2)N(CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S(O)(=O)=O)=C1 AXMCIYLNKNGNOT-UHFFFAOYSA-N 0.000 description 3
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 3
- 229940100459 steareth-20 Drugs 0.000 description 3
- 229940073743 steareth-20 methacrylate Drugs 0.000 description 3
- 239000003760 tallow Substances 0.000 description 3
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 3
- MTCFGRXMJLQNBG-REOHCLBHSA-N (2S)-2-Amino-3-hydroxypropansäure Chemical compound OC[C@H](N)C(O)=O MTCFGRXMJLQNBG-REOHCLBHSA-N 0.000 description 2
- OMDQUFIYNPYJFM-XKDAHURESA-N (2r,3r,4s,5r,6s)-2-(hydroxymethyl)-6-[[(2r,3s,4r,5s,6r)-4,5,6-trihydroxy-3-[(2s,3s,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methoxy]oxane-3,4,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@@H]1OC[C@@H]1[C@@H](O[C@H]2[C@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)[C@H](O)[C@H](O)[C@H](O)O1 OMDQUFIYNPYJFM-XKDAHURESA-N 0.000 description 2
- ALSTYHKOOCGGFT-KTKRTIGZSA-N (9Z)-octadecen-1-ol Chemical compound CCCCCCCC\C=C/CCCCCCCCO ALSTYHKOOCGGFT-KTKRTIGZSA-N 0.000 description 2
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 2
- VIXBPSTZNCRCJE-UHFFFAOYSA-N 1,3-bis[4-amino-n-(2-hydroxyethyl)anilino]propan-2-ol Chemical compound C1=CC(N)=CC=C1N(CCO)CC(O)CN(CCO)C1=CC=C(N)C=C1 VIXBPSTZNCRCJE-UHFFFAOYSA-N 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 2
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 2
- NLXFWUZKOOWWFD-UHFFFAOYSA-N 1-(2-hydroxyethylamino)-4-(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(NCCO)=CC=C2NC NLXFWUZKOOWWFD-UHFFFAOYSA-N 0.000 description 2
- HBXWUCXDUUJDRB-UHFFFAOYSA-N 1-octadecoxyoctadecane Chemical compound CCCCCCCCCCCCCCCCCCOCCCCCCCCCCCCCCCCCC HBXWUCXDUUJDRB-UHFFFAOYSA-N 0.000 description 2
- XAWPKHNOFIWWNZ-UHFFFAOYSA-N 1h-indol-6-ol Chemical compound OC1=CC=C2C=CNC2=C1 XAWPKHNOFIWWNZ-UHFFFAOYSA-N 0.000 description 2
- ORVPXPKEZLTMNW-UHFFFAOYSA-N 1h-indol-7-ol Chemical compound OC1=CC=CC2=C1NC=C2 ORVPXPKEZLTMNW-UHFFFAOYSA-N 0.000 description 2
- GZVVXXLYQIFVCA-UHFFFAOYSA-N 2,3-dimethylbenzene-1,4-diamine Chemical compound CC1=C(C)C(N)=CC=C1N GZVVXXLYQIFVCA-UHFFFAOYSA-N 0.000 description 2
- QAMCXJOYXRSXDU-UHFFFAOYSA-N 2,4-dimethoxy-n-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]aniline;chloride Chemical compound [Cl-].COC1=CC(OC)=CC=C1NC=CC1=[N+](C)C2=CC=CC=C2C1(C)C QAMCXJOYXRSXDU-UHFFFAOYSA-N 0.000 description 2
- MJMRSGYLARBUDK-UHFFFAOYSA-N 2,4-dimethoxybenzene-1,3-diamine Chemical compound COC1=CC=C(N)C(OC)=C1N MJMRSGYLARBUDK-UHFFFAOYSA-N 0.000 description 2
- BWAPJIHJXDYDPW-UHFFFAOYSA-N 2,5-dimethyl-p-phenylenediamine Chemical compound CC1=CC(N)=C(C)C=C1N BWAPJIHJXDYDPW-UHFFFAOYSA-N 0.000 description 2
- BXBOXUNPNIJELB-UHFFFAOYSA-N 2,6-dimethoxypyridine-3,5-diamine Chemical compound COC1=NC(OC)=C(N)C=C1N BXBOXUNPNIJELB-UHFFFAOYSA-N 0.000 description 2
- MJAVQHPPPBDYAN-UHFFFAOYSA-N 2,6-dimethylbenzene-1,4-diamine Chemical compound CC1=CC(N)=CC(C)=C1N MJAVQHPPPBDYAN-UHFFFAOYSA-N 0.000 description 2
- BQHMISUMCDYQTR-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-ylamino)ethanol Chemical compound OCCNC1=CC=C2OCOC2=C1 BQHMISUMCDYQTR-UHFFFAOYSA-N 0.000 description 2
- UEANEAODIZOETQ-UHFFFAOYSA-N 2-(2,4-diaminophenoxy)acetic acid Chemical compound NC1=CC=C(OCC(O)=O)C(N)=C1 UEANEAODIZOETQ-UHFFFAOYSA-N 0.000 description 2
- OWMQBFHMJVSJSA-UHFFFAOYSA-N 2-(2-amino-4-nitroanilino)ethanol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1NCCO OWMQBFHMJVSJSA-UHFFFAOYSA-N 0.000 description 2
- YUNHBAIHRNIODP-UHFFFAOYSA-N 2-(2-hydroxyethylamino)-5-nitrophenol Chemical compound OCCNC1=CC=C([N+]([O-])=O)C=C1O YUNHBAIHRNIODP-UHFFFAOYSA-N 0.000 description 2
- LFOUYKNCQNVIGI-UHFFFAOYSA-N 2-(2-nitroanilino)ethanol Chemical compound OCCNC1=CC=CC=C1[N+]([O-])=O LFOUYKNCQNVIGI-UHFFFAOYSA-N 0.000 description 2
- ZTNLMELMADJSAH-UHFFFAOYSA-N 2-(3-aminoanilino)ethanol Chemical compound NC1=CC=CC(NCCO)=C1 ZTNLMELMADJSAH-UHFFFAOYSA-N 0.000 description 2
- JEGKOEYHLJTZGJ-UHFFFAOYSA-N 2-(3-hydroxyanilino)acetamide Chemical compound NC(=O)CNC1=CC=CC(O)=C1 JEGKOEYHLJTZGJ-UHFFFAOYSA-N 0.000 description 2
- KDBUTNSQYYLYOY-UHFFFAOYSA-N 2-(4,5-diaminopyrazol-1-yl)ethanol Chemical compound NC=1C=NN(CCO)C=1N KDBUTNSQYYLYOY-UHFFFAOYSA-N 0.000 description 2
- LGZSBRSLVPLNTM-UHFFFAOYSA-N 2-(4-amino-2-methyl-5-nitroanilino)ethanol Chemical compound CC1=CC(N)=C([N+]([O-])=O)C=C1NCCO LGZSBRSLVPLNTM-UHFFFAOYSA-N 0.000 description 2
- LGGKGPQFSCBUOR-UHFFFAOYSA-N 2-(4-chloro-2-nitroanilino)ethanol Chemical compound OCCNC1=CC=C(Cl)C=C1[N+]([O-])=O LGGKGPQFSCBUOR-UHFFFAOYSA-N 0.000 description 2
- AWTLUMCKTGWXNY-UHFFFAOYSA-N 2-(4-methoxyanilino)ethanol Chemical compound COC1=CC=C(NCCO)C=C1 AWTLUMCKTGWXNY-UHFFFAOYSA-N 0.000 description 2
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical class CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 2
- AFEGSWYFCCXCQJ-UHFFFAOYSA-N 2-(ethylamino)-4,6-dinitrophenol Chemical compound CCNC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O AFEGSWYFCCXCQJ-UHFFFAOYSA-N 0.000 description 2
- GMTGBTPMSKOJGU-UHFFFAOYSA-N 2-[(3-aminoanilino)methyl]phenol;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2C(=CC=CC=2)O)=C1 GMTGBTPMSKOJGU-UHFFFAOYSA-N 0.000 description 2
- DEZOGYCXWGTILF-UHFFFAOYSA-N 2-[(4-chlorophenyl)methyl]pyrazole-3,4-diamine Chemical compound NC1=C(N)C=NN1CC1=CC=C(Cl)C=C1 DEZOGYCXWGTILF-UHFFFAOYSA-N 0.000 description 2
- BYYOWEYWJDNTBJ-UHFFFAOYSA-N 2-[(4-methylphenyl)methyl]pyrazole-3,4-diamine Chemical compound C1=CC(C)=CC=C1CN1C(N)=C(N)C=N1 BYYOWEYWJDNTBJ-UHFFFAOYSA-N 0.000 description 2
- NLMKTBGFQGKQEV-UHFFFAOYSA-N 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hexadecoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol Chemical compound CCCCCCCCCCCCCCCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO NLMKTBGFQGKQEV-UHFFFAOYSA-N 0.000 description 2
- WIDDYDROAFWYSF-UHFFFAOYSA-N 2-[3-(3-aminoanilino)prop-1-enyl]benzene-1,4-diamine Chemical compound NC1=CC=CC(NCC=CC=2C(=CC=C(N)C=2)N)=C1 WIDDYDROAFWYSF-UHFFFAOYSA-N 0.000 description 2
- LRCKHQHASZLXMD-UHFFFAOYSA-N 2-[3-(4-aminoanilino)prop-1-enyl]benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NCC=CC1=CC(N)=CC=C1N LRCKHQHASZLXMD-UHFFFAOYSA-N 0.000 description 2
- MQMMMSDSVNOFJM-UHFFFAOYSA-N 2-[3-amino-n-(2-hydroxyethyl)anilino]ethanol Chemical compound NC1=CC=CC(N(CCO)CCO)=C1 MQMMMSDSVNOFJM-UHFFFAOYSA-N 0.000 description 2
- WXGKXLXGYOYZMX-UHFFFAOYSA-N 2-[4-(2-aminoethylamino)-3-nitrophenoxy]ethanol Chemical compound NCCNC1=CC=C(OCCO)C=C1[N+]([O-])=O WXGKXLXGYOYZMX-UHFFFAOYSA-N 0.000 description 2
- FCDKGTXZKZEBPA-UHFFFAOYSA-N 2-[4-(2-hydroxyethylamino)anilino]ethanol Chemical compound OCCNC1=CC=C(NCCO)C=C1 FCDKGTXZKZEBPA-UHFFFAOYSA-N 0.000 description 2
- YSVKKVUAUKQDBY-UHFFFAOYSA-N 2-[4-[(4-aminophenyl)diazenyl]-n-(2-hydroxyethyl)-3-methylanilino]ethanol Chemical compound CC1=CC(N(CCO)CCO)=CC=C1N=NC1=CC=C(N)C=C1 YSVKKVUAUKQDBY-UHFFFAOYSA-N 0.000 description 2
- LXKQJEXWFGAMMW-UHFFFAOYSA-N 2-[4-[ethyl(2-hydroxyethyl)amino]-2-nitroanilino]ethanol;hydrochloride Chemical compound Cl.OCCN(CC)C1=CC=C(NCCO)C([N+]([O-])=O)=C1 LXKQJEXWFGAMMW-UHFFFAOYSA-N 0.000 description 2
- FWHJBCKOBHQMNO-UHFFFAOYSA-N 2-[4-amino-2-[(3,5-diaminophenyl)methylamino]phenoxy]ethanol;hydrochloride Chemical compound Cl.NC1=CC=C(OCCO)C(NCC=2C=C(N)C=C(N)C=2)=C1 FWHJBCKOBHQMNO-UHFFFAOYSA-N 0.000 description 2
- ASAQRGCLIPUSEK-UHFFFAOYSA-N 2-[4-amino-n-(2-hydroxyethyl)-3-nitroanilino]ethanol;hydrochloride Chemical compound Cl.NC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O ASAQRGCLIPUSEK-UHFFFAOYSA-N 0.000 description 2
- ZEARLPPIUCBHRP-UHFFFAOYSA-N 2-[4-chloro-5-(2-hydroxyethylamino)-2-nitroanilino]ethanol Chemical compound OCCNC1=CC(NCCO)=C([N+]([O-])=O)C=C1Cl ZEARLPPIUCBHRP-UHFFFAOYSA-N 0.000 description 2
- PDFQDTGOGSGZPN-UHFFFAOYSA-N 2-[5-(2-hydroxyethylamino)-2,4-dimethoxyanilino]ethanol Chemical compound COC1=CC(OC)=C(NCCO)C=C1NCCO PDFQDTGOGSGZPN-UHFFFAOYSA-N 0.000 description 2
- ADCWDMYESTYBBN-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-3-methyl-4-[(4-nitrophenyl)diazenyl]anilino]ethanol Chemical compound CC1=CC(N(CCO)CCO)=CC=C1N=NC1=CC=C([N+]([O-])=O)C=C1 ADCWDMYESTYBBN-UHFFFAOYSA-N 0.000 description 2
- MSWZFWKMSRAUBD-IVMDWMLBSA-N 2-amino-2-deoxy-D-glucopyranose Chemical compound N[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O MSWZFWKMSRAUBD-IVMDWMLBSA-N 0.000 description 2
- HCPJEHJGFKWRFM-UHFFFAOYSA-N 2-amino-5-methylphenol Chemical compound CC1=CC=C(N)C(O)=C1 HCPJEHJGFKWRFM-UHFFFAOYSA-N 0.000 description 2
- ALQKEYVDQYGZDN-UHFFFAOYSA-N 2-amino-6-methylphenol Chemical compound CC1=CC=CC(N)=C1O ALQKEYVDQYGZDN-UHFFFAOYSA-N 0.000 description 2
- PUAQLLVFLMYYJJ-UHFFFAOYSA-N 2-aminopropiophenone Chemical compound CC(N)C(=O)C1=CC=CC=C1 PUAQLLVFLMYYJJ-UHFFFAOYSA-N 0.000 description 2
- MGLZGLAFFOMWPB-UHFFFAOYSA-N 2-chloro-1,4-phenylenediamine Chemical compound NC1=CC=C(N)C(Cl)=C1 MGLZGLAFFOMWPB-UHFFFAOYSA-N 0.000 description 2
- CDFNUSAXZDSXKF-UHFFFAOYSA-N 2-chloro-6-(ethylamino)-4-nitrophenol Chemical compound CCNC1=CC([N+]([O-])=O)=CC(Cl)=C1O CDFNUSAXZDSXKF-UHFFFAOYSA-N 0.000 description 2
- WROUWQQRXUBECT-UHFFFAOYSA-N 2-ethylacrylic acid Chemical group CCC(=C)C(O)=O WROUWQQRXUBECT-UHFFFAOYSA-N 0.000 description 2
- ASUDFOJKTJLAIK-UHFFFAOYSA-N 2-methoxyethanamine Chemical compound COCCN ASUDFOJKTJLAIK-UHFFFAOYSA-N 0.000 description 2
- UYNRBRQYDFOBBD-UHFFFAOYSA-N 2-methyl-5-(propan-2-ylamino)phenol Chemical compound CC(C)NC1=CC=C(C)C(O)=C1 UYNRBRQYDFOBBD-UHFFFAOYSA-N 0.000 description 2
- XOAXOKSJNVLLHZ-UHFFFAOYSA-N 2-methylpyrazole-3,4-diamine Chemical compound CN1N=CC(N)=C1N XOAXOKSJNVLLHZ-UHFFFAOYSA-N 0.000 description 2
- WNYJRJRHKRZXEO-UHFFFAOYSA-N 2-propan-2-ylbenzene-1,4-diamine Chemical compound CC(C)C1=CC(N)=CC=C1N WNYJRJRHKRZXEO-UHFFFAOYSA-N 0.000 description 2
- DAWNEUSXWHZHRZ-UHFFFAOYSA-N 2-propan-2-ylpyrazole-3,4-diamine Chemical compound CC(C)N1N=CC(N)=C1N DAWNEUSXWHZHRZ-UHFFFAOYSA-N 0.000 description 2
- HEMGYNNCNNODNX-UHFFFAOYSA-N 3,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1N HEMGYNNCNNODNX-UHFFFAOYSA-N 0.000 description 2
- UVUGDGRIYQQKIT-UHFFFAOYSA-N 3,4-dihydro-2h-1,4-benzoxazin-6-amine Chemical compound O1CCNC2=CC(N)=CC=C21 UVUGDGRIYQQKIT-UHFFFAOYSA-N 0.000 description 2
- CEAZJJWZNUEYAN-UHFFFAOYSA-N 3,5-dimethoxypyridine-2,6-diamine Chemical compound COC1=CC(OC)=C(N)N=C1N CEAZJJWZNUEYAN-UHFFFAOYSA-N 0.000 description 2
- URWKQPHSJZKEOB-UHFFFAOYSA-N 3-(2,4-diaminophenoxy)propan-1-ol Chemical compound NC1=CC=C(OCCCO)C(N)=C1 URWKQPHSJZKEOB-UHFFFAOYSA-N 0.000 description 2
- GPRKFLQJBUXTIP-UHFFFAOYSA-N 3-(2,5-diaminophenyl)-n-ethylprop-2-enamide Chemical compound CCNC(=O)C=CC1=CC(N)=CC=C1N GPRKFLQJBUXTIP-UHFFFAOYSA-N 0.000 description 2
- LMLXFTWWTZTUSE-UHFFFAOYSA-N 3-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=C(O)C=CC=C1NCCO LMLXFTWWTZTUSE-UHFFFAOYSA-N 0.000 description 2
- YBJRIYRYCGKUIM-UHFFFAOYSA-N 3-(2-hydroxyethylamino)phenol Chemical compound OCCNC1=CC=CC(O)=C1 YBJRIYRYCGKUIM-UHFFFAOYSA-N 0.000 description 2
- GOIOOIZLSGKBBH-UHFFFAOYSA-N 3-(2-methoxyethylamino)phenol Chemical compound COCCNC1=CC=CC(O)=C1 GOIOOIZLSGKBBH-UHFFFAOYSA-N 0.000 description 2
- YHRACTMMZSGROP-UHFFFAOYSA-N 3-(3-hydroxy-2-methylanilino)propane-1,2-diol Chemical compound CC1=C(O)C=CC=C1NCC(O)CO YHRACTMMZSGROP-UHFFFAOYSA-N 0.000 description 2
- YFKNIPGAJBJZQT-UHFFFAOYSA-N 3-(4-amino-2-chloro-5-nitroanilino)propane-1,2-diol Chemical compound NC1=CC(Cl)=C(NCC(O)CO)C=C1[N+]([O-])=O YFKNIPGAJBJZQT-UHFFFAOYSA-N 0.000 description 2
- MZQGZBUNWFAKAC-UHFFFAOYSA-N 3-(4-aminoanilino)propan-1-ol Chemical compound NC1=CC=C(NCCCO)C=C1 MZQGZBUNWFAKAC-UHFFFAOYSA-N 0.000 description 2
- WAVOOWVINKGEHS-UHFFFAOYSA-N 3-(diethylamino)phenol Chemical compound CCN(CC)C1=CC=CC(O)=C1 WAVOOWVINKGEHS-UHFFFAOYSA-N 0.000 description 2
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 2
- NXBITZINFNZWBN-UHFFFAOYSA-N 3-[(3-aminoanilino)methyl]phenol;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2C=C(O)C=CC=2)=C1 NXBITZINFNZWBN-UHFFFAOYSA-N 0.000 description 2
- XDHQHBSDKYPJRG-UHFFFAOYSA-N 3-[2-nitro-4-(trifluoromethyl)anilino]propane-1,2-diol Chemical compound OCC(O)CNC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O XDHQHBSDKYPJRG-UHFFFAOYSA-N 0.000 description 2
- SZWQTBKBBNGUAB-UHFFFAOYSA-N 3-[4-(2-hydroxyethylamino)-3-nitrophenoxy]propane-1,2-diol Chemical compound OCCNC1=CC=C(OCC(O)CO)C=C1[N+]([O-])=O SZWQTBKBBNGUAB-UHFFFAOYSA-N 0.000 description 2
- YHSOWKGIYXECIF-UHFFFAOYSA-N 3-[4-[bis(2-hydroxyethyl)amino]-2-nitroanilino]propan-1-ol Chemical compound OCCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O YHSOWKGIYXECIF-UHFFFAOYSA-N 0.000 description 2
- SYRZWFBWUASJJI-UHFFFAOYSA-N 3-amino-2,4-dichlorophenol Chemical compound NC1=C(Cl)C=CC(O)=C1Cl SYRZWFBWUASJJI-UHFFFAOYSA-N 0.000 description 2
- FLROJJGKUKLCAE-UHFFFAOYSA-N 3-amino-2-methylphenol Chemical compound CC1=C(N)C=CC=C1O FLROJJGKUKLCAE-UHFFFAOYSA-N 0.000 description 2
- IVZSVRVNPYVZAD-UHFFFAOYSA-N 3-n-(1,3-benzodioxol-5-ylmethyl)benzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2C=C3OCOC3=CC=2)=C1 IVZSVRVNPYVZAD-UHFFFAOYSA-N 0.000 description 2
- LRZCBJYTBUZEFK-UHFFFAOYSA-N 3-n-(2-aminoethyl)benzene-1,3-diamine Chemical compound NCCNC1=CC=CC(N)=C1 LRZCBJYTBUZEFK-UHFFFAOYSA-N 0.000 description 2
- HGAQHLOYWDRZCG-UHFFFAOYSA-N 3-n-(furan-2-ylmethyl)benzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2OC=CC=2)=C1 HGAQHLOYWDRZCG-UHFFFAOYSA-N 0.000 description 2
- MBIOTDAEBZGQRR-UHFFFAOYSA-N 3-n-(thiophen-2-ylmethyl)benzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2SC=CC=2)=C1 MBIOTDAEBZGQRR-UHFFFAOYSA-N 0.000 description 2
- ZQYZKDPAEKLCDS-UHFFFAOYSA-N 3-n-[(4-aminophenyl)methyl]benzene-1,3-diamine;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1CNC1=CC=CC(N)=C1 ZQYZKDPAEKLCDS-UHFFFAOYSA-N 0.000 description 2
- STZIZYKIMIKSIR-UHFFFAOYSA-N 3-n-[(4-methoxyphenyl)methyl]benzene-1,3-diamine;hydrochloride Chemical compound Cl.C1=CC(OC)=CC=C1CNC1=CC=CC(N)=C1 STZIZYKIMIKSIR-UHFFFAOYSA-N 0.000 description 2
- XRQTVYCGHLGBEB-UHFFFAOYSA-N 3-n-benzylbenzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2C=CC=CC=2)=C1 XRQTVYCGHLGBEB-UHFFFAOYSA-N 0.000 description 2
- GRLQBYQELUWBIO-UHFFFAOYSA-N 4,6-dichlorobenzene-1,3-diol Chemical compound OC1=CC(O)=C(Cl)C=C1Cl GRLQBYQELUWBIO-UHFFFAOYSA-N 0.000 description 2
- BNRMHEDSMWOIMC-UHFFFAOYSA-N 4-(2-aminoethoxy)benzene-1,3-diamine Chemical compound NCCOC1=CC=C(N)C=C1N BNRMHEDSMWOIMC-UHFFFAOYSA-N 0.000 description 2
- HWIFOTHJSSDGGC-UHFFFAOYSA-N 4-(2-hydroxyethylamino)-3-nitrobenzamide Chemical compound NC(=O)C1=CC=C(NCCO)C([N+]([O-])=O)=C1 HWIFOTHJSSDGGC-UHFFFAOYSA-N 0.000 description 2
- PWOSOZQHIRPPHP-UHFFFAOYSA-N 4-(2-hydroxyethylamino)-3-nitrobenzonitrile Chemical compound OCCNC1=CC=C(C#N)C=C1[N+]([O-])=O PWOSOZQHIRPPHP-UHFFFAOYSA-N 0.000 description 2
- VTXBLQLZQLHDIL-UHFFFAOYSA-N 4-(3-hydroxypropylamino)-3-nitrophenol Chemical compound OCCCNC1=CC=C(O)C=C1[N+]([O-])=O VTXBLQLZQLHDIL-UHFFFAOYSA-N 0.000 description 2
- BGGGDHXHMQFBGA-UHFFFAOYSA-N 4-[(2,4-diaminophenoxy)methoxy]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OCOC1=CC=C(N)C=C1N BGGGDHXHMQFBGA-UHFFFAOYSA-N 0.000 description 2
- NZMFZUGEOCZRAX-UHFFFAOYSA-N 4-amino-2-(2-hydroxyethyl)phenol Chemical compound NC1=CC=C(O)C(CCO)=C1 NZMFZUGEOCZRAX-UHFFFAOYSA-N 0.000 description 2
- PZKNKZNLQYKXFV-UHFFFAOYSA-N 4-amino-2-(aminomethyl)phenol Chemical compound NCC1=CC(N)=CC=C1O PZKNKZNLQYKXFV-UHFFFAOYSA-N 0.000 description 2
- RGKJLNMYCNSVKZ-UHFFFAOYSA-N 4-amino-2-(methoxymethyl)phenol Chemical compound COCC1=CC(N)=CC=C1O RGKJLNMYCNSVKZ-UHFFFAOYSA-N 0.000 description 2
- JXCIBUJZPALRGP-UHFFFAOYSA-N 4-amino-2-(propylaminomethyl)phenol Chemical compound CCCNCC1=CC(N)=CC=C1O JXCIBUJZPALRGP-UHFFFAOYSA-N 0.000 description 2
- CXBFRQIFEVEZPR-UHFFFAOYSA-N 4-amino-2-[(pyridin-3-ylamino)methyl]phenol Chemical compound NC1=CC=C(O)C(CNC=2C=NC=CC=2)=C1 CXBFRQIFEVEZPR-UHFFFAOYSA-N 0.000 description 2
- GPMWAWDEZPFUTN-UHFFFAOYSA-N 4-fluoro-6-methylbenzene-1,3-diamine Chemical compound CC1=CC(F)=C(N)C=C1N GPMWAWDEZPFUTN-UHFFFAOYSA-N 0.000 description 2
- NLMQHXUGJIAKTH-UHFFFAOYSA-N 4-hydroxyindole Chemical compound OC1=CC=CC2=C1C=CN2 NLMQHXUGJIAKTH-UHFFFAOYSA-N 0.000 description 2
- JOJAEBZHFWYZAY-UHFFFAOYSA-N 4-methoxy-6-methylbenzene-1,3-diamine Chemical compound COC1=CC(C)=C(N)C=C1N JOJAEBZHFWYZAY-UHFFFAOYSA-N 0.000 description 2
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 2
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 2
- XCJRRZLPXALCIP-UHFFFAOYSA-N 4-n-(2-methoxyethyl)benzene-1,4-diamine Chemical compound COCCNC1=CC=C(N)C=C1 XCJRRZLPXALCIP-UHFFFAOYSA-N 0.000 description 2
- FRHDFBXUGSTTGN-UHFFFAOYSA-N 4-n-(furan-3-ylmethyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NCC1=COC=C1 FRHDFBXUGSTTGN-UHFFFAOYSA-N 0.000 description 2
- SGWAXDAXRPWVHR-UHFFFAOYSA-N 4-n-(thiophen-3-ylmethyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NCC1=CSC=C1 SGWAXDAXRPWVHR-UHFFFAOYSA-N 0.000 description 2
- SGNZYJXNUURYCH-UHFFFAOYSA-N 5,6-dihydroxyindole Chemical compound C1=C(O)C(O)=CC2=C1NC=C2 SGNZYJXNUURYCH-UHFFFAOYSA-N 0.000 description 2
- XOVBEQRPIHPGPO-UHFFFAOYSA-N 5-(3-hydroxypropylamino)-2-methylphenol Chemical compound CC1=CC=C(NCCCO)C=C1O XOVBEQRPIHPGPO-UHFFFAOYSA-N 0.000 description 2
- CKGFPHOMFYTYMQ-UHFFFAOYSA-N 5-(anilinomethyl)benzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC(N)=CC(CNC=2C=CC=CC=2)=C1 CKGFPHOMFYTYMQ-UHFFFAOYSA-N 0.000 description 2
- YDXQHDSFUYVNGG-UHFFFAOYSA-N 5-(furan-2-ylmethylamino)-2-methylphenol Chemical compound C1=C(O)C(C)=CC=C1NCC1=CC=CO1 YDXQHDSFUYVNGG-UHFFFAOYSA-N 0.000 description 2
- UWIASMTXKMLBML-UHFFFAOYSA-N 5-[(4-aminoanilino)methyl]benzene-1,3-diamine;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1NCC1=CC(N)=CC(N)=C1 UWIASMTXKMLBML-UHFFFAOYSA-N 0.000 description 2
- QPHMVRPABQUYGN-UHFFFAOYSA-N 5-amino-2,4-dichlorophenol Chemical compound NC1=CC(O)=C(Cl)C=C1Cl QPHMVRPABQUYGN-UHFFFAOYSA-N 0.000 description 2
- CNEHJJGZSQRWRR-UHFFFAOYSA-N 5-amino-2-(2-hydroxyethoxy)phenol Chemical compound NC1=CC=C(OCCO)C(O)=C1 CNEHJJGZSQRWRR-UHFFFAOYSA-N 0.000 description 2
- SZNMBMXMWVVCOE-UHFFFAOYSA-N 5-amino-2-ethylphenol Chemical compound CCC1=CC=C(N)C=C1O SZNMBMXMWVVCOE-UHFFFAOYSA-N 0.000 description 2
- WDQMXRWYXILWPT-UHFFFAOYSA-N 5-amino-4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=C(N)C=C1O WDQMXRWYXILWPT-UHFFFAOYSA-N 0.000 description 2
- PERWLJUQQIWGLB-UHFFFAOYSA-N 5-amino-4-ethoxy-2-methylphenol Chemical compound CCOC1=CC(C)=C(O)C=C1N PERWLJUQQIWGLB-UHFFFAOYSA-N 0.000 description 2
- HEAQOCBITATQEW-UHFFFAOYSA-N 5-amino-4-fluoro-2-methylphenol Chemical compound CC1=CC(F)=C(N)C=C1O HEAQOCBITATQEW-UHFFFAOYSA-N 0.000 description 2
- MUHQJMUYRYHUIW-UHFFFAOYSA-N 5-amino-4-methoxy-2-methylphenol Chemical compound COC1=CC(C)=C(O)C=C1N MUHQJMUYRYHUIW-UHFFFAOYSA-N 0.000 description 2
- LMIQERWZRIFWNZ-UHFFFAOYSA-N 5-hydroxyindole Chemical compound OC1=CC=C2NC=CC2=C1 LMIQERWZRIFWNZ-UHFFFAOYSA-N 0.000 description 2
- FLCAEMBIQVZWIF-UHFFFAOYSA-N 6-(dimethylamino)-2-methylhex-2-enamide Chemical compound CN(C)CCCC=C(C)C(N)=O FLCAEMBIQVZWIF-UHFFFAOYSA-N 0.000 description 2
- TUYBCLHMZFLWRY-UHFFFAOYSA-N 6-bromo-1,3-benzodioxol-5-ol Chemical compound C1=C(Br)C(O)=CC2=C1OCO2 TUYBCLHMZFLWRY-UHFFFAOYSA-N 0.000 description 2
- KIEGFAYDOKCBOK-UHFFFAOYSA-N 6-hydroxy-4,5-dimethyl-1h-pyridin-2-one Chemical compound CC1=CC(=O)NC(O)=C1C KIEGFAYDOKCBOK-UHFFFAOYSA-N 0.000 description 2
- WEPOCTWSRWLQLL-UHFFFAOYSA-N 6-methoxypyridine-2,3-diamine Chemical compound COC1=CC=C(N)C(N)=N1 WEPOCTWSRWLQLL-UHFFFAOYSA-N 0.000 description 2
- TWLMSPNQBKSXOP-UHFFFAOYSA-N 6358-09-4 Chemical compound NC1=CC([N+]([O-])=O)=CC(Cl)=C1O TWLMSPNQBKSXOP-UHFFFAOYSA-N 0.000 description 2
- 229940076442 9,10-anthraquinone Drugs 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 239000004475 Arginine Substances 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- SGHZXLIDFTYFHQ-UHFFFAOYSA-L Brilliant Blue Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 SGHZXLIDFTYFHQ-UHFFFAOYSA-L 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 2
- 125000006577 C1-C6 hydroxyalkyl group Chemical group 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical class NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- ZRALSGWEFCBTJO-UHFFFAOYSA-N Guanidine Chemical compound NC(N)=N ZRALSGWEFCBTJO-UHFFFAOYSA-N 0.000 description 2
- GZGZVOLBULPDFD-UHFFFAOYSA-N HC Red No. 3 Chemical compound NC1=CC=C(NCCO)C([N+]([O-])=O)=C1 GZGZVOLBULPDFD-UHFFFAOYSA-N 0.000 description 2
- PNENOUKIPPERMY-UHFFFAOYSA-N HC Yellow No. 4 Chemical compound OCCNC1=CC=C([N+]([O-])=O)C=C1OCCO PNENOUKIPPERMY-UHFFFAOYSA-N 0.000 description 2
- WOBHKFSMXKNTIM-UHFFFAOYSA-N Hydroxyethyl methacrylate Chemical compound CC(=C)C(=O)OCCO WOBHKFSMXKNTIM-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 2
- WHUUTDBJXJRKMK-VKHMYHEASA-N L-glutamic acid Chemical compound OC(=O)[C@@H](N)CCC(O)=O WHUUTDBJXJRKMK-VKHMYHEASA-N 0.000 description 2
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 2
- 239000004166 Lanolin Substances 0.000 description 2
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 2
- 239000004472 Lysine Substances 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical group CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 description 2
- BZORFPDSXLZWJF-UHFFFAOYSA-N N,N-dimethyl-1,4-phenylenediamine Chemical compound CN(C)C1=CC=C(N)C=C1 BZORFPDSXLZWJF-UHFFFAOYSA-N 0.000 description 2
- 229920000691 Poly[bis(2-chloroethyl) ether-alt-1,3-bis[3-(dimethylamino)propyl]urea] Polymers 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- 108010077895 Sarcosine Proteins 0.000 description 2
- MTCFGRXMJLQNBG-UHFFFAOYSA-N Serine Natural products OCC(N)C(O)=O MTCFGRXMJLQNBG-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 229920002125 Sokalan® Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 239000005864 Sulphur Substances 0.000 description 2
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- HSWXSHNPRUMJKI-UHFFFAOYSA-N [8-[(2-methoxyphenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].COC1=CC=CC=C1N\N=C/1C2=CC([N+](C)(C)C)=CC=C2C=CC\1=O HSWXSHNPRUMJKI-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000001253 acrylic acids Chemical class 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 235000010443 alginic acid Nutrition 0.000 description 2
- 229920000615 alginic acid Polymers 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- WLDHEUZGFKACJH-UHFFFAOYSA-K amaranth Chemical compound [Na+].[Na+].[Na+].C12=CC=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=C1N=NC1=CC=C(S([O-])(=O)=O)C2=CC=CC=C12 WLDHEUZGFKACJH-UHFFFAOYSA-K 0.000 description 2
- 235000001014 amino acid Nutrition 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 2
- 229920013822 aminosilicone Polymers 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940053200 antiepileptics fatty acid derivative Drugs 0.000 description 2
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- HWYNRVXFYFQSID-UHFFFAOYSA-M benzo[a]phenoxazin-9-ylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C1=CC=C2C(N=C3C=CC(C=C3O3)=[N+](C)C)=C3C=CC2=C1 HWYNRVXFYFQSID-UHFFFAOYSA-M 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- MSWZFWKMSRAUBD-UHFFFAOYSA-N beta-D-galactosamine Natural products NC1C(O)OC(CO)C(O)C1O MSWZFWKMSRAUBD-UHFFFAOYSA-N 0.000 description 2
- 229960003237 betaine Drugs 0.000 description 2
- 235000012745 brilliant blue FCF Nutrition 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 102220431943 c.61C>T Human genes 0.000 description 2
- 229940096584 c12-15 pareth-3 Drugs 0.000 description 2
- 125000005517 carbenium group Chemical group 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 229960000541 cetyl alcohol Drugs 0.000 description 2
- 239000013522 chelant Substances 0.000 description 2
- PXOZAFXVEWKXED-UHFFFAOYSA-N chembl1590721 Chemical compound C1=CC(NC(=O)C)=CC=C1N=NC1=CC(C)=CC=C1O PXOZAFXVEWKXED-UHFFFAOYSA-N 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- AMTWCFIAVKBGOD-UHFFFAOYSA-N dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane Chemical compound O=[Si]=O.CO[Si](C)(C)O[Si](C)(C)C AMTWCFIAVKBGOD-UHFFFAOYSA-N 0.000 description 2
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 2
- LGWXIBBJZQOXSO-UHFFFAOYSA-L disodium 5-acetamido-4-hydroxy-3-[(2-methylphenyl)diazenyl]naphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].OC1=C2C(NC(=O)C)=CC(S([O-])(=O)=O)=CC2=CC(S([O-])(=O)=O)=C1N=NC1=CC=CC=C1C LGWXIBBJZQOXSO-UHFFFAOYSA-L 0.000 description 2
- BFPHARWMKXLEBO-UHFFFAOYSA-L disodium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate;hydrate Chemical compound O.[Na+].[Na+].OC(=O)CN(CC(O)=O)CCN(CC([O-])=O)CC([O-])=O BFPHARWMKXLEBO-UHFFFAOYSA-L 0.000 description 2
- YSVBPNGJESBVRM-UHFFFAOYSA-L disodium;4-[(1-oxido-4-sulfonaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate Chemical compound [Na+].[Na+].C1=CC=C2C(N=NC3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)O)=CC=C(S([O-])(=O)=O)C2=C1 YSVBPNGJESBVRM-UHFFFAOYSA-L 0.000 description 2
- FPAYXBWMYIMERV-UHFFFAOYSA-L disodium;5-methyl-2-[[4-(4-methyl-2-sulfonatoanilino)-9,10-dioxoanthracen-1-yl]amino]benzenesulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC(C)=CC=C1NC(C=1C(=O)C2=CC=CC=C2C(=O)C=11)=CC=C1NC1=CC=C(C)C=C1S([O-])(=O)=O FPAYXBWMYIMERV-UHFFFAOYSA-L 0.000 description 2
- NOPFSRXAKWQILS-UHFFFAOYSA-N docosan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCO NOPFSRXAKWQILS-UHFFFAOYSA-N 0.000 description 2
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 2
- IGBSXRIJNMDLFB-UHFFFAOYSA-N ethane-1,2-diamine;pentanedioic acid Chemical compound NCCN.OC(=O)CCCC(O)=O.OC(=O)CCCC(O)=O IGBSXRIJNMDLFB-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- AMFZXVSYJYDGJD-UHFFFAOYSA-M ethyl-dimethyl-(3-methyl-2-oxobut-3-enyl)azanium;chloride Chemical compound [Cl-].CC[N+](C)(C)CC(=O)C(C)=C AMFZXVSYJYDGJD-UHFFFAOYSA-M 0.000 description 2
- STVZJERGLQHEKB-UHFFFAOYSA-N ethylene glycol dimethacrylate Substances CC(=C)C(=O)OCCOC(=O)C(C)=C STVZJERGLQHEKB-UHFFFAOYSA-N 0.000 description 2
- 150000002193 fatty amides Chemical class 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 229960002442 glucosamine Drugs 0.000 description 2
- 235000013922 glutamic acid Nutrition 0.000 description 2
- 239000004220 glutamic acid Substances 0.000 description 2
- 238000005469 granulation Methods 0.000 description 2
- 230000003179 granulation Effects 0.000 description 2
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 230000037308 hair color Effects 0.000 description 2
- 229940051250 hexylene glycol Drugs 0.000 description 2
- 229960004337 hydroquinone Drugs 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229940039717 lanolin Drugs 0.000 description 2
- 235000019388 lanolin Nutrition 0.000 description 2
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 description 2
- VGSVNUGKHOVSPK-UHFFFAOYSA-N leukoaminochrome Chemical compound C1=C(O)C(O)=CC2=C1NCC2 VGSVNUGKHOVSPK-UHFFFAOYSA-N 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- KBOPZPXVLCULAV-UHFFFAOYSA-N mesalamine Chemical compound NC1=CC=C(O)C(C(O)=O)=C1 KBOPZPXVLCULAV-UHFFFAOYSA-N 0.000 description 2
- 229960004963 mesalazine Drugs 0.000 description 2
- 229920003145 methacrylic acid copolymer Polymers 0.000 description 2
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 2
- SNVLJLYUUXKWOJ-UHFFFAOYSA-N methylidenecarbene Chemical compound C=[C] SNVLJLYUUXKWOJ-UHFFFAOYSA-N 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- AFAJYBYVKUTWJK-UHFFFAOYSA-N n'-(5-methoxy-2-nitrophenyl)ethane-1,2-diamine;hydrochloride Chemical compound Cl.COC1=CC=C([N+]([O-])=O)C(NCCN)=C1 AFAJYBYVKUTWJK-UHFFFAOYSA-N 0.000 description 2
- BKEFUBHXUTWQED-UHFFFAOYSA-N n-(4-amino-3-hydroxyphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C(O)=C1 BKEFUBHXUTWQED-UHFFFAOYSA-N 0.000 description 2
- SPPNTLPHOCHOLW-UHFFFAOYSA-N n-[(2,5-diaminophenyl)methylideneamino]-4-hydroxybenzamide Chemical compound NC1=CC=C(N)C(C=NNC(=O)C=2C=CC(O)=CC=2)=C1 SPPNTLPHOCHOLW-UHFFFAOYSA-N 0.000 description 2
- ZUVBIBLYOCVYJU-UHFFFAOYSA-N naphthalene-1,7-diol Chemical compound C1=CC=C(O)C2=CC(O)=CC=C21 ZUVBIBLYOCVYJU-UHFFFAOYSA-N 0.000 description 2
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 2
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229940093446 oleth-5 Drugs 0.000 description 2
- 229940055577 oleyl alcohol Drugs 0.000 description 2
- XMLQWXUVTXCDDL-UHFFFAOYSA-N oleyl alcohol Natural products CCCCCCC=CCCCCCCCCCCO XMLQWXUVTXCDDL-UHFFFAOYSA-N 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000002924 oxiranes Chemical class 0.000 description 2
- ATGUVEKSASEFFO-UHFFFAOYSA-N p-aminodiphenylamine Chemical compound C1=CC(N)=CC=C1NC1=CC=CC=C1 ATGUVEKSASEFFO-UHFFFAOYSA-N 0.000 description 2
- 150000004989 p-phenylenediamines Chemical class 0.000 description 2
- 229960003330 pentetic acid Drugs 0.000 description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 2
- 229920001281 polyalkylene Polymers 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 235000012731 ponceau 4R Nutrition 0.000 description 2
- 235000019237 ponceau SX Nutrition 0.000 description 2
- 229960003975 potassium Drugs 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 2
- MIROPXUFDXCYLG-UHFFFAOYSA-N pyridine-2,5-diamine Chemical compound NC1=CC=C(N)N=C1 MIROPXUFDXCYLG-UHFFFAOYSA-N 0.000 description 2
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 2
- PZRKPUQWIFJRKZ-UHFFFAOYSA-N pyrimidine-2,4,5,6-tetramine Chemical compound NC1=NC(N)=C(N)C(N)=N1 PZRKPUQWIFJRKZ-UHFFFAOYSA-N 0.000 description 2
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical compound OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- OARRHUQTFTUEOS-UHFFFAOYSA-N safranin Chemical compound [Cl-].C=12C=C(N)C(C)=CC2=NC2=CC(C)=C(N)C=C2[N+]=1C1=CC=CC=C1 OARRHUQTFTUEOS-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229940043230 sarcosine Drugs 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- 229940083037 simethicone Drugs 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 229940001482 sodium sulfite Drugs 0.000 description 2
- DJDYMAHXZBQZKH-UHFFFAOYSA-M sodium;1-amino-4-(cyclohexylamino)-9,10-dioxoanthracene-2-sulfonate Chemical compound [Na+].C1=2C(=O)C3=CC=CC=C3C(=O)C=2C(N)=C(S([O-])(=O)=O)C=C1NC1CCCCC1 DJDYMAHXZBQZKH-UHFFFAOYSA-M 0.000 description 2
- GTKIEPUIFBBXJQ-UHFFFAOYSA-M sodium;2-[(4-hydroxy-9,10-dioxoanthracen-1-yl)amino]-5-methylbenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(C)=CC=C1NC1=CC=C(O)C2=C1C(=O)C1=CC=CC=C1C2=O GTKIEPUIFBBXJQ-UHFFFAOYSA-M 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 229940100458 steareth-21 Drugs 0.000 description 2
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- HLZKNKRTKFSKGZ-UHFFFAOYSA-N tetradecan-1-ol Chemical compound CCCCCCCCCCCCCCO HLZKNKRTKFSKGZ-UHFFFAOYSA-N 0.000 description 2
- GMMAPXRGRVJYJY-UHFFFAOYSA-J tetrasodium 4-acetamido-5-hydroxy-6-[[7-sulfonato-4-[(4-sulfonatophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1,7-disulfonate Chemical compound [Na+].[Na+].[Na+].[Na+].OC1=C2C(NC(=O)C)=CC=C(S([O-])(=O)=O)C2=CC(S([O-])(=O)=O)=C1N=NC(C1=CC(=CC=C11)S([O-])(=O)=O)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 GMMAPXRGRVJYJY-UHFFFAOYSA-J 0.000 description 2
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- DWKARHJHPSUOBW-UHFFFAOYSA-N trimethyl-[3-[(2e)-2-(3-methyl-5-oxo-1-phenylpyrazol-4-ylidene)hydrazinyl]phenyl]azanium;chloride Chemical compound [Cl-].CC1=NN(C=2C=CC=CC=2)C(O)=C1N=NC1=CC=CC([N+](C)(C)C)=C1 DWKARHJHPSUOBW-UHFFFAOYSA-N 0.000 description 2
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 2
- 229940048081 trisodium ethylenediamine disuccinate Drugs 0.000 description 2
- QEHXDDFROMGLSP-VDBFCSKJSA-K trisodium;(2s)-2-[2-[[(1s)-1-carboxy-2-carboxylatoethyl]amino]ethylamino]butanedioate Chemical compound [Na+].[Na+].[Na+].OC(=O)C[C@@H](C([O-])=O)NCCN[C@H](C([O-])=O)CC([O-])=O QEHXDDFROMGLSP-VDBFCSKJSA-K 0.000 description 2
- UJMBCXLDXJUMFB-UHFFFAOYSA-K trisodium;5-oxo-1-(4-sulfonatophenyl)-4-[(4-sulfonatophenyl)diazenyl]-4h-pyrazole-3-carboxylate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)C1=NN(C=2C=CC(=CC=2)S([O-])(=O)=O)C(=O)C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 UJMBCXLDXJUMFB-UHFFFAOYSA-K 0.000 description 2
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 2
- 229920001285 xanthan gum Polymers 0.000 description 2
- NKNCGBHPGCHYCQ-UHFFFAOYSA-N (2,5-diaminophenyl)methanol Chemical compound NC1=CC=C(N)C(CO)=C1 NKNCGBHPGCHYCQ-UHFFFAOYSA-N 0.000 description 1
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- GWHLYFOWAINYAH-UHFFFAOYSA-N (3-azaniumyl-4-methoxyphenyl)-(2-hydroxyethyl)azanium;sulfate Chemical compound OS(O)(=O)=O.COC1=CC=C(NCCO)C=C1N GWHLYFOWAINYAH-UHFFFAOYSA-N 0.000 description 1
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- 125000006528 (C2-C6) alkyl group Chemical group 0.000 description 1
- MYIDTCFDQGAVFL-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalene-1,5-diol Chemical compound C1=CC=C2C(O)CCCC2=C1O MYIDTCFDQGAVFL-UHFFFAOYSA-N 0.000 description 1
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 description 1
- AQNZDXHBYRTSHA-UHFFFAOYSA-N 1,4-bis(2,3-dihydroxypropylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(NCC(O)CO)=CC=C2NCC(O)CO AQNZDXHBYRTSHA-UHFFFAOYSA-N 0.000 description 1
- WHPNHQRWWMLKPJ-UHFFFAOYSA-N 1,4-dihydroxy-5,8-bis(2-hydroxyethylamino)anthracene-9,10-dione Chemical compound O=C1C2=C(O)C=CC(O)=C2C(=O)C2=C1C(NCCO)=CC=C2NCCO WHPNHQRWWMLKPJ-UHFFFAOYSA-N 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-dioxonaphthalene Natural products C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- IYNWDOLJDNUWPD-UHFFFAOYSA-N 1-(2,5-diaminophenyl)ethane-1,2-diol Chemical compound NC1=CC=C(N)C(C(O)CO)=C1 IYNWDOLJDNUWPD-UHFFFAOYSA-N 0.000 description 1
- OMZZHCWHBDIZFK-UHFFFAOYSA-N 1-(3,4-diamino-1h-pyrazol-5-yl)ethanol;sulfuric acid Chemical compound OS(O)(=O)=O.CC(O)C1=NNC(N)=C1N OMZZHCWHBDIZFK-UHFFFAOYSA-N 0.000 description 1
- MLDHMLJPHZYBDV-UHFFFAOYSA-N 1-(3-aminopropylamino)-4-(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(NCCCN)=CC=C2NC MLDHMLJPHZYBDV-UHFFFAOYSA-N 0.000 description 1
- BQYHUHIVBWYROK-UHFFFAOYSA-N 1-(3-aminopropylamino)-4-(methylamino)anthracene-9,10-dione;hydrochloride Chemical compound Cl.O=C1C2=CC=CC=C2C(=O)C2=C1C(NCCCN)=CC=C2NC BQYHUHIVBWYROK-UHFFFAOYSA-N 0.000 description 1
- MLVKRZHLEQPZTP-UHFFFAOYSA-N 1-(3-aminopropylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NCCCN MLVKRZHLEQPZTP-UHFFFAOYSA-N 0.000 description 1
- XYAQUYKPDDPZHG-UHFFFAOYSA-N 1-(4-aminoanilino)propan-2-ol Chemical compound CC(O)CNC1=CC=C(N)C=C1 XYAQUYKPDDPZHG-UHFFFAOYSA-N 0.000 description 1
- JDTDIZGWSVNMDX-UHFFFAOYSA-N 1-(5-amino-2-hydroxyphenyl)ethane-1,2-diol Chemical compound NC1=CC=C(O)C(C(O)CO)=C1 JDTDIZGWSVNMDX-UHFFFAOYSA-N 0.000 description 1
- LXQMHOKEXZETKB-UHFFFAOYSA-N 1-amino-2-methylpropan-2-ol Chemical compound CC(C)(O)CN LXQMHOKEXZETKB-UHFFFAOYSA-N 0.000 description 1
- KODLUXHSIZOKTG-UHFFFAOYSA-N 1-aminobutan-2-ol Chemical compound CCC(O)CN KODLUXHSIZOKTG-UHFFFAOYSA-N 0.000 description 1
- ZRUPXAZUXDFLTG-UHFFFAOYSA-N 1-aminopentan-2-ol Chemical compound CCCC(O)CN ZRUPXAZUXDFLTG-UHFFFAOYSA-N 0.000 description 1
- RPOTYPSPQZVIJY-UHFFFAOYSA-N 1-aminopentan-3-ol Chemical compound CCC(O)CCN RPOTYPSPQZVIJY-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- ZIQRJGXRRBOCEI-UHFFFAOYSA-M 1-ethenyl-3-methylimidazol-3-ium;1-ethenylpyrrolidin-2-one;chloride Chemical compound [Cl-].CN1C=C[N+](C=C)=C1.C=CN1CCCC1=O ZIQRJGXRRBOCEI-UHFFFAOYSA-M 0.000 description 1
- BYEUGKXDVZGBLP-UHFFFAOYSA-M 1-ethenylazepan-2-one;1-ethenyl-3-methylimidazol-3-ium;1-ethenylpyrrolidin-2-one;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]=1C=CN(C=C)C=1.C=CN1CCCC1=O.C=CN1CCCCCC1=O BYEUGKXDVZGBLP-UHFFFAOYSA-M 0.000 description 1
- WAROVFJVCBYVHY-UHFFFAOYSA-N 1-ethenylpyrrolidin-2-one;trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride Chemical compound [Cl-].C=CN1CCCC1=O.CC(=C)C(=O)NCCC[N+](C)(C)C WAROVFJVCBYVHY-UHFFFAOYSA-N 0.000 description 1
- WSMJTXVQAZYLAV-UHFFFAOYSA-N 1-methylindol-4-ol Chemical compound C1=CC=C2N(C)C=CC2=C1O WSMJTXVQAZYLAV-UHFFFAOYSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- RZRNAYUHWVFMIP-KTKRTIGZSA-N 1-oleoylglycerol Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(O)CO RZRNAYUHWVFMIP-KTKRTIGZSA-N 0.000 description 1
- GGZKJFGVSZKFLD-UHFFFAOYSA-N 1-prop-1-enyl-1h-imidazol-1-ium;chloride Chemical class [Cl-].CC=CN1C=C[NH+]=C1 GGZKJFGVSZKFLD-UHFFFAOYSA-N 0.000 description 1
- KNENSDLFTGIERH-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-phenylpentan-3-ol Chemical compound CC(C)(C)C(O)(C(C)(C)C)C1=CC=CC=C1 KNENSDLFTGIERH-UHFFFAOYSA-N 0.000 description 1
- WCOXQTXVACYMLM-UHFFFAOYSA-N 2,3-bis(12-hydroxyoctadecanoyloxy)propyl 12-hydroxyoctadecanoate Chemical compound CCCCCCC(O)CCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCC(O)CCCCCC)COC(=O)CCCCCCCCCCC(O)CCCCCC WCOXQTXVACYMLM-UHFFFAOYSA-N 0.000 description 1
- IGXSSRPZRAIXQF-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-5-ol Chemical compound O1CCOC2=C1C=CC=C2O IGXSSRPZRAIXQF-UHFFFAOYSA-N 0.000 description 1
- LGQMDCIHBYTQJU-UHFFFAOYSA-N 2,5-dimethyl-1h-pyrazolo[1,5-a]pyrimidin-7-one Chemical compound CC1=CC(=O)N2NC(C)=CC2=N1 LGQMDCIHBYTQJU-UHFFFAOYSA-N 0.000 description 1
- KEEQZNSCYCPKOJ-UHFFFAOYSA-N 2,6-diethylbenzene-1,4-diamine Chemical compound CCC1=CC(N)=CC(CC)=C1N KEEQZNSCYCPKOJ-UHFFFAOYSA-N 0.000 description 1
- WMBARJXWTQXPGE-UHFFFAOYSA-N 2,7-dimethyl-1h-pyrazolo[1,5-a]pyrimidin-5-one Chemical compound O=C1C=C(C)N2NC(C)=CC2=N1 WMBARJXWTQXPGE-UHFFFAOYSA-N 0.000 description 1
- NDSQCPUOJHJUJB-UHFFFAOYSA-N 2-(1,3-thiazol-2-yl)benzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2SC=CN=2)=C1 NDSQCPUOJHJUJB-UHFFFAOYSA-N 0.000 description 1
- VQUSUEWNKVODST-UHFFFAOYSA-N 2-(2,4-diaminophenyl)ethanol Chemical compound NC1=CC=C(CCO)C(N)=C1 VQUSUEWNKVODST-UHFFFAOYSA-N 0.000 description 1
- KULOFVMDAJSPOK-UHFFFAOYSA-N 2-(2,5-diaminophenoxy)ethanol Chemical compound NC1=CC=C(N)C(OCCO)=C1 KULOFVMDAJSPOK-UHFFFAOYSA-N 0.000 description 1
- VCBHNMILEWXGLS-UHFFFAOYSA-N 2-(2-aminoethylamino)anthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=CC(NCCN)=CC=C3C(=O)C2=C1 VCBHNMILEWXGLS-UHFFFAOYSA-N 0.000 description 1
- JXVSZMLWYMMWAL-UHFFFAOYSA-N 2-(2-aminoethylamino)anthracene-9,10-dione;hydrochloride Chemical compound Cl.C1=CC=C2C(=O)C3=CC(NCCN)=CC=C3C(=O)C2=C1 JXVSZMLWYMMWAL-UHFFFAOYSA-N 0.000 description 1
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N 2-(2-butoxyethoxy)ethanol Chemical compound CCCCOCCOCCO OAYXUHPQHDHDDZ-UHFFFAOYSA-N 0.000 description 1
- BXHKTRKRBRMQTM-UHFFFAOYSA-N 2-(2-chlorophenyl)benzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2C(=CC=CC=2)Cl)=C1 BXHKTRKRBRMQTM-UHFFFAOYSA-N 0.000 description 1
- VYHSWZULFYFDMO-UHFFFAOYSA-N 2-(2-hydroxyethylamino)phenol Chemical compound OCCNC1=CC=CC=C1O VYHSWZULFYFDMO-UHFFFAOYSA-N 0.000 description 1
- DZFVBIGUJAYIFJ-UHFFFAOYSA-N 2-(2-methoxy-4-nitroanilino)ethanol Chemical compound COC1=CC([N+]([O-])=O)=CC=C1NCCO DZFVBIGUJAYIFJ-UHFFFAOYSA-N 0.000 description 1
- CWDMDQXDGXFQFX-UHFFFAOYSA-N 2-(2-methoxyanilino)ethanol Chemical compound COC1=CC=CC=C1NCCO CWDMDQXDGXFQFX-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- ANOZXMCHUVSBFK-UHFFFAOYSA-N 2-(3-fluorophenyl)benzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2C=C(F)C=CC=2)=C1 ANOZXMCHUVSBFK-UHFFFAOYSA-N 0.000 description 1
- VSSLBIBNTSJNSE-UHFFFAOYSA-N 2-(3-hydroxy-4-methylanilino)acetamide Chemical compound CC1=CC=C(NCC(N)=O)C=C1O VSSLBIBNTSJNSE-UHFFFAOYSA-N 0.000 description 1
- QBOQGVXXIUOJRM-UHFFFAOYSA-N 2-(4,5-diamino-3-methylpyrazol-1-yl)ethanol Chemical compound CC1=NN(CCO)C(N)=C1N QBOQGVXXIUOJRM-UHFFFAOYSA-N 0.000 description 1
- IBCDZZHMNXXYAP-UHFFFAOYSA-N 2-(4,5-diaminopyrazol-1-yl)ethanol;sulfuric acid Chemical compound OS(O)(=O)=O.NC=1C=NN(CCO)C=1N IBCDZZHMNXXYAP-UHFFFAOYSA-N 0.000 description 1
- QNJWQAYYVNKOKR-UHFFFAOYSA-N 2-(4-amino-2-chloro-5-nitroanilino)ethanol Chemical compound NC1=CC(Cl)=C(NCCO)C=C1[N+]([O-])=O QNJWQAYYVNKOKR-UHFFFAOYSA-N 0.000 description 1
- ILLLLOUPPUYPON-UHFFFAOYSA-N 2-(4-amino-2-nitroanilino)-5-(dimethylamino)benzoic acid Chemical compound OC(=O)C1=CC(N(C)C)=CC=C1NC1=CC=C(N)C=C1[N+]([O-])=O ILLLLOUPPUYPON-UHFFFAOYSA-N 0.000 description 1
- YESOPQNVGIQNEV-UHFFFAOYSA-N 2-(4-amino-2-nitroanilino)benzoic acid Chemical compound [O-][N+](=O)C1=CC(N)=CC=C1NC1=CC=CC=C1C(O)=O YESOPQNVGIQNEV-UHFFFAOYSA-N 0.000 description 1
- DAGCJJZWDAVKRE-UHFFFAOYSA-N 2-(4-amino-3-nitroanilino)ethanol Chemical compound NC1=CC=C(NCCO)C=C1[N+]([O-])=O DAGCJJZWDAVKRE-UHFFFAOYSA-N 0.000 description 1
- WFXLRLQSHRNHCE-UHFFFAOYSA-N 2-(4-amino-n-ethylanilino)ethanol Chemical compound OCCN(CC)C1=CC=C(N)C=C1 WFXLRLQSHRNHCE-UHFFFAOYSA-N 0.000 description 1
- QEGBGDPGAZIVMK-UHFFFAOYSA-N 2-(4-methoxyphenyl)benzene-1,4-diamine Chemical compound C1=CC(OC)=CC=C1C1=CC(N)=CC=C1N QEGBGDPGAZIVMK-UHFFFAOYSA-N 0.000 description 1
- SCZQUWZLEIYDBD-UHFFFAOYSA-N 2-(4-methyl-2-nitroanilino)ethanol Chemical compound CC1=CC=C(NCCO)C([N+]([O-])=O)=C1 SCZQUWZLEIYDBD-UHFFFAOYSA-N 0.000 description 1
- OJYWOOVHUFSZJP-UHFFFAOYSA-N 2-(4-nitroanilino)ethylurea Chemical compound NC(=O)NCCNC1=CC=C([N+]([O-])=O)C=C1 OJYWOOVHUFSZJP-UHFFFAOYSA-N 0.000 description 1
- BNKHVFQRWLPRHB-UHFFFAOYSA-N 2-(6-methylpyridin-2-yl)benzene-1,4-diamine Chemical compound CC1=CC=CC(C=2C(=CC=C(N)C=2)N)=N1 BNKHVFQRWLPRHB-UHFFFAOYSA-N 0.000 description 1
- YATFNFXGMVOFKB-UHFFFAOYSA-N 2-(aminomethyl)benzene-1,4-diamine Chemical compound NCC1=CC(N)=CC=C1N YATFNFXGMVOFKB-UHFFFAOYSA-N 0.000 description 1
- IOLOLKAVXSYJSX-UHFFFAOYSA-N 2-[(3-amino-6-methoxypyridin-2-yl)amino]ethanol Chemical compound COC1=CC=C(N)C(NCCO)=N1 IOLOLKAVXSYJSX-UHFFFAOYSA-N 0.000 description 1
- KWVPFECTOKLOBL-KTKRTIGZSA-N 2-[(z)-octadec-9-enoxy]ethanol Chemical compound CCCCCCCC\C=C/CCCCCCCCOCCO KWVPFECTOKLOBL-KTKRTIGZSA-N 0.000 description 1
- PBBRFJWECSDSDZ-UHFFFAOYSA-N 2-[2,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol Chemical compound NC1=CC(N)=C(OCCO)C=C1OCCO PBBRFJWECSDSDZ-UHFFFAOYSA-N 0.000 description 1
- VGLJFRDEMBDATL-UHFFFAOYSA-N 2-[2-(2,4-diaminophenoxy)ethyl-(2-hydroxyethyl)amino]ethanol Chemical compound NC1=CC=C(OCCN(CCO)CCO)C(N)=C1 VGLJFRDEMBDATL-UHFFFAOYSA-N 0.000 description 1
- QSQJPVOCPBBFNL-UHFFFAOYSA-N 2-[2-amino-4-(methylamino)phenoxy]ethanol Chemical compound CNC1=CC=C(OCCO)C(N)=C1 QSQJPVOCPBBFNL-UHFFFAOYSA-N 0.000 description 1
- FJLWSRYKQCJGGK-UHFFFAOYSA-N 2-[3,5-diamino-6-(2-hydroxyethoxy)pyridin-2-yl]oxyethanol Chemical compound NC1=CC(N)=C(OCCO)N=C1OCCO FJLWSRYKQCJGGK-UHFFFAOYSA-N 0.000 description 1
- OOOJBBUBZCLWDE-UHFFFAOYSA-N 2-[3-(2-methylanilino)-6-(2-methyl-4-sulfoanilino)xanthen-10-ium-9-yl]benzoate Chemical compound Cc1ccccc1Nc1ccc2c(-c3ccccc3C(O)=O)c3ccc(Nc4ccc(cc4C)S([O-])(=O)=O)cc3[o+]c2c1 OOOJBBUBZCLWDE-UHFFFAOYSA-N 0.000 description 1
- IUTYXFLUCZMDMM-UHFFFAOYSA-N 2-[3-(methylamino)-4-nitrophenoxy]ethanol Chemical compound CNC1=CC(OCCO)=CC=C1[N+]([O-])=O IUTYXFLUCZMDMM-UHFFFAOYSA-N 0.000 description 1
- KBHHZOYDILVUBF-UHFFFAOYSA-N 2-[4-amino-n-(2-hydroxyethyl)-3-methylanilino]ethanol Chemical compound CC1=CC(N(CCO)CCO)=CC=C1N KBHHZOYDILVUBF-UHFFFAOYSA-N 0.000 description 1
- QVZXLWGJYIOCOV-UHFFFAOYSA-N 2-[5-amino-2-ethoxy-n-(2-hydroxyethyl)anilino]ethanol Chemical compound CCOC1=CC=C(N)C=C1N(CCO)CCO QVZXLWGJYIOCOV-UHFFFAOYSA-N 0.000 description 1
- YCAQIPZHGGRGEI-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-4-(2-methoxyethylamino)-3-nitroanilino]ethanol Chemical compound COCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O YCAQIPZHGGRGEI-UHFFFAOYSA-N 0.000 description 1
- GTMWPZKEYRLDJV-UHFFFAOYSA-N 2-[n-(2-hydroxyethyl)-4-(2-methoxyethylamino)-3-nitroanilino]ethanol;hydrochloride Chemical compound Cl.COCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O GTMWPZKEYRLDJV-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- KUCWUAFNGCMZDB-UHFFFAOYSA-N 2-amino-3-nitrophenol Chemical compound NC1=C(O)C=CC=C1[N+]([O-])=O KUCWUAFNGCMZDB-UHFFFAOYSA-N 0.000 description 1
- SZAJCDAIQPZDSA-UHFFFAOYSA-N 2-amino-5-ethylphenol;hydrochloride Chemical compound Cl.CCC1=CC=C(N)C(O)=C1 SZAJCDAIQPZDSA-UHFFFAOYSA-N 0.000 description 1
- ZMXYNJXDULEQCK-UHFFFAOYSA-N 2-amino-p-cresol Chemical compound CC1=CC=C(O)C(N)=C1 ZMXYNJXDULEQCK-UHFFFAOYSA-N 0.000 description 1
- URPJUMVYJFHGOR-UHFFFAOYSA-N 2-benzylpyrazole-3,4-diamine Chemical compound NC1=C(N)C=NN1CC1=CC=CC=C1 URPJUMVYJFHGOR-UHFFFAOYSA-N 0.000 description 1
- KSNXIEVAOOZTGY-UHFFFAOYSA-N 2-chloro-5-(2,2,2-trifluoroethylamino)phenol Chemical compound OC1=CC(NCC(F)(F)F)=CC=C1Cl KSNXIEVAOOZTGY-UHFFFAOYSA-N 0.000 description 1
- JVTIXNMXDLQEJE-UHFFFAOYSA-N 2-decanoyloxypropyl decanoate 2-octanoyloxypropyl octanoate Chemical compound C(CCCCCCC)(=O)OCC(C)OC(CCCCCCC)=O.C(=O)(CCCCCCCCC)OCC(C)OC(=O)CCCCCCCCC JVTIXNMXDLQEJE-UHFFFAOYSA-N 0.000 description 1
- MLMGJTAJUDSUKA-UHFFFAOYSA-N 2-ethenyl-1h-imidazole Chemical class C=CC1=NC=CN1 MLMGJTAJUDSUKA-UHFFFAOYSA-N 0.000 description 1
- HGUYBLVGLMAUFF-UHFFFAOYSA-N 2-methoxybenzene-1,4-diamine Chemical compound COC1=CC(N)=CC=C1N HGUYBLVGLMAUFF-UHFFFAOYSA-N 0.000 description 1
- OBCSAIDCZQSFQH-UHFFFAOYSA-N 2-methyl-1,4-phenylenediamine Chemical compound CC1=CC(N)=CC=C1N OBCSAIDCZQSFQH-UHFFFAOYSA-N 0.000 description 1
- VGKYEIFFSOPYEW-UHFFFAOYSA-N 2-methyl-4-[(4-phenyldiazenylphenyl)diazenyl]phenol Chemical compound Cc1cc(ccc1O)N=Nc1ccc(cc1)N=Nc1ccccc1 VGKYEIFFSOPYEW-UHFFFAOYSA-N 0.000 description 1
- SRJCJJKWVSSELL-UHFFFAOYSA-N 2-methylnaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(C)=CC=C21 SRJCJJKWVSSELL-UHFFFAOYSA-N 0.000 description 1
- LYQBBLCPNOHFMR-UHFFFAOYSA-N 2-methylpyrazolo[1,5-a]pyrimidine-3,7-diamine;hydrochloride Chemical compound Cl.NC1=CC=NC2=C(N)C(C)=NN21 LYQBBLCPNOHFMR-UHFFFAOYSA-N 0.000 description 1
- WHJNKCNHEVCICH-UHFFFAOYSA-N 2-nitro-1-n-phenylbenzene-1,4-diamine Chemical compound [O-][N+](=O)C1=CC(N)=CC=C1NC1=CC=CC=C1 WHJNKCNHEVCICH-UHFFFAOYSA-N 0.000 description 1
- FKHKSWSHWLYDOI-UHFFFAOYSA-N 2-phenylbenzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2C=CC=CC=2)=C1 FKHKSWSHWLYDOI-UHFFFAOYSA-N 0.000 description 1
- BBJFYVNGXJSBTI-UHFFFAOYSA-N 2-prop-1-enylbenzene-1,4-diamine Chemical compound CC=CC1=CC(N)=CC=C1N BBJFYVNGXJSBTI-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- YFHBPZJUEOCAMK-UHFFFAOYSA-N 2-propylbenzene-1,4-diamine Chemical compound CCCC1=CC(N)=CC=C1N YFHBPZJUEOCAMK-UHFFFAOYSA-N 0.000 description 1
- FFQHUOQNSGCJMV-UHFFFAOYSA-N 2-pyridin-2-ylbenzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2N=CC=CC=2)=C1 FFQHUOQNSGCJMV-UHFFFAOYSA-N 0.000 description 1
- UEWPUMVXPDOGGA-UHFFFAOYSA-N 2-pyridin-3-ylbenzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2C=NC=CC=2)=C1 UEWPUMVXPDOGGA-UHFFFAOYSA-N 0.000 description 1
- GCNUGWIBKQDYGG-UHFFFAOYSA-N 2-thiophen-2-ylbenzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C=2SC=CC=2)=C1 GCNUGWIBKQDYGG-UHFFFAOYSA-N 0.000 description 1
- HUGIREQZMZZHCH-UHFFFAOYSA-N 2-thiophen-3-ylbenzene-1,4-diamine Chemical compound NC1=CC=C(N)C(C2=CSC=C2)=C1 HUGIREQZMZZHCH-UHFFFAOYSA-N 0.000 description 1
- JKZGDHJHXRRQKD-UHFFFAOYSA-N 3-(2,4-diaminophenoxy)propane-1,2-diol Chemical compound NC1=CC=C(OCC(O)CO)C(N)=C1 JKZGDHJHXRRQKD-UHFFFAOYSA-N 0.000 description 1
- IOERGEUWVDQLEB-UHFFFAOYSA-N 3-(3,5-diaminopyridin-2-yl)oxypropane-1,2-diol Chemical compound NC1=CN=C(OCC(O)CO)C(N)=C1 IOERGEUWVDQLEB-UHFFFAOYSA-N 0.000 description 1
- XMROXKQCNKMNBG-UHFFFAOYSA-N 3-(4-aminoanilino)propane-1,2-diol Chemical compound NC1=CC=C(NCC(O)CO)C=C1 XMROXKQCNKMNBG-UHFFFAOYSA-N 0.000 description 1
- YCRGIOIOENCYMG-UHFFFAOYSA-N 3-(cyclopentylamino)phenol Chemical compound OC1=CC=CC(NC2CCCC2)=C1 YCRGIOIOENCYMG-UHFFFAOYSA-N 0.000 description 1
- UTLQFNPZWCRAIP-UHFFFAOYSA-N 3-(diethylamino)propyl 2-phenylheptanoate;hydrochloride Chemical compound [Cl-].CC[NH+](CC)CCCOC(=O)C(CCCCC)C1=CC=CC=C1 UTLQFNPZWCRAIP-UHFFFAOYSA-N 0.000 description 1
- OXEIXRNCCWLEFR-UHFFFAOYSA-N 3-(pyridin-3-yldiazenyl)pyridine-2,6-diamine Chemical compound NC1=NC(N)=CC=C1N=NC1=CC=CN=C1 OXEIXRNCCWLEFR-UHFFFAOYSA-N 0.000 description 1
- IJBOVPNSQXXDJB-UHFFFAOYSA-N 3-[2-chloro-4-(2,3-dihydroxypropylamino)-5-nitroanilino]propane-1,2-diol Chemical compound OCC(O)CNC1=CC([N+]([O-])=O)=C(NCC(O)CO)C=C1Cl IJBOVPNSQXXDJB-UHFFFAOYSA-N 0.000 description 1
- ICMWDHODFTWYFK-UHFFFAOYSA-N 3-[4-[2-hydroxyethyl(methyl)amino]-2-nitroanilino]propane-1,2-diol Chemical compound OCCN(C)C1=CC=C(NCC(O)CO)C([N+]([O-])=O)=C1 ICMWDHODFTWYFK-UHFFFAOYSA-N 0.000 description 1
- NSIQDLRDQOSLPD-UHFFFAOYSA-N 3-[4-[ethyl(2-hydroxyethyl)amino]-2-nitroanilino]propane-1,2-diol;hydrochloride Chemical compound Cl.OCCN(CC)C1=CC=C(NCC(O)CO)C([N+]([O-])=O)=C1 NSIQDLRDQOSLPD-UHFFFAOYSA-N 0.000 description 1
- ITADNSURISDPLT-UHFFFAOYSA-N 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-[2-(2-methoxypropoxy)ethoxy]propyl]-methylsilyl]oxy-methyl-trimethylsilyloxysilyl]propan-1-amine Chemical compound COC(C)COCCOCCC[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(CCCN)O[Si](C)(C)C ITADNSURISDPLT-UHFFFAOYSA-N 0.000 description 1
- ZYOJRYOHGSVALD-UHFFFAOYSA-N 3-[n-methyl-4-(methylamino)-3-nitroanilino]propane-1,2-diol Chemical compound CNC1=CC=C(N(C)CC(O)CO)C=C1[N+]([O-])=O ZYOJRYOHGSVALD-UHFFFAOYSA-N 0.000 description 1
- XSUKBLJKLXZDPN-UHFFFAOYSA-N 3-[n-methyl-4-(methylamino)-3-nitroanilino]propane-1,2-diol;hydrochloride Chemical compound Cl.CNC1=CC=C(N(C)CC(O)CO)C=C1[N+]([O-])=O XSUKBLJKLXZDPN-UHFFFAOYSA-N 0.000 description 1
- XSBKXUJEVYHSNO-UHFFFAOYSA-N 3-amino-2,6-dimethylphenol Chemical compound CC1=CC=C(N)C(C)=C1O XSBKXUJEVYHSNO-UHFFFAOYSA-N 0.000 description 1
- FVXBTPGZQMNAEZ-UHFFFAOYSA-N 3-amino-2-methylpropan-1-ol Chemical compound NCC(C)CO FVXBTPGZQMNAEZ-UHFFFAOYSA-N 0.000 description 1
- KQIGMPWTAHJUMN-VKHMYHEASA-N 3-aminopropane-1,2-diol Chemical compound NC[C@H](O)CO KQIGMPWTAHJUMN-VKHMYHEASA-N 0.000 description 1
- MXRGSJAOLKBZLU-UHFFFAOYSA-N 3-ethenylazepan-2-one Chemical compound C=CC1CCCCNC1=O MXRGSJAOLKBZLU-UHFFFAOYSA-N 0.000 description 1
- MPLRYKWLGRFQIY-UHFFFAOYSA-N 3-n-[(2-aminophenyl)methyl]benzene-1,3-diamine;hydrochloride Chemical compound Cl.NC1=CC=CC(NCC=2C(=CC=CC=2)N)=C1 MPLRYKWLGRFQIY-UHFFFAOYSA-N 0.000 description 1
- JDDBEGQJCQQHNB-UHFFFAOYSA-N 4,5-dichloro-2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=C(Cl)C(Cl)=C1O JDDBEGQJCQQHNB-UHFFFAOYSA-N 0.000 description 1
- RRIMNXYWOCQLCF-UHFFFAOYSA-N 4,6-dimethoxybenzene-1,3-diamine Chemical compound COC1=CC(OC)=C(N)C=C1N RRIMNXYWOCQLCF-UHFFFAOYSA-N 0.000 description 1
- YITBUHOJBRDBCQ-UHFFFAOYSA-N 4-(2,4-diaminophenyl)phenol;hydrochloride Chemical compound Cl.NC1=CC(N)=CC=C1C1=CC=C(O)C=C1 YITBUHOJBRDBCQ-UHFFFAOYSA-N 0.000 description 1
- GMJHZZCVWDJKFB-UHFFFAOYSA-N 4-(4-aminophenyl)benzene-1,3-diamine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1N GMJHZZCVWDJKFB-UHFFFAOYSA-N 0.000 description 1
- UPWSUPQSYYDGED-UHFFFAOYSA-N 4-(4-aminophenyl)benzene-1,3-diamine;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1C1=CC=C(N)C=C1N UPWSUPQSYYDGED-UHFFFAOYSA-N 0.000 description 1
- XPLTXYDVYDWSSO-UHFFFAOYSA-N 4-(ethylamino)-3-nitrobenzoic acid Chemical compound CCNC1=CC=C(C(O)=O)C=C1[N+]([O-])=O XPLTXYDVYDWSSO-UHFFFAOYSA-N 0.000 description 1
- YHGLHQNDHNOAKF-UHFFFAOYSA-M 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-n,n-dimethylaniline;chloride Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)N=CN1C YHGLHQNDHNOAKF-UHFFFAOYSA-M 0.000 description 1
- ZRVPOURSNDQODC-UHFFFAOYSA-M 4-[(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)diazenyl]-n,n-dimethylaniline;methyl sulfate Chemical compound COS([O-])(=O)=O.C1=CC(N(C)C)=CC=C1N=NC1=[N+](C)C=NN1C ZRVPOURSNDQODC-UHFFFAOYSA-M 0.000 description 1
- DHAHKSQXIXFZJB-UHFFFAOYSA-N 4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]-2-hydroxy-5-sulfobenzenesulfonate Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=C(O)C=1)S(O)(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 DHAHKSQXIXFZJB-UHFFFAOYSA-N 0.000 description 1
- IKHKJYWPWWBSFZ-UHFFFAOYSA-N 4-[[4-(diethylamino)phenyl]-(4-diethylazaniumylidenecyclohexa-2,5-dien-1-ylidene)methyl]benzene-1,3-disulfonate;hydron Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S(O)(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 IKHKJYWPWWBSFZ-UHFFFAOYSA-N 0.000 description 1
- WWZWFCACOZFBBD-UHFFFAOYSA-N 4-[[5-[(2,4-diamino-5-methylphenyl)diazenyl]-5-methylcyclohexa-1,3-dien-1-yl]diazenyl]-6-methylbenzene-1,3-diamine Chemical compound C1=C(N)C(C)=CC(N=NC=2CC(C)(C=CC=2)N=NC=2C(=CC(N)=C(C)C=2)N)=C1N WWZWFCACOZFBBD-UHFFFAOYSA-N 0.000 description 1
- WHLALWVCKSOVKK-UHFFFAOYSA-N 4-amino-2-(2-hydroxyethylamino)-3-methylphenol Chemical compound CC1=C(N)C=CC(O)=C1NCCO WHLALWVCKSOVKK-UHFFFAOYSA-N 0.000 description 1
- WSEFOZIMAJPJHW-UHFFFAOYSA-N 4-amino-2-(hydroxymethyl)phenol Chemical compound NC1=CC=C(O)C(CO)=C1 WSEFOZIMAJPJHW-UHFFFAOYSA-N 0.000 description 1
- LGEWISVEKJCNED-UHFFFAOYSA-N 4-amino-2-[(2-hydroxy-5-nitroanilino)methyl]phenol Chemical compound NC1=CC=C(O)C(CNC=2C(=CC=C(C=2)[N+]([O-])=O)O)=C1 LGEWISVEKJCNED-UHFFFAOYSA-N 0.000 description 1
- JXSXNFJCVCGAOA-UHFFFAOYSA-N 4-amino-2-[(2-hydroxy-5-nitroanilino)methyl]phenol;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(CNC=2C(=CC=C(C=2)[N+]([O-])=O)O)=C1 JXSXNFJCVCGAOA-UHFFFAOYSA-N 0.000 description 1
- MHKCKFXELRFGOH-UHFFFAOYSA-N 4-amino-2-[(propan-2-ylamino)methyl]phenol Chemical compound CC(C)NCC1=CC(N)=CC=C1O MHKCKFXELRFGOH-UHFFFAOYSA-N 0.000 description 1
- KEZXSUCXJJCECA-UHFFFAOYSA-N 4-amino-2-[(propan-2-ylamino)methyl]phenol;hydrochloride Chemical compound Cl.CC(C)NCC1=CC(N)=CC=C1O KEZXSUCXJJCECA-UHFFFAOYSA-N 0.000 description 1
- MXJQJURZHQZLNN-UHFFFAOYSA-N 4-amino-2-fluorophenol Chemical compound NC1=CC=C(O)C(F)=C1 MXJQJURZHQZLNN-UHFFFAOYSA-N 0.000 description 1
- DHKIYDNMIXSKQP-UHFFFAOYSA-N 4-amino-3-(hydroxymethyl)phenol Chemical compound NC1=CC=C(O)C=C1CO DHKIYDNMIXSKQP-UHFFFAOYSA-N 0.000 description 1
- MNPLTKHJEAFOCA-UHFFFAOYSA-N 4-amino-3-fluorophenol Chemical compound NC1=CC=C(O)C=C1F MNPLTKHJEAFOCA-UHFFFAOYSA-N 0.000 description 1
- IQXUIDYRTHQTET-UHFFFAOYSA-N 4-amino-3-nitrophenol Chemical compound NC1=CC=C(O)C=C1[N+]([O-])=O IQXUIDYRTHQTET-UHFFFAOYSA-N 0.000 description 1
- BLFRQYKZFKYQLO-UHFFFAOYSA-N 4-aminobutan-1-ol Chemical compound NCCCCO BLFRQYKZFKYQLO-UHFFFAOYSA-N 0.000 description 1
- DBCAQXHNJOFNGC-UHFFFAOYSA-N 4-bromo-1,1,1-trifluorobutane Chemical compound FC(F)(F)CCCBr DBCAQXHNJOFNGC-UHFFFAOYSA-N 0.000 description 1
- HGWQOFDAUWCQDA-UHFFFAOYSA-N 4-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 HGWQOFDAUWCQDA-UHFFFAOYSA-N 0.000 description 1
- QQCNRMGYJWTLHB-UHFFFAOYSA-N 4-methyl-2-phenyl-4h-pyrazol-3-one Chemical compound O=C1C(C)C=NN1C1=CC=CC=C1 QQCNRMGYJWTLHB-UHFFFAOYSA-N 0.000 description 1
- POKISONDDBRXBK-UHFFFAOYSA-N 4-n,4-n,2-trimethylbenzene-1,4-diamine Chemical compound CN(C)C1=CC=C(N)C(C)=C1 POKISONDDBRXBK-UHFFFAOYSA-N 0.000 description 1
- UOWYGPTYSRURDP-UHFFFAOYSA-N 4-n,4-n-dipropylbenzene-1,4-diamine Chemical compound CCCN(CCC)C1=CC=C(N)C=C1 UOWYGPTYSRURDP-UHFFFAOYSA-N 0.000 description 1
- AZTIXJZQJUAAGH-UHFFFAOYSA-N 4-n-(2-ethoxyethyl)benzene-1,4-diamine Chemical compound CCOCCNC1=CC=C(N)C=C1 AZTIXJZQJUAAGH-UHFFFAOYSA-N 0.000 description 1
- QZHXKQKKEBXYRG-UHFFFAOYSA-N 4-n-(4-aminophenyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NC1=CC=C(N)C=C1 QZHXKQKKEBXYRG-UHFFFAOYSA-N 0.000 description 1
- UWFNOURYAXAXSB-UHFFFAOYSA-N 4-n-(furan-2-ylmethyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NCC1=CC=CO1 UWFNOURYAXAXSB-UHFFFAOYSA-N 0.000 description 1
- ZNARLHQMPCPQNV-UHFFFAOYSA-N 4-n-(thiophen-2-ylmethyl)benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NCC1=CC=CS1 ZNARLHQMPCPQNV-UHFFFAOYSA-N 0.000 description 1
- ZQMZIOUGOZDCNR-UHFFFAOYSA-N 4-n-[(4-aminophenyl)methyl]benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1CNC1=CC=C(N)C=C1 ZQMZIOUGOZDCNR-UHFFFAOYSA-N 0.000 description 1
- OOPWJBCZQDTTNE-UHFFFAOYSA-N 4-n-[4-(4-aminoanilino)butyl]benzene-1,4-diamine Chemical compound C1=CC(N)=CC=C1NCCCCNC1=CC=C(N)C=C1 OOPWJBCZQDTTNE-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- OPINSZDQXLCVFB-UHFFFAOYSA-N 4-thiophen-3-ylbenzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1C1=CSC=C1 OPINSZDQXLCVFB-UHFFFAOYSA-N 0.000 description 1
- GRFUQGOPIICPOU-UHFFFAOYSA-N 5,6,7-trimethylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride Chemical compound Cl.CC1=C(C)C(C)=NC2=C(N)C=NN21 GRFUQGOPIICPOU-UHFFFAOYSA-N 0.000 description 1
- HMVYTHIBCLCVQA-UHFFFAOYSA-N 5,7-bis(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC(C(F)(F)F)=NC2=C(N)C=NN21 HMVYTHIBCLCVQA-UHFFFAOYSA-N 0.000 description 1
- AIFLBQWKMQUUHT-UHFFFAOYSA-N 5,7-ditert-butylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride Chemical compound Cl.N1=C(C(C)(C)C)C=C(C(C)(C)C)N2N=CC(N)=C21 AIFLBQWKMQUUHT-UHFFFAOYSA-N 0.000 description 1
- GMVGJPGHVIUINB-UHFFFAOYSA-N 5-(2-hydroxyethylamino)-4-methoxy-2-methylphenol Chemical compound COC1=CC(C)=C(O)C=C1NCCO GMVGJPGHVIUINB-UHFFFAOYSA-N 0.000 description 1
- IOJGGHXVNBFMFL-UHFFFAOYSA-N 5-(3,5-diaminopyridin-2-yl)oxypentane-1,3-diol Chemical compound NC1=CN=C(OCCC(O)CCO)C(N)=C1 IOJGGHXVNBFMFL-UHFFFAOYSA-N 0.000 description 1
- RSVRQCPLGMIUKG-UHFFFAOYSA-N 5-(methoxymethyl)-2-methyl-1h-pyrazolo[1,5-a]pyrimidin-7-one Chemical compound COCC1=CC(=O)N2NC(C)=CC2=N1 RSVRQCPLGMIUKG-UHFFFAOYSA-N 0.000 description 1
- VNECCGPOXBLLOG-UHFFFAOYSA-N 5-amino-2,6-dimethoxypyridin-3-ol Chemical compound COC1=NC(OC)=C(O)C=C1N VNECCGPOXBLLOG-UHFFFAOYSA-N 0.000 description 1
- BLQFHJKRTDIZLX-UHFFFAOYSA-N 5-amino-2-methoxyphenol Chemical compound COC1=CC=C(N)C=C1O BLQFHJKRTDIZLX-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- LQGKDMHENBFVRC-UHFFFAOYSA-N 5-aminopentan-1-ol Chemical compound NCCCCCO LQGKDMHENBFVRC-UHFFFAOYSA-N 0.000 description 1
- VJGRDSFPHUTBBE-UHFFFAOYSA-N 5-aminopentan-2-ol Chemical compound CC(O)CCCN VJGRDSFPHUTBBE-UHFFFAOYSA-N 0.000 description 1
- AJGLCXBDYCEVIE-UHFFFAOYSA-N 5-chloro-3-hydroxy-1h-pyridin-2-one Chemical compound OC1=CC(Cl)=CN=C1O AJGLCXBDYCEVIE-UHFFFAOYSA-N 0.000 description 1
- UVDFWCLPZHLVNN-UHFFFAOYSA-N 5-methyl-1h-pyrazolo[1,5-c]triazole Chemical compound C1=NNN2N=C(C)C=C21 UVDFWCLPZHLVNN-UHFFFAOYSA-N 0.000 description 1
- JSVCLRZBHIRDNZ-UHFFFAOYSA-N 5-methyl-2-phenylpyrazole-3,4-diamine Chemical compound NC1=C(N)C(C)=NN1C1=CC=CC=C1 JSVCLRZBHIRDNZ-UHFFFAOYSA-N 0.000 description 1
- ZHNIGKLWCFMIEP-UHFFFAOYSA-N 5-phenyl-1h-pyrazolo[1,5-c]triazole Chemical compound C1=C2C=NNN2N=C1C1=CC=CC=C1 ZHNIGKLWCFMIEP-UHFFFAOYSA-N 0.000 description 1
- JTHZUSWLNCPZLX-UHFFFAOYSA-N 6-fluoro-3-methyl-2h-indazole Chemical compound FC1=CC=C2C(C)=NNC2=C1 JTHZUSWLNCPZLX-UHFFFAOYSA-N 0.000 description 1
- JJHVYGVVMBYCMQ-UHFFFAOYSA-N 6-hydroxy-4-methyl-1h-pyridin-2-one Chemical compound CC=1C=C(O)NC(=O)C=1 JJHVYGVVMBYCMQ-UHFFFAOYSA-N 0.000 description 1
- YGGTVPCTAKYCSQ-UHFFFAOYSA-N 6-methoxyquinolin-8-amine Chemical compound N1=CC=CC2=CC(OC)=CC(N)=C21 YGGTVPCTAKYCSQ-UHFFFAOYSA-N 0.000 description 1
- ZVDCYZVYRXZJQF-UHFFFAOYSA-N 6-nitro-1,2,3,4-tetrahydroquinoxaline Chemical compound N1CCNC2=CC([N+](=O)[O-])=CC=C21 ZVDCYZVYRXZJQF-UHFFFAOYSA-N 0.000 description 1
- JZRHHWYIUJHRNO-UHFFFAOYSA-N 6-nitro-3,4-dihydro-2h-1,4-benzoxazin-7-amine Chemical compound O1CCNC2=C1C=C(N)C([N+]([O-])=O)=C2 JZRHHWYIUJHRNO-UHFFFAOYSA-N 0.000 description 1
- DRSOPPBVZYEMNZ-UHFFFAOYSA-N 6-nitropyridine-2,5-diamine Chemical compound NC1=CC=C(N)C([N+]([O-])=O)=N1 DRSOPPBVZYEMNZ-UHFFFAOYSA-N 0.000 description 1
- KYARBIJYVGJZLB-UHFFFAOYSA-N 7-amino-4-hydroxy-2-naphthalenesulfonic acid Chemical compound OC1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KYARBIJYVGJZLB-UHFFFAOYSA-N 0.000 description 1
- YCMUYLRBWDIHCF-UHFFFAOYSA-N 7-methylpyrazolo[1,5-a]pyrimidin-3-amine;hydrochloride Chemical compound Cl.CC1=CC=NC2=C(N)C=NN12 YCMUYLRBWDIHCF-UHFFFAOYSA-N 0.000 description 1
- COCLLEMEIJQBAG-UHFFFAOYSA-N 8-methylnonyl 2-methylprop-2-enoate Chemical compound CC(C)CCCCCCCOC(=O)C(C)=C COCLLEMEIJQBAG-UHFFFAOYSA-N 0.000 description 1
- LVGFPWDANALGOY-UHFFFAOYSA-N 8-methylnonyl prop-2-enoate Chemical compound CC(C)CCCCCCCOC(=O)C=C LVGFPWDANALGOY-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- WLDHEUZGFKACJH-ZRUFZDNISA-K Amaranth Chemical compound [Na+].[Na+].[Na+].C12=CC=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=C1\N=N\C1=CC=C(S([O-])(=O)=O)C2=CC=CC=C12 WLDHEUZGFKACJH-ZRUFZDNISA-K 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- 229920000189 Arabinogalactan Polymers 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- RTMBGDBBDQKNNZ-UHFFFAOYSA-L C.I. Acid Blue 3 Chemical compound [Ca+2].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=C(O)C=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1.C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=C(O)C=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 RTMBGDBBDQKNNZ-UHFFFAOYSA-L 0.000 description 1
- FHUUVZRSICMBNO-UHFFFAOYSA-N CN(C)C1=CC=C([C+](C(C=C2)=CC=C2N(C)C)C(C2=CC(S(O)(=O)=O)=CC=C2C=C2S([O-])(=O)=O)=C2O)C=C1 Chemical compound CN(C)C1=CC=C([C+](C(C=C2)=CC=C2N(C)C)C(C2=CC(S(O)(=O)=O)=CC=C2C=C2S([O-])(=O)=O)=C2O)C=C1 FHUUVZRSICMBNO-UHFFFAOYSA-N 0.000 description 1
- 101100439236 Caenorhabditis elegans cfi-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- NJBIXVBXXKLSGY-UHFFFAOYSA-N Cc1ccc2c(c1)[nH]c1ccnn21 Chemical compound Cc1ccc2c(c1)[nH]c1ccnn21 NJBIXVBXXKLSGY-UHFFFAOYSA-N 0.000 description 1
- 240000008886 Ceratonia siliqua Species 0.000 description 1
- 235000013912 Ceratonia siliqua Nutrition 0.000 description 1
- 229920002101 Chitin Polymers 0.000 description 1
- 229920001661 Chitosan Polymers 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- CIWBSHSKHKDKBQ-DUZGATOHSA-N D-araboascorbic acid Natural products OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-DUZGATOHSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- KZQYIMCESJLPQH-UHFFFAOYSA-N Demethylated antipyrine Chemical compound N1C(C)=CC(=O)N1C1=CC=CC=C1 KZQYIMCESJLPQH-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004641 Diallyl-phthalate Substances 0.000 description 1
- HMEKVHWROSNWPD-UHFFFAOYSA-N Erioglaucine A Chemical compound [NH4+].[NH4+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 HMEKVHWROSNWPD-UHFFFAOYSA-N 0.000 description 1
- 229920001503 Glucan Polymers 0.000 description 1
- 229920002581 Glucomannan Polymers 0.000 description 1
- 229920001706 Glucuronoxylan Polymers 0.000 description 1
- 229920002527 Glycogen Polymers 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- MIWUTEVJIISHCP-UHFFFAOYSA-N HC Blue No. 2 Chemical compound OCCNC1=CC=C(N(CCO)CCO)C=C1[N+]([O-])=O MIWUTEVJIISHCP-UHFFFAOYSA-N 0.000 description 1
- 229920000209 Hexadimethrine bromide Polymers 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 description 1
- ZDXPYRJPNDTMRX-VKHMYHEASA-N L-glutamine Chemical compound OC(=O)[C@@H](N)CCC(N)=O ZDXPYRJPNDTMRX-VKHMYHEASA-N 0.000 description 1
- HNDVDQJCIGZPNO-YFKPBYRVSA-N L-histidine Chemical compound OC(=O)[C@@H](N)CC1=CN=CN1 HNDVDQJCIGZPNO-YFKPBYRVSA-N 0.000 description 1
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- 241000219730 Lathyrus aphaca Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- 229920000057 Mannan Polymers 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- WWKGVZASJYXZKN-UHFFFAOYSA-N Methyl violet 2B Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC(N)=CC=1)=C1C=CC(=[N+](C)C)C=C1 WWKGVZASJYXZKN-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- 101100252165 Mus musculus Rnd2 gene Proteins 0.000 description 1
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 1
- OVRNDRQMDRJTHS-UHFFFAOYSA-N N-acelyl-D-glucosamine Natural products CC(=O)NC1C(O)OC(CO)C(O)C1O OVRNDRQMDRJTHS-UHFFFAOYSA-N 0.000 description 1
- OVRNDRQMDRJTHS-FMDGEEDCSA-N N-acetyl-beta-D-glucosamine Chemical compound CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O OVRNDRQMDRJTHS-FMDGEEDCSA-N 0.000 description 1
- MBLBDJOUHNCFQT-LXGUWJNJSA-N N-acetylglucosamine Natural products CC(=O)N[C@@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO MBLBDJOUHNCFQT-LXGUWJNJSA-N 0.000 description 1
- CHJJGSNFBQVOTG-UHFFFAOYSA-N N-methyl-guanidine Natural products CNC(N)=N CHJJGSNFBQVOTG-UHFFFAOYSA-N 0.000 description 1
- ZNYRZXGYXPPFQA-UHFFFAOYSA-N N1C(C)=NN2N=C(C)C=C21 Chemical compound N1C(C)=NN2N=C(C)C=C21 ZNYRZXGYXPPFQA-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 description 1
- 229920002230 Pectic acid Polymers 0.000 description 1
- 108700020962 Peroxidase Proteins 0.000 description 1
- 102000003992 Peroxidases Human genes 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229920001219 Polysorbate 40 Polymers 0.000 description 1
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 240000001058 Sterculia urens Species 0.000 description 1
- 235000015125 Sterculia urens Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- PHYFQTYBJUILEZ-UHFFFAOYSA-N Trioleoylglycerol Natural products CCCCCCCCC=CCCCCCCCC(=O)OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COC(=O)CCCCCCCC=CCCCCCCCC PHYFQTYBJUILEZ-UHFFFAOYSA-N 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 244000098338 Triticum aestivum Species 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- 229920002000 Xyloglucan Polymers 0.000 description 1
- NJSSICCENMLTKO-HRCBOCMUSA-N [(1r,2s,4r,5r)-3-hydroxy-4-(4-methylphenyl)sulfonyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)O[C@H]1C(O)[C@@H](OS(=O)(=O)C=2C=CC(C)=CC=2)[C@@H]2OC[C@H]1O2 NJSSICCENMLTKO-HRCBOCMUSA-N 0.000 description 1
- RFQSMLBZXQOMKK-UHFFFAOYSA-N [3-[(4,8-diamino-6-bromo-1,5-dioxonaphthalen-2-yl)amino]phenyl]-trimethylazanium;chloride Chemical compound [Cl-].C[N+](C)(C)C1=CC=CC(NC=2C(C3=C(N)C=C(Br)C(=O)C3=C(N)C=2)=O)=C1 RFQSMLBZXQOMKK-UHFFFAOYSA-N 0.000 description 1
- UUHBEKCQQLDQNG-UHFFFAOYSA-N [3-azaniumyl-4-(2-hydroxyethoxy)phenyl]azanium;sulfate Chemical compound [O-]S([O-])(=O)=O.[NH3+]C1=CC=C(OCCO)C([NH3+])=C1 UUHBEKCQQLDQNG-UHFFFAOYSA-N 0.000 description 1
- WLKAMFOFXYCYDK-UHFFFAOYSA-N [5-amino-4-[[3-[(2-amino-4-azaniumyl-5-methylphenyl)diazenyl]-4-methylphenyl]diazenyl]-2-methylphenyl]azanium;dichloride Chemical compound [Cl-].[Cl-].CC1=CC=C(N=NC=2C(=CC([NH3+])=C(C)C=2)N)C=C1N=NC1=CC(C)=C([NH3+])C=C1N WLKAMFOFXYCYDK-UHFFFAOYSA-N 0.000 description 1
- JPXGJOSSRZTSFX-UHFFFAOYSA-N [6-(diethylamino)-9-(2,4-disulfophenyl)xanthen-3-ylidene]-diethylazanium;hydroxide Chemical compound [OH-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=C(S(O)(=O)=O)C=C1S(O)(=O)=O JPXGJOSSRZTSFX-UHFFFAOYSA-N 0.000 description 1
- WIJOZBDYRBXOOW-UHFFFAOYSA-N [8-[(4-amino-2-nitrophenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].C12=CC([N+](C)(C)C)=CC=C2C=CC(=O)\C1=N/NC1=CC=C(N)C=C1[N+]([O-])=O WIJOZBDYRBXOOW-UHFFFAOYSA-N 0.000 description 1
- CMPPYVDBIJWGCB-UHFFFAOYSA-N [8-[(4-amino-3-nitrophenyl)hydrazinylidene]-7-oxonaphthalen-2-yl]-trimethylazanium;chloride Chemical compound [Cl-].C12=CC([N+](C)(C)C)=CC=C2C=CC(=O)\C1=N\NC1=CC=C(N)C([N+]([O-])=O)=C1 CMPPYVDBIJWGCB-UHFFFAOYSA-N 0.000 description 1
- ORDGVBRMUJCHEO-UHFFFAOYSA-M [Cl-].C1=C(N)C(C)=CC([C+](C=2C=C(C)C(N)=CC=2)C=2C=C(C)C(N)=CC=2)=C1 Chemical compound [Cl-].C1=C(N)C(C)=CC([C+](C=2C=C(C)C(N)=CC=2)C=2C=C(C)C(N)=CC=2)=C1 ORDGVBRMUJCHEO-UHFFFAOYSA-M 0.000 description 1
- ZYSSQPQJLFIRBX-UHFFFAOYSA-M [Cl-].C1=C(N)C(C)=CC([C+](C=2C=CC(N)=CC=2)C=2C=CC(N)=CC=2)=C1 Chemical compound [Cl-].C1=C(N)C(C)=CC([C+](C=2C=CC(N)=CC=2)C=2C=CC(N)=CC=2)=C1 ZYSSQPQJLFIRBX-UHFFFAOYSA-M 0.000 description 1
- DWIPINOXGQSOBZ-UHFFFAOYSA-M [Cl-].C1=CC(NC)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 Chemical compound [Cl-].C1=CC(NC)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 DWIPINOXGQSOBZ-UHFFFAOYSA-M 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- DGOBMKYRQHEFGQ-UHFFFAOYSA-L acid green 5 Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C=CC(=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 DGOBMKYRQHEFGQ-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004973 alkali metal peroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000012735 amaranth Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 235000019312 arabinogalactan Nutrition 0.000 description 1
- 229920000617 arabinoxylan Polymers 0.000 description 1
- 150000004783 arabinoxylans Chemical class 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 235000012733 azorubine Nutrition 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- QUDWYFHPNIMBFC-UHFFFAOYSA-N bis(prop-2-enyl) benzene-1,2-dicarboxylate Chemical compound C=CCOC(=O)C1=CC=CC=C1C(=O)OCC=C QUDWYFHPNIMBFC-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 229920001400 block copolymer Polymers 0.000 description 1
- 235000012709 brilliant black BN Nutrition 0.000 description 1
- 239000004161 brilliant blue FCF Substances 0.000 description 1
- NNBFNNNWANBMTI-UHFFFAOYSA-M brilliant green Chemical compound OS([O-])(=O)=O.C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 NNBFNNNWANBMTI-UHFFFAOYSA-M 0.000 description 1
- HXCILVUBKWANLN-UHFFFAOYSA-N brilliant green cation Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](CC)CC)C=C1 HXCILVUBKWANLN-UHFFFAOYSA-N 0.000 description 1
- XNOQNFJEPBFKLL-UHFFFAOYSA-N butanedioic acid;1,2-diaminopropan-2-ol Chemical compound CC(N)(O)CN.OC(=O)CCC(O)=O.OC(=O)CCC(O)=O XNOQNFJEPBFKLL-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- STIAPHVBRDNOAJ-UHFFFAOYSA-N carbamimidoylazanium;carbonate Chemical compound NC(N)=N.NC(N)=N.OC(O)=O STIAPHVBRDNOAJ-UHFFFAOYSA-N 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 210000004534 cecum Anatomy 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229940081733 cetearyl alcohol Drugs 0.000 description 1
- 229940056318 ceteth-20 Drugs 0.000 description 1
- BVQUETZBXIMAFZ-UHFFFAOYSA-N chembl1328567 Chemical compound C1=CC=C2C(=O)C(O)=C(O)C(=O)C2=C1 BVQUETZBXIMAFZ-UHFFFAOYSA-N 0.000 description 1
- FIKBURFLPVUDAX-UHFFFAOYSA-M chembl2105313 Chemical compound [Na+].CC1=CC(C)=CC=C1N=NC1=C(O)C=CC(N=NC=2C=CC(=CC=2)S([O-])(=O)=O)=C1O FIKBURFLPVUDAX-UHFFFAOYSA-M 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- UCDLTZDEXAIGRE-UHFFFAOYSA-N chromium 3-hydroxy-4-[(2-hydroxynaphthalen-1-yl)diazenyl]-7-nitronaphthalene-1-sulfonic acid Chemical compound [Cr].[O-][N+](=O)C1=CC=C2C(N=NC3=C4C=CC=CC4=CC=C3O)=C(O)C=C(S(O)(=O)=O)C2=C1 UCDLTZDEXAIGRE-UHFFFAOYSA-N 0.000 description 1
- 101150114166 coa2 gene Proteins 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229920006037 cross link polymer Polymers 0.000 description 1
- 229940096890 d&c violet no. 2 Drugs 0.000 description 1
- GTBGXKPAKVYEKJ-UHFFFAOYSA-N decyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCOC(=O)C(C)=C GTBGXKPAKVYEKJ-UHFFFAOYSA-N 0.000 description 1
- FWLDHHJLVGRRHD-UHFFFAOYSA-N decyl prop-2-enoate Chemical compound CCCCCCCCCCOC(=O)C=C FWLDHHJLVGRRHD-UHFFFAOYSA-N 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 1
- 125000004427 diamine group Chemical group 0.000 description 1
- KMSRVXJGTIRNNK-UHFFFAOYSA-N diaminomethylideneazanium;hydrogen carbonate Chemical compound NC(N)=N.OC(O)=O KMSRVXJGTIRNNK-UHFFFAOYSA-N 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- RNPXCFINMKSQPQ-UHFFFAOYSA-N dicetyl hydrogen phosphate Chemical compound CCCCCCCCCCCCCCCCOP(O)(=O)OCCCCCCCCCCCCCCCC RNPXCFINMKSQPQ-UHFFFAOYSA-N 0.000 description 1
- 229940093541 dicetylphosphate Drugs 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- VJZWIFWPGRIJSN-XRHABHTOSA-N dilinoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O.CCCCC\C=C/C\C=C/CCCCCCCC(O)=O VJZWIFWPGRIJSN-XRHABHTOSA-N 0.000 description 1
- YIOJGTBNHQAVBO-UHFFFAOYSA-N dimethyl-bis(prop-2-enyl)azanium Chemical compound C=CC[N+](C)(C)CC=C YIOJGTBNHQAVBO-UHFFFAOYSA-N 0.000 description 1
- GQOKIYDTHHZSCJ-UHFFFAOYSA-M dimethyl-bis(prop-2-enyl)azanium;chloride Chemical compound [Cl-].C=CC[N+](C)(C)CC=C GQOKIYDTHHZSCJ-UHFFFAOYSA-M 0.000 description 1
- SWSQBOPZIKWTGO-UHFFFAOYSA-N dimethylaminoamidine Natural products CN(C)C(N)=N SWSQBOPZIKWTGO-UHFFFAOYSA-N 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 229940113120 dipropylene glycol Drugs 0.000 description 1
- JFVXEJADITYJHK-UHFFFAOYSA-L disodium 2-(3-hydroxy-5-sulfonato-1H-indol-2-yl)-3-oxoindole-5-sulfonate Chemical compound [Na+].[Na+].Oc1c([nH]c2ccc(cc12)S([O-])(=O)=O)C1=Nc2ccc(cc2C1=O)S([O-])(=O)=O JFVXEJADITYJHK-UHFFFAOYSA-L 0.000 description 1
- AOMZHDJXSYHPKS-UHFFFAOYSA-L disodium 4-amino-5-hydroxy-3-[(4-nitrophenyl)diazenyl]-6-phenyldiazenylnaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC2=CC(S([O-])(=O)=O)=C(N=NC=3C=CC=CC=3)C(O)=C2C(N)=C1N=NC1=CC=C([N+]([O-])=O)C=C1 AOMZHDJXSYHPKS-UHFFFAOYSA-L 0.000 description 1
- LQJVOKWHGUAUHK-UHFFFAOYSA-L disodium 5-amino-4-hydroxy-3-phenyldiazenylnaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].OC1=C2C(N)=CC(S([O-])(=O)=O)=CC2=CC(S([O-])(=O)=O)=C1N=NC1=CC=CC=C1 LQJVOKWHGUAUHK-UHFFFAOYSA-L 0.000 description 1
- 229940047642 disodium cocoamphodiacetate Drugs 0.000 description 1
- 229940079857 disodium cocoamphodipropionate Drugs 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229940079881 disodium lauroamphodiacetate Drugs 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- SMVRDGHCVNAOIN-UHFFFAOYSA-L disodium;1-dodecoxydodecane;sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O.CCCCCCCCCCCCOCCCCCCCCCCCC SMVRDGHCVNAOIN-UHFFFAOYSA-L 0.000 description 1
- IVKWXPBUMQZFCW-UHFFFAOYSA-L disodium;2-(2,4,5,7-tetraiodo-3-oxido-6-oxoxanthen-9-yl)benzoate;hydrate Chemical compound O.[Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C21 IVKWXPBUMQZFCW-UHFFFAOYSA-L 0.000 description 1
- NJDNXYGOVLYJHP-UHFFFAOYSA-L disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzoate Chemical compound [Na+].[Na+].[O-]C(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC([O-])=CC=C21 NJDNXYGOVLYJHP-UHFFFAOYSA-L 0.000 description 1
- QKQCPXJIOJLHAL-UHFFFAOYSA-L disodium;2-[2-(carboxylatomethoxy)ethyl-[2-(dodecanoylamino)ethyl]amino]acetate Chemical compound [Na+].[Na+].CCCCCCCCCCCC(=O)NCCN(CC([O-])=O)CCOCC([O-])=O QKQCPXJIOJLHAL-UHFFFAOYSA-L 0.000 description 1
- JUOPAVUCOCCTBO-UHFFFAOYSA-L disodium;2-[[4-[ethyl-[(4-sulfonatophenyl)methyl]amino]phenyl]-[4-[ethyl-[(4-sulfonatophenyl)methyl]azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonate Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=CC(=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=C(S([O-])(=O)=O)C=C1 JUOPAVUCOCCTBO-UHFFFAOYSA-L 0.000 description 1
- HQYLVDYBSIUTBB-UHFFFAOYSA-L disodium;3-[2-(2-carboxylatoethoxy)ethyl-[2-(dodecanoylamino)ethyl]amino]propanoate Chemical compound [Na+].[Na+].CCCCCCCCCCCC(=O)NCCN(CCC([O-])=O)CCOCCC([O-])=O HQYLVDYBSIUTBB-UHFFFAOYSA-L 0.000 description 1
- GEGKMYLSPGGTQM-UHFFFAOYSA-L disodium;3-[2-(2-carboxylatoethoxy)ethyl-[2-(octanoylamino)ethyl]amino]propanoate Chemical compound [Na+].[Na+].CCCCCCCC(=O)NCCN(CCC([O-])=O)CCOCCC([O-])=O GEGKMYLSPGGTQM-UHFFFAOYSA-L 0.000 description 1
- KJDVLQDNIBGVMR-UHFFFAOYSA-L disodium;3-[2-aminoethyl-[2-(2-carboxylatoethoxy)ethyl]amino]propanoate Chemical compound [Na+].[Na+].[O-]C(=O)CCN(CCN)CCOCCC([O-])=O KJDVLQDNIBGVMR-UHFFFAOYSA-L 0.000 description 1
- KHLVKKOJDHCJMG-UHFFFAOYSA-L disodium;3-oxo-2-(3-oxo-5-sulfonato-1h-indol-2-ylidene)-1h-indole-5-sulfonate Chemical compound [Na+].[Na+].N1C2=CC=C(S([O-])(=O)=O)C=C2C(=O)C1=C1NC2=CC=C(S(=O)(=O)[O-])C=C2C1=O KHLVKKOJDHCJMG-UHFFFAOYSA-L 0.000 description 1
- 229960000735 docosanol Drugs 0.000 description 1
- UCYFZDNMZYZSPN-UHFFFAOYSA-N docosyl(trimethyl)azanium Chemical class CCCCCCCCCCCCCCCCCCCCCC[N+](C)(C)C UCYFZDNMZYZSPN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000007720 emulsion polymerization reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 235000010350 erythorbic acid Nutrition 0.000 description 1
- 239000004318 erythorbic acid Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 235000019326 ethyl hydroxyethyl cellulose Nutrition 0.000 description 1
- 229940093476 ethylene glycol Drugs 0.000 description 1
- 229920003089 ethylhydroxy ethyl cellulose Polymers 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229940057915 fd&c red no. 4 Drugs 0.000 description 1
- 229940051147 fd&c yellow no. 6 Drugs 0.000 description 1
- YKGGGCXBWXHKIZ-UHFFFAOYSA-N fluorescein (acid form) Chemical compound OC(=O)C1=CC=CC=C1C1=C2C=CC(=O)C=C2OC2=CC(O)=CC=C21 YKGGGCXBWXHKIZ-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000003709 fluoroalkyl group Chemical group 0.000 description 1
- MKXKFYHWDHIYRV-UHFFFAOYSA-N flutamide Chemical compound CC(C)C(=O)NC1=CC=C([N+]([O-])=O)C(C(F)(F)F)=C1 MKXKFYHWDHIYRV-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 229940096919 glycogen Drugs 0.000 description 1
- 125000003827 glycol group Chemical group 0.000 description 1
- 150000002337 glycosamines Chemical class 0.000 description 1
- 229920000578 graft copolymer Polymers 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 235000012701 green S Nutrition 0.000 description 1
- WDPIZEKLJKBSOZ-UHFFFAOYSA-M green s Chemical compound [Na+].C1=CC(N(C)C)=CC=C1C(C=1C2=CC=C(C=C2C=C(C=1O)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](C)C)C=C1 WDPIZEKLJKBSOZ-UHFFFAOYSA-M 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 230000003700 hair damage Effects 0.000 description 1
- 210000004919 hair shaft Anatomy 0.000 description 1
- 229940008453 hc yellow no. 5 Drugs 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FIKFOOMAUXPBJM-UHFFFAOYSA-N hepta-2,5-dienediamide Chemical class NC(=O)C=CCC=CC(N)=O FIKFOOMAUXPBJM-UHFFFAOYSA-N 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNDVDQJCIGZPNO-UHFFFAOYSA-N histidine Natural products OC(=O)C(N)CC1=CN=CN1 HNDVDQJCIGZPNO-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- KDNFLUWYIMPBSA-UHFFFAOYSA-N hydrogen peroxide;1,3,5-triazine-2,4,6-triamine Chemical compound OO.NC1=NC(N)=NC(N)=N1 KDNFLUWYIMPBSA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 125000001165 hydrophobic group Chemical group 0.000 description 1
- 229920013821 hydroxy alkyl cellulose Polymers 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 150000002462 imidazolines Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 235000012738 indigotine Nutrition 0.000 description 1
- 229910001412 inorganic anion Inorganic materials 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 229940026239 isoascorbic acid Drugs 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N itaconic acid Chemical compound OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 150000003903 lactic acid esters Chemical class 0.000 description 1
- TWNIBLMWSKIRAT-VFUOTHLCSA-N levoglucosan Chemical group O[C@@H]1[C@@H](O)[C@H](O)[C@H]2CO[C@@H]1O2 TWNIBLMWSKIRAT-VFUOTHLCSA-N 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 150000004988 m-phenylenediamines Chemical class 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- FDZZZRQASAIRJF-UHFFFAOYSA-M malachite green Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC=CC=1)=C1C=CC(=[N+](C)C)C=C1 FDZZZRQASAIRJF-UHFFFAOYSA-M 0.000 description 1
- LUEWUZLMQUOBSB-GFVSVBBRSA-N mannan Chemical class O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@H]3[C@H](O[C@@H](O)[C@@H](O)[C@H]3O)CO)[C@@H](O)[C@H]2O)CO)[C@H](O)[C@H]1O LUEWUZLMQUOBSB-GFVSVBBRSA-N 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical class COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229940043348 myristyl alcohol Drugs 0.000 description 1
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 description 1
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical group CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 1
- MLKPMOZMNCKWGN-UHFFFAOYSA-N n-[2-(2,5-diaminophenoxy)ethyl]acetamide Chemical compound CC(=O)NCCOC1=CC(N)=CC=C1N MLKPMOZMNCKWGN-UHFFFAOYSA-N 0.000 description 1
- NYEAZTKGGQLIJM-UHFFFAOYSA-N n-[4-amino-2-(2-hydroxyethyl)pyrazol-3-yl]-3-(5-amino-2-hydroxyphenyl)prop-2-enamide Chemical compound C1=NN(CCO)C(NC(=O)C=CC=2C(=CC=C(N)C=2)O)=C1N NYEAZTKGGQLIJM-UHFFFAOYSA-N 0.000 description 1
- IFNVGPBEXQJCMU-UHFFFAOYSA-N n-[4-amino-2-(2-hydroxyethyl)pyrazol-3-yl]-3-(5-amino-2-hydroxyphenyl)prop-2-enamide;hydrochloride Chemical compound Cl.C1=NN(CCO)C(NC(=O)C=CC=2C(=CC=C(N)C=2)O)=C1N IFNVGPBEXQJCMU-UHFFFAOYSA-N 0.000 description 1
- 229950006780 n-acetylglucosamine Drugs 0.000 description 1
- VAMFXQBUQXONLZ-UHFFFAOYSA-N n-alpha-eicosene Natural products CCCCCCCCCCCCCCCCCCC=C VAMFXQBUQXONLZ-UHFFFAOYSA-N 0.000 description 1
- GQEZCXVZFLOKMC-UHFFFAOYSA-N n-alpha-hexadecene Natural products CCCCCCCCCCCCCCC=C GQEZCXVZFLOKMC-UHFFFAOYSA-N 0.000 description 1
- ZBJVLWIYKOAYQH-UHFFFAOYSA-N naphthalen-2-yl 2-hydroxybenzoate Chemical compound OC1=CC=CC=C1C(=O)OC1=CC=C(C=CC=C2)C2=C1 ZBJVLWIYKOAYQH-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- GSGDTSDELPUTKU-UHFFFAOYSA-N nonoxybenzene Chemical compound CCCCCCCCCOC1=CC=CC=C1 GSGDTSDELPUTKU-UHFFFAOYSA-N 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N o-dihydroxy-benzene Natural products OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 1
- 150000004987 o-phenylenediamines Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- HMZGPNHSPWNGEP-UHFFFAOYSA-N octadecyl 2-methylprop-2-enoate Chemical compound CCCCCCCCCCCCCCCCCCOC(=O)C(C)=C HMZGPNHSPWNGEP-UHFFFAOYSA-N 0.000 description 1
- 229920004914 octoxynol-40 Polymers 0.000 description 1
- 150000002891 organic anions Chemical class 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical class C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000012736 patent blue V Nutrition 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- GVKCHTBDSMQENH-UHFFFAOYSA-L phloxine B Chemical compound [Na+].[Na+].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C1=C2C=C(Br)C(=O)C(Br)=C2OC2=C(Br)C([O-])=C(Br)C=C21 GVKCHTBDSMQENH-UHFFFAOYSA-L 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- PTMHPRAIXMAOOB-UHFFFAOYSA-N phosphoramidic acid Chemical class NP(O)(O)=O PTMHPRAIXMAOOB-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229920002553 poly(2-methacrylolyloxyethyltrimethylammonium chloride) polymer Polymers 0.000 description 1
- 229920000371 poly(diallyldimethylammonium chloride) polymer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 235000010483 polyoxyethylene sorbitan monopalmitate Nutrition 0.000 description 1
- 239000000249 polyoxyethylene sorbitan monopalmitate Substances 0.000 description 1
- 229940101027 polysorbate 40 Drugs 0.000 description 1
- 239000004175 ponceau 4R Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical group 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000005588 protonation Effects 0.000 description 1
- PNFZIEOWPDFJBH-UHFFFAOYSA-N pyrazolo[1,5-a]pyrimidine-3,7-diamine Chemical compound NC1=CC=NC2=C(N)C=NN21 PNFZIEOWPDFJBH-UHFFFAOYSA-N 0.000 description 1
- UBUFOHLVTQZEQF-UHFFFAOYSA-N pyridine-2,3,4,6-tetramine Chemical compound NC1=CC(N)=C(N)C(N)=N1 UBUFOHLVTQZEQF-UHFFFAOYSA-N 0.000 description 1
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical compound OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 description 1
- 235000012752 quinoline yellow Nutrition 0.000 description 1
- 229940051201 quinoline yellow Drugs 0.000 description 1
- FZUOVNMHEAPVBW-UHFFFAOYSA-L quinoline yellow ws Chemical compound [Na+].[Na+].O=C1C2=CC=CC=C2C(=O)C1C1=NC2=C(S([O-])(=O)=O)C=C(S(=O)(=O)[O-])C=C2C=C1 FZUOVNMHEAPVBW-UHFFFAOYSA-L 0.000 description 1
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 102220087975 rs777340009 Human genes 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 210000004761 scalp Anatomy 0.000 description 1
- 150000003335 secondary amines Chemical group 0.000 description 1
- DUIOPKIIICUYRZ-UHFFFAOYSA-N semicarbazide Chemical compound NNC(N)=O DUIOPKIIICUYRZ-UHFFFAOYSA-N 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- COEZWFYORILMOM-UHFFFAOYSA-M sodium 4-[(2,4-dihydroxyphenyl)diazenyl]benzenesulfonate Chemical compound [Na+].OC1=CC(O)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 COEZWFYORILMOM-UHFFFAOYSA-M 0.000 description 1
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- MHYHOFJMOINIMT-UHFFFAOYSA-J sodium chromium(3+) 3-hydroxy-4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]naphthalene-1-sulfonate Chemical compound [Cr+3].OC=1C=C(C2=CC=CC=C2C1N=NC1C(=NN(C1=O)C1=CC=CC=C1)C)S(=O)(=O)[O-].[Na+].OC=1C=C(C2=CC=CC=C2C1N=NC1C(=NN(C1=O)C1=CC=CC=C1)C)S(=O)(=O)[O-].OC=1C=C(C2=CC=CC=C2C1N=NC1C(=NN(C1=O)C1=CC=CC=C1)C)S(=O)(=O)[O-].OC=1C=C(C2=CC=CC=C2C1N=NC1C(=NN(C1=O)C1=CC=CC=C1)C)S(=O)(=O)[O-] MHYHOFJMOINIMT-UHFFFAOYSA-J 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- PFUVRDFDKPNGAV-UHFFFAOYSA-N sodium peroxide Chemical compound [Na+].[Na+].[O-][O-] PFUVRDFDKPNGAV-UHFFFAOYSA-N 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- LJFWQNJLLOFIJK-UHFFFAOYSA-N solvent violet 13 Chemical compound C1=CC(C)=CC=C1NC1=CC=C(O)C2=C1C(=O)C1=CC=CC=C1C2=O LJFWQNJLLOFIJK-UHFFFAOYSA-N 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 229940012831 stearyl alcohol Drugs 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 235000012751 sunset yellow FCF Nutrition 0.000 description 1
- 239000004173 sunset yellow FCF Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 235000012756 tartrazine Nutrition 0.000 description 1
- 239000004149 tartrazine Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000004685 tetrahydrates Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-M toluene-4-sulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-M 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 229940057400 trihydroxystearin Drugs 0.000 description 1
- USFMMZYROHDWPJ-UHFFFAOYSA-N trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium Chemical compound CC(=C)C(=O)OCC[N+](C)(C)C USFMMZYROHDWPJ-UHFFFAOYSA-N 0.000 description 1
- RRHXZLALVWBDKH-UHFFFAOYSA-M trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium;chloride Chemical compound [Cl-].CC(=C)C(=O)OCC[N+](C)(C)C RRHXZLALVWBDKH-UHFFFAOYSA-M 0.000 description 1
- UZNHKBFIBYXPDV-UHFFFAOYSA-N trimethyl-[3-(2-methylprop-2-enoylamino)propyl]azanium;chloride Chemical compound [Cl-].CC(=C)C(=O)NCCC[N+](C)(C)C UZNHKBFIBYXPDV-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- YXHBBEQKMVAJOH-UHFFFAOYSA-K trisodium;5-oxido-4-[(4-sulfonatophenyl)diazenyl]-1-(4-sulfophenyl)pyrazole-3-carboxylate Chemical compound [Na+].[Na+].[Na+].C1=CC(S(=O)(=O)O)=CC=C1N1C([O-])=C(N=NC=2C=CC(=CC=2)S([O-])(=O)=O)C(C([O-])=O)=N1 YXHBBEQKMVAJOH-UHFFFAOYSA-K 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- LLWJPGAKXJBKKA-UHFFFAOYSA-N victoria blue B Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1C(C=1C=CC(=CC=1)N(C)C)=C(C=C1)C2=CC=CC=C2C1=[NH+]C1=CC=CC=C1 LLWJPGAKXJBKKA-UHFFFAOYSA-N 0.000 description 1
- ROVRRJSRRSGUOL-UHFFFAOYSA-N victoria blue bo Chemical compound [Cl-].C12=CC=CC=C2C(NCC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)=C1C=CC(=[N+](CC)CC)C=C1 ROVRRJSRRSGUOL-UHFFFAOYSA-N 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229940100445 wheat starch Drugs 0.000 description 1
- PEAGNRWWSMMRPZ-UHFFFAOYSA-L woodstain scarlet Chemical compound [Na+].[Na+].OC1=CC=C2C=C(S([O-])(=O)=O)C=C(S([O-])(=O)=O)C2=C1N=NC(C=C1)=CC=C1N=NC1=CC=CC=C1 PEAGNRWWSMMRPZ-UHFFFAOYSA-L 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 235000010493 xanthan gum Nutrition 0.000 description 1
- 239000000230 xanthan gum Substances 0.000 description 1
- 229940082509 xanthan gum Drugs 0.000 description 1
- 229920001221 xylan Polymers 0.000 description 1
- 150000004823 xylans Chemical class 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/411—Aromatic amines, i.e. where the amino group is directly linked to the aromatic nucleus
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q5/00—Preparations for care of the hair
- A61Q5/10—Preparations for permanently dyeing the hair
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
Abstract
The present invention relates to a composition comprising as developer compound at least one 1,4-diamino-2-methoxymethylbenzene of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt;
as well as a method of dyeing keratin fibers using the above dye composition.
as well as a method of dyeing keratin fibers using the above dye composition.
Description
DEMANDES OU BREVETS VOLUMINEUX
LA PRESENTE PARTIE I)E CETTE DEMANDE OU CE BREVETS
COMPREND PLUS D'UN TOME.
CECI EST LE TOME DE _2 NOTE: Pour les tomes additionels, veillez contacter le Bureau Canadien des Brevets.
JUMBO APPLICATIONS / PATENTS
THIS SECTION OF THE APPLICATION / PATENT CONTAINS MORE
THAN ONE VOLUME.
NOTE: For additional volumes please contact the Canadian Patent Office.
DESCRIPTION
Hair Dyes comprising 1,4-diamino-2-methoxymethylbenzene FIELD OF THE INVENTION
The subject matter of the present application are compositions and methods for dyeing keratin fibers containing the 1,4-diamino-2-methoxymethylbenzene and physiologically compatible salts thereof.
BACKGROUND OF THE INVENTION
In the field of dyeing keratin fibers, in particular hair coloring, oxidation dyes have achieved significant importance. The coloration arises here as a result of the reaction of certain developer substances with certain coupler substances in the presence of a suitable oxidizing agent. The developer substances used here are, in particular, unsubstituted or substituted 1,4-diaminobenzenes.
Besides dyeing to the desired intensity, numerous additional demands are made on oxidation dyes which are used for coloring human hair. For example, the dyes must be acceptable from a toxicological and dermatological point of view and the hair colorations achieved must have good light fastness, permanent wave fastness, acid fastness and rubbing fastness.
However, in any case, such colorations must remain stable over a period of at least 4 to 6 weeks without being affected by light, rubbing and chemical agents. Furthermore, it is required that the suitable dyes possess a good physiological compatibility.
The currently used colorants, however, do not satisfy the above mentioned requirements in all respects. Therefore there is still a need for novel developer substances which satisfy the above mentioned requirements to a better degree.
SUMMARY OF THE INVENTION
Therefore there is a need for new 1,4-diaminobenzene derivatives with improved properties, especially with regard to improved physiological compatibility.
DETAILED DESCRIPTION OF THE INVENTION
It has now been found that the new 1,4-diaminobenzenes according to formula (I) have improved properties, especially they are non-sensitizing.
LA PRESENTE PARTIE I)E CETTE DEMANDE OU CE BREVETS
COMPREND PLUS D'UN TOME.
CECI EST LE TOME DE _2 NOTE: Pour les tomes additionels, veillez contacter le Bureau Canadien des Brevets.
JUMBO APPLICATIONS / PATENTS
THIS SECTION OF THE APPLICATION / PATENT CONTAINS MORE
THAN ONE VOLUME.
NOTE: For additional volumes please contact the Canadian Patent Office.
DESCRIPTION
Hair Dyes comprising 1,4-diamino-2-methoxymethylbenzene FIELD OF THE INVENTION
The subject matter of the present application are compositions and methods for dyeing keratin fibers containing the 1,4-diamino-2-methoxymethylbenzene and physiologically compatible salts thereof.
BACKGROUND OF THE INVENTION
In the field of dyeing keratin fibers, in particular hair coloring, oxidation dyes have achieved significant importance. The coloration arises here as a result of the reaction of certain developer substances with certain coupler substances in the presence of a suitable oxidizing agent. The developer substances used here are, in particular, unsubstituted or substituted 1,4-diaminobenzenes.
Besides dyeing to the desired intensity, numerous additional demands are made on oxidation dyes which are used for coloring human hair. For example, the dyes must be acceptable from a toxicological and dermatological point of view and the hair colorations achieved must have good light fastness, permanent wave fastness, acid fastness and rubbing fastness.
However, in any case, such colorations must remain stable over a period of at least 4 to 6 weeks without being affected by light, rubbing and chemical agents. Furthermore, it is required that the suitable dyes possess a good physiological compatibility.
The currently used colorants, however, do not satisfy the above mentioned requirements in all respects. Therefore there is still a need for novel developer substances which satisfy the above mentioned requirements to a better degree.
SUMMARY OF THE INVENTION
Therefore there is a need for new 1,4-diaminobenzene derivatives with improved properties, especially with regard to improved physiological compatibility.
DETAILED DESCRIPTION OF THE INVENTION
It has now been found that the new 1,4-diaminobenzenes according to formula (I) have improved properties, especially they are non-sensitizing.
The present invention therefore relates to compositions and methods for dyeing keratin fibers, especially wool, silk or hair, particularly human hair, using the 1,4-diamino-methoxymethylbenzene of formula (I).
NHZ
NH2 xnHX (I), wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt.
Although the 1,4-diamino-2-methoxymethylbenzene of formula (I) is especially suitable for dyeing kertain fibers, in principle it would also be possible to dye other natural or synthetic fibers, especially cotton or nylon 66, with the 1,4-diarnino-2-methoxymethylbenzene of formula (I).
The compounds of formula (I) may be used alone or in combination with known developer substances and/or coupler substances.
Suitable couplers for use in the compositions described herein include, but are not limited to:
phenols, resorcinol and naphthol derivatives such as: naphthalene- 1,7-diol, benzene- 1,3-diol, 4-chlorobenzene-1,3-diol, naphthalen-l-ol, 2-methyl-naphthalen-l-ol, naphthalene- 1,5-diol, naphthalene-2,7-diol, benzene- 1,4-diol, 2-methyl-benzene-1,3-diol, 7-amino-4-hydroxy-naphthalene-2-sulfonic acid, 2-isopropyl-5-methylphenol, 1,2,3,4-tetrahydro-naphthalene-1,5-diol, 2-chloro-benzene-l,3-diol, 4-hydroxy-naphthalene-l-sulfonic acid, benzene-1,2,3-triol, naphthalene-2,3-diol, 5-dichloro-2-methylbenzene-1,3-diol, 4,6-dichlorobenzene-1,3-diol, 2,3-dihydroxy-[1,4]naphthoquinone; and 1-Acetoxy-2-methylnaphthalene; m-phenylenediamines such as: 2,4-diaminophenol, benzene-1,3-diamine, 2-(2,4-diamino-phenoxy)-ethanol, 2-[(3-amino-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, 2-mehyl-benzene-1,3-diamine, 2-[[2-(2,4-diamino-phenoxy)-ethyl]-(2-hydroxy-ethyl)-amino]-ethanol, 4-(3-[(2,4-diaminophenyl)oxy]-propoxy}benzene-1,3-diamine, 2-(2,4-diamino-phenyl)-ethanol, 2-(3-amino-4-methoxy-phenylamino)-ethanol, 4-(2-amino-ethoxy)-benzene-1,3-diamine, (2,4-diamino-phenoxy)-acetic acid, 2-[2,4-diamino-5-(2-hydroxy-ethoxy)-phenoxy]-ethanol, 4-ethoxy-6-methyl-benzene-1,3-diamine, 2-(2,4-diamino-5-methyl-phenoxy)-ethanol, 4,6-dimethoxy-benzene-1,3-diamine, 2-[3-(2-hydroxy-ethylamino)-2-methyl-phenylamino]-ethanol, 3-(2,4-diamino-phenoxy)-propan-l-ol, N-[3-(dimethylamino)phenyl]urea, 4-methoxy-6-methylbenzene-1,3-diamine, 4-fluoro-6-methylbenzene-1,3-diamine, 2-( {3-[(2-hydroxyethyl)amino]-4,6-dimethoxyphenyl}-amino)ethanol, 3-(2,4-diaminophenoxy)-propane-1,2-diol, 2-[2-amino-4-(methylamino)-phenoxy]ethanol, 2-[(5-amino-2-ethoxy-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, 2-[(3-aminophenyl)amino]ethanol, 2,4-Diamino-5-(2'-hydroxyethyloxy)toluene; N,N-Dimethyl-3-ureidoaniline; N-(2-aminoethyl)benzene-1,3-diamine, 4-{[(2,4-diamino-phenyl)oxy]methoxy}-benzene-1,3-diamine, 1-methyl-2,6-bis(2-hydroxyethylamino)benzene; and 2,4-dimethoxy-benzene- 1,3-diamine; m-aminophenols such as: 3-amino-phenol, 2-(3-hydroxy-4-methyl-phenylamino)-acetamide, 2-(3-hydroxy-phenylamino)-acetamide, 5-amino-2-methyl-phenol, 5-(2-hydroxyethylamino)-2-methyl-phenol, 5-amino-2,4-dichloro-phenol, 3-amino-2-methyl-phenol, 3-amino-2-chloro-6-methyl-phenol, 5-amino-2-(2-hydroxy-ethoxy)-phenol, 2-chloro-5-(2,2,2-trifluoro-ethylamino)-phenol, 5-amino-4-chloro-2-methyl-phenol, 3-cyclopentylamino-phenol, 5-[(2-hydroxyethyl)amino]-4-methoxy-2-methylphenol, 5-amino-4-methoxy-methylphenol, 3-(dimethylamino)phenol, 3-(diethylamino)phenol, 5-amino-4-fluoro-2-methylphenol, 5-amino-4-ethoxy-2-methylphenol, 3-amino-2,4-dichloro-phenol, 3-[(2-methoxyethyl)amino]phenol, 3-[(2-hydroxyethyl)amino]phenol, 5-amino-2-ethyl-phenol, 5-amino-2-methoxyphenol, 5-[(3-hydroxy-propyl)amino]-2-methylphenol, 3-[(3-hydroxy-2-methylphenyl)-amino]propane-1,2-diol, 3-[(2-hydroxyethyl)amino]-2-methylphenol; 1-Methyl-2-hydroxy-4-(2'-hydroxyethyl)amino-benzene; 1,3-Bis-(2,4-Diaminophenoxy)propane; 1-Hydroxy-2-methyl-5-amino-6-chlorobenzene; and heterocyclic derivatives such as: 3,4-dihydro-2H-1,4-benzoxazin-6-ol, 4-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3 -one, 6-methoxyquinolin-8-amine, 4-methylpyridine-2,6-diol, 2,3-dihydro-1,4-benzodioxin-5-ol, 1,3-benzodioxol-5-ol, 2-(1,3-benzodioxol-5-ylamino)ethanol, 3,4-dimethylpyridine-2,6-diol, 5-chloropyridine-2,3-diol, 2,6-dimethoxypyridine-3,5-diamine, 1,3-benzodioxol-5-amine, 2-{[3,5-diamino-6-(2-hydroxy-ethoxy)-pyridin-2-yl]oxy}-ethanol, 1H-indol-4-ol, 5-amino-2,6-dimethoxypyridin-3-ol, 1H-indole-5,6-diol, 1H-indol-7-ol, 1H-indol-5-ol, 1H-indol-6-ol, 6-bromo-1,3-benzodioxol-5-ol, 2-aminopyridin-3-ol, pyridine-2,6-diamine, 3-[(3,5-diaminopyridin-2-yl)oxy]propane-1,2-diol, 5-[(3,5-diaminopyridin-2-yl)oxy]pentane-1,3-diol, 1H-indole-2,3-dione, indoline-5,6-diol, 3,5-dimethoxypyridine-2,6-diamine, 6-methoxypyridine-2,3-diamine; 3,4-dihydro-2H-1,4-benzoxazin-6-amine; 4-hydroxy-N-methylindole, 1H-5-methylpyrazol-5-one, 1-phenyl-3-methylpyrazol-5-one, 2,6-dimethylpyrazolo[1,5-b]-1,2,4-triazole, 2,6-dimethyl[3,2-c]-1,2,4-triazole, 6-methylpyrazolo-[1,5-a]benzimidazole, 2,6-dihydroxypyridine, 2,6-dihydroxy-3,4-dimethylpyridine, 5-methylpyrazolo[5,1-e]-1,2,3-triazole, 5-methyl-6-chloropyrazolo[5,1-e]-1,2,3,-triazole, 5-phenylpyrazolo[5,1-e]-1,2,3-triazole and its addition salts, 1H-2,6-dimethylpyrazolo[1,5-b]-1,2,4-triazole tosylate, 7,8-dicyano-4-methylimidazolo-[3,2-a]imidazole, 2,7-dimethylpyrazolo [ 1, 5 -a]pyrimidin-5 -one, 2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-one, and 2-methyl-5-methoxymethyl-pyrazolo[1,5-a]pyrimidin-7-one;
6-Hydroxybenzomorpholine; and 3-Amino-2-methylamino-6-methoxypyridine; 1-Phenyl-3-methyl-5-pyrazolone-2,4-dihydro-5,2-phenyl-3 H-pyrazole-3-one.
Preferred coupler substances include: N-(3-dimethylaminophenyl)urea, 2,6-diaminopyridine, 2-amino-4-[(2-hydroxyethyl)amino]anisole, 2,4-diamino-l-fluoro-5-methylbenzene, 2,4-diamino-l-methoxy-5-methylbenzene, 2,4-diamino-l-ethoxy-5-methylbenzene, 2,4-diamino-1-(2-hydroxyethoxy)-5-methylbenzene, 2,4-di-[(2-hydroxyethyl)amino]-1,5-dimethoxybenzene, 2,3-diamino-6-methoxypyridine, 3-amino-6-methoxy-2-(methylamino)-pyridine, 2,6-diamino-3,5-dimethoxypyridine, 3,5-diamino-2,6-dimethoxypyridine, 1,3-diaminobenzene, 2,4-diamino-1-(2-hydroxyethoxy)benzene, 2,4-diamino-l-(3-hydroxypropoxy)benzene, 1-(2-aminoethoxy)-2,4-diaminobenzene, 2-amiono-1-(2-hydroxyethoxy)-4-methylaminobenzene, 2,4-diaminophenoxyacetic acid, 3-[di(2-hydroxyethyl)-amino]aniline, 4-amino-2-di[(2-hydroxyethyl)amino]-1-ethoxybenzene, 5-methyl-2-(1-methylethyl)phenol, 3-[(2-hydroxyethyl)amino] aniline, 3-[(2-aminoethyl)amino]aniline, 1,3-di(2,4-diaminophenoxy)propane, di-(2,4-diaminophenoxy)methane, 1,3-diamino-2,4-dimethoxybenzene, 2,6-bis-(2-hydroxyethyl)aminotoluene, 4-hydroxyindol, 3-dimethylaminophenol, 3-diethylaminophenol, 5-amino-2-methylphenol, 5-amino-4-fluoro-2-methylphenol, 5-amino-4-methoxy-2-methylphenol, 5-amino-4-ethoxy-2-methylphenol, 3-amino-2,4-dichlorophenol, 5-amino-2,4-dichlorophenol, 3-amino-2-methylphenol, 3-amino-2-chloro-6-methyl-phenol, 3-amino-phenol, 2-[(3-hydroxyphenyl)amino]acetamide, 5-[(2-hydroxyethyl)amino]-2-methylphenol, 3-[(2-hydroxyethyl)amino]-phenol, 3-[(2-methoxy-ethyl)amino]-phenol, 5-amino-2-ethylphenol, 2-(4-amino-2-hydroxyphenoxy)-ethanol, 5-[(3-hydroxypropyl)amino]-2-methylphenol, 3-[(2,3-dihydroxypropyl)-amino]-2-methyl-phenol, 3-[(2-hydroxyethyl)amino]-2-methylphenol, 2-amino-3-hydroxypyridine, 5-amino-4-chloro-2-methylphenol, 1-naphthol, 1,5-dihydroxy-naphthalene, 1,7-dihydroxy-naphthalene, 2,3-dihydroxynaphthalene, 2,7-dihydroxynaphthalene, 2-methyl-l-naphthol acetate, 1,3-dihydroxy-benzene, 1-chloro-2,4-dihydroxybenzene, 2-chloro-1,3-dihydroxybenzene, 1,2-dichloro-3,5-dihydroxy-4-methylbenzene, 1,5-dichloro-2,4-dihydroxybenzene, 1,3-dihydroxy-2-methylbenzene, 3,4-methylenedioxyphenol, 3,4-methylenedioxy-aniline, 5-[(2-hydroxyethyl)amino]-1,3-benzodioxole, 6-bromo-l-hydroxy-3,4-methylendioxybenzene, 3,4-diaminobenzoic acid, 3,4-dihydro-6-hydroxy-1,4(2H)-benzoxazine, 6-amino-3,4-dihydro-1,4(2H)-benzoxazine, 3-methyl-l-phenyl-5-pyrazolone, 5,6-dihydroxyindole, 5,6-dihydroxyindoline, 5-hydroxy-indole, 6-hydroxyindole, 7-hydroxy-indole and 5 2,3-indolindione, or their salts.
To produce natural shades and fashionable red tones it is advantageous to use the compounds of formula (I) in combination with additional developer substances, such as p-phenylenediamine derivatives, e.g. benzene-l,4-diamine (commonly known as p-phenylenediamine), 2-methyl-benzene- 1,4-diamine, 2-chloro-benzene-1,4-diamine, N-phenyl-benzene-1,4-diamine, N-(2-ethoxyethyl)benzene-1,4-diamine, 2-[(4-amino-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, (commonly known as N,N-bis(2-hydroxyethyl)-p-phenylenediamine) (2,5-diamino-phenyl)-methanol, 1-(2'-Hydroxyethyl)-2,5-diaminobenzene, 2-(2,5-diamino-phenyl)-ethanol, N-(4-aminophenyl)benzene-1,4-diamine, 2,6-dimethyl-benzene-1,4-diamine, 2-isopropyl-benzene-1,4-diamine, 1-[(4-aminophenyl)amino]-propan-2-ol, 2-propyl-benzene-1,4-diamine, 1,3-bis[(4-aminophenyl)(2-hydroxyethyl)amino]propan-2-ol, N4,N4,2-trimethylbenzene-1,4-diamine, 2-methoxy-benzene-1,4-diamine, 1-(2,5-diaminophenyl)ethane-1,2-diol, 2,3-dimethyl-benzene-1,4-diamine, N-(4-amino-3-hydroxy-phenyl)-acetamide, 2,6-diethylbenzene-1,4-diamine, 2,5-dimethylbenzene-1,4-diamine, 2-thien-2-ylbenzene-1,4-diamine, 2-thien-3-ylbenzene-1,4-diamine, 2-pyridin-3-ylbenzene-1,4-diamine, 1,1'-biphenyl-2,5-diamine, 2-(methoxymethyl)-benzene- 1,4-diamine, 2-(aminomethyl)benzene-1,4-diamine, 2-(2,5-diaminophenoxy)ethanol, N-[2-(2,5-diaminophenoxy)ethyl]-acetamide, N,N-dimethylbenzene-1,4-diamine, N,N-diethylbenzene-1,4-diamine, N,N-dipropylbenzene-1,4-diamine, 2-[(4-aminophenyl)-(ethyl)amino]ethanol, 2-[(4-amino-3-methyl-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, N-(2-methoxyethyl)-benzene-1,4-diamine, 3-[(4-aminophenyl)amino]propan-l-ol, 3-[(4-aminophenyl)-amino]propane-1,2-diol, N-{4-[(4-aminophenyl)amino]butyl}benzene-1,4-diamine, and 2-[2-(2- {2-[(2,5-diaminophenyl)-oxy]ethoxy}
ethoxy)ethoxy]benzene-1,4-diamine;
1,3-Bis(N(2-Hydroxyethyl)-N-(4-amino-phenyl)amino)-2-propanol; 2,2'-[ 1,2-Ethanediyl-bis-(oxy-2,1-ethanediyloxy)]-bis-benzene-1,4-diamine; N,N-Bis(2-hydroxyethyl)-p-phenylinediamine; p-aminophenol derivatives such as: 4-amino-phenol (commonly known as p-aminophenol), 4-methylamino-phenol, 4-amino-3-methyl-phenol, 4-amino-2-hydroxymethyl-phenol, 4-amino-2-methyl-phenol, 4-amino-l-hydroxy-2-(2'-hydroxyethylaminomethyl)benzene, 4-amino-2-methoxymethyl-phenol, 5-amino-2-hydroxy-benzoic acid, 1-(5-amino-2-hydroxy-phenyl)-ethane-1,2-diol, 4-amino-2-(2-hydroxy-ethyl)-phenol, 4-amino-3-(hydroxymethyl)-phenol, 4-amino-3-fluoro-phenol, 4-amino-2-(aminomethyl)-phenol, 4-amino-2-fluoro-phenol;
1-Hydroxy-2,4-diaminobenzene; 1-(2'-Hydroxyethyloxy)-2,4-diaminobenzene; 2,4-Diamino-5-methylphenetol; o-phenylenediamine derivatives such as: 3,4-Diaminobenzoic acid and salts thereof; o-aminophenol derivatives such as: 2-amino-phenol (commonly known as o-aminophenol), 2,4-diaminophenol, 2-amino-5-methyl-phenol, 2-amino-6-methyl-phenol, N-(4-amino-3-hydroxy-phenyl)-acetamide, and 2-amino-4-methyl-phenol; and heterocyclic derivatives such as: pyrimidine-2,4,5,6-tetramine (commonly known as 2,4,5,6-tetraamino-pyridine), 1-methyl-lH-pyrazole-4,5-diamine, 2-(4,5-diamino-lH-pyrazol-1-yl)ethanol, NZ,Nz-dimethyl-pyridine-2,5-diamine, 2-[(3-amino-6-methoxypyridin-2-yl)amino]ethanol, 6-methoxy-N2 -methyl-pyridine-2,3-diamine, 2,5,6-triaminopyrimidin-4(1 H)-one, pyridine-2,5-diamine, 1-isopropyl-lH-pyrazole-4,5-diamine, 1-(4-methylbenzyl)-1H-pyrazole-4,5-diamine, 1-(benzyl)-1H-pyrazole-4,5-diamine, 1-(4-chlorobenzyl)-1H-pyrazole-4,5-diamine, pyrazolo[1,5-a]-pyrimidine-3,7-diamine, 5,6,7-trimethylpyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 7-methylpyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 2,5,6,7-teramethyl-pyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 5,7-di-tert-butylpyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 5,7-di-trifluoromethyl-pyrazolo[ 1,5-a]pyrimidin-3-ylamine hydrochloride, 2-methylpyrazolo[1,5-a]pyrimidin-3,7-diamine hydrochloride; 4-hydroxy-2,5,6-triaminopyrimidine; 1-(2'hydroxyethyl)-amino-3,4-methylene dioxybenzene; and 1-hydroxyethyl-4,5-diaminopyrazole sulphate.
Additional developers include: N-(3-furylmethyl)benzene-1,4-diamine; N-Thiophen-3-ylmethyl-benzene- 1,4-diamine; N-(2-furylmethyl)benzene-1,4-diamine; N-Thiophen-2-ylmethyl-benzene-1,4-diamine; 4-Hydroxy-benzoic acid (2,5-diamino-benzylidene)-hydrazide; 3-(2,5-Diamino-phenyl)-N-ethyl-acrylamide; 2- [3 -(3 -Amino-phenylamino)-propenyl] -benzene-1,4-diamine;
2- [ 3 -(4-Amino-phenylamino)-propenyl] -benzene- 1,4-diamine; 2-(6-Methyl-pyridin-2-yl)-benzene- 1,4-diamine; 2-Pyridin-2-yl-benzene-1,4-diamine; 2-[3-(4-Amino-phenylamino)-propenyl] -benzene- 1,4-diamine; 2- [3 -(3 -Amino-phenylamino)-propenyl] -benzene- 1,4-diamine;
3-(2,5-Diamino-phenyl)-N-ethyl-acrylamide; 2-Thiazol-2-yl-benzene-1,4-diamine;
4-Hydroxy-benzoic acid (2,5-diamino-benzylidene)-hydrazide; 3'-Fluoro-biphenyl-2,5-diamine; 2-Propenyl-benzene- 1,4-diamine; 2'-Chloro-biphenyl-2,5-diamine; N-Thiophen-3-ylmethyl-benzene-1,4-diamine; N-(3-furylmethyl)benzene-1,4-diamine; 4'-Methoxy-biphenyl-2,5-diamine; N-(4-Amino-benzyl)-benzene-1,4-diamine; 2-Methyl-5 - [(1 -H-pyrrol-2-ylmethyl)-amino] -phenol;
5-[(Furan-2-ylmethyl)-amino]-2-methyl-phenol; 5-Isopropylamino-2-methyl-phenol; Biphenyl-2,4,4'-triamine hydrochloride; 5-(4-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; 5-Phenylaminomethyl-benzene-1,3-diamine hydrochloride; 2-[4-Amino-2-(3,5-diamino-benzylamino)-phenoxy]-ethanol hydrochloride; 5-(3-Amino-phenyl)aminomethyl-benzene- 1,3-diamine hydrochloride; N-(2-Amino-benzyl)-benzene-1,3-diamine hydrochloride;
N-Furan-2-ylmethyl-benzene-1,3-diamine hydrochloride; 2-[(3-Amino-phenylamino)-methyl]-phenol hydrochloride; 4-Amino-2-propylaminomethyl-phenol; hydrochloride;
N-Benzo[1,3]dioxol-5-ylmethyl-benzene-1,3-diamine hydrochloride; N-[4-Amino-2-(2-hydroxy-ethyl)-2H-pyrazol-3-yl]-3-(5-amino-2-hydroxy-phenyl)-acrylamide;
hydrochloride; 4-Amino-2-(isopropylamino-methyl)-phenol; hydrochloride; 4-Thiophen-3-yl-benzene-l,3-diamine;
hydrochloride hydrochloride; 5-Phenylaminomethyl-benzene-1,3-diamine hydrochloride;
5-(3-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; 4-Thiophen-3-yl-benzene- 1,3-diamine; hydrochloride; 2',4'-Diamino-biphenyl-4-oI;
hydrochloride;
5-Cyclobutylamino-2-methyl-phenol; 5-Cyclobutylamino-2-methyl-phenol; 4-Amino-2-(pyridin-3-ylaminomethyl)-phenol; 5-(3-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; 5-Allylaminomethyl-benzene-1,3-diamine hydrochloride; N-(4-Amino-benzyl)-benzene- 1,3-diamine hydrochloride; N-Benzyl-benzene-1,3-diamine hydrochloride;
3-[(3-Amino-phenylamino)-methyl]-phenol hydrochloride; N-(4-Methoxy-benzyl)-benzene-1,3-diamine hydrochloride; N-Thiophen-2-ylmethyl-benzene-1,3-diamine hydrochloride; 4-Amino-2-[(2-hydroxy-5-nitro-phenylamino)-methyl]-phenol; hydrochloride; 2',4'-Diamino-biphenyl-4-ol hydrochloride; Biphenyl-2,4,4'-triamine; 5-(4-Amino-phenyl)aminomethyl-benzene-1, 3 -diamine hydrochloride; 2-[4-Amino-2-(3,5 -diamino-benzylamino)-phenoxy] -ethanol hydrochloride;
5-Allylaminomethyl-benzene-1,3-diamine hydrochloride; 5-(3-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; N-(4-Amino-benzyl)-benzene-1,3-diamine hydrochloride;
N-Benzyl-benzene-1,3-diamine hydrochloride; 3 -[(3 -Amino-phenylamino)-methyl]
-phenol hydrochloride; N-(2-Amino-benzyl)-benzene-l,3-diamine hydrochloride; N-(4-Methoxy-benzyl)-benzene-1,3-diamine hydrochloride; N-Furan-2-ylmethyl-benzene-1,3-diamine hydrochloride; 2-[(3-Amino-phenylamino)-methyl]-phenol hydrochloride; N-Thiophen-2-ylmethyl-benzene-1,3-diamine hydrochloride; N-Benzo[1,3]dioxol-5-ylmethyl-benzene-1,3-diamine hydrochloride; N-[4-Amino-2-(2-hydroxy-ethyl)-2H-pyrazol-3-yl]-3-(5-amino-2-hydroxy-phenyl)-acrylamide hydrochloride; 4-Amino-2-propylaminomethyl-phenol;
hydrochloride; 4-Amino-2-(isopropylamino-methyl)-phenol hydrochloride; 4-Amino-2-[(2-hydroxy-5-nitro-phenylamino)-methyl]-phenol hydrochloride; 2-Methyl-5-[(1-H-pyrrol-2-ylmethyl)-amino]-phenol; 5-[(Furan-2-ylmethyl)-amino]-2-methyl-phenol; 5-Isopropylamino-2-methyl-phenol; 5-Cyclobutylamino-2-methyl-phenol; 4-Amino-2-(pyridin-3-ylaminomethyl)-phenol; and 5-Cyclobutylamino-2-methyl-phenol.
NHZ
NH2 xnHX (I), wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt.
Although the 1,4-diamino-2-methoxymethylbenzene of formula (I) is especially suitable for dyeing kertain fibers, in principle it would also be possible to dye other natural or synthetic fibers, especially cotton or nylon 66, with the 1,4-diarnino-2-methoxymethylbenzene of formula (I).
The compounds of formula (I) may be used alone or in combination with known developer substances and/or coupler substances.
Suitable couplers for use in the compositions described herein include, but are not limited to:
phenols, resorcinol and naphthol derivatives such as: naphthalene- 1,7-diol, benzene- 1,3-diol, 4-chlorobenzene-1,3-diol, naphthalen-l-ol, 2-methyl-naphthalen-l-ol, naphthalene- 1,5-diol, naphthalene-2,7-diol, benzene- 1,4-diol, 2-methyl-benzene-1,3-diol, 7-amino-4-hydroxy-naphthalene-2-sulfonic acid, 2-isopropyl-5-methylphenol, 1,2,3,4-tetrahydro-naphthalene-1,5-diol, 2-chloro-benzene-l,3-diol, 4-hydroxy-naphthalene-l-sulfonic acid, benzene-1,2,3-triol, naphthalene-2,3-diol, 5-dichloro-2-methylbenzene-1,3-diol, 4,6-dichlorobenzene-1,3-diol, 2,3-dihydroxy-[1,4]naphthoquinone; and 1-Acetoxy-2-methylnaphthalene; m-phenylenediamines such as: 2,4-diaminophenol, benzene-1,3-diamine, 2-(2,4-diamino-phenoxy)-ethanol, 2-[(3-amino-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, 2-mehyl-benzene-1,3-diamine, 2-[[2-(2,4-diamino-phenoxy)-ethyl]-(2-hydroxy-ethyl)-amino]-ethanol, 4-(3-[(2,4-diaminophenyl)oxy]-propoxy}benzene-1,3-diamine, 2-(2,4-diamino-phenyl)-ethanol, 2-(3-amino-4-methoxy-phenylamino)-ethanol, 4-(2-amino-ethoxy)-benzene-1,3-diamine, (2,4-diamino-phenoxy)-acetic acid, 2-[2,4-diamino-5-(2-hydroxy-ethoxy)-phenoxy]-ethanol, 4-ethoxy-6-methyl-benzene-1,3-diamine, 2-(2,4-diamino-5-methyl-phenoxy)-ethanol, 4,6-dimethoxy-benzene-1,3-diamine, 2-[3-(2-hydroxy-ethylamino)-2-methyl-phenylamino]-ethanol, 3-(2,4-diamino-phenoxy)-propan-l-ol, N-[3-(dimethylamino)phenyl]urea, 4-methoxy-6-methylbenzene-1,3-diamine, 4-fluoro-6-methylbenzene-1,3-diamine, 2-( {3-[(2-hydroxyethyl)amino]-4,6-dimethoxyphenyl}-amino)ethanol, 3-(2,4-diaminophenoxy)-propane-1,2-diol, 2-[2-amino-4-(methylamino)-phenoxy]ethanol, 2-[(5-amino-2-ethoxy-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, 2-[(3-aminophenyl)amino]ethanol, 2,4-Diamino-5-(2'-hydroxyethyloxy)toluene; N,N-Dimethyl-3-ureidoaniline; N-(2-aminoethyl)benzene-1,3-diamine, 4-{[(2,4-diamino-phenyl)oxy]methoxy}-benzene-1,3-diamine, 1-methyl-2,6-bis(2-hydroxyethylamino)benzene; and 2,4-dimethoxy-benzene- 1,3-diamine; m-aminophenols such as: 3-amino-phenol, 2-(3-hydroxy-4-methyl-phenylamino)-acetamide, 2-(3-hydroxy-phenylamino)-acetamide, 5-amino-2-methyl-phenol, 5-(2-hydroxyethylamino)-2-methyl-phenol, 5-amino-2,4-dichloro-phenol, 3-amino-2-methyl-phenol, 3-amino-2-chloro-6-methyl-phenol, 5-amino-2-(2-hydroxy-ethoxy)-phenol, 2-chloro-5-(2,2,2-trifluoro-ethylamino)-phenol, 5-amino-4-chloro-2-methyl-phenol, 3-cyclopentylamino-phenol, 5-[(2-hydroxyethyl)amino]-4-methoxy-2-methylphenol, 5-amino-4-methoxy-methylphenol, 3-(dimethylamino)phenol, 3-(diethylamino)phenol, 5-amino-4-fluoro-2-methylphenol, 5-amino-4-ethoxy-2-methylphenol, 3-amino-2,4-dichloro-phenol, 3-[(2-methoxyethyl)amino]phenol, 3-[(2-hydroxyethyl)amino]phenol, 5-amino-2-ethyl-phenol, 5-amino-2-methoxyphenol, 5-[(3-hydroxy-propyl)amino]-2-methylphenol, 3-[(3-hydroxy-2-methylphenyl)-amino]propane-1,2-diol, 3-[(2-hydroxyethyl)amino]-2-methylphenol; 1-Methyl-2-hydroxy-4-(2'-hydroxyethyl)amino-benzene; 1,3-Bis-(2,4-Diaminophenoxy)propane; 1-Hydroxy-2-methyl-5-amino-6-chlorobenzene; and heterocyclic derivatives such as: 3,4-dihydro-2H-1,4-benzoxazin-6-ol, 4-methyl-2-phenyl-2,4-dihydro-3H-pyrazol-3 -one, 6-methoxyquinolin-8-amine, 4-methylpyridine-2,6-diol, 2,3-dihydro-1,4-benzodioxin-5-ol, 1,3-benzodioxol-5-ol, 2-(1,3-benzodioxol-5-ylamino)ethanol, 3,4-dimethylpyridine-2,6-diol, 5-chloropyridine-2,3-diol, 2,6-dimethoxypyridine-3,5-diamine, 1,3-benzodioxol-5-amine, 2-{[3,5-diamino-6-(2-hydroxy-ethoxy)-pyridin-2-yl]oxy}-ethanol, 1H-indol-4-ol, 5-amino-2,6-dimethoxypyridin-3-ol, 1H-indole-5,6-diol, 1H-indol-7-ol, 1H-indol-5-ol, 1H-indol-6-ol, 6-bromo-1,3-benzodioxol-5-ol, 2-aminopyridin-3-ol, pyridine-2,6-diamine, 3-[(3,5-diaminopyridin-2-yl)oxy]propane-1,2-diol, 5-[(3,5-diaminopyridin-2-yl)oxy]pentane-1,3-diol, 1H-indole-2,3-dione, indoline-5,6-diol, 3,5-dimethoxypyridine-2,6-diamine, 6-methoxypyridine-2,3-diamine; 3,4-dihydro-2H-1,4-benzoxazin-6-amine; 4-hydroxy-N-methylindole, 1H-5-methylpyrazol-5-one, 1-phenyl-3-methylpyrazol-5-one, 2,6-dimethylpyrazolo[1,5-b]-1,2,4-triazole, 2,6-dimethyl[3,2-c]-1,2,4-triazole, 6-methylpyrazolo-[1,5-a]benzimidazole, 2,6-dihydroxypyridine, 2,6-dihydroxy-3,4-dimethylpyridine, 5-methylpyrazolo[5,1-e]-1,2,3-triazole, 5-methyl-6-chloropyrazolo[5,1-e]-1,2,3,-triazole, 5-phenylpyrazolo[5,1-e]-1,2,3-triazole and its addition salts, 1H-2,6-dimethylpyrazolo[1,5-b]-1,2,4-triazole tosylate, 7,8-dicyano-4-methylimidazolo-[3,2-a]imidazole, 2,7-dimethylpyrazolo [ 1, 5 -a]pyrimidin-5 -one, 2,5-dimethylpyrazolo[1,5-a]pyrimidin-7-one, and 2-methyl-5-methoxymethyl-pyrazolo[1,5-a]pyrimidin-7-one;
6-Hydroxybenzomorpholine; and 3-Amino-2-methylamino-6-methoxypyridine; 1-Phenyl-3-methyl-5-pyrazolone-2,4-dihydro-5,2-phenyl-3 H-pyrazole-3-one.
Preferred coupler substances include: N-(3-dimethylaminophenyl)urea, 2,6-diaminopyridine, 2-amino-4-[(2-hydroxyethyl)amino]anisole, 2,4-diamino-l-fluoro-5-methylbenzene, 2,4-diamino-l-methoxy-5-methylbenzene, 2,4-diamino-l-ethoxy-5-methylbenzene, 2,4-diamino-1-(2-hydroxyethoxy)-5-methylbenzene, 2,4-di-[(2-hydroxyethyl)amino]-1,5-dimethoxybenzene, 2,3-diamino-6-methoxypyridine, 3-amino-6-methoxy-2-(methylamino)-pyridine, 2,6-diamino-3,5-dimethoxypyridine, 3,5-diamino-2,6-dimethoxypyridine, 1,3-diaminobenzene, 2,4-diamino-1-(2-hydroxyethoxy)benzene, 2,4-diamino-l-(3-hydroxypropoxy)benzene, 1-(2-aminoethoxy)-2,4-diaminobenzene, 2-amiono-1-(2-hydroxyethoxy)-4-methylaminobenzene, 2,4-diaminophenoxyacetic acid, 3-[di(2-hydroxyethyl)-amino]aniline, 4-amino-2-di[(2-hydroxyethyl)amino]-1-ethoxybenzene, 5-methyl-2-(1-methylethyl)phenol, 3-[(2-hydroxyethyl)amino] aniline, 3-[(2-aminoethyl)amino]aniline, 1,3-di(2,4-diaminophenoxy)propane, di-(2,4-diaminophenoxy)methane, 1,3-diamino-2,4-dimethoxybenzene, 2,6-bis-(2-hydroxyethyl)aminotoluene, 4-hydroxyindol, 3-dimethylaminophenol, 3-diethylaminophenol, 5-amino-2-methylphenol, 5-amino-4-fluoro-2-methylphenol, 5-amino-4-methoxy-2-methylphenol, 5-amino-4-ethoxy-2-methylphenol, 3-amino-2,4-dichlorophenol, 5-amino-2,4-dichlorophenol, 3-amino-2-methylphenol, 3-amino-2-chloro-6-methyl-phenol, 3-amino-phenol, 2-[(3-hydroxyphenyl)amino]acetamide, 5-[(2-hydroxyethyl)amino]-2-methylphenol, 3-[(2-hydroxyethyl)amino]-phenol, 3-[(2-methoxy-ethyl)amino]-phenol, 5-amino-2-ethylphenol, 2-(4-amino-2-hydroxyphenoxy)-ethanol, 5-[(3-hydroxypropyl)amino]-2-methylphenol, 3-[(2,3-dihydroxypropyl)-amino]-2-methyl-phenol, 3-[(2-hydroxyethyl)amino]-2-methylphenol, 2-amino-3-hydroxypyridine, 5-amino-4-chloro-2-methylphenol, 1-naphthol, 1,5-dihydroxy-naphthalene, 1,7-dihydroxy-naphthalene, 2,3-dihydroxynaphthalene, 2,7-dihydroxynaphthalene, 2-methyl-l-naphthol acetate, 1,3-dihydroxy-benzene, 1-chloro-2,4-dihydroxybenzene, 2-chloro-1,3-dihydroxybenzene, 1,2-dichloro-3,5-dihydroxy-4-methylbenzene, 1,5-dichloro-2,4-dihydroxybenzene, 1,3-dihydroxy-2-methylbenzene, 3,4-methylenedioxyphenol, 3,4-methylenedioxy-aniline, 5-[(2-hydroxyethyl)amino]-1,3-benzodioxole, 6-bromo-l-hydroxy-3,4-methylendioxybenzene, 3,4-diaminobenzoic acid, 3,4-dihydro-6-hydroxy-1,4(2H)-benzoxazine, 6-amino-3,4-dihydro-1,4(2H)-benzoxazine, 3-methyl-l-phenyl-5-pyrazolone, 5,6-dihydroxyindole, 5,6-dihydroxyindoline, 5-hydroxy-indole, 6-hydroxyindole, 7-hydroxy-indole and 5 2,3-indolindione, or their salts.
To produce natural shades and fashionable red tones it is advantageous to use the compounds of formula (I) in combination with additional developer substances, such as p-phenylenediamine derivatives, e.g. benzene-l,4-diamine (commonly known as p-phenylenediamine), 2-methyl-benzene- 1,4-diamine, 2-chloro-benzene-1,4-diamine, N-phenyl-benzene-1,4-diamine, N-(2-ethoxyethyl)benzene-1,4-diamine, 2-[(4-amino-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, (commonly known as N,N-bis(2-hydroxyethyl)-p-phenylenediamine) (2,5-diamino-phenyl)-methanol, 1-(2'-Hydroxyethyl)-2,5-diaminobenzene, 2-(2,5-diamino-phenyl)-ethanol, N-(4-aminophenyl)benzene-1,4-diamine, 2,6-dimethyl-benzene-1,4-diamine, 2-isopropyl-benzene-1,4-diamine, 1-[(4-aminophenyl)amino]-propan-2-ol, 2-propyl-benzene-1,4-diamine, 1,3-bis[(4-aminophenyl)(2-hydroxyethyl)amino]propan-2-ol, N4,N4,2-trimethylbenzene-1,4-diamine, 2-methoxy-benzene-1,4-diamine, 1-(2,5-diaminophenyl)ethane-1,2-diol, 2,3-dimethyl-benzene-1,4-diamine, N-(4-amino-3-hydroxy-phenyl)-acetamide, 2,6-diethylbenzene-1,4-diamine, 2,5-dimethylbenzene-1,4-diamine, 2-thien-2-ylbenzene-1,4-diamine, 2-thien-3-ylbenzene-1,4-diamine, 2-pyridin-3-ylbenzene-1,4-diamine, 1,1'-biphenyl-2,5-diamine, 2-(methoxymethyl)-benzene- 1,4-diamine, 2-(aminomethyl)benzene-1,4-diamine, 2-(2,5-diaminophenoxy)ethanol, N-[2-(2,5-diaminophenoxy)ethyl]-acetamide, N,N-dimethylbenzene-1,4-diamine, N,N-diethylbenzene-1,4-diamine, N,N-dipropylbenzene-1,4-diamine, 2-[(4-aminophenyl)-(ethyl)amino]ethanol, 2-[(4-amino-3-methyl-phenyl)-(2-hydroxy-ethyl)-amino]-ethanol, N-(2-methoxyethyl)-benzene-1,4-diamine, 3-[(4-aminophenyl)amino]propan-l-ol, 3-[(4-aminophenyl)-amino]propane-1,2-diol, N-{4-[(4-aminophenyl)amino]butyl}benzene-1,4-diamine, and 2-[2-(2- {2-[(2,5-diaminophenyl)-oxy]ethoxy}
ethoxy)ethoxy]benzene-1,4-diamine;
1,3-Bis(N(2-Hydroxyethyl)-N-(4-amino-phenyl)amino)-2-propanol; 2,2'-[ 1,2-Ethanediyl-bis-(oxy-2,1-ethanediyloxy)]-bis-benzene-1,4-diamine; N,N-Bis(2-hydroxyethyl)-p-phenylinediamine; p-aminophenol derivatives such as: 4-amino-phenol (commonly known as p-aminophenol), 4-methylamino-phenol, 4-amino-3-methyl-phenol, 4-amino-2-hydroxymethyl-phenol, 4-amino-2-methyl-phenol, 4-amino-l-hydroxy-2-(2'-hydroxyethylaminomethyl)benzene, 4-amino-2-methoxymethyl-phenol, 5-amino-2-hydroxy-benzoic acid, 1-(5-amino-2-hydroxy-phenyl)-ethane-1,2-diol, 4-amino-2-(2-hydroxy-ethyl)-phenol, 4-amino-3-(hydroxymethyl)-phenol, 4-amino-3-fluoro-phenol, 4-amino-2-(aminomethyl)-phenol, 4-amino-2-fluoro-phenol;
1-Hydroxy-2,4-diaminobenzene; 1-(2'-Hydroxyethyloxy)-2,4-diaminobenzene; 2,4-Diamino-5-methylphenetol; o-phenylenediamine derivatives such as: 3,4-Diaminobenzoic acid and salts thereof; o-aminophenol derivatives such as: 2-amino-phenol (commonly known as o-aminophenol), 2,4-diaminophenol, 2-amino-5-methyl-phenol, 2-amino-6-methyl-phenol, N-(4-amino-3-hydroxy-phenyl)-acetamide, and 2-amino-4-methyl-phenol; and heterocyclic derivatives such as: pyrimidine-2,4,5,6-tetramine (commonly known as 2,4,5,6-tetraamino-pyridine), 1-methyl-lH-pyrazole-4,5-diamine, 2-(4,5-diamino-lH-pyrazol-1-yl)ethanol, NZ,Nz-dimethyl-pyridine-2,5-diamine, 2-[(3-amino-6-methoxypyridin-2-yl)amino]ethanol, 6-methoxy-N2 -methyl-pyridine-2,3-diamine, 2,5,6-triaminopyrimidin-4(1 H)-one, pyridine-2,5-diamine, 1-isopropyl-lH-pyrazole-4,5-diamine, 1-(4-methylbenzyl)-1H-pyrazole-4,5-diamine, 1-(benzyl)-1H-pyrazole-4,5-diamine, 1-(4-chlorobenzyl)-1H-pyrazole-4,5-diamine, pyrazolo[1,5-a]-pyrimidine-3,7-diamine, 5,6,7-trimethylpyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 7-methylpyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 2,5,6,7-teramethyl-pyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 5,7-di-tert-butylpyrazolo[1,5-a]pyrimidin-3-ylamine hydrochloride, 5,7-di-trifluoromethyl-pyrazolo[ 1,5-a]pyrimidin-3-ylamine hydrochloride, 2-methylpyrazolo[1,5-a]pyrimidin-3,7-diamine hydrochloride; 4-hydroxy-2,5,6-triaminopyrimidine; 1-(2'hydroxyethyl)-amino-3,4-methylene dioxybenzene; and 1-hydroxyethyl-4,5-diaminopyrazole sulphate.
Additional developers include: N-(3-furylmethyl)benzene-1,4-diamine; N-Thiophen-3-ylmethyl-benzene- 1,4-diamine; N-(2-furylmethyl)benzene-1,4-diamine; N-Thiophen-2-ylmethyl-benzene-1,4-diamine; 4-Hydroxy-benzoic acid (2,5-diamino-benzylidene)-hydrazide; 3-(2,5-Diamino-phenyl)-N-ethyl-acrylamide; 2- [3 -(3 -Amino-phenylamino)-propenyl] -benzene-1,4-diamine;
2- [ 3 -(4-Amino-phenylamino)-propenyl] -benzene- 1,4-diamine; 2-(6-Methyl-pyridin-2-yl)-benzene- 1,4-diamine; 2-Pyridin-2-yl-benzene-1,4-diamine; 2-[3-(4-Amino-phenylamino)-propenyl] -benzene- 1,4-diamine; 2- [3 -(3 -Amino-phenylamino)-propenyl] -benzene- 1,4-diamine;
3-(2,5-Diamino-phenyl)-N-ethyl-acrylamide; 2-Thiazol-2-yl-benzene-1,4-diamine;
4-Hydroxy-benzoic acid (2,5-diamino-benzylidene)-hydrazide; 3'-Fluoro-biphenyl-2,5-diamine; 2-Propenyl-benzene- 1,4-diamine; 2'-Chloro-biphenyl-2,5-diamine; N-Thiophen-3-ylmethyl-benzene-1,4-diamine; N-(3-furylmethyl)benzene-1,4-diamine; 4'-Methoxy-biphenyl-2,5-diamine; N-(4-Amino-benzyl)-benzene-1,4-diamine; 2-Methyl-5 - [(1 -H-pyrrol-2-ylmethyl)-amino] -phenol;
5-[(Furan-2-ylmethyl)-amino]-2-methyl-phenol; 5-Isopropylamino-2-methyl-phenol; Biphenyl-2,4,4'-triamine hydrochloride; 5-(4-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; 5-Phenylaminomethyl-benzene-1,3-diamine hydrochloride; 2-[4-Amino-2-(3,5-diamino-benzylamino)-phenoxy]-ethanol hydrochloride; 5-(3-Amino-phenyl)aminomethyl-benzene- 1,3-diamine hydrochloride; N-(2-Amino-benzyl)-benzene-1,3-diamine hydrochloride;
N-Furan-2-ylmethyl-benzene-1,3-diamine hydrochloride; 2-[(3-Amino-phenylamino)-methyl]-phenol hydrochloride; 4-Amino-2-propylaminomethyl-phenol; hydrochloride;
N-Benzo[1,3]dioxol-5-ylmethyl-benzene-1,3-diamine hydrochloride; N-[4-Amino-2-(2-hydroxy-ethyl)-2H-pyrazol-3-yl]-3-(5-amino-2-hydroxy-phenyl)-acrylamide;
hydrochloride; 4-Amino-2-(isopropylamino-methyl)-phenol; hydrochloride; 4-Thiophen-3-yl-benzene-l,3-diamine;
hydrochloride hydrochloride; 5-Phenylaminomethyl-benzene-1,3-diamine hydrochloride;
5-(3-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; 4-Thiophen-3-yl-benzene- 1,3-diamine; hydrochloride; 2',4'-Diamino-biphenyl-4-oI;
hydrochloride;
5-Cyclobutylamino-2-methyl-phenol; 5-Cyclobutylamino-2-methyl-phenol; 4-Amino-2-(pyridin-3-ylaminomethyl)-phenol; 5-(3-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; 5-Allylaminomethyl-benzene-1,3-diamine hydrochloride; N-(4-Amino-benzyl)-benzene- 1,3-diamine hydrochloride; N-Benzyl-benzene-1,3-diamine hydrochloride;
3-[(3-Amino-phenylamino)-methyl]-phenol hydrochloride; N-(4-Methoxy-benzyl)-benzene-1,3-diamine hydrochloride; N-Thiophen-2-ylmethyl-benzene-1,3-diamine hydrochloride; 4-Amino-2-[(2-hydroxy-5-nitro-phenylamino)-methyl]-phenol; hydrochloride; 2',4'-Diamino-biphenyl-4-ol hydrochloride; Biphenyl-2,4,4'-triamine; 5-(4-Amino-phenyl)aminomethyl-benzene-1, 3 -diamine hydrochloride; 2-[4-Amino-2-(3,5 -diamino-benzylamino)-phenoxy] -ethanol hydrochloride;
5-Allylaminomethyl-benzene-1,3-diamine hydrochloride; 5-(3-Amino-phenyl)aminomethyl-benzene-1,3-diamine hydrochloride; N-(4-Amino-benzyl)-benzene-1,3-diamine hydrochloride;
N-Benzyl-benzene-1,3-diamine hydrochloride; 3 -[(3 -Amino-phenylamino)-methyl]
-phenol hydrochloride; N-(2-Amino-benzyl)-benzene-l,3-diamine hydrochloride; N-(4-Methoxy-benzyl)-benzene-1,3-diamine hydrochloride; N-Furan-2-ylmethyl-benzene-1,3-diamine hydrochloride; 2-[(3-Amino-phenylamino)-methyl]-phenol hydrochloride; N-Thiophen-2-ylmethyl-benzene-1,3-diamine hydrochloride; N-Benzo[1,3]dioxol-5-ylmethyl-benzene-1,3-diamine hydrochloride; N-[4-Amino-2-(2-hydroxy-ethyl)-2H-pyrazol-3-yl]-3-(5-amino-2-hydroxy-phenyl)-acrylamide hydrochloride; 4-Amino-2-propylaminomethyl-phenol;
hydrochloride; 4-Amino-2-(isopropylamino-methyl)-phenol hydrochloride; 4-Amino-2-[(2-hydroxy-5-nitro-phenylamino)-methyl]-phenol hydrochloride; 2-Methyl-5-[(1-H-pyrrol-2-ylmethyl)-amino]-phenol; 5-[(Furan-2-ylmethyl)-amino]-2-methyl-phenol; 5-Isopropylamino-2-methyl-phenol; 5-Cyclobutylamino-2-methyl-phenol; 4-Amino-2-(pyridin-3-ylaminomethyl)-phenol; and 5-Cyclobutylamino-2-methyl-phenol.
The following compounds are especially suitable as developer compounds: 1,4-diamino-2,6-dimethylbenzene, 1,4-diamino-2,5-dimethylbenzene, 1,4-diamino-2,3-dimethylbenzene, 2-chloro-1,4-diaminobenzene, 4-phenylaminoaniline, 4-dimethylaminoaniline, 4-diethylamino-aniline, 4-[di(2-hydroxyethyl)amino]aniline, 4-[(2-methoxyethyl)amino] -aniline, 4-[(3-hydroxypropyl)amino]aniline, 1,4-diamino-2-(2-hydroxyethyl)benzene, 1,4-diamino-2-(1-methylethyl)benzene, 1,3-bis-[(4-aminophenyl)-(2-hydroxyethyl)amino]-2-propanol, 1,8-bis-(2,5-diaminophenoxy)-3,6-dioxaoctane, 4-aminophenol, 4-amino-3-methylphenol, 4-methyl-aminophenol, 4-amino-2-(aminomethyl)phenol, 4-amino-2-[(2-hydroxyethyl)amino]-methylphenol, 4-amino-2-(methoxymethyl)phenol, 4-amino-2-(2-hydroxyethyl)phenol, 5-amino-salicylic acid, 2,5-diaminopyridine, 2,4,5,6-tetraamino-pyrimidine, 2,5,6-triamino-4-(1H)-pyrimidone, 4,5-diamino-l-(2-hydroxyethyl)-1H-pyrazole, 4,5-diamino-l-(1-methylethyl)-1H-pyrazole, 4,5-diamino-l-[(4-methylphenyl)-methyl]-1H-pyrazole, 1-[(4-chlorophenyl)methyl]-4,5-diamino-lH-pyrazole, 4,5-diamino-l-methyl-lH-pyrazole, 4,5-diamino-3-methyl-l-phenyl-1H-pyrazole, 4,5-diamino-l-(2-hydroxyethyl)-3-methyl-lH-pyrazole, 2-amino-phenol, 2-amino-6-methylphenol and 2-amino-5-methyl-phenol, or their salts.
The hair dye compositions of the present invention will generally comprise from about 0.001% to about 15% by weight of dye precursors. For example compositions providing low intensity dyeing such as natural blond to light brown hair shades generally comprise from about 0.001% to about 7% by weight, preferably from about 0.1% to about 5% by weight, more preferably from about 0.2% to about 2% by weight of dyeing composition of precursors and couplers. Darker shades such as browns and black typically comprise from 0.00 1% to about 15%
by weight, preferably from about 0.05% to about 10% by weight, more preferably form about 1% to about 5% by weight of precursors and couplers.
The developer substances and coupler substances are generally used in approximately equimolar amounts; however, it is not disadvantageous if the developer substances are present in this regard in a certain excess or deficit, for example a coupler:developer ratio of 1:3 to 1:0.3.
The hair colouring compositions of the present invention are preferably hair colouring compositions which comprise oxidative dyeing compositions. Such compositions comprise oxidative hair dye precursors (also known as primary intermediates) that will deliver a variety of hair colors to the hair. These small molecules are activated by the oxidizing agent and react with further molecules to form a larger colored complex in the hair shaft. The precursors may be used alone or in combination with other precursors, and one or more may be used in combination with one or more couplers. Couplers (also known as color modifiers or secondary intermediates) are generally colorless molecules that can form colors in the presence of activated precursors, and are used with other precursors or couplers to generate specific color effects or to stabilize the color. The choice of precursors and couplers will be determined by the color, shade and intensity of coloration that is desired. The precursors and couplers may be used herein, singly or in combination, to provide dyes having a variety of shades ranging from ash blonde to black.
Nevertheless the hair colouring compositions of the present invention comprising at least one compound of formula (I) may also include non-oxidative hair dyes (i.e. direct dyes) which may be used alone or in combination with the above described oxidative dyes.
Suitable direct dyes include: direct-dyeing anionic, cationic or non-ionic dye compounds.
The following are preferred examples of anionic direct-dyeing dye compounds for use in the compositions of the invention: 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalene sulfonic acid disodium salt (C.I. 15985; Food Yellow No. 3; FD&C Yellow No. 6), 2,4-dinitro-l-naphthol-7-sulfonic acid disodium salt (C.I.10316; Acid Yellow No. 1; Food Yellow No. 1), 2-(indan-1,3-dion-2-yl)quinoline-x,x-sulfonic acid (mixture of mono- and disolfuonic acid) (C.I.47005;D&C
Yellow No. 10; Food Yellow No. 13, Acid Yellow No. 3), 5-hydroxy-l-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]pyrazole-3-carboxylic acid sodium salt (C.I. 19140; Food Yellow No. 4; Acid Yellow No. 23), 9-(2-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one (C.I.45350;
Acid Yellow No. 73; D&C Yellow No. 8), 5-[(2,4-dinitrophenyl)amino]-2-phenylaminobenzenesulfonic acid sodium salt (C.I. 10385; Acid Orange No. 3), 4-[(2,4-dihydroxyphenyl)azo] -benzene sulfonic acid monosodium salt (C.I.14270; Acid Orange No. 6), 4-[(2-hydroxynaphth-1-yl)azo]benzenesulfonic acid sodium salt (C.I. 15510; Acid Orange No. 7), 4-[(2,4-dihydroxy-3-[(2,4-dimethylphenyl)azo]phenyl)azo]-benzene sulfonic acid sodium salt (C.I.20170; Acid Orange No. 24), 4-hydroxy-3-[(4-sulfonaphth-l-yl)azo]-1-naphthalene sulfonic acid disodium salt (C.I. 14720; Acid Red No. 14), 6-hydroxy-5-[(4-sulfonaphth-l-yl)azo]-2,4-naphthalene-disulfonic acid trisodium salt (C.I. 16255; Ponceau 4R; Acid Red No. 18), 3-hydroxy-4-[(4-sulfonaphth-1-yl)azo]-2,7-naphthalene-disulfonic acid trisodium salt (C.I.
16185; Acid Red No.
27), 8-amino-1 -hydroxy-2-(phenylazo)-3,6-naphthalene disulfonic acid disodium salt (C.I.17200; Acid Red No. 33), 5-(acetylamino)-4-hydroxy-3-[(2-methylphenyl)azo]-2,7-naphthalene disulfonic acid disodium salt (C.I.18065; Acid Red No. 35), 2-(3-hydroxy-2,4,5,7-tetraiodo-dibenzopyran-6-on-9-yl)-benzene sulfonic acid disodium salt (C.I.
45430; Acid Red No. 51), N-[6-(diethylamino)-9-(2,4-disulfophenyl)-3H-xanthen-3-yliden]-N-ethylethanaminium hydroxide, inner Salt, sodium salt (C.I.45100; Acid Red No. 52), 8-[(4-(phenylazo)phenyl)azo]-7-naphthol-1,3-disulfonic acid disodium salt (C.I. 27290; Acid Red No. 73), 2',4',5',7'-tetrabromo-3',6'-dihydroxyspiro[isobenzofuran-l-(3H),9'-[9H]xanthen]-3-one disodium salt (C.I.45380; Acid Red No. 87), 2',4',5',7'-tetrabromo-4,5,6,7-tetrachloro-3',6'-5 dihydroxyspiro[isobenzofuran-1(3H),9'[9H]xanthen]-3-one disodium salt (C.I.
45410; Acid Red No. 92), 3',6'-dihydroxy-4',5'-diiodospiro[isobenzofuran-1(3H),9'(9H)-xanthen)-3-one disodium salt (C.I. 45425; Acid Red No. 95), (2-sulfophenyl)-di-[4-(ethyl-((4-sulfophenyl)methyl)-amino)phenyl]carbenium disodium salt, betaine (C.I. 42090; Acid Blue No.9;
FD&C Blue No.1), 1,4-bis-[(2-sulfo-4-methyl-phenyl)amino]-9,10-anthraquinone disodium salt (C.I. 61570; Acid 10 Green No. 25), bis-[4-(dimethylamino)phenyl]-(3,7-disulfo-2-hydroxynaphth-1-yl)carbenium inner salt, monosodium salt (C.I. 44090; Food Green No. 4; Acid Green No. 50), bis-[4-(diethylamino)phenyl](2,4-disulfophenyl)carbenium inner salt, sodium salt (2:1) (C.I. 42045;
Food Blue No. 3; Acid Blue No. 1), bis[4-(diethylamino)phenyl]-(5-hydroxy-2,4-disulfophenyl)carbenium inner salt, calcium salt (2:1) (C.I. 42051; Acid Blue No. 3), 1 -amino-4-(cyclohexylamino)-9,10-anthraquinone-2-sulfonic acid sodium salt (C.I. 62045;
Acid Blue No.
62), 2-(1,3-dihydro-3-oxo-5-sulfo-2H-indol-2-yliden)-2,3-dihydro-3-oxo-lH-indol-5-sulfonic acid disodium salt (C.I. 73015; Acid Blue No. 74), 9-(2-carboxyphenyl)-3-[(2-methylphenyl)-amino] 6-[(2-methyl-4-sulfophenyl)amino]xanthylium inner salt, monosodium salt (C.I. 45190;
Acid Violet No. 9), 1 -hydroxy-4-[(4-methyl-2-sulfophenyl)amino]-9,1 0-anthraquinone sodium salt (C.I. 60730; D&C Violet No. 2; Acid Violet No. 43), bis-[3-nitro-4-[(4-phenylamino)-3-sulfophenylami no]phenyl]-sulfone (C.I. 10410; Acid Brown No. 13), 5-amino-4-hydroxy-6-[(4-nitrophenyl)azo]3-(phenylazo)-2,7-naphthalene disulfonic acid disodium salt (C.I.20470; Acid Black No. 1), 3-hydroxy-4-[(2-hydroxynaphth-l-yl)azo]-7-nitronaphthalenesulfonic acid chromium complex (3:2) (C.I. 15711; Acid Black No. 52), 3-[(2,4-dimethyl-5-sulfophenyl)azo]-4-hydroxy-l-naphthalene-sulfonic acid disodium salt (C.I. 14700; Food Red No.
1; Ponceau SX;
FD&C Red No. 4), 4-(acetylamino)-5-hydroxy-6-[(7-sulfo-4-[(4-sulfophenyl)azo]naphth-1 yl)azo]-1,7-naphthalene disulfonic acid tetrasodium salt (C.I. 28440; Food Black No. 1), 3-hydroxy-4-(3-methyl-5-oxo-l-phenyl-4,5-dihydro-1 H-pyrazole-4-yl-azo)-naphthalene-l-sulfonic acid sodium salt chromium complex (Acid Red No. 195).
The following are preferred cationic direct-dyeing dye compounds: 9-(dimethylamino)-benzo[a]phenoxazin-7-ium chloride (C.I. 51175; Basic Blue No. 6), di[4-(diethylamino)phenyl]-[4-(ethylamino)naphthyl]carbenium chloride (C.I. 42595; Basic Blue No. 7), 3,7-di(dimethylamino)phenothiazin-5-ium chloride (C.I. 52015; Basic Blue No.
9), di[4-dimethylamino)phenyl][4(phenylamino)naphthyl]carbenium chloride (C.I. 44045;
Basic Blue No. 26), 2-[(4-(ethyl(2-hydroxyethyl )amino)phenyl )azo]-6-methoxy-3-methylbenzothiazol ium methylsulfate (C.I. 11154; Basic Blue No. 41), 8-amino-2-bromo-5-hydroxy-4-imino-6-[(3-(trimethylammonio)phenyl)amino]-1 (4H)naphthalenone chloride (C.I.56059; Basic Blue No.
99), bis-[4-(dimethylamino)phenyl][4-(methylamino)phenyl]carbenium chloride (C.I. 42535;
Basic Violet No. 1), tris-(4-amino-3-methylphenyl)carbenium chloride (C.I. 425 20; Basic Violet No. 2), tris-[4-(dimethylamino)phenyl]carbenium chloride (C.I. 42555; Basic Violet No. 3), 2-[3,6-(diethylamino)dibenzopyranium-9-yl]benzoic acid chloride (C.I. 45170;
Basic Violet No.
10), di(4-aminophenyl)(4-amino-3-methylphenyl)carbenium chloride (C.I. 42510;
Basic Violet No. 14), 1,3-bis[(2,4-diamino-5-methylphenyl)azo]-3-methylbenzene (C.I.
21010;Basic Brown No. 4), 1-[(4-aminophenyl)azo]-7-(trimethylammonio)-2-naphthol chloride (C.I.
12250; Basic Brown No. 16), 1-[(4-amino-2-nitrophenyl)azo]-7-(trimethylammonio)-2-naphthol chloride (C.I.
12251; Basic Brown No.17), 1-[(4-amino-3-nitrophenyl)azo]-7-(trimethylammonio)-2-naphthol chloride (C.I. 12251; Basic Brown No. 17), 3,7-diamino-2,8-dimethyl-5-phenylphenazinium chloride (C.I. 50240; Basic Red No. 2), 1,4-dimethyl-5-[(4(dimethylamino)phenyl)azo]-1,2,4-triazolium chloride (C.I. 11055; Basic Red No. 22), 2-hydroxy-l-[(2-methoxyphenyl)azo]-7-(trimethylammonio)naphthalene chloride (C.I. 12245; Basic Red No. 76), 2-[2-((2,4-dimethoxyphenyl)amino)ethenyl]-1,3,3-trimethyl-3H-indol-l-ium-chloride (C.I.
48055; Basic Yellow No. 11), 3-methyl-l-phenyl-4-[(3-(trimethylammonio)phenyl)azo]-pyrazole-5-one chloride (C.I. 12719; Basic Yellow No. 57), bis-[4-(diethylamino)phenyl]phenylcarbenium hydrogen sulfate(1:1) (C.I. 42040; Basic Green No. 1).
To improve the color balance and to produce special shades the following nonionic direct-dyeing dye compounds have proven to be useful in the compositions according to the invention:
1-amino-2-[(2-hydroxyethyl)amino]-5-nitrobenzene (HC Yellow No. 5), 1-(2-hydroxyethoxy)-2-[(2-hydroxyethyl)amino]-5-nitrobenzene (HC Yellow No. 4), 1-[(2-hydroxyethyl)amino]-2-nitrobenzene (HC Yellow No. 2), 2-[(2-hydroxyethyl)amino]-1-methoxy-5-nitrobenzene, 2-amino-3-nitrophenol, 1-(2-hydroxyethoxy)-3-methylamino-4-nitrobenzene, 2,3-(dihydroxy-propoxy)-3-methylamino-4-nitrobenzene, 2-[(2-hydroxyethyl)amino]-5-nitrophenol (HC Yellow No. 11), 3-[(2-aminoethyl)amino]-1-methoxy-4-nitrobenzene hydrochloride (HC
Yellow No.9), 1-[(2-ureidoethyl)amino]-4-nitrobenzene, 4-[(2,3-dihydroxypropyl )amino]-3-nitro-l-trifluoromethylbenzene (HC Yellow No. 6), 1-chloro-2,4-bis-[(2-hydroxyethyl)amino]-5-nitrobenzene (HC Yellow No. 10), 4-[(2-hydroxyethyl)amino]-3-nitro-l-methylbenzene, 1-chloro-4-[(2-hydroxyethyl)amino]-3-nitrobenzene (HC Yellow No. 12), 4-[(2-hydroxyethyl)-amino]-3-nitro-l-trifluoromethylbenzene (HC Yellow No. 13), 4-[(2-hydroxyethyl)amino]-3-nitrobenzonitrile (HC Yellow No. 14), 4-[(2-hydroxyethyl)amino]-3-nitrobenzamide (HC
Yellow No. 15), 1-amino-4-[(2-hydroxyethyl)amino]-2-nitrobenzene (HC Red No.
7), 2-amino-4,6-dinitrophenol, 2-ethylamino-4,6-dinitrophenol, 4-amino-2-nitrodiphenylamine (HC Red No.
1), 1-amino-4-[di(2-hydroxyethyl)amino]-2-nitrobenzene hydrochloride (HC Red No. 13), 1-amino-5-chloro-4-[(2hydroxyethyl)amino]-2-nitrobenzene, 4-amino-l-[(2-hydroxyethyl)-amino] -2-nitrobenzene (HC Red No. 3), 4-amino-3-nitrophenol, 4-[(2-hydroxyethyl)amino]-3-nitrophenol, 1-[(2-aminoethyl)amino]4-(2-hydroxyethoxy)-2-nitrobenzene (HC
Orange No. 2), 4-(2,3-dihydroxypropoxy)-1-[(2-hydroxyethyl)amino]-2-nitrobenzene (HC Orange No. 3), 1-amino-5-chloro-4-[(2,3-dihydroxypropyl)amino]-2-nitrobenzene (HC Red No.
10), 5-chloro-1,4-[di(2,3-dihydroxypropyl)amino]-2-nitrobenzene (HC Red No. 11), 2-[(2-hydroxyethyl)-amino]4,6-dinitrophenol, 4-ethylamino-3-nitrobenzoic acid, 2-[(4-amino-2-nitrophenyl)amino]-benzoic acid, 2-chloro-6-methylamino-4-nitrophenol2-chloro-6-[(2-hydroxyethyl)amino]4-nitrophenol, 2-chloro-6-ethylamino-4-nitrophenol, 2-amino-6-chloro-4-nitrophenol, 4-[(3-hydroxypropyl )-amino]-3-nitrophenol, 2,5-diamino-6-nitropyridine, 1,2,3,4-tetrahydro-6-nitrochinoxalin, 7-amino-3,4-dihydro-6-nitro-2H-1,4-benzoxazine (HC Red No.
14),1,4-bis-[(2-hydroxyethyl )-amino]-2-nitrobenzene, 1-(2-hydroxyethyl )ami no-2-nitro-4-[di(2-hydroxyethyl)amino]benzene (HC Blue No. 2), 1-amino-3-methyl-4-[(2-hydroxyethyl)amino]-6-nitrobenzene (HC Violet No. 1), 4-[ethyl-(2-hydroxyethyl)amino]- 1 -[(2-hydroxyethyl)amino]-2-nitrobenzene hydrochloride (HC Blue No. 12), 4-[di(2-hydroxyethyl)amino]-1-[(2-methoxyethyl )amino] -2-nitrobenzene (HC Blue No. 11), 1-[(2,3-dihydroxy-propyl)amino]4-[methyl-(2-hydroxyethyl)amino]-2-nitrobenzene (HC Blue No. 10), 1-[(2,3-dihydroxypropyl)amino]4-[ethyl-(2-hydroxyethyl)amino]-2-nitrobenzene hydrochloride (HC Blue No. 9), 1-(3-hydroxypropylamino)-4-[di(2-hydroxyethyl)amino]-2-nitrobenzene (HC Violet No. 2), 1-methylamino-4-[methyl-(2,3-dihydroxypropyl)amino]-2nitrobenzene (HC Blue No.
6), 2-((4-amino-2-nitrophenyl)amino)-5-dimethylamino-benzoic acid (HC Blue No.
The hair dye compositions of the present invention will generally comprise from about 0.001% to about 15% by weight of dye precursors. For example compositions providing low intensity dyeing such as natural blond to light brown hair shades generally comprise from about 0.001% to about 7% by weight, preferably from about 0.1% to about 5% by weight, more preferably from about 0.2% to about 2% by weight of dyeing composition of precursors and couplers. Darker shades such as browns and black typically comprise from 0.00 1% to about 15%
by weight, preferably from about 0.05% to about 10% by weight, more preferably form about 1% to about 5% by weight of precursors and couplers.
The developer substances and coupler substances are generally used in approximately equimolar amounts; however, it is not disadvantageous if the developer substances are present in this regard in a certain excess or deficit, for example a coupler:developer ratio of 1:3 to 1:0.3.
The hair colouring compositions of the present invention are preferably hair colouring compositions which comprise oxidative dyeing compositions. Such compositions comprise oxidative hair dye precursors (also known as primary intermediates) that will deliver a variety of hair colors to the hair. These small molecules are activated by the oxidizing agent and react with further molecules to form a larger colored complex in the hair shaft. The precursors may be used alone or in combination with other precursors, and one or more may be used in combination with one or more couplers. Couplers (also known as color modifiers or secondary intermediates) are generally colorless molecules that can form colors in the presence of activated precursors, and are used with other precursors or couplers to generate specific color effects or to stabilize the color. The choice of precursors and couplers will be determined by the color, shade and intensity of coloration that is desired. The precursors and couplers may be used herein, singly or in combination, to provide dyes having a variety of shades ranging from ash blonde to black.
Nevertheless the hair colouring compositions of the present invention comprising at least one compound of formula (I) may also include non-oxidative hair dyes (i.e. direct dyes) which may be used alone or in combination with the above described oxidative dyes.
Suitable direct dyes include: direct-dyeing anionic, cationic or non-ionic dye compounds.
The following are preferred examples of anionic direct-dyeing dye compounds for use in the compositions of the invention: 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalene sulfonic acid disodium salt (C.I. 15985; Food Yellow No. 3; FD&C Yellow No. 6), 2,4-dinitro-l-naphthol-7-sulfonic acid disodium salt (C.I.10316; Acid Yellow No. 1; Food Yellow No. 1), 2-(indan-1,3-dion-2-yl)quinoline-x,x-sulfonic acid (mixture of mono- and disolfuonic acid) (C.I.47005;D&C
Yellow No. 10; Food Yellow No. 13, Acid Yellow No. 3), 5-hydroxy-l-(4-sulfophenyl)-4-[(4-sulfophenyl)azo]pyrazole-3-carboxylic acid sodium salt (C.I. 19140; Food Yellow No. 4; Acid Yellow No. 23), 9-(2-carboxyphenyl)-6-hydroxy-3H-xanthen-3-one (C.I.45350;
Acid Yellow No. 73; D&C Yellow No. 8), 5-[(2,4-dinitrophenyl)amino]-2-phenylaminobenzenesulfonic acid sodium salt (C.I. 10385; Acid Orange No. 3), 4-[(2,4-dihydroxyphenyl)azo] -benzene sulfonic acid monosodium salt (C.I.14270; Acid Orange No. 6), 4-[(2-hydroxynaphth-1-yl)azo]benzenesulfonic acid sodium salt (C.I. 15510; Acid Orange No. 7), 4-[(2,4-dihydroxy-3-[(2,4-dimethylphenyl)azo]phenyl)azo]-benzene sulfonic acid sodium salt (C.I.20170; Acid Orange No. 24), 4-hydroxy-3-[(4-sulfonaphth-l-yl)azo]-1-naphthalene sulfonic acid disodium salt (C.I. 14720; Acid Red No. 14), 6-hydroxy-5-[(4-sulfonaphth-l-yl)azo]-2,4-naphthalene-disulfonic acid trisodium salt (C.I. 16255; Ponceau 4R; Acid Red No. 18), 3-hydroxy-4-[(4-sulfonaphth-1-yl)azo]-2,7-naphthalene-disulfonic acid trisodium salt (C.I.
16185; Acid Red No.
27), 8-amino-1 -hydroxy-2-(phenylazo)-3,6-naphthalene disulfonic acid disodium salt (C.I.17200; Acid Red No. 33), 5-(acetylamino)-4-hydroxy-3-[(2-methylphenyl)azo]-2,7-naphthalene disulfonic acid disodium salt (C.I.18065; Acid Red No. 35), 2-(3-hydroxy-2,4,5,7-tetraiodo-dibenzopyran-6-on-9-yl)-benzene sulfonic acid disodium salt (C.I.
45430; Acid Red No. 51), N-[6-(diethylamino)-9-(2,4-disulfophenyl)-3H-xanthen-3-yliden]-N-ethylethanaminium hydroxide, inner Salt, sodium salt (C.I.45100; Acid Red No. 52), 8-[(4-(phenylazo)phenyl)azo]-7-naphthol-1,3-disulfonic acid disodium salt (C.I. 27290; Acid Red No. 73), 2',4',5',7'-tetrabromo-3',6'-dihydroxyspiro[isobenzofuran-l-(3H),9'-[9H]xanthen]-3-one disodium salt (C.I.45380; Acid Red No. 87), 2',4',5',7'-tetrabromo-4,5,6,7-tetrachloro-3',6'-5 dihydroxyspiro[isobenzofuran-1(3H),9'[9H]xanthen]-3-one disodium salt (C.I.
45410; Acid Red No. 92), 3',6'-dihydroxy-4',5'-diiodospiro[isobenzofuran-1(3H),9'(9H)-xanthen)-3-one disodium salt (C.I. 45425; Acid Red No. 95), (2-sulfophenyl)-di-[4-(ethyl-((4-sulfophenyl)methyl)-amino)phenyl]carbenium disodium salt, betaine (C.I. 42090; Acid Blue No.9;
FD&C Blue No.1), 1,4-bis-[(2-sulfo-4-methyl-phenyl)amino]-9,10-anthraquinone disodium salt (C.I. 61570; Acid 10 Green No. 25), bis-[4-(dimethylamino)phenyl]-(3,7-disulfo-2-hydroxynaphth-1-yl)carbenium inner salt, monosodium salt (C.I. 44090; Food Green No. 4; Acid Green No. 50), bis-[4-(diethylamino)phenyl](2,4-disulfophenyl)carbenium inner salt, sodium salt (2:1) (C.I. 42045;
Food Blue No. 3; Acid Blue No. 1), bis[4-(diethylamino)phenyl]-(5-hydroxy-2,4-disulfophenyl)carbenium inner salt, calcium salt (2:1) (C.I. 42051; Acid Blue No. 3), 1 -amino-4-(cyclohexylamino)-9,10-anthraquinone-2-sulfonic acid sodium salt (C.I. 62045;
Acid Blue No.
62), 2-(1,3-dihydro-3-oxo-5-sulfo-2H-indol-2-yliden)-2,3-dihydro-3-oxo-lH-indol-5-sulfonic acid disodium salt (C.I. 73015; Acid Blue No. 74), 9-(2-carboxyphenyl)-3-[(2-methylphenyl)-amino] 6-[(2-methyl-4-sulfophenyl)amino]xanthylium inner salt, monosodium salt (C.I. 45190;
Acid Violet No. 9), 1 -hydroxy-4-[(4-methyl-2-sulfophenyl)amino]-9,1 0-anthraquinone sodium salt (C.I. 60730; D&C Violet No. 2; Acid Violet No. 43), bis-[3-nitro-4-[(4-phenylamino)-3-sulfophenylami no]phenyl]-sulfone (C.I. 10410; Acid Brown No. 13), 5-amino-4-hydroxy-6-[(4-nitrophenyl)azo]3-(phenylazo)-2,7-naphthalene disulfonic acid disodium salt (C.I.20470; Acid Black No. 1), 3-hydroxy-4-[(2-hydroxynaphth-l-yl)azo]-7-nitronaphthalenesulfonic acid chromium complex (3:2) (C.I. 15711; Acid Black No. 52), 3-[(2,4-dimethyl-5-sulfophenyl)azo]-4-hydroxy-l-naphthalene-sulfonic acid disodium salt (C.I. 14700; Food Red No.
1; Ponceau SX;
FD&C Red No. 4), 4-(acetylamino)-5-hydroxy-6-[(7-sulfo-4-[(4-sulfophenyl)azo]naphth-1 yl)azo]-1,7-naphthalene disulfonic acid tetrasodium salt (C.I. 28440; Food Black No. 1), 3-hydroxy-4-(3-methyl-5-oxo-l-phenyl-4,5-dihydro-1 H-pyrazole-4-yl-azo)-naphthalene-l-sulfonic acid sodium salt chromium complex (Acid Red No. 195).
The following are preferred cationic direct-dyeing dye compounds: 9-(dimethylamino)-benzo[a]phenoxazin-7-ium chloride (C.I. 51175; Basic Blue No. 6), di[4-(diethylamino)phenyl]-[4-(ethylamino)naphthyl]carbenium chloride (C.I. 42595; Basic Blue No. 7), 3,7-di(dimethylamino)phenothiazin-5-ium chloride (C.I. 52015; Basic Blue No.
9), di[4-dimethylamino)phenyl][4(phenylamino)naphthyl]carbenium chloride (C.I. 44045;
Basic Blue No. 26), 2-[(4-(ethyl(2-hydroxyethyl )amino)phenyl )azo]-6-methoxy-3-methylbenzothiazol ium methylsulfate (C.I. 11154; Basic Blue No. 41), 8-amino-2-bromo-5-hydroxy-4-imino-6-[(3-(trimethylammonio)phenyl)amino]-1 (4H)naphthalenone chloride (C.I.56059; Basic Blue No.
99), bis-[4-(dimethylamino)phenyl][4-(methylamino)phenyl]carbenium chloride (C.I. 42535;
Basic Violet No. 1), tris-(4-amino-3-methylphenyl)carbenium chloride (C.I. 425 20; Basic Violet No. 2), tris-[4-(dimethylamino)phenyl]carbenium chloride (C.I. 42555; Basic Violet No. 3), 2-[3,6-(diethylamino)dibenzopyranium-9-yl]benzoic acid chloride (C.I. 45170;
Basic Violet No.
10), di(4-aminophenyl)(4-amino-3-methylphenyl)carbenium chloride (C.I. 42510;
Basic Violet No. 14), 1,3-bis[(2,4-diamino-5-methylphenyl)azo]-3-methylbenzene (C.I.
21010;Basic Brown No. 4), 1-[(4-aminophenyl)azo]-7-(trimethylammonio)-2-naphthol chloride (C.I.
12250; Basic Brown No. 16), 1-[(4-amino-2-nitrophenyl)azo]-7-(trimethylammonio)-2-naphthol chloride (C.I.
12251; Basic Brown No.17), 1-[(4-amino-3-nitrophenyl)azo]-7-(trimethylammonio)-2-naphthol chloride (C.I. 12251; Basic Brown No. 17), 3,7-diamino-2,8-dimethyl-5-phenylphenazinium chloride (C.I. 50240; Basic Red No. 2), 1,4-dimethyl-5-[(4(dimethylamino)phenyl)azo]-1,2,4-triazolium chloride (C.I. 11055; Basic Red No. 22), 2-hydroxy-l-[(2-methoxyphenyl)azo]-7-(trimethylammonio)naphthalene chloride (C.I. 12245; Basic Red No. 76), 2-[2-((2,4-dimethoxyphenyl)amino)ethenyl]-1,3,3-trimethyl-3H-indol-l-ium-chloride (C.I.
48055; Basic Yellow No. 11), 3-methyl-l-phenyl-4-[(3-(trimethylammonio)phenyl)azo]-pyrazole-5-one chloride (C.I. 12719; Basic Yellow No. 57), bis-[4-(diethylamino)phenyl]phenylcarbenium hydrogen sulfate(1:1) (C.I. 42040; Basic Green No. 1).
To improve the color balance and to produce special shades the following nonionic direct-dyeing dye compounds have proven to be useful in the compositions according to the invention:
1-amino-2-[(2-hydroxyethyl)amino]-5-nitrobenzene (HC Yellow No. 5), 1-(2-hydroxyethoxy)-2-[(2-hydroxyethyl)amino]-5-nitrobenzene (HC Yellow No. 4), 1-[(2-hydroxyethyl)amino]-2-nitrobenzene (HC Yellow No. 2), 2-[(2-hydroxyethyl)amino]-1-methoxy-5-nitrobenzene, 2-amino-3-nitrophenol, 1-(2-hydroxyethoxy)-3-methylamino-4-nitrobenzene, 2,3-(dihydroxy-propoxy)-3-methylamino-4-nitrobenzene, 2-[(2-hydroxyethyl)amino]-5-nitrophenol (HC Yellow No. 11), 3-[(2-aminoethyl)amino]-1-methoxy-4-nitrobenzene hydrochloride (HC
Yellow No.9), 1-[(2-ureidoethyl)amino]-4-nitrobenzene, 4-[(2,3-dihydroxypropyl )amino]-3-nitro-l-trifluoromethylbenzene (HC Yellow No. 6), 1-chloro-2,4-bis-[(2-hydroxyethyl)amino]-5-nitrobenzene (HC Yellow No. 10), 4-[(2-hydroxyethyl)amino]-3-nitro-l-methylbenzene, 1-chloro-4-[(2-hydroxyethyl)amino]-3-nitrobenzene (HC Yellow No. 12), 4-[(2-hydroxyethyl)-amino]-3-nitro-l-trifluoromethylbenzene (HC Yellow No. 13), 4-[(2-hydroxyethyl)amino]-3-nitrobenzonitrile (HC Yellow No. 14), 4-[(2-hydroxyethyl)amino]-3-nitrobenzamide (HC
Yellow No. 15), 1-amino-4-[(2-hydroxyethyl)amino]-2-nitrobenzene (HC Red No.
7), 2-amino-4,6-dinitrophenol, 2-ethylamino-4,6-dinitrophenol, 4-amino-2-nitrodiphenylamine (HC Red No.
1), 1-amino-4-[di(2-hydroxyethyl)amino]-2-nitrobenzene hydrochloride (HC Red No. 13), 1-amino-5-chloro-4-[(2hydroxyethyl)amino]-2-nitrobenzene, 4-amino-l-[(2-hydroxyethyl)-amino] -2-nitrobenzene (HC Red No. 3), 4-amino-3-nitrophenol, 4-[(2-hydroxyethyl)amino]-3-nitrophenol, 1-[(2-aminoethyl)amino]4-(2-hydroxyethoxy)-2-nitrobenzene (HC
Orange No. 2), 4-(2,3-dihydroxypropoxy)-1-[(2-hydroxyethyl)amino]-2-nitrobenzene (HC Orange No. 3), 1-amino-5-chloro-4-[(2,3-dihydroxypropyl)amino]-2-nitrobenzene (HC Red No.
10), 5-chloro-1,4-[di(2,3-dihydroxypropyl)amino]-2-nitrobenzene (HC Red No. 11), 2-[(2-hydroxyethyl)-amino]4,6-dinitrophenol, 4-ethylamino-3-nitrobenzoic acid, 2-[(4-amino-2-nitrophenyl)amino]-benzoic acid, 2-chloro-6-methylamino-4-nitrophenol2-chloro-6-[(2-hydroxyethyl)amino]4-nitrophenol, 2-chloro-6-ethylamino-4-nitrophenol, 2-amino-6-chloro-4-nitrophenol, 4-[(3-hydroxypropyl )-amino]-3-nitrophenol, 2,5-diamino-6-nitropyridine, 1,2,3,4-tetrahydro-6-nitrochinoxalin, 7-amino-3,4-dihydro-6-nitro-2H-1,4-benzoxazine (HC Red No.
14),1,4-bis-[(2-hydroxyethyl )-amino]-2-nitrobenzene, 1-(2-hydroxyethyl )ami no-2-nitro-4-[di(2-hydroxyethyl)amino]benzene (HC Blue No. 2), 1-amino-3-methyl-4-[(2-hydroxyethyl)amino]-6-nitrobenzene (HC Violet No. 1), 4-[ethyl-(2-hydroxyethyl)amino]- 1 -[(2-hydroxyethyl)amino]-2-nitrobenzene hydrochloride (HC Blue No. 12), 4-[di(2-hydroxyethyl)amino]-1-[(2-methoxyethyl )amino] -2-nitrobenzene (HC Blue No. 11), 1-[(2,3-dihydroxy-propyl)amino]4-[methyl-(2-hydroxyethyl)amino]-2-nitrobenzene (HC Blue No. 10), 1-[(2,3-dihydroxypropyl)amino]4-[ethyl-(2-hydroxyethyl)amino]-2-nitrobenzene hydrochloride (HC Blue No. 9), 1-(3-hydroxypropylamino)-4-[di(2-hydroxyethyl)amino]-2-nitrobenzene (HC Violet No. 2), 1-methylamino-4-[methyl-(2,3-dihydroxypropyl)amino]-2nitrobenzene (HC Blue No.
6), 2-((4-amino-2-nitrophenyl)amino)-5-dimethylamino-benzoic acid (HC Blue No.
13), 1,4-di[(2,3-dihydroxypropyl)amino]-9,10-anthraquinone, 1-[(2-hydroxyethyl)amino]4-methylamino-9,10-anthraquinone (C.I. 61505, disperse Blue No. 3), 2-[(2-aminoethyl)amino]-9,10-anthraquinone (HC Orange No. 5),1-hydroxy-4-[(4-methyl-2-sulfophenyl)amino]-9,10-anthraquinone, 1-[(3-aminopropyl)amino]4-methylamino-9, 1 0-anthraquinone (HC Blue No. 8), 1-[(3-aminopropyl)amino]-9,10-anthraquinone (HC Red No. 8), 1,4-diamino-2-methoxy-9,10-anthraquinone (C.I.62015, disperse Red No. 11, Solvent Violet No. 26), 1,4-dihydroxy-5,8-bis[(2-hydroxyethyl)amino-9,10-anthraquinone (C.I. 62500, disperse Blue No. 7, Solvent Blue No. 69), 1-[di-(2-hydroxyethyl)amino]-3-methyl-4-[(4-nitrophenyl)azo]benzene (C.I. 11210, disperse Red No. 17), 4-[(4-aminophenyl)azo]-1-[di(2-hydroxyethyl)amino]-3-methylbenzene (HC Yellow No. 7), 2,6-diamino-3-[(pyridine-3-yl)azo]pyridine, 2-((4-(acetylamino)phenyl)-azo)-4-methylphenol (C.I. 11855; disperse Yellow No. 3).
The following compounds may also be used as direct-dyeing dye compounds: 2-amino-4,6-dinitrophenol, 2-ethylamino-4,6-dinitrophenol, 2-[(2-hydroxyethyl)-amino]4,6-dinitrophenol and dye compounds of the following general formula (VII):
OH
CI NHR
NO2 formula (VII) wherein R represents hydrogen, methyl, ethyl or hydroxyethyl.
The hair dye compositions of the present invention will generally comprise from about 0.001 % to about 10% by weight of direct dyes, preferably from about 0.1 % to about 5% by weight, more preferably from about 0.2% to about 2% by weight.
The composition of the present invention comprising at least one compound of formula (I) and optionally additional oxidation dye precursor compounds and/or direct-dyeing dye compounds is applied to the fibers to be dyed in a suitable dye-carrying composition.
The present invention also relates to ready-to-apply hair dye mixtures for the oxidative dyeing of hair, which are each made by mixing an oxidation dye precursor composition with an oxidizing agent immediately prior to application. They are characterized by a content of at least one compound of formula (I) as well as additional oxidation dye precursor compounds and/or direct-dyeing dye compounds as needed.
Any oxidizing agent known in the art (including air-oxgen and enzyme-based oxidizing systems) may be utilized in the present invention. Preferred water-soluble oxidizing agents are inorganic peroxygen materials capable of yielding hydrogen peroxide in an aqueous solution. Water-soluble peroxygen oxidizing agents are well known in the art and include hydrogen peroxide, inorganic alkali metal peroxides such as sodium periodate and sodium peroxide and organic peroxides such as urea peroxide, melamine peroxide, and inorganic perhydrate salt bleaching compounds, such as the alkali metal salts of perborates, percarbonates, perphosphates, persilicates, persulphates and the like. These inorganic perhydrate salts may be incorporated as monohydrates, tetrahydrates etc. Alkyl and aryl peroxides, and or peroxidases may also be used.
Mixtures of two or more such oxidizing agents may also be used if desired. The oxidizing agents may be provided in aqueous solution or as a powder which is dissolved prior to use. Preferred for use in the compositions according to the present invention are hydrogen peroxide, percarbonate, persulphates and combinations thereof.
According to the present invention the compositions comprise from 0.1% to about 15% by weight, preferably from 1% to 10% by weight, and most preferably from 2% to 7%
by weight of an oxidizing agent.
Another preferred oxidizing agent for use herein is a source of peroxymonocarbonate ions.
Preferably such a source is formed in situ from a source of hydrogen peroxide and a hydrogen carbonate ion source. Such an oxidizing agent has been found to be particularly effective at a pH
of up to and including 9.5, preferably 7.5 to 9.5 more preferably pH 9.
Moreover, this system is also particularly effective in combination with a source of ammonia or ammonium ions. It has been found that this oxidizing agent can deliver improvements to the desired hair colour results particularly with regard to the delivery of high lift, whilst considerably reducing the odour, skin and scalp irritation and damage to the hair fibres.
Accordingly, any source of these ions may be utilized. Suitable sources for use herein include sodium, potassium, guanidine, arginine, lithium, calcium, magnesium, barium, ammonium salts of carbonate, carbamate and hydrocarbonate ions and mixtures thereof such as sodium carbonate, sodium hydrogen carbonate, potassium carbonate, potassium hydrogen carbonate, guanidine carbonate, guanidine hydrogen carbonate, lithium carbonate, calcium carbonate, magnesium carbonate, barium carbonate, ammonium carbonate, ammonium hydrogen carbonate and mixtures thereof. Percarbonate salts may also be utilized to provide both the source of carbonate ions and oxidizing agent. Preferred sources of carbonate ions, carbamate and hydrocarbonate ions are sodium hydrogen carbonate, potassium hydrogen carbonate, ammonium carbamate, and mixtures thereof.
According to the present invention the compositions comprise from 0.1% to about 15% by 5 weight, preferably from 1% to 10% by weight, and most preferably from 1% to 8% by weight of a hydrogencarbonate ion and from 0.1 % to 10% by weight, preferably from 1% to 7% by weight, and most preferably from 2% to 5% by weight of a source of hydrogen peroxide.
According to the present invention the composition may further optionally comprise at least one 10 source of alkalizing agent, preferably a source of ammonium ions and or ammonia. Any agent known in the art may be used such as alkanolamides for example monoethanolamine, diethanolamine, triethanolamine, monopropanolamine, dipropanolamine, tripropanolamine, 2-amino-2-methyl-1, 3-propanediol, 2-amino-2-methyl-l-propanol, and 2-amino-2-hydroxymethyl-1,3-propanediol and guanidium salts. Particularly, preferred alkalizing agents are 15 those which provide a source of ammonium ions. Any source of ammonium ions is suitable for use herein. Preferred sources include ammonium chloride, ammonium sulphate, ammonium nitrate, ammonium phosphate, ammonium acetate, ammonium carbonate, ammonium hydrogen carbonate, ammonium carbamate, ammonium hydroxide, percarbonate salts, ammonia and mixtures thereof. Particularly preferred are ammonium carbonate, ammonium carbamate, ammonium hydrogen carbonate, ammonia and mixtures thereof. The compositions of the present invention may comprise from 0.1 % to 10% by weight, preferably from 0.5% to 5%
by weight, most preferably from 1% to 3% by weight, of an alkalizing agent, preferably ammonium ions.
According to the present invention the compositions may further comprise a source of radical scavenger. As used herein the term radical scavenger refers to a species that can react with a reactive radical, preferably carbonate radicals, to convert the reactive radical by a series of fast reactions to a less reactive species.
Suitable radical scavengers for use herein include compounds according to the general formula (RSI):
Rl'-Y-C(H)(R3 )-R4 -(C(H)(RS')-Y-R6')n (RSI) wherein Y is NR2', 0, or S, preferably NR2', n is 0 to 2, and wherein R4' is monovalent or divalent and is selected from: (a) substituted or unsubstituted, straight or branched, alkyl, mono-or polyunsaturated alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (b) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (c) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; the systems of (a), (b) and (c) comprising from 1 to 12 carbon atoms and 0 to 5 heteroatoms selected from 0, S, N, P, and Si; and wherein R4' may be connected to R3' or RS' to create a 5, 6 or 7-membered ring; and wherein R", R2', R3', RS', and R6' are monovalent and are selected independently from: (a), (b) and (c) described herein above, or H.
Preferably, R4' is selected from: (a) substituted or unsubstituted, straight or branched, alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (b) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (c) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; more preferably R4' is selected from (a) substituted or unsubstituted, straight or branched, alkyl, heteroalkyl, aliphatic, or heteroaliphatic systems, (b) substituted or unsubstituted, aryl, or heterocyclic systems, or (c) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; more preferably substituted or unsubstituted, straight or branched, alkyl, or heteroalkyl systems.
Preferably, the R4' systems of (a), (b), and (c), described herein above, comprise from 1 to 8 carbon atoms, preferably from 1 to 6, more preferably from 1 to 4 carbon atoms and from 0 to 3 heteroatoms; preferably from 0 to 2 heteroatoms; most preferably from 0 to 1 heteroatoms.
Where the systems contain heteroatoms, preferably they contain 1 heteroatom.
Preferred heteroatoms include 0, S, and N; more preferred are 0, and N; and most preferred is O.
Preferably, R", R 2', R3', R5', and R6' are selected independently from any of the systems defined for R4 above, and H.
In alternative embodiments, any of R", Rz', R3', R4', RS', and R6' groups are substituted.
Preferably, the substituent(s) is selected from: (a) the group of C-linked monovalent substituents consisting of: (i) substituted or unsubstituted, straight or branched, alkyl, mono- or poly-unsaturated alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (ii) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (iii) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; said systems of (i), (ii) and (iii) comprising from 1 to 10 carbon atoms and 0 to 5 heteroatoms selected from 0, S, N, P, and Si; (b) the group of S-linked monovalent substituents consisting of SA1, SCN, SO2A', SO3A', SSA', SOA', SO2NA'A2, SNA'A2, and SONA'A2; (c) the group of 0-linked monovalent substituents consisting of OA', OCN and ONA'A2; (d) the group of N-linked monovalent substituents consisting of NA'A2, (NA'AZA3)+, NC, NA'OAZ, NA'SAz, NCO, NCS, NO2, N=NA', N=NOA', NA'CN, NA1NAZA3; (e) the group of monovalent substituents consisting of COOA', CON3, CONA'Z, CONA'COA2, C(=NA')NA'A2, CHO, CHS, CN, NC, and X; and (f) the group consisting fluoroalkyl monovalent substituents consisting of mono-, poly-, or per-fluoro alkyl systems comprising from 1 to 12 carbon atoms and 0 to 4 heteroatoms.
For the groups (b) to (e), described above, A', AZ, and A3 are monovalent and are independently selected from: (1) H, (2) substituted or unsubstituted, straight or branched, alkyl, mono- or poly-unsaturated alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (3) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (4) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; said systems of (2), (3) and (4) comprising from 1 to 10 carbon atoms and 0 to 5 heteroatoms selected from 0, S, N, P, and Si; and wherein X is a halogen selected from the group consisting of F, Cl, Br, and I.
Preferred substituents for use herein include those having a Hammett Sigma Para (Qp) Value from -0.65 to +0.75, preferably from -0.4 to +0.5. Hammett Sigma Values are described in Advanced Organic Chemistry - Reactions, Mechanisms and Structure (Jerry March, 5th ed.
(2001) at pages 368-375).
Alternative suitable radical scavengers for use herein are compounds according to the general formula (RSII) :
OH
::Irr:::
R
3"
(RSII) wherein R> , R2==, Rp, R4 , and R5 are each independently selected from H, C00V, Cl, Br, SO3"M+, NOZ, OCH3, OH or a C 1 to C 10 primary or secondary alkyl and M is either H or alkali metal. Preferably, the above-described radical scavengers have a pKa of more than 8.5 to ensure protonation of the hydroxy goup.
The following compounds may also be used as direct-dyeing dye compounds: 2-amino-4,6-dinitrophenol, 2-ethylamino-4,6-dinitrophenol, 2-[(2-hydroxyethyl)-amino]4,6-dinitrophenol and dye compounds of the following general formula (VII):
OH
CI NHR
NO2 formula (VII) wherein R represents hydrogen, methyl, ethyl or hydroxyethyl.
The hair dye compositions of the present invention will generally comprise from about 0.001 % to about 10% by weight of direct dyes, preferably from about 0.1 % to about 5% by weight, more preferably from about 0.2% to about 2% by weight.
The composition of the present invention comprising at least one compound of formula (I) and optionally additional oxidation dye precursor compounds and/or direct-dyeing dye compounds is applied to the fibers to be dyed in a suitable dye-carrying composition.
The present invention also relates to ready-to-apply hair dye mixtures for the oxidative dyeing of hair, which are each made by mixing an oxidation dye precursor composition with an oxidizing agent immediately prior to application. They are characterized by a content of at least one compound of formula (I) as well as additional oxidation dye precursor compounds and/or direct-dyeing dye compounds as needed.
Any oxidizing agent known in the art (including air-oxgen and enzyme-based oxidizing systems) may be utilized in the present invention. Preferred water-soluble oxidizing agents are inorganic peroxygen materials capable of yielding hydrogen peroxide in an aqueous solution. Water-soluble peroxygen oxidizing agents are well known in the art and include hydrogen peroxide, inorganic alkali metal peroxides such as sodium periodate and sodium peroxide and organic peroxides such as urea peroxide, melamine peroxide, and inorganic perhydrate salt bleaching compounds, such as the alkali metal salts of perborates, percarbonates, perphosphates, persilicates, persulphates and the like. These inorganic perhydrate salts may be incorporated as monohydrates, tetrahydrates etc. Alkyl and aryl peroxides, and or peroxidases may also be used.
Mixtures of two or more such oxidizing agents may also be used if desired. The oxidizing agents may be provided in aqueous solution or as a powder which is dissolved prior to use. Preferred for use in the compositions according to the present invention are hydrogen peroxide, percarbonate, persulphates and combinations thereof.
According to the present invention the compositions comprise from 0.1% to about 15% by weight, preferably from 1% to 10% by weight, and most preferably from 2% to 7%
by weight of an oxidizing agent.
Another preferred oxidizing agent for use herein is a source of peroxymonocarbonate ions.
Preferably such a source is formed in situ from a source of hydrogen peroxide and a hydrogen carbonate ion source. Such an oxidizing agent has been found to be particularly effective at a pH
of up to and including 9.5, preferably 7.5 to 9.5 more preferably pH 9.
Moreover, this system is also particularly effective in combination with a source of ammonia or ammonium ions. It has been found that this oxidizing agent can deliver improvements to the desired hair colour results particularly with regard to the delivery of high lift, whilst considerably reducing the odour, skin and scalp irritation and damage to the hair fibres.
Accordingly, any source of these ions may be utilized. Suitable sources for use herein include sodium, potassium, guanidine, arginine, lithium, calcium, magnesium, barium, ammonium salts of carbonate, carbamate and hydrocarbonate ions and mixtures thereof such as sodium carbonate, sodium hydrogen carbonate, potassium carbonate, potassium hydrogen carbonate, guanidine carbonate, guanidine hydrogen carbonate, lithium carbonate, calcium carbonate, magnesium carbonate, barium carbonate, ammonium carbonate, ammonium hydrogen carbonate and mixtures thereof. Percarbonate salts may also be utilized to provide both the source of carbonate ions and oxidizing agent. Preferred sources of carbonate ions, carbamate and hydrocarbonate ions are sodium hydrogen carbonate, potassium hydrogen carbonate, ammonium carbamate, and mixtures thereof.
According to the present invention the compositions comprise from 0.1% to about 15% by 5 weight, preferably from 1% to 10% by weight, and most preferably from 1% to 8% by weight of a hydrogencarbonate ion and from 0.1 % to 10% by weight, preferably from 1% to 7% by weight, and most preferably from 2% to 5% by weight of a source of hydrogen peroxide.
According to the present invention the composition may further optionally comprise at least one 10 source of alkalizing agent, preferably a source of ammonium ions and or ammonia. Any agent known in the art may be used such as alkanolamides for example monoethanolamine, diethanolamine, triethanolamine, monopropanolamine, dipropanolamine, tripropanolamine, 2-amino-2-methyl-1, 3-propanediol, 2-amino-2-methyl-l-propanol, and 2-amino-2-hydroxymethyl-1,3-propanediol and guanidium salts. Particularly, preferred alkalizing agents are 15 those which provide a source of ammonium ions. Any source of ammonium ions is suitable for use herein. Preferred sources include ammonium chloride, ammonium sulphate, ammonium nitrate, ammonium phosphate, ammonium acetate, ammonium carbonate, ammonium hydrogen carbonate, ammonium carbamate, ammonium hydroxide, percarbonate salts, ammonia and mixtures thereof. Particularly preferred are ammonium carbonate, ammonium carbamate, ammonium hydrogen carbonate, ammonia and mixtures thereof. The compositions of the present invention may comprise from 0.1 % to 10% by weight, preferably from 0.5% to 5%
by weight, most preferably from 1% to 3% by weight, of an alkalizing agent, preferably ammonium ions.
According to the present invention the compositions may further comprise a source of radical scavenger. As used herein the term radical scavenger refers to a species that can react with a reactive radical, preferably carbonate radicals, to convert the reactive radical by a series of fast reactions to a less reactive species.
Suitable radical scavengers for use herein include compounds according to the general formula (RSI):
Rl'-Y-C(H)(R3 )-R4 -(C(H)(RS')-Y-R6')n (RSI) wherein Y is NR2', 0, or S, preferably NR2', n is 0 to 2, and wherein R4' is monovalent or divalent and is selected from: (a) substituted or unsubstituted, straight or branched, alkyl, mono-or polyunsaturated alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (b) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (c) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; the systems of (a), (b) and (c) comprising from 1 to 12 carbon atoms and 0 to 5 heteroatoms selected from 0, S, N, P, and Si; and wherein R4' may be connected to R3' or RS' to create a 5, 6 or 7-membered ring; and wherein R", R2', R3', RS', and R6' are monovalent and are selected independently from: (a), (b) and (c) described herein above, or H.
Preferably, R4' is selected from: (a) substituted or unsubstituted, straight or branched, alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (b) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (c) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; more preferably R4' is selected from (a) substituted or unsubstituted, straight or branched, alkyl, heteroalkyl, aliphatic, or heteroaliphatic systems, (b) substituted or unsubstituted, aryl, or heterocyclic systems, or (c) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; more preferably substituted or unsubstituted, straight or branched, alkyl, or heteroalkyl systems.
Preferably, the R4' systems of (a), (b), and (c), described herein above, comprise from 1 to 8 carbon atoms, preferably from 1 to 6, more preferably from 1 to 4 carbon atoms and from 0 to 3 heteroatoms; preferably from 0 to 2 heteroatoms; most preferably from 0 to 1 heteroatoms.
Where the systems contain heteroatoms, preferably they contain 1 heteroatom.
Preferred heteroatoms include 0, S, and N; more preferred are 0, and N; and most preferred is O.
Preferably, R", R 2', R3', R5', and R6' are selected independently from any of the systems defined for R4 above, and H.
In alternative embodiments, any of R", Rz', R3', R4', RS', and R6' groups are substituted.
Preferably, the substituent(s) is selected from: (a) the group of C-linked monovalent substituents consisting of: (i) substituted or unsubstituted, straight or branched, alkyl, mono- or poly-unsaturated alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (ii) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (iii) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; said systems of (i), (ii) and (iii) comprising from 1 to 10 carbon atoms and 0 to 5 heteroatoms selected from 0, S, N, P, and Si; (b) the group of S-linked monovalent substituents consisting of SA1, SCN, SO2A', SO3A', SSA', SOA', SO2NA'A2, SNA'A2, and SONA'A2; (c) the group of 0-linked monovalent substituents consisting of OA', OCN and ONA'A2; (d) the group of N-linked monovalent substituents consisting of NA'A2, (NA'AZA3)+, NC, NA'OAZ, NA'SAz, NCO, NCS, NO2, N=NA', N=NOA', NA'CN, NA1NAZA3; (e) the group of monovalent substituents consisting of COOA', CON3, CONA'Z, CONA'COA2, C(=NA')NA'A2, CHO, CHS, CN, NC, and X; and (f) the group consisting fluoroalkyl monovalent substituents consisting of mono-, poly-, or per-fluoro alkyl systems comprising from 1 to 12 carbon atoms and 0 to 4 heteroatoms.
For the groups (b) to (e), described above, A', AZ, and A3 are monovalent and are independently selected from: (1) H, (2) substituted or unsubstituted, straight or branched, alkyl, mono- or poly-unsaturated alkyl, heteroalkyl, aliphatic, heteroaliphatic, or heteroolefinic systems, (3) substituted or unsubstituted, mono- or polycyclic aliphatic, aryl, or heterocyclic systems, or (4) substituted or unsubstituted, mono-, poly-, or perfluoro alkyl systems; said systems of (2), (3) and (4) comprising from 1 to 10 carbon atoms and 0 to 5 heteroatoms selected from 0, S, N, P, and Si; and wherein X is a halogen selected from the group consisting of F, Cl, Br, and I.
Preferred substituents for use herein include those having a Hammett Sigma Para (Qp) Value from -0.65 to +0.75, preferably from -0.4 to +0.5. Hammett Sigma Values are described in Advanced Organic Chemistry - Reactions, Mechanisms and Structure (Jerry March, 5th ed.
(2001) at pages 368-375).
Alternative suitable radical scavengers for use herein are compounds according to the general formula (RSII) :
OH
::Irr:::
R
3"
(RSII) wherein R> , R2==, Rp, R4 , and R5 are each independently selected from H, C00V, Cl, Br, SO3"M+, NOZ, OCH3, OH or a C 1 to C 10 primary or secondary alkyl and M is either H or alkali metal. Preferably, the above-described radical scavengers have a pKa of more than 8.5 to ensure protonation of the hydroxy goup.
Other suitable radical scavengers for use herein include those selected from group (III) benzylamine, imidazole, di-tert-butylhydroxytoluene, hydroquinone, guanine, pyrazine, piperidine, morpholine, methylmorpholine, 2-methyoxyethylamine, and mixtures thereof.
Preferred radical scavengers according to the present invention are selected from the classes of alkanolamines, amino sugars, amino acids, esters of amino acids and mixtures thereof.
Particularly preferred compounds are: monoethanolamine, 3-amino-l-propanol, 4-amino-1 -butanol,5-amino-1-pentanol, 1-amino-2-propanol, 1-amino-2-butanol, 1-amino-2-pentanol, 1-amino-3-pentanol, 1-amino-4-pentanol, 3-amino-2-methylpropan-l-ol, 1-amino-2-methylpropan-2-ol, 3-aminopropane-1,2-diol, glucosamine, N-acetylglucosamine, glycine, arginine, lysine, proline, glutamine, histidine, sarcosine, serine, glutamic acid, tryptophan, and mixtures thereof, and the salts such as the potassium, sodium and ammonium salts thereof and mixtures thereof. Especially preferred compounds are glycine, sarcosine, lysine, serine, 2 methoxyethylamine, glucosamine, glutamic acid, morpholine, piperdine, ethylamine, 3 amino-1-propanol and mixtures thereof.
The radical scavengers according to the present invention preferably have a molecular weight of less than 500, preferably less than 300, more preferably less than 250 in order to facilitate penetration of the radical scavenger into the hair fibre. The compositions of the present invention preferably comprise from 0.1 % to 10% by weight, preferably from 1% to 7% by weight of radical scavenger. The radical scavenger is also preferably selected such that it is not an identical species as the alkalizing agent. According to one embodiment of the present invention the radical scavenger may be formed insitu in the hair dyeing compositions prior to application to the hair fibres.
The compositions of the present invention may further comprise additional ingredients which include, but are not limited to, thickeners, solvents, enzymes, surfactants, conditioning agents, carriers, antioxidants or reducing agents, stabilizers, chelants, perfumes, hair swelling agents and/or polymers. Some of these additional components are detailed hereafter.
Thickeners: The composition of the present invention may optionally further comprise at least about 0.01% by weight, especially from 0.05 to 25% by weight, of thickeners.
Thickeners are preferably comprised in amount sufficient to provide the composition with a viscosity of from about 1 Pa.s to 40 Pa.s (1,000 to 40,000 cP) at 26 C in order to provide a composition that can be readily applied to the hair without dripping.
The at least one thickener is chosen, for example, from:
(i) associative thickeners;
(ii) crosslinked acrylic acid homopolymers;
(iii) crosslinked copolymers of (meth)acrylic acid and of (C1-C6)alkyl acrylate;
(iv) nonionic homopolymers and copolymers containing ethylenically unsaturated monomers of ester and amide type;
(v) ammonium acrylate homopolymers and copolymers of ammonium acrylate and of acrylamide;
(vi) polysaccharides;
(vii) C12-C30 fatty alcohols and (viii) particulate or crystalline thickeners.
(i) As used herein, the expression "associative thickener" means an amphiphilic thickener comprising both hydrophilic units and hydrophobic units, for example, at least one C8-C30 fatty chain and at least one hydrophilic unit. Representative associative thickeners that may be used are associative polymers chosen from:
(a) nonionic amphiphilic polymers comprising at least one fatty chain and at least one hydrophilic unit;
(b) anionic amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit;
(c) cationic amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit; and (d) amphoteric amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit;
The nonionic amphiphilic polymers comprising at least one fatty chain and at least one hydrophilic unit may, for example, be chosen from:
(1) celluloses modified with groups comprising at least one fatty chain; for example:
hydroxyethylcelluloses modified with groups comprising at least one fatty chain chosen from alkyl, arylalkyl and alkylaryl groups, and in which the alkyl groups are, for example, C8-C22, such as the product Natrosol Plus Grade 330 CS(C16 alkyls) sold by the company Aqualon, and the product Bermocoll EHM 100 sold by the company Berol Nobel, and celluloses modified with polyalkylene glycol alkylphenyl ether groups, such as the product Amercell Polymer HM- 1500 (polyethylene glycol (15) nonylphenyl ether) sold by the company Amerchol;
(2) hydroxypropyl guars modified with groups comprising at least one fatty chain, such as the product Esaflor HM 22 (C22 alkyl chain) sold by the company Lamberti, and the products 5 Miracare XC95-3 (C14 alkyl chain) and RE205-1 (C20 alkyl chain) sold by the company Rhodia Chimie;
(3) polyether urethanes comprising at least one fatty chain, such as C10-C30 alkyl or alkenyl groups, for instance the products Elfacos T 210 and Elfacos T 212 sold by the company Akzo or the products Aculyn 44 and Aculyn 46 and Aculyn 48 sold by the company Rohm &
Haas;
10 (4) copolymers of vinylpyrrolidone and of fatty-chain hydrophobic monomers;
examples that may be mentioned include: the products Antaron V216 and Ganex V216 (vinylpyrrolidone/hexadecene copolymer) sold by the company I.S.P., the products Antaron V220 and Ganex V220 (vinylpyrrolidone/eicosene copolymer) sold by the company I.S.P. ;
(5) copolymers of C1-C6 alkyl acrylates or methacrylates and of amphiphilic monomers 15 comprising at least one fatty chain, such as the oxyethylenated methyl methacrylate/stearyl acrylate copolymer sold by the company Goldschmidt under the name Antil 208;
(6) copolymers of hydrophilic acrylates or methacrylates and of hydrophobic monomers comprising at least one fatty chain, such as polyethylene glycol methacrylate/lauryl methacrylate copolymer; and 20 (7) polymers as described in WO 96/40815 comprising at least one hydrophobbic group and at least one hydrophilic group, such as the following polymers according INCI
designation:
Polyether- 1, PEG-180/Laureth-50/TMMG Copolymer and PEG-180/Octoxynol-40/TMMG
Copolymer (sold by the company United Catalysts under the name Pure-Thix 1442, Pure-Thix 1450, Pure-Thix HH, Pure-Thix L and Pure-Thix M).
The anionic amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit, may, for example, be chosen from those comprising at least one fatty-chain allyl ether unit and at least one hydrophilic unit comprising an ethylenic unsaturated anionic monomeric unit, for example, a vinylcarboxylic acid unit and further, for example, chosen from units derived from acrylic acids, methacrylic acids and mixtures thereof, wherein the fatty-chain allyl ether unit corresponds to the monomer of formula below:
CH2=C(R')CH2OBõR (I) in which R1 is chosen from H and CH3, B is an ethyleneoxy radical, n is chosen from zero and integers ranging from 1 to 100, R is chosen from hydrocarbon-based radicals chosen from alkyl, arylalkyl, aryl, alkylaryl and cycloalkyl radicals, comprising from 10 to 30 carbon atoms, and, further, for example, from 10 to 24 carbon atoms and even further, for example, from 12 to 18 carbon atoms.
In one embodiment, a unit of formula (I) is, for example, a unit in which R1 may be H, n may be equal to 10 and R may be a stearyl (C 18) radical.
Anionic amphiphilic polymers of this type are described and prepared, according to an emulsion polymerization process, in patent EP-0 216 479 B2.
In one embodiment, anionic amphiphilic polymers are, for example, polymers formed from 20%
to 60% by weight of acrylic acid and/or of methacrylic acid, from 5% to 60% by weight of lower alkyl (meth)acrylates, from 2% to 50% by weight of fatty-chain allyl ether of formula (I), and from 0% to 1% by weight of a crosslinking agent which is a well-known copolymerizable unsaturated polyethylenic monomer, for example, diallyl phthalate, allyl (meth)acrylate, divinylbenzene, (poly)ethylene glycol dimethacrylate and methylenebisacrylamide.
Examples of such polymers are crosslinked terpolymers of methacrylic acid, of ethyl acrylate and of polyethylene glycol (10 EO) stearyl ether (Steareth- 10), such as those sold by the company Ciba under the names Salcare SC 80 and Salcare SC 90, which are aqueous 30%
emulsions of a crosslinked terpolymer of methacrylic acid, of ethyl acrylate and of steareth-10 allyl ether (40/50/10).
The anionic amphiphilic polymers may further be chosen, for example, from those comprising at least one hydrophilic unit of unsaturated olefinic carboxylic acid type, and at least one hydrophobic unit of the type such as a (C 10-C30) alkyl ester of an unsaturated carboxylic acid. The hydrophilic unit of unsaturated olefinic carboxylic acid type corresponds to, for example, the monomer of formula (II) below:
CH2=CR'-COOH (II) in which R' is chosen from H, CH3, and C2H5, i.e. acrylic acid, methacrylic acid and ethacrylic acid units. And the hydrophobic unit of the type such as a(C10-C30) alkyl ester of an unsaturated carboxylic acid corresponds to, for example, the monomer of formula (III) below:
CH2=CR'-COOR2 (III) in which R' is chosen from H, CH3, and C2H5 (i.e. acrylate, methacrylate and ethacrylate units) and is, for example, chosen from, for example, H (acrylate units) and CH3 (methacrylate units), R2 is chosen from C10-C30 alkyl radicals, for example, C12-C22 alkyl radical.
Examples of (C 10-C30)alkyl esters of unsaturated carboxylic acids include lauryl acrylate, stearyl acrylate, decyl acrylate, isodecyl acrylate, and dodecyl acrylate, and the corresponding methacrylates, lauryl methacrylate, stearyl methacrylate, decyl methacrylate, isodecyl methacrylate and dodecyl methacrylate.
Preferred radical scavengers according to the present invention are selected from the classes of alkanolamines, amino sugars, amino acids, esters of amino acids and mixtures thereof.
Particularly preferred compounds are: monoethanolamine, 3-amino-l-propanol, 4-amino-1 -butanol,5-amino-1-pentanol, 1-amino-2-propanol, 1-amino-2-butanol, 1-amino-2-pentanol, 1-amino-3-pentanol, 1-amino-4-pentanol, 3-amino-2-methylpropan-l-ol, 1-amino-2-methylpropan-2-ol, 3-aminopropane-1,2-diol, glucosamine, N-acetylglucosamine, glycine, arginine, lysine, proline, glutamine, histidine, sarcosine, serine, glutamic acid, tryptophan, and mixtures thereof, and the salts such as the potassium, sodium and ammonium salts thereof and mixtures thereof. Especially preferred compounds are glycine, sarcosine, lysine, serine, 2 methoxyethylamine, glucosamine, glutamic acid, morpholine, piperdine, ethylamine, 3 amino-1-propanol and mixtures thereof.
The radical scavengers according to the present invention preferably have a molecular weight of less than 500, preferably less than 300, more preferably less than 250 in order to facilitate penetration of the radical scavenger into the hair fibre. The compositions of the present invention preferably comprise from 0.1 % to 10% by weight, preferably from 1% to 7% by weight of radical scavenger. The radical scavenger is also preferably selected such that it is not an identical species as the alkalizing agent. According to one embodiment of the present invention the radical scavenger may be formed insitu in the hair dyeing compositions prior to application to the hair fibres.
The compositions of the present invention may further comprise additional ingredients which include, but are not limited to, thickeners, solvents, enzymes, surfactants, conditioning agents, carriers, antioxidants or reducing agents, stabilizers, chelants, perfumes, hair swelling agents and/or polymers. Some of these additional components are detailed hereafter.
Thickeners: The composition of the present invention may optionally further comprise at least about 0.01% by weight, especially from 0.05 to 25% by weight, of thickeners.
Thickeners are preferably comprised in amount sufficient to provide the composition with a viscosity of from about 1 Pa.s to 40 Pa.s (1,000 to 40,000 cP) at 26 C in order to provide a composition that can be readily applied to the hair without dripping.
The at least one thickener is chosen, for example, from:
(i) associative thickeners;
(ii) crosslinked acrylic acid homopolymers;
(iii) crosslinked copolymers of (meth)acrylic acid and of (C1-C6)alkyl acrylate;
(iv) nonionic homopolymers and copolymers containing ethylenically unsaturated monomers of ester and amide type;
(v) ammonium acrylate homopolymers and copolymers of ammonium acrylate and of acrylamide;
(vi) polysaccharides;
(vii) C12-C30 fatty alcohols and (viii) particulate or crystalline thickeners.
(i) As used herein, the expression "associative thickener" means an amphiphilic thickener comprising both hydrophilic units and hydrophobic units, for example, at least one C8-C30 fatty chain and at least one hydrophilic unit. Representative associative thickeners that may be used are associative polymers chosen from:
(a) nonionic amphiphilic polymers comprising at least one fatty chain and at least one hydrophilic unit;
(b) anionic amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit;
(c) cationic amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit; and (d) amphoteric amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit;
The nonionic amphiphilic polymers comprising at least one fatty chain and at least one hydrophilic unit may, for example, be chosen from:
(1) celluloses modified with groups comprising at least one fatty chain; for example:
hydroxyethylcelluloses modified with groups comprising at least one fatty chain chosen from alkyl, arylalkyl and alkylaryl groups, and in which the alkyl groups are, for example, C8-C22, such as the product Natrosol Plus Grade 330 CS(C16 alkyls) sold by the company Aqualon, and the product Bermocoll EHM 100 sold by the company Berol Nobel, and celluloses modified with polyalkylene glycol alkylphenyl ether groups, such as the product Amercell Polymer HM- 1500 (polyethylene glycol (15) nonylphenyl ether) sold by the company Amerchol;
(2) hydroxypropyl guars modified with groups comprising at least one fatty chain, such as the product Esaflor HM 22 (C22 alkyl chain) sold by the company Lamberti, and the products 5 Miracare XC95-3 (C14 alkyl chain) and RE205-1 (C20 alkyl chain) sold by the company Rhodia Chimie;
(3) polyether urethanes comprising at least one fatty chain, such as C10-C30 alkyl or alkenyl groups, for instance the products Elfacos T 210 and Elfacos T 212 sold by the company Akzo or the products Aculyn 44 and Aculyn 46 and Aculyn 48 sold by the company Rohm &
Haas;
10 (4) copolymers of vinylpyrrolidone and of fatty-chain hydrophobic monomers;
examples that may be mentioned include: the products Antaron V216 and Ganex V216 (vinylpyrrolidone/hexadecene copolymer) sold by the company I.S.P., the products Antaron V220 and Ganex V220 (vinylpyrrolidone/eicosene copolymer) sold by the company I.S.P. ;
(5) copolymers of C1-C6 alkyl acrylates or methacrylates and of amphiphilic monomers 15 comprising at least one fatty chain, such as the oxyethylenated methyl methacrylate/stearyl acrylate copolymer sold by the company Goldschmidt under the name Antil 208;
(6) copolymers of hydrophilic acrylates or methacrylates and of hydrophobic monomers comprising at least one fatty chain, such as polyethylene glycol methacrylate/lauryl methacrylate copolymer; and 20 (7) polymers as described in WO 96/40815 comprising at least one hydrophobbic group and at least one hydrophilic group, such as the following polymers according INCI
designation:
Polyether- 1, PEG-180/Laureth-50/TMMG Copolymer and PEG-180/Octoxynol-40/TMMG
Copolymer (sold by the company United Catalysts under the name Pure-Thix 1442, Pure-Thix 1450, Pure-Thix HH, Pure-Thix L and Pure-Thix M).
The anionic amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit, may, for example, be chosen from those comprising at least one fatty-chain allyl ether unit and at least one hydrophilic unit comprising an ethylenic unsaturated anionic monomeric unit, for example, a vinylcarboxylic acid unit and further, for example, chosen from units derived from acrylic acids, methacrylic acids and mixtures thereof, wherein the fatty-chain allyl ether unit corresponds to the monomer of formula below:
CH2=C(R')CH2OBõR (I) in which R1 is chosen from H and CH3, B is an ethyleneoxy radical, n is chosen from zero and integers ranging from 1 to 100, R is chosen from hydrocarbon-based radicals chosen from alkyl, arylalkyl, aryl, alkylaryl and cycloalkyl radicals, comprising from 10 to 30 carbon atoms, and, further, for example, from 10 to 24 carbon atoms and even further, for example, from 12 to 18 carbon atoms.
In one embodiment, a unit of formula (I) is, for example, a unit in which R1 may be H, n may be equal to 10 and R may be a stearyl (C 18) radical.
Anionic amphiphilic polymers of this type are described and prepared, according to an emulsion polymerization process, in patent EP-0 216 479 B2.
In one embodiment, anionic amphiphilic polymers are, for example, polymers formed from 20%
to 60% by weight of acrylic acid and/or of methacrylic acid, from 5% to 60% by weight of lower alkyl (meth)acrylates, from 2% to 50% by weight of fatty-chain allyl ether of formula (I), and from 0% to 1% by weight of a crosslinking agent which is a well-known copolymerizable unsaturated polyethylenic monomer, for example, diallyl phthalate, allyl (meth)acrylate, divinylbenzene, (poly)ethylene glycol dimethacrylate and methylenebisacrylamide.
Examples of such polymers are crosslinked terpolymers of methacrylic acid, of ethyl acrylate and of polyethylene glycol (10 EO) stearyl ether (Steareth- 10), such as those sold by the company Ciba under the names Salcare SC 80 and Salcare SC 90, which are aqueous 30%
emulsions of a crosslinked terpolymer of methacrylic acid, of ethyl acrylate and of steareth-10 allyl ether (40/50/10).
The anionic amphiphilic polymers may further be chosen, for example, from those comprising at least one hydrophilic unit of unsaturated olefinic carboxylic acid type, and at least one hydrophobic unit of the type such as a (C 10-C30) alkyl ester of an unsaturated carboxylic acid. The hydrophilic unit of unsaturated olefinic carboxylic acid type corresponds to, for example, the monomer of formula (II) below:
CH2=CR'-COOH (II) in which R' is chosen from H, CH3, and C2H5, i.e. acrylic acid, methacrylic acid and ethacrylic acid units. And the hydrophobic unit of the type such as a(C10-C30) alkyl ester of an unsaturated carboxylic acid corresponds to, for example, the monomer of formula (III) below:
CH2=CR'-COOR2 (III) in which R' is chosen from H, CH3, and C2H5 (i.e. acrylate, methacrylate and ethacrylate units) and is, for example, chosen from, for example, H (acrylate units) and CH3 (methacrylate units), R2 is chosen from C10-C30 alkyl radicals, for example, C12-C22 alkyl radical.
Examples of (C 10-C30)alkyl esters of unsaturated carboxylic acids include lauryl acrylate, stearyl acrylate, decyl acrylate, isodecyl acrylate, and dodecyl acrylate, and the corresponding methacrylates, lauryl methacrylate, stearyl methacrylate, decyl methacrylate, isodecyl methacrylate and dodecyl methacrylate.
Anionic amphiphilic polymers of this type are disclosed and prepared, for example, according to U.S. Pat. Nos. 3,915,921 and 4,509,949.
Representative anionic amphiphilic polymers that may be used may further be chosen from polymers formed from a mixture of monomers comprising:
(1) acrylic acid, an ester of formula (IV) below:
CH2=CR'-COOR2 (IV) in which R' is chosen from H and CH3, R2 is chosen from C10-C30 alkyl radicals, such as alkyl radicals comprising from 12 to 22 carbon atoms, and a crosslinking agent; such as polymers derived from 95% to 60% by weight of the acrylic acid (hydrophilic unit), 4%
to 40% by weight of C10-C30 alkyl acrylate (hydrophobic unit), and 0% to 6% by weight of crosslinking polymerizable monomer, or polymers derived from 98% to 96% by weight of the acrylic acid (hydrophilic unit), 1% to 4% by weight of C 10-C30 alkyl acrylate (hydrophobic unit) and 0.1 %
to 0.6% by weight of crosslinking polymerizable monomer; or (2) acrylic acid and lauryl methacrylate, such as the polymers formed from 66%
by weight of acrylic acid and 34% by weight of lauryl methacrylate.
The crosslinking agent may be a monomer comprising a group (V) I
CH2=C (V) with at least one other polymerizable group whose unsaturated bonds are not conjugated with respect to one another. Mention may be made, for example, of polyallyl ethers such as polyallylsucrose and polyallyl pentaerythritol.
Among said polymers above mention may be made, for example, of the products sold by the company Noveon under the trade names Pemulen TR1, Pemulen TR2, Carbopol 1382, and further, for example, Pemulen TR1, and the product sold by the company S.E.P.C. under the name Coatex SX.
Suitable anionic amphiphilic fatty-chain polymers, include for example the methacrylic acid/methyl acrylate/ethoxylated alkyl dimethyl-meta-isopropenylbenzylisocyanate copolymer sold under the name Viscophobe DB 1000 by the company Amerchol.
Further suitable anionic amphiphilic fatty-chain polymers, include polymers having the INCI
designation Acrylates/Ceteth-20 Itaconate Copolymer (sold by the company National Starch under the name Structure 3001) and Acrylates/Steareth-20 Itaconate Copolymer (sold by the company National Starch under the name Structure 2001).
The cationic amphiphilic polymers used are, for example, chosen from quaternized cellulose derivatives and polyacrylates comprising amino side groups.
Representative anionic amphiphilic polymers that may be used may further be chosen from polymers formed from a mixture of monomers comprising:
(1) acrylic acid, an ester of formula (IV) below:
CH2=CR'-COOR2 (IV) in which R' is chosen from H and CH3, R2 is chosen from C10-C30 alkyl radicals, such as alkyl radicals comprising from 12 to 22 carbon atoms, and a crosslinking agent; such as polymers derived from 95% to 60% by weight of the acrylic acid (hydrophilic unit), 4%
to 40% by weight of C10-C30 alkyl acrylate (hydrophobic unit), and 0% to 6% by weight of crosslinking polymerizable monomer, or polymers derived from 98% to 96% by weight of the acrylic acid (hydrophilic unit), 1% to 4% by weight of C 10-C30 alkyl acrylate (hydrophobic unit) and 0.1 %
to 0.6% by weight of crosslinking polymerizable monomer; or (2) acrylic acid and lauryl methacrylate, such as the polymers formed from 66%
by weight of acrylic acid and 34% by weight of lauryl methacrylate.
The crosslinking agent may be a monomer comprising a group (V) I
CH2=C (V) with at least one other polymerizable group whose unsaturated bonds are not conjugated with respect to one another. Mention may be made, for example, of polyallyl ethers such as polyallylsucrose and polyallyl pentaerythritol.
Among said polymers above mention may be made, for example, of the products sold by the company Noveon under the trade names Pemulen TR1, Pemulen TR2, Carbopol 1382, and further, for example, Pemulen TR1, and the product sold by the company S.E.P.C. under the name Coatex SX.
Suitable anionic amphiphilic fatty-chain polymers, include for example the methacrylic acid/methyl acrylate/ethoxylated alkyl dimethyl-meta-isopropenylbenzylisocyanate copolymer sold under the name Viscophobe DB 1000 by the company Amerchol.
Further suitable anionic amphiphilic fatty-chain polymers, include polymers having the INCI
designation Acrylates/Ceteth-20 Itaconate Copolymer (sold by the company National Starch under the name Structure 3001) and Acrylates/Steareth-20 Itaconate Copolymer (sold by the company National Starch under the name Structure 2001).
The cationic amphiphilic polymers used are, for example, chosen from quaternized cellulose derivatives and polyacrylates comprising amino side groups.
The quaternized cellulose derivatives are, for example, chosen from;
quaternized celluloses modified with groups comprising at least one fatty chain, such as alkyl, arylalkyl and alkylaryl groups comprising at least 8 carbon atoms, and mixtures thereof, quaternized hydroxyethylcelluloses modified with groups comprising at least one fatty chain, such as alkyl, arylalkyl and alkylaryl groups comprising at least 8 carbon atoms, and mixtures thereof.
Quaternized and non-quaternized polyacrylates comprising amino side groups having for example, hydrophobic groups, such as Steareth 20 (polyoxy-ethylenated(20) stearyl alcohol) and (C 10-C30)alkyl PEG-20 itaconate.
The alkyl radicals borne by the above quaternized celluloses and hydroxyethylcelluloses, for example, contain from 8 to 30 carbon atoms. The aryl radicals, for example, are chosen from phenyl, benzyl, naphthyl and anthryl groups.
Examples of quaternized alkylhydroxyethyl-celluloses comprising C8-C30 fatty chains are the products Quatrisoft LM 200, Quatrisoft LM-X 529-18-A, Quatrisoft LM-X 529-18B
(C 12 alkyl) and Quatrisoft LM-X 529-8 (C 18 alkyl) sold by the company Amerchol, and the products Crodacel QM, Crodacel QL (C 12 alkyl) and Crodacel QS (C 18 alkyl) sold by the company Croda.
Examples of polyacrylates comprising amino side chains is Structure Plus from the company National Starch.
Among amphoteric amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit, mention may be made, for example, of methacrylamidopropyltrimethylammonium chloride/acrylic acid/C 10-C30 alkyl methacrylate copolymers, wherein the alkyl radical is, for example, a stearyl radical.
(ii) Among the crosslinked acrylic acid homopolymers that may be mentioned are those crosslinked with an allylic alcohol ether of the sugar series, such as the products sold under the names Carbopo1980, 981, 954, 2984 and 5984 by the company Noveon or the products sold under the names Synthalen M, Synthalen L and Synthalen K by the company 3V
Sigma.
(iii) Crosslinked copolymers of (meth)acrylic acid and of C1-C6 alkyl acrylate may be chosen from crosslinked copolymers of methacrylic acid and of ethyl acrylate as an aqueous dispersion comprising 38% active material sold, for example, under the name Viscoatex 538C by the company Coatex, and crosslinked copolymers of acrylic acid and of ethyl acrylate as an aqueous dispersion comprising 28% active material sold under the name Aculyn 33 by the company Rohm & Haas. Crosslinked copolymers of methacrylic acid and of ethyl acrylate include an aqueous dispersion comprising 30% active material manufactured and sold under the name Carbopol Aqua SF-1 by the company Noveon.
quaternized celluloses modified with groups comprising at least one fatty chain, such as alkyl, arylalkyl and alkylaryl groups comprising at least 8 carbon atoms, and mixtures thereof, quaternized hydroxyethylcelluloses modified with groups comprising at least one fatty chain, such as alkyl, arylalkyl and alkylaryl groups comprising at least 8 carbon atoms, and mixtures thereof.
Quaternized and non-quaternized polyacrylates comprising amino side groups having for example, hydrophobic groups, such as Steareth 20 (polyoxy-ethylenated(20) stearyl alcohol) and (C 10-C30)alkyl PEG-20 itaconate.
The alkyl radicals borne by the above quaternized celluloses and hydroxyethylcelluloses, for example, contain from 8 to 30 carbon atoms. The aryl radicals, for example, are chosen from phenyl, benzyl, naphthyl and anthryl groups.
Examples of quaternized alkylhydroxyethyl-celluloses comprising C8-C30 fatty chains are the products Quatrisoft LM 200, Quatrisoft LM-X 529-18-A, Quatrisoft LM-X 529-18B
(C 12 alkyl) and Quatrisoft LM-X 529-8 (C 18 alkyl) sold by the company Amerchol, and the products Crodacel QM, Crodacel QL (C 12 alkyl) and Crodacel QS (C 18 alkyl) sold by the company Croda.
Examples of polyacrylates comprising amino side chains is Structure Plus from the company National Starch.
Among amphoteric amphiphilic polymers comprising at least one hydrophilic unit and at least one fatty-chain unit, mention may be made, for example, of methacrylamidopropyltrimethylammonium chloride/acrylic acid/C 10-C30 alkyl methacrylate copolymers, wherein the alkyl radical is, for example, a stearyl radical.
(ii) Among the crosslinked acrylic acid homopolymers that may be mentioned are those crosslinked with an allylic alcohol ether of the sugar series, such as the products sold under the names Carbopo1980, 981, 954, 2984 and 5984 by the company Noveon or the products sold under the names Synthalen M, Synthalen L and Synthalen K by the company 3V
Sigma.
(iii) Crosslinked copolymers of (meth)acrylic acid and of C1-C6 alkyl acrylate may be chosen from crosslinked copolymers of methacrylic acid and of ethyl acrylate as an aqueous dispersion comprising 38% active material sold, for example, under the name Viscoatex 538C by the company Coatex, and crosslinked copolymers of acrylic acid and of ethyl acrylate as an aqueous dispersion comprising 28% active material sold under the name Aculyn 33 by the company Rohm & Haas. Crosslinked copolymers of methacrylic acid and of ethyl acrylate include an aqueous dispersion comprising 30% active material manufactured and sold under the name Carbopol Aqua SF-1 by the company Noveon.
(iv) Among the nonionic homopolymers or copolymers comprising ethylenically unsaturated monomers of ester and/or amide type, mention may be made of the products sold under the names: Cyanamer P250 by the company Cytec (polyacrylamide); PMMA MBX-8C by the company US Cosmetics (methyl methacrylate/ethylene glycol dimethacrylate copolymer);
Acryloid B66 by the company Rohm & Haas (butyl methacrylate/methyl methacrylate copolymer); BPA 500 by the company Kobo (polymethyl methacrylate).
(v) Ammonium acrylate homopolymers that may be mentioned include the product sold under the name Microsap PAS 5193 by the company Hoechst.
Copolymers of ammonium acrylate and of acrylamide include the product sold under the name Bozepol C Nouveau or the product PAS 5193 sold by the company Hoechst (which are described and prepared in documents FR-2 416 723, U.S. Pat. Nos. 2,798,053 and 2,923,692).
(vi) The polysaccharides are, for example, chosen from glucans, modified and unmodified starches (such as those derived, for example, from cereals, for instance wheat, corn or rice, from vegetables, for instance yellow pea, and tubers, for instance potato or cassaya), amylose, amylopectin, glycogen, dextrans, celluloses and derivatives thereof (methylcelluloses, hydroxyalkylcelluloses, ethyl hydroxyethylcellu loses, and carboxymethylcelluloses), mannans, xylans, lignins, arabans, galactans, galacturonans, chitin, chitosans, glucuronoxylans, arabinoxylans, xyloglucans, glucomannans, pectic acids and pectins, alginic acid and alginates, arabinogalactans, carrageenans, agars, glycosaminoglucans, succinoglucans, gum arabics, gum tragacanths, ghatti gums, karaya gums, carob gums, galactomannans, such as guar gums, and nonionic derivatives thereof (hydroxypropyl guar) and xanthan gums, and mixtures thereof.
For example, suitable polysaccharides are described in "Encyclopedia of Chemical Technology", Kirk-Othmer, Third Edition, 1982, volume 3, pp. 896-900, and volume 15, pp.
439-458, in "Polymers in Nature" by E. A. MacGregor and C. T. Greenwood, published by John Wiley &
Sons, Chapter 6, pp. 240-328,1980, and in "Industrial Gums-Polysaccharides and their Derivatives", edited by Roy L. Whistler, Second Edition, published by Academic Press Inc., the content of these three publications being entirely incorporated by reference.
For example, starches, guar gums and celluloses and derivatives thereof may be used. Suitable starches include for example, of macromolecules in the form of polymers comprising elemental moieties that are anhydroglucose units. The number of these moieties and their assembly make it possible to distinguish between amylose (linear polymer) and amylopectin (branched polymer).
The relative proportions of amylose and of amylopectin, and also their degree of polymerization, may vary as a function of the botanical origin of the starches. The botanical origin of the starch molecules used may be cereals or tubers. Thus, the starches may be, for example, chosen from corn starch, rice starch, cassaya starch, tapioca starch, barley starch, potato starch, wheat starch, sorghum starch and pea starch. Starches are generally in the form of a white powder, which is insoluble in cold water and which has an elementary particle size ranging from 3 to 100 microns.
The starches may optionally be C 1-C6 hydroxyalkylated or C 1-C6 acylated (such as acetylated).
5 The starches may also have undergone heat treatments. Distarch phosphates or of compounds rich in distarch phosphate, for instance the products sold under the references Prejel VA-70-T
AGGL (gelatinized hydroxypropylated cassaya distarch phosphate) or Prejel TK1 (gelatinized cassaya distarch phosphate) or Preje1200 (gelatinized acetylated cassaya distarch phosphate) by the company Avebe, or Structure ZEA from National Starch (hydroxypropylated corn distarch 10 phosphate), Structure XL from National Starch (hydroxypropylated starch phosphate) may also be used.
The guar gums may be modified or unmodified. The unmodified guar gums are, for example, the products sold under the name Vidogum GH 175 by the company Unipectine and under the names Meyro-Guar 50 and Jaguar C by the company Meyhall. The modified nonionic guar gums are, 15 for example, modified with C1-C6 hydroxyalkyl groups. Among hydroxyalkyl groups, mention may be made, for example, of hydroxymethyl, hydroxyethyl, hydroxypropyl and hydroxybutyl groups. These guar gums are well known in the state of the art and may be prepared, for example, by reacting corresponding alkene oxides, such aspropylene oxides, with guar gum so as to obtain a guar gum modified with hydroxypropyl groups. The degree of hydroxyalkylation, which 20 corresponds to the number of alkylene oxide molecules consumed by the number of free hydroxyl functions present on the guar gum, may, for example, range from 0.4 to 1.2.
Such nonionic guar gums optionally modified with hydroxyalkyl groups are sold, for example, under the trade names Jaguar HP8, Jaguar HP60 and Jaguar HP 120, Jaguar DC 293 and Jaguar HP 105 by the company Rhodia Chimie (Meyhall) or under the name Galactasol 4H4FD2 by the 25 company Aqualon.
Suitable celluloses include for example, hydroxyethylcellulose and hydroxypropylcelluloses, such as the products sold under the names Klucel EF, Klucel H, Klucel LHF, Klucel MF and Klucel G by the company Aqualon.
(vii) The C 12 - C30 fatty alcohols are, for example, chosen from myristyl alcohol, cetyl alcohol, stearyl alcohol, behenyl alcohol or mixture thereof. When fatty alcohols are used as thickeners, at least one additional surfactant with HLB value above about 6 is commonly included to form bi-layers with fatty alcohols. The most useful bi-layer structures include gel network phase where parallel bi-layers of fatty alcohols are swollen by water forming semi-solid creams, and vesicle dispersions where fatty alcohols bi-layers are curved into approximately spherical uni-lamellar or multi-lamellar aggregates.
(viii) The particulate and crystalline thickeners are for example, clays, fumed silica, microcrystalline cellulose, trihydroxystearin (ThixcinR), ethyleneglycol mono-and di-stearate or mixture thereof. The particulate or crystalline thickeners work via mechanisms well known in the art, for example particle aggregation, "house of card" particle an:angement or crystalline fiber formation.
Conditioningagent: The compositions of the present invention may comprise or are used in combination with a composition comprising a conditioning agent in an amount of at least about 0.01% by weight, especially from 0.1 % to 10% by weight. Conditioning agents suitable for use herein are selected from silicone materials, amino silicones, fatty alcohols, polymeric resins, polyol carboxylic acid esters, cationic polymers, cationic surfactants, insoluble oils and oil derived materials and mixtures thereof. Additional materials include mineral oils and other oils such as glycerin and sorbitol.
The conditioning agent will generally be used at levels of from about 0.05% to about 20% by weight of the composition, preferably of from about 0.1% to about 15% by weight, more preferably of from about 0.2% to about 10% by weight, even more preferably of from about 0.2% to about 2% by weight.
Particularly useful conditioning materials are cationic polymers. Conditioners of cationic polymer type may be chosen from those already know by those skilled in the art as improving at least one cosmetic properties of keratin fibres treated with a cosmetic composition. Cationic polymers may be chosen from those comprising units of at least one amine group chosen from primary, secondary, tertiary and quatemary amine groups that may either form part of the main polymer chain, or be borne by a side substituant that is directly attached to the main polymer chain. Such cationic polymers generally have a number average molecular mass ranging from 500 to 5,000,000, or more preferably from 1000 to 3,000,000. Polymers of the polyamine, polyamino amide and polyquaternary ammonium type that may be used include but are not limited to:
(1) homopolymers and copolymers derived from acrylic or methacrylic esters or amides.
Copolymers of these polymers may also comprise at least one unit derived from comonomers which may be chosen from the family of acrylamides, methacrylamides, diacetone acylamides, acrylamides and methacrylicamides substituted on the nitrogen with at least one group chosen from lower (C 1-C4) alkyls, acrylic and methacrylic acids and esters thereof, vinlylactams such as vinlypyrrolidone and vinylcaprolactam, and vinyl esters. Examples of such polymers include:
Copolymers of acrylamide and of methacryloyloxyethyltrimethylammonium methosulfate, examples of which include polymers known via the INCI nomenclature as Polquaternium-5, such as the products sold under the names Reten 210, Reten 220, Reten 230, Reten 240, Reten 1104, Reten 1105, Reten 1006 by the company Hercules and Merquat 5, Merquat 5 SF by the company Nalco.
Copolymers of vinylpyrrolidone and dimethylaminopropyl methacrylamide, examples of which include polymers known via the INCI nomenclature as Polyquatemium-28, such as the products sold under the name Gafquat HS-100 by the company International Speciality Products (ISP).
Copolymers of vinyl pyrrolidone and dialkyaminoalkyl acrylates or methactylates, examples of which include polymers known via the INCI nomenclature as Polquaternium-11, such as the products sold under the name Gafquat 440, Gafquat 734, Gafquat 755, Gafquat 755N by the company International Speciality Products (ISP), and Luviquat PQ 11 PM by the company BASF
and Polyquat-11 SL by the company Sino Lion.
Copolymers vinylpyrrolidone, dimethylaminopropyl methacrylamide and methacryloylaminopropyl lauryldimonium chloride, examples of which include polymers known via the INCI nomenclature as polyquaternium-55, such as the products sold under the name Styleze W-20 by the company International Speciality Products (ISP).
Copolymers of acrylic acid, acrylamide and methacrylamidopropyltrimonium chloride, examples of which include polymers known via the INCI nomenclature as Polyquaternium-53, such as the products sold under the name Merquat 2003 by the company Nalco.
Copolymers of dimethyaminopropylacrylate (DMAPA), acrylic acid and acrylonitrogens and diethyl sulfate, examples of which include polymers known via the INCI
nomenclature as Polyquaternium-31, such as the products sold under the name Hypan QT100 by the company Lipo.
Copolymers of acrylamide, acrylamidopropyltrimonium chloride, 2-amidopropylacrylamide sulfonate, and dimethyaminopropylacrylate (DMAPA), examples of which include polymers known via the INCI nomenclature as polyquaternium-43, such as the products sold under the name Bozequat 4000 by the company Clairant.
Copolymers of acrylic acid, methylacrylate and methacrylamidopropyltrimonium chloride, examples of which include polymers known via the INCI nomenclature as Polyquaternium-47, such as the products sold under the name Merquat 2001 and Merquat 2001N sold commercially by Nalco.
Acryloid B66 by the company Rohm & Haas (butyl methacrylate/methyl methacrylate copolymer); BPA 500 by the company Kobo (polymethyl methacrylate).
(v) Ammonium acrylate homopolymers that may be mentioned include the product sold under the name Microsap PAS 5193 by the company Hoechst.
Copolymers of ammonium acrylate and of acrylamide include the product sold under the name Bozepol C Nouveau or the product PAS 5193 sold by the company Hoechst (which are described and prepared in documents FR-2 416 723, U.S. Pat. Nos. 2,798,053 and 2,923,692).
(vi) The polysaccharides are, for example, chosen from glucans, modified and unmodified starches (such as those derived, for example, from cereals, for instance wheat, corn or rice, from vegetables, for instance yellow pea, and tubers, for instance potato or cassaya), amylose, amylopectin, glycogen, dextrans, celluloses and derivatives thereof (methylcelluloses, hydroxyalkylcelluloses, ethyl hydroxyethylcellu loses, and carboxymethylcelluloses), mannans, xylans, lignins, arabans, galactans, galacturonans, chitin, chitosans, glucuronoxylans, arabinoxylans, xyloglucans, glucomannans, pectic acids and pectins, alginic acid and alginates, arabinogalactans, carrageenans, agars, glycosaminoglucans, succinoglucans, gum arabics, gum tragacanths, ghatti gums, karaya gums, carob gums, galactomannans, such as guar gums, and nonionic derivatives thereof (hydroxypropyl guar) and xanthan gums, and mixtures thereof.
For example, suitable polysaccharides are described in "Encyclopedia of Chemical Technology", Kirk-Othmer, Third Edition, 1982, volume 3, pp. 896-900, and volume 15, pp.
439-458, in "Polymers in Nature" by E. A. MacGregor and C. T. Greenwood, published by John Wiley &
Sons, Chapter 6, pp. 240-328,1980, and in "Industrial Gums-Polysaccharides and their Derivatives", edited by Roy L. Whistler, Second Edition, published by Academic Press Inc., the content of these three publications being entirely incorporated by reference.
For example, starches, guar gums and celluloses and derivatives thereof may be used. Suitable starches include for example, of macromolecules in the form of polymers comprising elemental moieties that are anhydroglucose units. The number of these moieties and their assembly make it possible to distinguish between amylose (linear polymer) and amylopectin (branched polymer).
The relative proportions of amylose and of amylopectin, and also their degree of polymerization, may vary as a function of the botanical origin of the starches. The botanical origin of the starch molecules used may be cereals or tubers. Thus, the starches may be, for example, chosen from corn starch, rice starch, cassaya starch, tapioca starch, barley starch, potato starch, wheat starch, sorghum starch and pea starch. Starches are generally in the form of a white powder, which is insoluble in cold water and which has an elementary particle size ranging from 3 to 100 microns.
The starches may optionally be C 1-C6 hydroxyalkylated or C 1-C6 acylated (such as acetylated).
5 The starches may also have undergone heat treatments. Distarch phosphates or of compounds rich in distarch phosphate, for instance the products sold under the references Prejel VA-70-T
AGGL (gelatinized hydroxypropylated cassaya distarch phosphate) or Prejel TK1 (gelatinized cassaya distarch phosphate) or Preje1200 (gelatinized acetylated cassaya distarch phosphate) by the company Avebe, or Structure ZEA from National Starch (hydroxypropylated corn distarch 10 phosphate), Structure XL from National Starch (hydroxypropylated starch phosphate) may also be used.
The guar gums may be modified or unmodified. The unmodified guar gums are, for example, the products sold under the name Vidogum GH 175 by the company Unipectine and under the names Meyro-Guar 50 and Jaguar C by the company Meyhall. The modified nonionic guar gums are, 15 for example, modified with C1-C6 hydroxyalkyl groups. Among hydroxyalkyl groups, mention may be made, for example, of hydroxymethyl, hydroxyethyl, hydroxypropyl and hydroxybutyl groups. These guar gums are well known in the state of the art and may be prepared, for example, by reacting corresponding alkene oxides, such aspropylene oxides, with guar gum so as to obtain a guar gum modified with hydroxypropyl groups. The degree of hydroxyalkylation, which 20 corresponds to the number of alkylene oxide molecules consumed by the number of free hydroxyl functions present on the guar gum, may, for example, range from 0.4 to 1.2.
Such nonionic guar gums optionally modified with hydroxyalkyl groups are sold, for example, under the trade names Jaguar HP8, Jaguar HP60 and Jaguar HP 120, Jaguar DC 293 and Jaguar HP 105 by the company Rhodia Chimie (Meyhall) or under the name Galactasol 4H4FD2 by the 25 company Aqualon.
Suitable celluloses include for example, hydroxyethylcellulose and hydroxypropylcelluloses, such as the products sold under the names Klucel EF, Klucel H, Klucel LHF, Klucel MF and Klucel G by the company Aqualon.
(vii) The C 12 - C30 fatty alcohols are, for example, chosen from myristyl alcohol, cetyl alcohol, stearyl alcohol, behenyl alcohol or mixture thereof. When fatty alcohols are used as thickeners, at least one additional surfactant with HLB value above about 6 is commonly included to form bi-layers with fatty alcohols. The most useful bi-layer structures include gel network phase where parallel bi-layers of fatty alcohols are swollen by water forming semi-solid creams, and vesicle dispersions where fatty alcohols bi-layers are curved into approximately spherical uni-lamellar or multi-lamellar aggregates.
(viii) The particulate and crystalline thickeners are for example, clays, fumed silica, microcrystalline cellulose, trihydroxystearin (ThixcinR), ethyleneglycol mono-and di-stearate or mixture thereof. The particulate or crystalline thickeners work via mechanisms well known in the art, for example particle aggregation, "house of card" particle an:angement or crystalline fiber formation.
Conditioningagent: The compositions of the present invention may comprise or are used in combination with a composition comprising a conditioning agent in an amount of at least about 0.01% by weight, especially from 0.1 % to 10% by weight. Conditioning agents suitable for use herein are selected from silicone materials, amino silicones, fatty alcohols, polymeric resins, polyol carboxylic acid esters, cationic polymers, cationic surfactants, insoluble oils and oil derived materials and mixtures thereof. Additional materials include mineral oils and other oils such as glycerin and sorbitol.
The conditioning agent will generally be used at levels of from about 0.05% to about 20% by weight of the composition, preferably of from about 0.1% to about 15% by weight, more preferably of from about 0.2% to about 10% by weight, even more preferably of from about 0.2% to about 2% by weight.
Particularly useful conditioning materials are cationic polymers. Conditioners of cationic polymer type may be chosen from those already know by those skilled in the art as improving at least one cosmetic properties of keratin fibres treated with a cosmetic composition. Cationic polymers may be chosen from those comprising units of at least one amine group chosen from primary, secondary, tertiary and quatemary amine groups that may either form part of the main polymer chain, or be borne by a side substituant that is directly attached to the main polymer chain. Such cationic polymers generally have a number average molecular mass ranging from 500 to 5,000,000, or more preferably from 1000 to 3,000,000. Polymers of the polyamine, polyamino amide and polyquaternary ammonium type that may be used include but are not limited to:
(1) homopolymers and copolymers derived from acrylic or methacrylic esters or amides.
Copolymers of these polymers may also comprise at least one unit derived from comonomers which may be chosen from the family of acrylamides, methacrylamides, diacetone acylamides, acrylamides and methacrylicamides substituted on the nitrogen with at least one group chosen from lower (C 1-C4) alkyls, acrylic and methacrylic acids and esters thereof, vinlylactams such as vinlypyrrolidone and vinylcaprolactam, and vinyl esters. Examples of such polymers include:
Copolymers of acrylamide and of methacryloyloxyethyltrimethylammonium methosulfate, examples of which include polymers known via the INCI nomenclature as Polquaternium-5, such as the products sold under the names Reten 210, Reten 220, Reten 230, Reten 240, Reten 1104, Reten 1105, Reten 1006 by the company Hercules and Merquat 5, Merquat 5 SF by the company Nalco.
Copolymers of vinylpyrrolidone and dimethylaminopropyl methacrylamide, examples of which include polymers known via the INCI nomenclature as Polyquatemium-28, such as the products sold under the name Gafquat HS-100 by the company International Speciality Products (ISP).
Copolymers of vinyl pyrrolidone and dialkyaminoalkyl acrylates or methactylates, examples of which include polymers known via the INCI nomenclature as Polquaternium-11, such as the products sold under the name Gafquat 440, Gafquat 734, Gafquat 755, Gafquat 755N by the company International Speciality Products (ISP), and Luviquat PQ 11 PM by the company BASF
and Polyquat-11 SL by the company Sino Lion.
Copolymers vinylpyrrolidone, dimethylaminopropyl methacrylamide and methacryloylaminopropyl lauryldimonium chloride, examples of which include polymers known via the INCI nomenclature as polyquaternium-55, such as the products sold under the name Styleze W-20 by the company International Speciality Products (ISP).
Copolymers of acrylic acid, acrylamide and methacrylamidopropyltrimonium chloride, examples of which include polymers known via the INCI nomenclature as Polyquaternium-53, such as the products sold under the name Merquat 2003 by the company Nalco.
Copolymers of dimethyaminopropylacrylate (DMAPA), acrylic acid and acrylonitrogens and diethyl sulfate, examples of which include polymers known via the INCI
nomenclature as Polyquaternium-31, such as the products sold under the name Hypan QT100 by the company Lipo.
Copolymers of acrylamide, acrylamidopropyltrimonium chloride, 2-amidopropylacrylamide sulfonate, and dimethyaminopropylacrylate (DMAPA), examples of which include polymers known via the INCI nomenclature as polyquaternium-43, such as the products sold under the name Bozequat 4000 by the company Clairant.
Copolymers of acrylic acid, methylacrylate and methacrylamidopropyltrimonium chloride, examples of which include polymers known via the INCI nomenclature as Polyquaternium-47, such as the products sold under the name Merquat 2001 and Merquat 2001N sold commercially by Nalco.
Copolymes of methacryloyl ethyl betaine, 2-hydroxyethyl methacrylate and methacryloyl ethyl trimethyl ammonium chloride, examples of which include polymers known via the INCI
nomenclature as Polyquaternium-48, such as the products sold under the name Plascize L-450 by the company Goo Chemcial.
Copolymers of acrylic acid diallyl dimethyl ammonium chloride and acrylamide, examples of which include polymers known via the INCI nomenclature as polyquatemium 39, such as the products sold under the name Merquat 3330 and Merquat 3331 by the company Nalco.
Further examples include copolymers of methacrylamide methacrylamido-propyltrimonium and methacryloylethyltrimethyl ammonium chloride and their derivatives, either homo or copolymerised with other monomers, examples of which include polymers known via the INCI
nomenclature as: Polyquatemium-8, Polyquaternium-9, Polyquaternium-12, Polyquaternium-13 Polyquaternium-14, Polyquaternium-15, such as the products sold under the name Rohagit KF
720 F by the company Rohm, Polyquatemium-30, such as the products sold under the name Mexomere PX by the company Chimex, Polyquaternium-33, Polyquatemium-35, Polyquatemium-36, such as the products sold under the name Plex 3074 L by the company Rhon, Polyquatemium 45, such as the products sold under the name Plex 3073L by the company Rohn, Polyquaternium 49, such as the products sold under the name Plascize L-440 by the company Goo Chemicals, Polyquaternium 50 such as the products sold under the name Plascize L-441 by the company Goo Chemicals, Polyquaternium-52.
(2) Cationic polysaccharides, such as cationic celluloses and cationic galactomannan gums.
Among the cationic polysaccharides that maybe mentioned, for example, are cellulose ether derivatives comprising quaternary ammonium groups and cationic cellulose copolymers or cellulose derivatives grafted with a water-soluble quaternary ammonium monomer and cationic galactomannan gums. Examples include but are not limited to:
Copolymers of hydroxyethylcelluloses and diallyldimethyl ammonium chlorides, examples of which include polymers known via the INCI nomenclature as Polyquaternium-4, such as the products sold under the name Celquat L 200 and Celquat H 100 by the company National Starch.
Copolymers of hydroxyethylcelluloses and a trimethyl ammonium substituted epoxide, examples of which include polymers known via the INCI nomenclature as Polyquaternium-10, such as the products sold under the name AEC Polyquaternium-10 by the company A&E
Connock, Catinal C-100 Catinal HC-35 Catinal HC-100 Catinal HC-200 Catinal LC-Catinal LC-200 by the company Toho, Celquat SC-240C Celquat SC-230M, by the company National Starch, Dekaquat 400, Dekaquat 3000 by the company Dekker, Leogard GP
by the company Akzo Nobel, RITA Polyquta 400 RITA, Polyquta 3000 by the company RITA, UCARE Polymer JR-125 UCARE Polymer JR-400 UCARE Polymer JR-30M UCARE Polymer LK UCARE Polymer LR 400 UCARE Polymer LR 30M by the company Amerchol.
Copolymers of hydroxyethylcelluloses and lauryl dimethyl ammonium substituted epoxides, examples of which include polymers known via the INCI nomenclature as Polyquatemium-24, such as the products sold under the name Quatrisoft polymer LM-200 by the company Amerchol.
Derivatives of Hydroxypropyl Guar, examples of which include polymers known via the INCI
nomenclature as Guar Hydroxypropyltrimonium Chloride, such as the products sold under the name Catinal CG-100, Catinal CG-200 by the company Toho, Cosmedia Guar C-261N, Cosmedia Guar C-261N, Cosmedia Guar C-261N by the company Cognis, DiaGum P
5070 by the company Freedom Chemical Diamalt, N-Hance Cationic Guar by the company Hercules/Aqualon, Hi-Care 1000, Jaguar C- 17, Jaguar C-2000, Jaguar C- 13 S, Jaguar C- 14S, Jaguar Excel by the company Rhodia, Kiprogum CW, Kiprogum NGK by the company Nippon Starch.
Hydroxypropyl derivatives of Guar Hydroxypropyltrimonium Chloride, examples of which include polymers known via the INCI nomenclature as Hydroxypropyl Guar Hydroxypropyltrimonium Chloride, such as the products sold under the name Jagaur C-162 by the company Rhodia.
(3) Polyamino amide derivatives resulting from the condensation of polyalkylene polyamines with polycarboxylic acids followed by alkylation with difunctional agents.
Among the derivative, mention may be made for example to adipic acid /
dimethylaminohydroxypropyl /
diethylenetriamine.
(4) Polymers obtained by reaction of a polyalkylene polyamine comprising two primary amines groups and at last one secondary amine group with a decarboxylic acid chosen from diglycolic acids and saturated aliphatic dicarboxylic acids comprising from 3 to 8 carbon atoms. Non-limiting examples of such derivatives include the adipic acid / epxoypropyl /
diethylenetriamine.
(5) Cyclopolymers of dialkdiallylamine or of dialkyldiallyammonium, among which polymers mention may be made of:
Dimethyldiallyammonium chloride polymers, examples of which include polymers known via the INCI nomenclature as Polyquatemium-6, such as the products sold under the name Merquat 100 by the company Nalco, Mirapol 100 by the company Rhodia, Rheocare CC6 by the company Cosmetic Rheologies, AEC polyquatemium-6 by the company A&E Connock, Agequat 400 by the company CPS, Conditioner P6 by the company 3V Inc., Flocare C106 by the company SNF, Genamin PDAC by the company Clariant, Mackemium 006 by the company McIntyre.
Copolymers of acrylamides and dimethyldiallylammonium chlorides monomers, examples of which include polymers known via the 1NCI nomenclature as Polyquatemium-7, such as the 5 products sold under the name AEC Polyquaternium-7 by the company A&E
Connock, Agequat-5008, Agequat C-505 by the company CPS, Conditioner P7 by the company 3V Inc.
Flocare C
107 by the company SNF Mackernium 007, Mackemium 007S by the company McIntyre, ME
Polymer 09W by the company Toho, Merquat 550, Merquat 2200, Merquat S by the company Nalco, Mirapol 550 by the company Rhodia, Rheocare CC7, Rheocare CCP7 by the company 10 Cosmetic Rheologies, Salcare HSP-7, Salcare SC10, Salcare Super 7 by the company Ciba.
Copolymers of dimethyldiallylammoniumchlorides and acrylic acids, examples of which include polymers known via the INCI nomenclature as polyquatemary-22, such as the products sold under the name Merquat 280 and Merquat 295 by the company Nalco.
(6) Quatemary diammonium polymers comprising repeating units of formula 15 [-N+(Rl)(R2) -A1-N+(R3)(R4)-B1-] [2X"], in which R', R2, R3 and R4, which may be identical or different, are chosen from aliphatic, alicyclic and arylaliphatic radicals comprising from 1 to 20 carbon atoms and from lower hydroxyalkylaliphatic radicals, or Rl, RZ, R3 and R4, together or separately, constitute, with the nitrogen atoms to which they are attached, heterocycles optionally comprising a second heteroatom other then nitrogen, or R', R2, R3 and R4, are choen 20 from liner or branched C1-C6 alkyl radicals substituted with at least one group chosen from nitrile, ester, acyl and amide groups and groups of -CO-O-R5-D and -CO-NH-R5-D
wherein R5 is chosen from alkylene groups and D is chosen from quatemary ammonium groups. A' and B1, which may be identical or different, are chosen from linear and branched, saturated or unsaturated polymethylene groups comprising 2 to 20 carbon atoms. The polymethylene groups 25 may comprise, linked to or intercalated in the main ring, at least one entity chosen from aromatic rings, oxygen and sulphur atoms and sulphoxide, sulphone, disulphide, amino, alkylamino, hydroxyl, quaternary, ammonium, ureido, amide and ester groups, and X" is an anion derived from inorganic and organic acids. D is chosen from a glycol residue, a bis-secondary diamine residue, a bis-primary diamine residue or a ureylene group. An examples of which include 30 polymers known via the INCI nomenclature as Hexadimethrine chloride, where Rt, R2, R3 and R4 are each methyl radicals, A' is (CH2)3 and Bl is (CH2)6 and X = Cl. Further examples of which include polymers known via the INCI nomenclature as polyquatemium-34 where Rland R2 are ethyl radicals and R3 and R4 are methyl radicals and A' is (CH2)3 and B1 is (CH2)3 and X = Br, such as the products sold under the name Mexomere PAX by the company Chimax.
nomenclature as Polyquaternium-48, such as the products sold under the name Plascize L-450 by the company Goo Chemcial.
Copolymers of acrylic acid diallyl dimethyl ammonium chloride and acrylamide, examples of which include polymers known via the INCI nomenclature as polyquatemium 39, such as the products sold under the name Merquat 3330 and Merquat 3331 by the company Nalco.
Further examples include copolymers of methacrylamide methacrylamido-propyltrimonium and methacryloylethyltrimethyl ammonium chloride and their derivatives, either homo or copolymerised with other monomers, examples of which include polymers known via the INCI
nomenclature as: Polyquatemium-8, Polyquaternium-9, Polyquaternium-12, Polyquaternium-13 Polyquaternium-14, Polyquaternium-15, such as the products sold under the name Rohagit KF
720 F by the company Rohm, Polyquatemium-30, such as the products sold under the name Mexomere PX by the company Chimex, Polyquaternium-33, Polyquatemium-35, Polyquatemium-36, such as the products sold under the name Plex 3074 L by the company Rhon, Polyquatemium 45, such as the products sold under the name Plex 3073L by the company Rohn, Polyquaternium 49, such as the products sold under the name Plascize L-440 by the company Goo Chemicals, Polyquaternium 50 such as the products sold under the name Plascize L-441 by the company Goo Chemicals, Polyquaternium-52.
(2) Cationic polysaccharides, such as cationic celluloses and cationic galactomannan gums.
Among the cationic polysaccharides that maybe mentioned, for example, are cellulose ether derivatives comprising quaternary ammonium groups and cationic cellulose copolymers or cellulose derivatives grafted with a water-soluble quaternary ammonium monomer and cationic galactomannan gums. Examples include but are not limited to:
Copolymers of hydroxyethylcelluloses and diallyldimethyl ammonium chlorides, examples of which include polymers known via the INCI nomenclature as Polyquaternium-4, such as the products sold under the name Celquat L 200 and Celquat H 100 by the company National Starch.
Copolymers of hydroxyethylcelluloses and a trimethyl ammonium substituted epoxide, examples of which include polymers known via the INCI nomenclature as Polyquaternium-10, such as the products sold under the name AEC Polyquaternium-10 by the company A&E
Connock, Catinal C-100 Catinal HC-35 Catinal HC-100 Catinal HC-200 Catinal LC-Catinal LC-200 by the company Toho, Celquat SC-240C Celquat SC-230M, by the company National Starch, Dekaquat 400, Dekaquat 3000 by the company Dekker, Leogard GP
by the company Akzo Nobel, RITA Polyquta 400 RITA, Polyquta 3000 by the company RITA, UCARE Polymer JR-125 UCARE Polymer JR-400 UCARE Polymer JR-30M UCARE Polymer LK UCARE Polymer LR 400 UCARE Polymer LR 30M by the company Amerchol.
Copolymers of hydroxyethylcelluloses and lauryl dimethyl ammonium substituted epoxides, examples of which include polymers known via the INCI nomenclature as Polyquatemium-24, such as the products sold under the name Quatrisoft polymer LM-200 by the company Amerchol.
Derivatives of Hydroxypropyl Guar, examples of which include polymers known via the INCI
nomenclature as Guar Hydroxypropyltrimonium Chloride, such as the products sold under the name Catinal CG-100, Catinal CG-200 by the company Toho, Cosmedia Guar C-261N, Cosmedia Guar C-261N, Cosmedia Guar C-261N by the company Cognis, DiaGum P
5070 by the company Freedom Chemical Diamalt, N-Hance Cationic Guar by the company Hercules/Aqualon, Hi-Care 1000, Jaguar C- 17, Jaguar C-2000, Jaguar C- 13 S, Jaguar C- 14S, Jaguar Excel by the company Rhodia, Kiprogum CW, Kiprogum NGK by the company Nippon Starch.
Hydroxypropyl derivatives of Guar Hydroxypropyltrimonium Chloride, examples of which include polymers known via the INCI nomenclature as Hydroxypropyl Guar Hydroxypropyltrimonium Chloride, such as the products sold under the name Jagaur C-162 by the company Rhodia.
(3) Polyamino amide derivatives resulting from the condensation of polyalkylene polyamines with polycarboxylic acids followed by alkylation with difunctional agents.
Among the derivative, mention may be made for example to adipic acid /
dimethylaminohydroxypropyl /
diethylenetriamine.
(4) Polymers obtained by reaction of a polyalkylene polyamine comprising two primary amines groups and at last one secondary amine group with a decarboxylic acid chosen from diglycolic acids and saturated aliphatic dicarboxylic acids comprising from 3 to 8 carbon atoms. Non-limiting examples of such derivatives include the adipic acid / epxoypropyl /
diethylenetriamine.
(5) Cyclopolymers of dialkdiallylamine or of dialkyldiallyammonium, among which polymers mention may be made of:
Dimethyldiallyammonium chloride polymers, examples of which include polymers known via the INCI nomenclature as Polyquatemium-6, such as the products sold under the name Merquat 100 by the company Nalco, Mirapol 100 by the company Rhodia, Rheocare CC6 by the company Cosmetic Rheologies, AEC polyquatemium-6 by the company A&E Connock, Agequat 400 by the company CPS, Conditioner P6 by the company 3V Inc., Flocare C106 by the company SNF, Genamin PDAC by the company Clariant, Mackemium 006 by the company McIntyre.
Copolymers of acrylamides and dimethyldiallylammonium chlorides monomers, examples of which include polymers known via the 1NCI nomenclature as Polyquatemium-7, such as the 5 products sold under the name AEC Polyquaternium-7 by the company A&E
Connock, Agequat-5008, Agequat C-505 by the company CPS, Conditioner P7 by the company 3V Inc.
Flocare C
107 by the company SNF Mackernium 007, Mackemium 007S by the company McIntyre, ME
Polymer 09W by the company Toho, Merquat 550, Merquat 2200, Merquat S by the company Nalco, Mirapol 550 by the company Rhodia, Rheocare CC7, Rheocare CCP7 by the company 10 Cosmetic Rheologies, Salcare HSP-7, Salcare SC10, Salcare Super 7 by the company Ciba.
Copolymers of dimethyldiallylammoniumchlorides and acrylic acids, examples of which include polymers known via the INCI nomenclature as polyquatemary-22, such as the products sold under the name Merquat 280 and Merquat 295 by the company Nalco.
(6) Quatemary diammonium polymers comprising repeating units of formula 15 [-N+(Rl)(R2) -A1-N+(R3)(R4)-B1-] [2X"], in which R', R2, R3 and R4, which may be identical or different, are chosen from aliphatic, alicyclic and arylaliphatic radicals comprising from 1 to 20 carbon atoms and from lower hydroxyalkylaliphatic radicals, or Rl, RZ, R3 and R4, together or separately, constitute, with the nitrogen atoms to which they are attached, heterocycles optionally comprising a second heteroatom other then nitrogen, or R', R2, R3 and R4, are choen 20 from liner or branched C1-C6 alkyl radicals substituted with at least one group chosen from nitrile, ester, acyl and amide groups and groups of -CO-O-R5-D and -CO-NH-R5-D
wherein R5 is chosen from alkylene groups and D is chosen from quatemary ammonium groups. A' and B1, which may be identical or different, are chosen from linear and branched, saturated or unsaturated polymethylene groups comprising 2 to 20 carbon atoms. The polymethylene groups 25 may comprise, linked to or intercalated in the main ring, at least one entity chosen from aromatic rings, oxygen and sulphur atoms and sulphoxide, sulphone, disulphide, amino, alkylamino, hydroxyl, quaternary, ammonium, ureido, amide and ester groups, and X" is an anion derived from inorganic and organic acids. D is chosen from a glycol residue, a bis-secondary diamine residue, a bis-primary diamine residue or a ureylene group. An examples of which include 30 polymers known via the INCI nomenclature as Hexadimethrine chloride, where Rt, R2, R3 and R4 are each methyl radicals, A' is (CH2)3 and Bl is (CH2)6 and X = Cl. Further examples of which include polymers known via the INCI nomenclature as polyquatemium-34 where Rland R2 are ethyl radicals and R3 and R4 are methyl radicals and A' is (CH2)3 and B1 is (CH2)3 and X = Br, such as the products sold under the name Mexomere PAX by the company Chimax.
(7) Polyquaternary ammonium polymers comprising repeating units of formula [-N+(R6)(R')-(CH2)r-NH-CO-(CH2)q-(CO)t-NH-(CH2)s-N+(Rg)(R9)-A-][2X"], in which R6, R7, R8 and R9 which may be identical or different, are chosen from a hydrogen atom and a methyl, ethyl, propyl, hydroxyethyl, hydroxypropyl, and -CH2CH2(OCH2CH2)pOH
radicals, wherein p is equal to 0 or an integer ranging from 1 to 6, wherein R6, R7, R8 and R9 do not all simultaneously represent a hydrogen atom. R and s which maybe identical or different are each an integer ranging from 1 to 6, q is equal to 0 or an integer ranging from 1 to 34 and X- is an anion such as a halide. T is an integer chosen to be equal to 0 or 1. A is chosen from divalent radicals such as -CH2-CH2-O-CH2-CH2-. Examples of which include Polymers known via the INCI nomenclature as polyquaternium-2, where r=s=3, q=0,t=0, R6, R', R 8 and R9 are methyl groups, and A is -CH2-CH2-O-CH2-CH2, such as the products sold under the name Ethpol PQ-2 from Ethox and Mirapol A-15 by the company Rhodia.
Polymers known via the INCI nomenclature as polyquaternium-17 where r=s=3, q=4, t=1, R6, R7, R8 and R9 are methyl groups, and A is --CH2-CH2-O-CH2--CH2.
Polymers known via the INCI nomenclature as Polyquaternium 18, where r=s=3, q=7, t=1, R6, R7, R8 and R9 are methyl groups, and A is -CH2-CH2-0-CH2-CH2 Polymers known via the INCI nomenclature as the block copolymer formed by the reaction of Polyquaternium-2 with Polyquatemium- 17, known as Polyquatemium 27, such as the products sold under the name Mirapol 175 by the company Rhodia.
(8) Copolymers of vinylpyrrolidones and of vinylimidazoles and optionally vinylcaprolactums, examples of which include polymers known via the INCI nomenclature as Polyquaternary-16 formed from methylvinylimidazolium chlorides and vinylpyrrolidones, such as the products sold under the name Luviquat FC370, Luviquat FC550, Luviquat FC905, Luviquat HM-552 by the company BASF. Or copolymers of vinylcaprolactams and vinylpyrrolidones with methylvinylimidazolium methosulfates, examples of which include polymers known via the INCI nomenclature as Polyquatemium-46, such as the products sold under the name Luviquat Hold by the company BASF. Or copolymers of vinylpyrrolidones and quatemized imidazolines, examples of which include polymers known via the INCI nomenclature poylquaterary 44, such as the products sold under the name Luviquat Care by the company BASF
(9) Polyamines such as the product Polyquart H sold by Cognis under the reference name polyethylene glycol (15) tallow polyamine in the CTFA dictionary.
(10) Cross linked methacryloyloxy(C 1-C4)alkyltri(C 1-C4)alkylammonium salt polymers such as the polymers obtained by homopolymerisation of dimethylaminoethyl methacrylates quatemized with methyl chloride, or by copolymerisation of acrylamides with dimethylaminoethyl methacrylates quatemized with methyl chloride, the homo or copolymerisation being followed by crosslinking with a compound comprising olefinic unsaturation, such as methylenebisacrylamides, examples of which include polymers known via the INCI
nomenclature as Polyquatemium-37, such as the products sold under the name Synthalen, CN
Synthalen CR, Synthalen CU, sold by 3V sigma, or as a dispersion in another media such as the products sold under the name Salcare SC95 and Salcare SC96 by the company Ciba or Rheocare CTH(E) by the company Cosmetic Rheologies. Or in another example of which include polymers known via the INCI nomenclature as Polyquatemium-32, or when sold as a dispersion in mineral oil such as the products sold under the name Salcare SC92 by the company Ciba.
(11) Further examples of cationic polymers include polymers known via the INCI
nomenclature as Polyquaternium 51, such as the products sold under the name Lipidure-PMB by the company NOF, via the INCI nomenclature as Polyquatemium 54, such as the products sold under the name Qualty-Hy by the company Mitsui, and via the INCI nomenclature as Polyquatemium 56 such as the products sold under the name Hairrol UC-4 by the company Sanyo chemicals.
(12) silicone polymers comprising cationic groups and/or groups which may be ionised into cationic groups. For example: cationic silicones of the general formula (R10-N+(CH3)2)-R"-(Si(CH3)2-O)x-R"-(N+(CH3)2)-Rl0), where Rl0 is an alkyl derived from coconut oil, and R" is (CH2CHOCH2O(CH2)3 and x is a number between 20 and 2000, examples of which include polymers known by the INCI nomenclature as Quaternium 80, such as the products sold under the name as Abil Quat 3272 and Abil Quat 3474 sold commercially by Goldschmidt.
Silicones containing groups which may be ionised into cationic groups, for example aminosilicones containing at least 10 repeating siloxane -(Si(CH3)2-0) units within the polymer chain, with either terminal, graft or a mixture of terminal and graft aminofunctional groups.
Example functional groups are not limited to aminoethylaminopropyl, aminoethylaminoisobutly, aminopropyl. In the case of graft polymers, the terminal siloxane units may either be (CH3)3Si-O or R12(CH3)2Si-O, where R12 may be either OH or OR13, where R' 3 is a CI-C8 alky group, or a mixture of both functional terminal groups. These silicones are also available as preformed emulsions. Polymer with terminal siloxane units of (CH3)3Si-O examples of which include polymers known by the INCI nomenclature as trimethylsilylamodimethicone, such as the products sold under the name as DC-2-8566, DC 7224 and DC-2-8220 sold commercially by Dow Coming and SF1708 and SM 2125 sold commercially by GE Silicones and Wacker Belsil ADM 653 sold commercially by Wacker silicones. Further examples include polymers with terminal siloxane units of (R12O)(CH3)2Si-O where R1z may be either OH or OR13, where R13 is a C 1-C8 alky group, or a mixture of both functional terminal groups, known by the INCI
nomenclature as amodimethicone, such as the products sold under the name as Wacker Belsil ADM 1100, Wacker Belsil ADM 1600, Wacker Belsil ADM 652, Wacker Belsil ADM
6057E, Wacker Belsil ADM 8020 sold commercial by Wacker Silicones, DC929, DC939 and sold commercially by Dow Coming and SM2059 sold commercially by GE silicones.
Silicones containing groups which may be ionised into cationic groups - for example silicones containing at least 10 repeating siloxane -(Si(CH3)2-O) units within the polymer chain, with either terminal, graft or a mixture of terminal and graft aminofunctional groups, together with additional functional groups. Additional functional groups may include polyoxyalkylene, the reaction product of amines and carbinols, alky chains. For example products know by the INCI
nomenclature as methoxy PEG/PPG-7/3 Aminopropyl Dimethicone, such as the product sold under the name of Abil Soft AF100 sold commercially by Degussa. For example products know by the INCI nomenclature as Bis (C13-15 Alkoxy) PG Amodimethicone, such as the product sold under the name of DC 8500 sold commercially by Dow Coming.
Surfactants: The compositions according to the present invention may further comprise one or more surfactants. Surfactants suitable for use herein generally have a lipophilic chain length of from about 8 to about 30 carbon atoms and may be selected from anionic, nonionic, amphoteric and cationic surfactants and mixtures thereof. The total level of surfactant is from about 0.5% to about 60% by weight, preferably from about 2% to about 30% by weight, more preferably from about 8% to about 25% by weight and especially from about 10% to about 20% by weight.
The compositions of the invention preferably comprise a mixture of anionic and amphoteric surfactants with one or more nonionic surfactants. Anionic components, where may be present in the range of from about 0.1 % to about 20% by weight, preferably from about 0.1 % to about 15% by weight, and more preferably from about 5% to about 15% by weight of the composition;
amphoteric or nonionic components, may independently be present is in the range from about 0.1 % to about 15% by weight, preferably from about 0.5% to about 10% by weight, more preferably from about 1% to about 8% by weight.
As examples of anionic surfactants, which may be used, alone or as mixtures, mention may be made, for example, of salts (such as alkaline salts, for example, sodium salts, ammonium salts, amine salts, amino alcohol salts and magnesium salts) of the following compounds: alkyl sulphates, alkyl ether sulphates, alkylamido ether sulphates, alkylarylpolyether sulphates, monoglyceride sulphates; alkyl sulphonates, alkyl phosphates, alkylamide sulphonates, alkylaryl sulphonates, a-olefin sulphonates, paraffin sulphonates; alkyl sulphosuccinates, alkyl ether sulphosuccinates, alkylamide sulphosuccinates; alkyl sulphosuccinamates; alkyl sulphoacetates;
alkyl ether phosphates; acyl sarcosinates; acyl isethionates and N-acyltaurates. The alkyl or acyl radical of all of these various compounds, for example, comprises from 8 to 24 carbon atoms, and the aryl radical, for example, is chosen from phenyl and benzyl groups.
Among the anionic surfactants, which may also be used, mention may also be made of fatty acid salts such as the salts of oleic, ricinoleic, palmitic and stearic acids, coconut oil acid or hydrogenated coconut oil acid; acyl lactylates in which the acyl radical comprises from 8 to 20 carbon atoms. Weakly anionic surfactants may also be used, such as alkyl-D-galactosiduronic acids and their salts, as well as polyoxyalkylenated (C6-C24) alkyl ether carboxylic acids, polyoxyalkylenated (C6-C24) alkylaryl ether carboxylic acids, polyoxyalkylenated (C6-C24) alkylamido ether carboxylic acids and their salts, for example, those comprising from 2 to 50 ethylene oxide groups, and mixtures thereof. Anionic derivatives of polysaccharides, for example carboxyalkyl ether of alkyl polyglucosides, may be also used.
The nonionic surfactants are compounds that are well known (see, for example, in this respect "Handbook of Surfactants" by M. R. Porter, published by Blackie & Son (Glasgow and London), 1991, pp. 116-178). They may be chosen, for example, from polyethoxylated, polypropoxylated and polyglycerolated fatty acids, alkyl phenols, c~-diols and alcohols comprising a fatty chain comprising, for example, from 8 to 18 carbon atoms, it being possible for the number of ethylene oxide or propylene oxide groups to range, for example, from 2 to 200 and for the number of glycerol groups to range, for example, from 2 to 30. Mention may also be made of copolymers of ethylene oxide and of propylene oxide, condensates of ethylene oxide and of propylene oxide with fatty alcohols; polyethoxylated fatty amides preferably having from 2 to 30 mol of ethylene oxide and their momoethanolamine and diethanolamine derivatives, polyglycerolated fatty amides, for example, comprising on average from 1 to 5, and such as from 1.5 to 4, glycerol groups; polyethoxylated fatty amines such as those containing from 2 to 30 mol of ethylene oxide; oxyethylenated fatty acid esters of sorbitan having from 2 to 30 mol of ethylene oxide;
fatty acid esters of sucrose, fatty acid esters of polyethylene glycol, alkylpolyglycosides, N-alkylglucamine derivatives, amine oxides such as (CIo-C14)alkylamine oxides or N-acylaminopropylmorpholine oxides.
The amphoteric surfactants may be chosen, for example, from aliphatic secondary and tertiary amine derivatives in which the aliphatic radical is chosen from linear and branched chains comprising from 8 to 22 carbon atoms and comprising at least one water-soluble anionic group (for example carboxylate, sulphonate, sulphate, phosphate or phosphonate); mention may also be made of (C8-C20)alkylbetaines, sulphobetaines, (C8-C20)alkylamido(C1-C6)alkylbetaines or (C8-C20)alkylamido(C1-C6)alkylsulphobetaines.
Among the amine derivatives, mention may be made of the products sold under the name Miranol, as described, for example, in U.S. Pat. Nos. 2,528,378 and 2,781,354 and having the structures of: R2-CON HCHZCHZ N+(R3)(R4)(CHZCOO )(VI) 5 in which: R2 is chosen from alkyl radicals derived from an acid R2-COOH
present in hydrolysed coconut oil, and heptyl, nonyl and undecyl radicals, R3 is a(3-hydroxyethyl group and R4 is a carboxymethyl group; and of R$-CONHCHZCH2-N(B)(C) (VII) wherein B represents -CH2CH2OX', C represents -(CH2)Z Y', with z=1 or 2, X' is chosen from the -CH2CH2-COOH group and a hydrogen atom, Y' is chosen from -COOH and 10 -CHZ-CHOH-SO3H radicals, R5 is chosen from alkyl radicals of an acid R5-COOH present in coconut oil or in hydrolysed linseed oil, alkyl radicals, such as C7, C9, C11 and C13 alkyl radicals, a C17 alkyl radical and its iso form, and unsaturated C 17 radical.
These compounds are classified in the CTFA dictionary, 5th edition, 1993, under the names disodium cocoamphodiacetate, disodium lauroamphodiacetate, disodium caprylamphodiacetate, disodium 15 capryloamphodiacetate, disodium cocoamphodipropionate, disodium lauroamphodipropionate, disodium caprylamphodipropionate, disodium capryloamphodipropionate, lauroamphodipropionic acid, and cocoamphodipropionic acid. Salts of diethyl aminopropyl cocoaspartamid may be also used.
The cationic surfactants may be chosen from: A) the quatemary ammonium salts of general 20 formula (VIII): [NR'R2R3R4]+ X- (VIII) wherein X- is an anion chosen from halides (chloride, bromide and iodide), (CZ-C6)alkyl sulphates, such as methyl sulphate, phosphates, alkyl and alkylaryl sulphonates, and anions derived from organic acids, such as acetate and lactate, and (i) the radicals R' to R3, which may be identical or different, are chosen from linear and branched 25 aliphatic radicals comprising from 1 to 4 carbon atoms, and aromatic radicals such as aryl and alkylaryl. The aliphatic radicals may comprise at least one hetero atom such as oxygen, nitrogen, sulphur and halogens. The aliphatic radicals are chosen, for example, from alkyl, alkoxy and alkylamide radicals, R4 is chosen from linear and branched alkyl radicals comprising from 16 to 30 carbon atoms.
30 The cationic surfactant is, for example, a behenyltrimethylammonium salt (for example a chloride or bromide).
(ii) the radicals Rl and R2, which may be identical or different, are chosen from linear and branched aliphatic radicals comprising from 1 to 4 carbon atoms, and aromatic radicals such as aryl and alkylaryl. The aliphatic radicals may comprise at least one hetero atom such as oxygen, nitrogen, sulphur and halogens. The aliphatic radicals are chosen, for example, from alkyl, alkoxy, alkylamide and hydroxyalkyl radicals comprising from about 1 to 4 carbon atoms;
R3 and R4, which may be identical or different, are chosen from linear and branched alkyl radicals comprising from 12 to 30 carbon atoms, the said alkyl radicals comprise at least one function chosen from ester and amide functions.
R3 and R4 are chosen, for example, from (C12-CZ2)alkylamido(C2-C6)alkyl and (C12-C22)alkylacetate radicals.
The cationic surfactant is, for example, a dicetyldimethyl ammonium salt (for example chloride);
B) the quatemary ammonium salts of imidazolinium, such as that of formula (IX) below:
Ro J
CEt~i-C. C-i1 -N(tt*)-CO-t{3 X.
(IX) in which R5 is chosen from alkenyl and alkyl radicals comprising from 8 to 30 carbon atoms, for example fatty acid derivatives of tallow, R6 is chosen from a hydrogen atom, CI -C4 alkyl radicals and alkenyl and alkyl radicals comprising from 8 to 30 carbon atoms, R7 is chosen from Cl-C4 alkyl radicals, R8 is chosen from a hydrogen atom and C1-C4 alkyl radicals, and X is an anion chosen from halides, phosphates, acetates, lactates, alkyl sulphates, alkyl sulphonates and alkylaryl sulphonates.
In one embodiment, R5 and R6 are, for example, a mixture of radicals chosen from alkenyl and alkyl radicals comprising from 12 to 21 carbon atoms, such as fatty acid derivatives of tallow, R7 is methyl and R8 is hydrogen. Such a product is, for example, Quatemium-27 (CTFA 1997) or Quaternium-83 (CTFA 1997), which are sold under the names "Rewoquat " W75, W90, W75PG and W75HPG by the company Witco, C) the diquaternary ammonium salts of formula (X):
Rjj:j Rii (Cfi1)_y-N-RJ4 R,a (X) in which R9 is chosen from aliphatic radicals comprising from about 16 to 30 carbon atoms, R10, R11, R12, R13 and R14, which may be identical or different, are chosen from hydrogen and alkyl radicals comprising from 1 to 4 carbon atoms, and X is an anion chosen from halides, acetates, phosphates, nitrates and methyl sulphates. Such diquatemary ammonium salts, for example, include propanetallowdiammonium dichloride; and D) the quatemary ammonium salts comprising at least one ester function, of formula (XI) below:
'R 17-~ (OCsH .1 4t-(Cft,140)xR,.6 X-is (XI) in which:
R15 is chosen from C 1-C6 alkyl radicals and C 1-C6 hydroxyalkyl and dihydroxyalkyl radicals;
R16 is chosen from: a radical Rl9C(O)-, linear and branched, saturated and unsaturated C1-C22 hydrocarbon-based radicals R20, and a hydrogen atom, R18 is chosen from: a radical R21C(O)-, linear and branched, saturated and unsaturated Cl-C6 hydrocarbon-based radicals R22, and a hydrogen atom, R 17, R19 and R2 1, which may be identical or different, are chosen from linear and branched, saturated and unsaturated C7-C21 hydrocarbon-based radicals; n, p and r, which may be identical or different, are chosen from integers ranging from 2 to 6; y is chosen from integers ranging from 1 to 10; x and z, which may be identical or different, are chosen from integers ranging from 0 to 10; X- is an anion chosen from simple and complex, organic and inorganic anions; with the proviso that the sum x+y+z is from 1 to 15, that when x is 0, then R16 is R20 and that when z is 0, then R18 is R22.
In one embodiment, the ammonium salts of formula (XV) may be used, in which:
R15 is chosen from methyl and ethyl radicals, x and y are equal to 1; z is equal to 0 or 1; n, p and r are equal to 2; R16 is chosen from: a radical R19C(O)-,methyl, ethyl and C14-hydrocarbon-based radicals, and a hydrogen atom; R17, R19 and R2 1, which may be identical or different, are chosen from linear and branched, saturated and unsaturated C7-C2 1, hydrocarbon-based radicals; R18 is chosen from: a radical R21C(O)- and a hydrogen atom.
Such compounds are sold, for example, under the names Dehyquart by the company Cognis, Stepanquat by the company Stepan, Noxamium by the company Ceca, and Rewoquat WE 18 by the company Rewo-Witco.
Chelants: According to the present invention the compositions may comprise chelants.
Chelants are well known in the art and refer to a molecule or a mixture of different molecules each capable of forming a chelate with a metal ion. Chelants are well known in the art and a non-exhaustive list thereof can be found in AE Martell & RM Smith, Critical Stability Constants, Vol. 1, Plenum Press, New York & London (1974) and AE Martell & RD Hancock, Metal Complexes in Aqueous Solution, Plenum Press, New York & London (1996) both incorporated herein by reference.
Chelants suitable for use herein are carboxylic acids (in particular aminocarboxylic acids), polyamines, phosphonic acids (in particular aminophosphonic acids) and polyphosphoric acids (in particular linear polyphosphoric acids), their salts and derivatives.
Examples of preferred chelants include ethylenediaminotetraacetic acid (EDTA), nitrilotriacetic acid, diethylenetriamine pentaacetic acid (DTPA), ethylenediamine disuccinic acid (EDDS), ethylenediamine diglutaric acid (EDGA), 2-hydroxypropylenediamine disuccinic acid (HPDS), glycinamide-N,N'-disuccinic acid (GADS), ethylenediamine-N-N'-diglutaric acid (EDDG), 2-hydroxypropylenediamine-N-N'-disuccinic acid (HPDDS), salts thereof and derivatives thereof.
Chelants may be incorporated into the composition of the present invention as stabilizers and or preservatives. In addition it has also been found that chelants provide hair fibre damage benefits and thus they may be utilized in order to further improve the hair damage profile of the present invention. Levels of chelants in the present invention may be as low as about 0.1 % by weight, preferably at least about 0.25% by weight, more preferably about 0.5% by weight, for the most effective chelants such as diamine-N,N'-dipolyacid chelants and monoamine monoamide-N,N'-dipolyacid chelants (for example EDDS). Less effective chelants will be more preferably used at levels of at least about 1% by weight, even more preferably above about 2% by weight of the composition, depending of the efficiency of the chelant. Levels as high as about 10% by weight may be used, but above this level significant formulation issues may arise.
Solvents: Suitable solvents for use in the compositions of the present invention include, but are not limited to, water, butoxydiglycol, 1,2-propylene glycol, glycerol, lower aliphatic alcohols (e.g. ethanol, n-propanol or isoproanol), ethoxydiglycol, isopropylalcohol, hexylene glycol, benzyl alcohol and dipropylene glycol.
Antioxidants or reducing a eg nts: Suitable antioxidants or reducing agents for use in the compositions of the present invention include, but are not limited to, ascorbic acid, thioglycolic acid and sodium sulfite.
The form of the oxidation dye precursor composition and also for the ready-to-apply dye mixture may be, for example, a solution, especially an aqueous or aqueous-alcoholic solution. However a particularly preferred form of the composition according to the invention is a cream, a gel or an emulsion. Its composition comprises a mixture of the dye ingredients with the conventional additive ingredients usually used in this type of preparation.
According to a preferred embodiment of the present invention dye powders or granules are mixed with an appropriate dye carrier mass prior to use to form the oxidation dye precursor composition. Particularly preferred is the use of the dye-containing pellets according to WO 2005/044208 which are mixed with an appropriate dye carrier mass prior to use to form the oxidation dye precursor composition. WO 2005/044208 herewith is explicitly incorporated herein by reference.
The ready-to-apply hair dye mixture according to the invention is preferably made by a method comprising mixing the oxidation dye precursor composition with a liquid oxidizing agent immediately prior to application.
Hydrogen peroxide, or its addition compounds with urea, melamine or sodium bromate, in the form of a 1 to 12 percent by weight, preferably 6 percent by weight, aqueous solution, is preferred as the oxidizing agent. Hydrogen peroxide is especially preferred.
The oxidation dye precursor composition and the oxidizing agent are mixed with each other in a weight ratio of from 5:1 to 1:3. A weight ratio of 1:1 to 1:2 is especially preferred.
The pH of the ready-to-apply hair dye mixture according to the invention is adjusted during the mixing of the preferred alkaline oxidation dye precursor composition with the mostly acidic oxidizing agent. The resulting pH value of the mixture is determined by the alkali content of the dye-carrying or oxidation dye precursor composition, the acid content of the oxidizing agent and the mixing ratio. The pH of the ready-to-apply hair dye composition amounts to 3 to 11, preferably from 6 to 10.5.
The pH values of both the oxidation dye precursor composition and the oxidizing agent-containing composition may both be adjusted by adding dilute organic or inorganic acids, such as phosphoric acid, ascorbic acid and lactic acid, or bases, such as monoethanolamine, triethanolamine, 2-amino-2-methyl-l-propanol, ammonia, sodium hydroxide, potassium hydroxide or tris(hydroxymethyl)aminomethane.
After mixing the above-described oxidation dye precursor composition with an oxidizing agent, an amount of the ready-to-apply hair dye mixture sufficient for dyeing the hair, generally from 60 to 200 grams, is applied to the hair.
5 The hair dye mixture is allowed to act on the hair after application for 10 to 45 minutes at 15 to C, preferably for 30 to 40 minutes at 30 C to 40 C. It is subsequently rinsed from the hair with water. If necessary the hair is washed with a shampoo after rinsing with water and perhaps with a dilute weak organic acid, for example citric or tartaric acid.
Subsequently the hair is dried.
10 The new p-phenylenediamine derivatives of formula (I) allow the creation of non-sensitizing oxidative hair dyes with good dyeing properties.
The examples below are intended to illustrate the subject-matter of the invention in more detail without limiting it thereto.
EXAMPLES
Example 1A to 3100A: Hair Dye Solution Dye carrier mass A: 10.0 g Sodium lauryl ether sulfate (28 % strength aqueous solution) 7.8 g Ethanol 0.3 g Ascorbic acid 0.3 g Sodium sulfite, anhydrous 0.3 g Ethylenediaminetetraacetic acid disodium salt hydrate 9.0 g Ammonium hydroxide (22 % strength aqueous solution) X g Dyes (according to the below-mentioned table 1) ad 100.0 g Water, demineralized The pH of the solution was between 10 and 10.5.
Immediately prior to application 50 g of the above-described dye carrier mass A were mixed with 50 grams of a 6% by weight aqueous hydrogen peroxide solution. The resulting ready-to-apply hair dye mixture was applied to the hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 B to 3100B: Hair Dye Cream Dye carrier mass B: 15.00 g Cetylstearylalcohol 2.30 g Glycerinmonostearate 0.80 g Lanolin 3,80 g Lanolinalcohol 3.50 g Sodium lauryl diglykolether sulfate (28 % strength aqueous solution) 1.42 g Steareth-20 7.80 g Ethanol 0.30 g Ascorbic acid 0.30 g Sodium sulfite, anhydrous 0.30 g ethylenediaminetetraacetic acid disodium salt hydrate 10.00 g Ammonium hydroxide (22 % strength aqueous solution) 0.20 g Perfume X g Dyes (according to the below-mentioned table 1) ad 100.00 g Water, demineralized The pH of the cream was between 9.5 and 10.5.
Immediately prior to application 75 g of the above-described dye carrier mass B were mixed with 50 grams of a 9% by weight aqueous hydrogen peroxide solution. The resulting ready-to-use hair dye mixture was applied to the hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 C to 3100C: Hair Dye Gel Dye carrier mass C: 15,00 g Oleic acid 3,00 g Glycerol 7,00 g Isopropanol 0,50 g Ascorbic acid 0,40 g Sodium sulfite, anhydrous 0,40 g Sodium hydroxide 10,00 g Ammonium hydroxide (25 % strength aqueous solution) X g Dyes (according to the below-mentioned table 1) ad 100,00 g Water, demineralized Immediately prior to application 100 g of the above-described dye carrier mass C were mixed with 100 grams of a 6% by weight aqueous hydrogen peroxide solution. The resulting ready-to-apply hair dye mixture was applied to the hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 D to 3100D: Hair Dye Dye carrier mass D: 9.500 g Propylene glycol 5.000 g Ammonium hydroxide 4.000 g Ethoxydiglycol 4.500 g Ethanolamine 1.000 g Oleic acid 6.000 g Hexylene glycol 3.500 g Cocamidopropyl betaine 0.300 g Oleth-10 0.300 g Oleth-2 1.500 g Dilinoleic acid 0.500 g C 12-C 15 Pareth-3 7.000 g Soytrimonium chloride 0.005 g Sodium metasilicate 0.500 g Erythorbic acid 0.300 g Ethylenediaminetetraacetic acid disodium salt 0.300 g Sodium sulfite X g Dyes (according to the below-mentioned table 1) ad 100.000 g Water, demineralized Immediately prior to application 75 g of the above-described dye carrier mass D were mixed with 50 grams of a 9% by weight aqueous hydrogen peroxide solution. The resulting ready-to-use hair dye mixture was applied to bleached hair in the required amount.
After an acting time of 40 minutes at 30 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 E to 3100E: Nonionic Hair Dye Dye carrier mass E: 7.00 g Cetylstearyl alcohol 2.00 g Glyceryl oleate 13.00 g Polysorbate 40 6.00 g Ceteareth-50 0.50 g Sodium sulfite, anhydrous 0.10 g Ethylenediaminetetraacetic acid disodium salt 8.00 g Ammonia (25% strength aqueous solution) X g Dyes (according to the below-mentioned table 1) ad 100.00 g Water Hydrogen peroxide emulsion 3.0 g Cetylstearyl alcohol 0.8 g PEG-25 cetyl/stearyl ether 0.3 g Lanolin alcohol 6.0 g Hydrogen peroxide 0.1 g Phosphoric acid (85% strength aqueous solution) ad 100.0 g Water 60 g of the above non-ionic dye carrier mass E were mixed prior to application with 60 g of the above hydrogen peroxide emulsion (pH = 2.5). The pH of the resulting ready-to-use hair dye composition was about 10. The resulting ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 F to 3100F: Hair Dye Dye carrier mass F: 0.100 g Sodium sulphite 0.200 g Ascorbic Acid 0.003 g Ethylenediaminetetraacetic acid disodium salt 0.200 g Citric Acid 4.000 g Ammonia (30% strength aqueous solution) 1.000 g Acrylates Copolymer (Aculyn(V 33A) 0.500 g Oleth 5 1.000 g Oleth 2 0.900 g Oleic Acid 3.000 g Cocamidopropyl betaine 0.050 g Etidronic Acid 1.000 g Trisodium Ethylenediamine disuccinate 2.500 g Isopropyl alcohol 8.600 g Hydrogen Peroxide (35% aqueous solution) 3.000 g Soytrimonium Chloride and propylene glycol 0.003 g Simethicone 1.000 g Steareth-21 0.500 g PEG-50 Hydrogenated Palmamide 0.200 g Oleyl Alcohol 0.500 g Acrylates Steareth-20 Methacrylate Copolymer (Aculyn 22) 2.000 g Propylene Glycol 4.200 g Ethoxy Diglycol 0.500 g C 11-15 Pareth-9 0.800 g C12-15 Pareth-3 X g Dyes (according to the below-mentioned table 1) ad 100.000 g Water The pH of the ready-to-use hair dye composition was about 10. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 40 minutes at 30 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 G to 3100G: Hair Dye Dye carrier mass G: 0.100 g Sodium sulphite 0.200 g Ascorbic Acid 0.003 g Ethylenediaminetetraacetic acid disodium salt 0.200 g Citric Acid 4.000 g Ammonia (30% strength aqueous solution) 1.000 g Acrylates Copolymer (Aculyn 33A) 0.500 g Oleth 5 1.000 g Oleth 2 0.900 g Oleic Acid 5 3.000 g Cocamidopropyl betaine 0.050 g Etidronic Acid 1.000 g Trisodium Ethylenediamine disuccinate 2.500 g Isopropyl alcohol 13.000 g Hydrogen Peroxide (35% aqueous solution) 10 3.000 g Soytrimonium Chloride and propylene glycol 0.003 g Simethicone 1.000 g Steareth-21 0.500 g PEG-50 Hydrogenated Palmamide 0.200 g Oleyl Alcohol 15 1.000 g Acrylates Steareth-20 Methacrylate Copolymer (Aculyn 22) 2.000 g Propylene Glycol 4.200 g Ethoxy Diglycol 0.500 g C 11-15 Pareth-9 0.800 g C12-15 Pareth-3 20 X g Dyes (according to the below-mentioned table 1) ad 100.000 g Water The pH of the ready-to-use hair dye composition was about 10. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 30 minutes 25 at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 H to 3100H: Hair Dye Dye carrier mass H: 0.1 g Sodium sulphite 30 0.1 g Ascorbic Acid 5.0 g Ammonium Carbonate 0.1 g Potassium Hydrogen Carbonate 0.2 g Ammonium Acetate 2.0 g Crodafos CES
1.0 g Ceteareth-25 (Volpo CS25) 2.0 g Stearyl Alcohol 0.3 g Sodium Hydroxide (50% aqueous solution) 0.1 g Ethylenediaminetetraacetic acid tetrasodium salt 0.5 g Etidronic Acid 8.6 g Hydrogen Peroxide (35% aqueous solution) 0.2 g Polyquatemium-22 (Merquat 295) 0.2 g Polyquaternium-37 & Mineral oil (Salcare SC95) 0.1 g Styrene-PVP Copolymer (Polectron 430) 0.1 g Xanthan gum 2.0 g Cetyl Alcohol 1.0 g Acrylates copolymer (Aculyn 33) X g Dyes (according to the below-mentioned table 1) ad 100.0 g Water The pH of the ready-to-use hair dye composition was about 9. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 40 minutes at 30 C
the hair was washed with a shampoo, rinsed with water and dried.
Example lI to 31001: Hair Dye Dye carrier mass I: 0.1 g Sodium sulphite 0.1 g Ascorbic Acid 6.0 g Ammonium Carbonate 0.1 g Potassium Hydrogen Carbonate 0.2 g Ammonium Acetate 2.0 g Cetearyl Alcohol (and) Dicetyl Phosphate (and) Ceteth-10 Phosphate (Crodafos CES) 0.3 g Sodium Hydroxide (50% aqueous solution) 0.1 g Ethylenediaminetetraacetic acid tetrasodium salt 0.5 g Etidronic Acid 8.6 g Hydrogen Peroxide (35% aqueous solution) 1.0 g Amodimethicone (Belsil ADM1100) 0.5 g Styrene-PVP Copolymer (Polectron 430) 0.5 g Acrylates/C 10-30 Alkyl Acrylate Crosspolymer 1.0 g Acrylates Steareth-20 Methacrylate Copolymer (Aculyn 22) 1.0 g Acrylates copolymer (Aculyn 33) X g Dyes (according to the below-mentioned table 1) ad 100.0 g Water The pH of the ready-to-use hair dye composition was about 9. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 30 minutes at 40 C
the hair was washed with a shampoo, rinsed with water and dried.
Example 1 K to 3100K: Hair Dye Synthesis of dye pellets accordiniz to WO 2005/044208 (general method for producing pellets of each dye mixture 1 to 3100): In a Glatt fluidized bed granulator and coater, 400 g of the respective dye mixture 1 to 3100 according to table 1 were heated to a product temperature of 34 C with air at an incoming air temperature of 90 C and an air flow rate of 18 m3/h. A 20 %
aqueous polyvinylpyrrolidone solution ("spraying solution") was then sprayed onto this mixture at an initial spraying rate of 8 g/min and at a spraying air pressure of 0.5 bar. In the course of the granulation process, the spraying rate was increased to 12 g/min and the incoming air temperature was increased to 100 C, while the air flow rate was raised to a maximum of 30 m3/h. The product temperature was kept at about 30-31 C throughout the entire procedure. After 310 g of the polyvinylpyrrolidone solution had been sprayed on, the pellets were dried at a maximum product temperature of 57 C and then cooled to about 30 C and screened.
Before use these pellets (comprising the dye combinations 1 to 3100 as described in the below-mentioned table 1) were mixed with the following peroxide solution or emulsion in a 1:1 ratio.
Hydrogen Peroxide Emulsion: 9.00 g Hydrogen peroxide 1.80 g Cetylstearyl alcohol 3.30 g Polyvinylpyrrolidone-styrene copolymer 0.20 g Disodium phosphate 0.20 g Sodium laurylsulfate 0.10 g Salicylic acid 0.08 g Phosphoric acid to 100.00 g Water, demineralized The resulting ready-to-apply dye mixture was applied to the hair in the required amount. After an acting time of 40 minutes at 30 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 L to 3100 L: Hair Dye Synthesis of dye pellets accordiniz to WO 2005/044208 (general method for producing pellets of each dye mixture 1 to 3100): In a Glatt fluidized bed granulator and coater, 400 g of the respective dye mixture 1 to 3100 according to table 1 were heated to a product temperature of 34 C with air at an incoming air temperature of 90 C and an air flow rate of 18 m3/h. A 20 %
aqueous polyvinylpyrrolidone solution ("spraying solution") was then sprayed onto this mixture at an initial spraying rate of 8 g/min and at a spraying air pressure of 0.5 bar. In the course of the granulation process, the spraying rate was increased to 12 g/min and the incoming air temperature was increased to 100 C, while the air flow rate was raised to a maximum of 30 m3/h. The product temperature was kept at about 30-31 C throughout the entire procedure. After 310 g of the polyvinylpyrrolidone solution had been sprayed on, the pellets were dried at a maximum product temperature of 57 C and then cooled to about 30 C and screened.
Before use these pellets (comprising one of the dye combinations 1 to 3100 as described in the below-mentioned table 1) were included in one of the above dye carrier masses A to I as the "Xg Dyes (according to the below-mentioned table 1)" in the needed ratio. Then 60 g of the resulting composition were mixed with 60 grams of a 6% by weight aqueous hydrogen peroxide solution.
The resulting ready-to-apply hair dye mixture was applied to the hair in the required amount.
After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Table 1: Dye Combinations 1 to 3100 Example No. Dye Combination 1. 0.250g methoxymethyl-p-phenylenediamine + 0.120g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g m-aminophenol 2. 2.500g methoxymethyl-p-phenylenediamine + 1.250g resorcinol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-amino-2-hydroxytoluene 3. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-methyl-5-hydroxyethylaminophenol 4. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methylresorcinol 5. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-4-hydroxyethylaminoanisole 6. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 1-naphthol 7. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-chlororesorcinol 8. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3-hydroxypyridine 9. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 10. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 11. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 12. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 13. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 14. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 1-naphthol 15. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 5 16. 0.296g methoxymethyl-p-phenylenediamine dihydrochloride + 0. 145g resorcinol +
0.317g 1-hydroxyethyl-4,5-diaminopyrazole sulfate + 0.080g m-aminophenol +
0.720g 2-amino-3-hydroxypyridine 17. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-10 diaminophenoxyethanol 18. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 19. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-15 hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g methylresorcinol 20. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 20 21. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 22. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-25 chlororesorcinol 23. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 24. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-30 hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 25. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-methylresorcinol 26. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-4-hydroxyethylaminoanisole 27. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 1-naphthol 28. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 4-chlororesorcinol 29. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-3-hydroxypyridine 30. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2,4-diaminophenoxyethanol 31. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 32. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 33. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 34. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxypyridine 35. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 36. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 1-naphthol 37. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 4-chlororesorcinol 38. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 39. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2,4-diaminophenoxyethanol 40. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 41. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 42. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 43. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-hydroxypyridine 44. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 45. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 46. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g m-aminophenol 47. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 48. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 49. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g p-aminophenol + 1.313g 2-methylresorcinol 50. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 51. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g p-aminophenol + 0.263g 1-naphthol 52. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g p-aminophenol + 0.263g 4-chlororesorcinol 53. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 2-amino-3-hydroxypyridine 54. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 55. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 56. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 57. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 58. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 59. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 1-naphthol 60. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 61. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 62. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 63. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 64. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 65. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 66. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 67. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 68. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 69. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 70. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 71. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethyl-aminoanisole 72. 0.822g methoxymethyl-p-phenylenediamine sulfate + 1.050g resorcinol +
2.162g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 73. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 74. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 75. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 76. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 77. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 78. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 79. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 80. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 5 81. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 82. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 83. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol 10 + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 84. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 85. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 15 86. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 87. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 88. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol 20 + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 89. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 90. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 25 91. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 92. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 4-amino-2-hydroxytoluene 93. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g 3-methyl-p-30 aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 94. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 95. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 96. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 3-methyl-p-aminophenol + 1.313g 1-naphthol 97. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-chlororesorcinol 98. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 99. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 100. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 101. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 102. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 103. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 104. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 1-naphthol 105. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 106. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 107. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 108. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 109. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 110. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 111. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1 -naphthol 112. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 113. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 114. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 115. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 116. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 117. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1 -naphthol 118. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 119. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 120. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 121. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 122. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1 -naphthol 123. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 124. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 125. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 126. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 127. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 128. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 129. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 130. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 131. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 132. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 133. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 134. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 135. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 136. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g m-aminophenol 137. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 138. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol 139. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methylresorcinol 140. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 141. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 1-naphthol 142. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-chlororesorcinol 143. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-amino-3-hydroxypyridine 144. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2,4-diaminophenoxyethanol 145. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 146. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 147. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 148. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 149. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1 -naphthol 150. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 151. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 152. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 153. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-5 hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g methyl-5-hydroxyethylaminophenol 154. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 10 155. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 156. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-15 naphthol 157. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 158. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g resorcinol + 2.000g N,N-Bis(2-20 hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g amino-3-hydroxypyridine 159. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 25 160. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-methylresorcinol 161. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
30 2.100g 2-amino-4-hydroxyethylaminoanisole 162. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 1-naphthol 163. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 164. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-3-hydroxypyridine 165. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2,4-diaminophenoxyethanol 166. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 167. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 168. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 169. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxypyridine 170. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 171. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 1-naphthol 172. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 4-chlororesorcinol 173. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 174. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2,4-diaminophenoxyethanol 175. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 176. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 177. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 178. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2-amino-hydroxypyridine 179. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 180. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 181. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol 182. 1.667g methoxymethyl-p-phenylenediamine + 1.750g resorcinol + 1.750g m-aminophenol 183. 3.333g methoxymethyl-p-phenylenediamine + 0.500g resorcinol + 2.320g 4-amino-2-hydroxytoluene + 0.100g 2-amino-5-ethylphenol hydrochloride 184. 1.667g methoxymethyl-p-phenylenediamine + 1.750g resorcinol + 1.750g 2-methyl-5-hydroxyethylaminophenol 185. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 2-methylresorcinol 186. 1.667g methoxymethyl-p-phenylenediamine + 1.750g resorcinol + 1.750g 2-amino-4-hydroxyethylaminoanisole 187. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 1-naphthol 188. 3.333g methoxymethyl-p-phenylenediamine + 3.500g resorcinol + 3.500g 4-chlororesorcinol 189. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 2-amino-3-hydroxypyridine 190. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 2,4-diaminophenoxyethanol 191. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene 192. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 193. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g m-aminophenol + 2.625g 2-methylresorcinol 194. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g m-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 195. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g m-aminophenol + 0.263g 1-naphthol 196. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g m-aminophenol + 0.263g 4-chlororesorcinol 197. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g m-aminophenol + 1.313g 2-amino-3-hydroxypyridine 198. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g m-aminophenol + 1.313 g 2,4-diaminophenoxyethanol 199. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2-methyl-5-hydroxyethylaminophenol 200. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methylresorcinol 201. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-4-hydroxyethylaminoanisole 202. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 1-naphthol 203. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 4-chlororesorcinol 204. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-3-hydroxypyridine 205. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2,4-diaminophenoxyethanol 206. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol 207. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 208. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1-naphthol 209. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-chlororesorcinol 210. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 211. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 212. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 2-methylresorcinol + 0.263g 2-amino-4-hydroxyethylaminoanisole 213. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methylresorcinol + 1.313g 1 -naphthol 214. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methylresorcinol + 1.313g 4-chlororesorcinol 215. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 216. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-methylresorcinol + 2.625g 2,4-diaminophenoxyethanol 217. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1 -naphthol 218. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-chlororesorcinol 219. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-amino-3-hydroxypyridine 220. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2,4-diaminophenoxyethanol 221. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 1-naphthol +
1.313g 4-chlororesorcinol 5 222. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 1 -naphthol +
1.313g 2-amino-3-hydroxypyridine 223. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 1 -naphthol +
1.313g 2,4-diaminophenoxyethanol 224. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 4-10 chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 225. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 4-chlororesorcinol + 2.625g 2,4-diaminophenoxyethanol 226. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 15 227. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 228. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 20 229. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 230. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol 25 231. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 232. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 233. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-30 aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 234. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 235. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 236. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 237. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 238. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 239. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 240. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 241. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 242. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 243. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 244. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 245. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 246. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 247. 0.200g methoxymethyl-p-phenylenediamine + 0.050g resorcinol + 0.012g m-aminophenol + 0.077g 2-amino-4-hydroxyethylaminoanisole sulfate + 0.021 g 2-amino-3-hydroxypyridine 248. 1.000g methoxymethyl-p-phenylenediamine + 0.050g resorcinol + 1.050g m-aminophenol + 0.079g 2-amino-4-hydroxyethylaminoanisole + 0.095g 2,4-diaminophenoxyethanol sulfate 249. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 250. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 251. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 252. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 253. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 254. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 255. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 256. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.214g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 257. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1 -naphthol 258. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 259. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 260. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 261. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 262. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 263. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 264. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-3 -hydroxypyridine 265. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 266. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 267. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 268. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 269. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 270. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 271. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 272. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 273. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol +.1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 274. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 275. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 276. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 277. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 278. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 279. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 280. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 281. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 282. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 283. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 284. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 285. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 286. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 5 287. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 288. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 10 289. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 290. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-15 diaminophenoxyethanol 291. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 292. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-20 chlororesorcinol 293. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-hydroxypyridine 294. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-25 methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 295. 2.000g methoxymethyl-p-phenylenediamine + 2. 1 00g resorcinol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 296. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-30 methylresorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 297. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 298. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 299. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 300. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2, l00g 2-amino-3-hydroxypyridine + 2. lOOg 2,4-diaminophenoxyethanol 301. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 302. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 303. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 304. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 305. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 306. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 307. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 1-naphthol +
1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 308. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g resorcinol + 2. l00g 1-naphthol +
2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 309. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 310. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 311. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 312. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-amino-2-hydroxytoluene 313. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-methyl-5-hydroxyethylaminophenol 314. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methylresorcinol 315. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-4-hydroxyethylaminoanisole 316. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 317. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-chlororesorcinol 318. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-3-hydroxypyridine 319. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 320. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 321. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 322. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 323. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 324. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 1-naphthol 325. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-chlororesorcinol 326. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 327. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 328. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 329. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 330. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 331. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 332. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 0.150g 4-[(2-hydroxyethyl)-amino]-3-nitrophenol 333. 1.000g methoxymethyl-p-phenylenediamine + 0.850g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 3-amino-2,6-dimethylphenol + 0.750g amino-3-hydroxypyridine + 0.100g 4-[(3-hydroxypropyl)amino]-3-nitrophenol 334. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 335. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-methylresorcinol 336. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-4-hydroxyethylaminoanisole 337. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 1-naphthol 338. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 4-chlororesorcinol 339. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-3 -hydroxypyridine 340. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2,4-diaminophenoxyethanol 341. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxyethylaminoanisole 342. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 1-naphthol 343. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 344. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxypyridine 345. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 346. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 1-naphthol 347. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 4-chlororesorcinol 348. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-5 hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2-amino-3 -hydroxypyridine 349. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 10 350. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 351. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 15 352. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1 -naphthol + 1.050g 2,4-diaminophenoxyethanol 353. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-20 hydroxypyridine 354. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 355. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-25 hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-3-hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 356. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g p-aminophenol + 2.625g resorcinol 357. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g p-30 aminophenol + 2.625g 4-amino-2-hydroxytoluene 358. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 359. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g p-aminophenol + 1.313g 2-methylresorcinol 360. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 361. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g p-aminophenol + 0.263g 1-naphthol 362. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g p-aminophenol + 1.313g 4-chlororesorcinol 363. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 364. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 365. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 366. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 367. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 368. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 369. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 370. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 371. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 372. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 373. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 374. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 375. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 376. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 377. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 378. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 379. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 380. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 381. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 382. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 383. 1.500g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 0.200g phenyl-methylpyrazolone 384. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 385. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 386. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 387. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 388. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 389. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 390. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 391. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 392. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 393. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 394. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 395. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 396. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 397. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 1 -naphthol + 0.210g 2,4-diaminophenoxyethanol 398. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 399. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 400. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 401. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 3-methyl-p-aminophenol + 2.625g resorcinol 402. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 403. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 404. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 405. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 406. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 3-methyl-p-aminophenol + 2.625g 1-naphthol 407. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-chlororesorcinol 408. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 409. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 410. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 411. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 412. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 413. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 414. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 415. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 416. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 417. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 418. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-5 hydroxyethylaminophenol 419. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 420. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-10 hydroxyethylaminoanisole 421. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g m-aminophenol + 2.000g methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1 -naphthol 422. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 15 423. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 424. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-20 diaminophenoxyethanol 425. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 426. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-25 methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 427. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 30 428. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 429. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 430. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 431. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 432. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 433. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 434. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 435. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 436. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 437. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 438. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 439. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 440. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 441. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 442. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 1 -naphthol + 1.050g 2,4-diaminophenoxyethanol 443. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 444. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 445. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 446. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g resorcinol 447. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 448. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol 449. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-methylresorcinol 450. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 451. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 1 -naphthol 452. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 4-chlororesorcinol 453. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 454. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2,4-diaminophenoxyethanol 455. 0.879g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 456. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 457. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 2.830g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methylresorcinol 458. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 459. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 1-naphthol 460. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-chlororesorcinol 461. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 462. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 463. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol 464. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol 465. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole 466. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 1-naphthol 467. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 468. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-3-hydroxypyridine 469. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2,4-diaminophenoxyethanol 470. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 471. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 472. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 473. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 474. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l 00g 2-amino-3 -hydroxypyridine 475. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 476. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 477. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 478. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 479. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-5 Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 480. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 10 481. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 482. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole 15 + 1.050g 4-chlororesorcinol 483. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 484. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-20 Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 485. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 25 486. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 487. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2,4-30 diaminophenoxyethanol 488. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 489. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 490. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-3-hydroxypyridine +
1.050g 2,4-diaminophenoxyethanol 491. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g resorcinol 492. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 493. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g resorcinol + 2.625g 2-methyl-5-hydroxyethylaminophenol 494. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g resorcinol + 1.313g 2-methylresorcinol 495. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g resorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 496. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g resorcinol + 1.313g 1-naphthol 497. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g resorcinol + 2.625g 4-chlororesorcinol 498. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g resorcinol + 0.263g 2-amino-3-hydroxypyridine 499. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g resorcinol + 2.625g 2,4-diaminophenoxyethanol 500. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 501. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 502. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 503. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol 504. 1.000g methoxyrnethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 505. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 506. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 507. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 508. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 509. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 510. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 511. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 512. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 513. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 514. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 515. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 516. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 517. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 518. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 519. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 520. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 521. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 522. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 523. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 524. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 525. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 526. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 527. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 528. 0.500g methoxymethyl-p-phenylenediamine + 0.525g m-aminophenol 529. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 4-amino-2-hydroxytoluene 530. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 2-methyl-5-hydroxyethylaminophenol 531. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 2-methylresorcinol 532. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 2-amino-4-hydroxyethylaminoanisole 533. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 1-naphthol 534. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 4-chlororesorcinol 535. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 2-amino-3-hydroxypyridine 536. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 2,4-diaminophenoxyethanol 537. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2-methyl-5-hydroxyethylaminophenol 538. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methylresorcinol 539. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-4-hydroxyethylaminoanisole 540. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 1-naphthol 541. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 542. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-3-hydroxypyridine 543. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2,4-diaminophenoxyethanol 544. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-methylresorcinol 545. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 546. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1-naphthol 547. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 4-chlororesorcinol 548. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-3-hydroxypyridine 549. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2,4-diaminophenoxyethanol 5 550. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g methylresorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 551. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methylresorcinol + 1.313g 1-naphthol 552. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-10 methylresorcinol + 1.313g 4-chlororesorcinol 553. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methylresorcinol + 2.625g 2-amino-3-hydroxypyridine 554. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methylresorcinol + 2.625g 2,4-diaminophenoxyethanol 15 555. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1-naphthol 556. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-chlororesorcinol 557. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-amino-20 4-hydroxyethylaminoanisole + 1.313g 2-amino-3-hydroxypyridine 558. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2,4-diaminophenoxyethanol 559. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 1-naphthol + 1.313g 4-chlororesorcinol 25 560. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol +
1.313g 1-naphthol + 1.313g 2-amino-3-hydroxypyridine 561. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 1-naphthol + 1.313g 2,4-diaminophenoxyethanol 562. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-30 chlororesorcinol + 2.625g 2-amino-3-hydroxypyridine 563. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-chlororesorcinol + 2.625g 2,4-diaminophenoxyethanol 564. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-amino-3-hydroxypyridine + 2.625g 2,4-diaminophenoxyethanol 565. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g m-aminophenol + 2.l00g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 566. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-hydroxyethylaminoanisole 567. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 568. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 569. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-hydroxypyridine 570. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 571. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 572. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 573. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 574. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 575. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 576. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 577. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 578. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-hydroxypyridine 579. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 580. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 581. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 582. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 583. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 584. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 585. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 586. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxyethylaminoanisole 587. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 588. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 589. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxypyridine 590. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 591. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 1 -naphthol 592. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 4-chlororesorcinol 593. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 594. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2,4-diaminophenoxyethanol 595. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 596. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 597. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 598. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-hydroxypyridine 599. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 600. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 601. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 602. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 603. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-hydroxypyridine 604. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 605. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 606. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 607. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 608. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3 -hydroxypyridine 609. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 610. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 611. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 612. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 613. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 614. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-5 hydroxypyridine 615. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 616. 4.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-10 4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 617. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 618. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-15 naphthol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 619. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 620. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-20 diaminophenoxyethanol 621. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 622. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g m-aminophenol 25 623. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methyl-5-hydroxyethylaminophenol 624. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methylresorcinol 30 625. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-4-hydroxyethylaminoanisole 626. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 1 -naphthol 627. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-chlororesorcinol 628. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-3-hydroxypyridine 629. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 630. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 631. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.l00g resorcinol + 2.l00g 2-methyl-5-hydroxyethylaminophenol 632. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.090g 4-[(2-hydroxyethyl)amino]-3-nitrophenol 633. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 634. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.l00g resorcinol + 2.100g 1-naphthol 635. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 4-chlororesorcinol 636. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-amino-hydroxypyridine 637. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 638. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 639. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 640. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 641. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 1-naphthol 642. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 643. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 644. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 645. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 646. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 647. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1 -naphthol 648. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 649. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 650. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 651. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g amino-4-hydroxyethylaminoanisole 652. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g naphthol 653. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g chlororesorcinol 654. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g amino-3-hydroxypyridine 655. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 656. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 657. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 658. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 659. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 660. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 661. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 662. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1 -naphthol + 1.050g 2,4-diaminophenoxyethanol 663. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g amino-3 -hydroxypyridine 664. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 665. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-3-hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 666. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g p-aminophenol + 1.313g resorcinol 667. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g m-aminophenol 668. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 669. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g 2-methylresorcinol 670. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 671. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 1-naphthol 672. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 4-chlororesorcinol 673. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g 2-amino-3-hydroxypyridine 674. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 675. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g m-aminophenol 676. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 677. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol 678. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 679. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 680. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 681. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 682. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 683. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 684. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 685. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 686. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 1-naphthol 687. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 688. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 689. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 690. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 691. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 692. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 693. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 694. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 695. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 696. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.100g 2-amino-6-chloro-4-nitrophenol 697. 1.000g methoxymethyl-p-phenylenediamine + 0.600g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 0.300g 2-methylresorcinol + 1.050g 1-acetoxy-2-methylnaphthalene + 0.100g 2-chloro-6-ethylamino-4-nitrophenol 698. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 699. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3 -hydroxypyridine 700. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 701. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 702. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 703. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 704. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 705. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 706. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 707. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 708. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 709. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 710. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 711. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g resorcinol 712. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 713. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 714. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 715. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 716. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 1-naphthol 717. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 718. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 719. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 3-methyl-p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 720. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 721. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 722. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol 723. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 724. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3 -methyl-p-aminophenol + 2.100g resorcinol + 2.100g 1 -naphthol 725. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 726. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 727. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2. l00g resorcinol + 2. l00g 2,4-diaminophenoxyethanol 728. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2. l00g m-aminophenol + 2.l04g 2-methyl-5-hydroxyethylaminophenol 729. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.l00g m-aminophenol + 2.l00g 2-methylresorcinol 730. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 731. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 1 -naphthol 732. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 733. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 734. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 735. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-methylresorcinol 736. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-amino-4-hydroxyethylaminoanisole 737. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 1-naphthol 738. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 739. 2.000g methoxymethyl-p-phenylenediamine + 0.600g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 0.500g 2-methyl-5-hydroxyethylaminophenol +
0.900g 2-amino-3-hydroxypyridine + 0.010g picramic acid +0.040g HC Yellow No. 13 740. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2,4-diaminophenoxyethanol + 0.200g 2-hydroxyethyl picramic acid 741. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 742. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 743. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 744. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 745. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 746. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 1-naphthol 747. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 4-chlororesorcinol 748. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3 -hydroxypyridine 749. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 750. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 751. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 752. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 753. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 754. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 755. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 756. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g resorcinol 757. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g m-aminophenol 758. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol 759. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-methylresorcinol 760. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 761. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 1-naphthol 762. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 4-chlororesorcinol 763. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 764. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2,4-diaminophenoxyethanol 765. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol 766. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g methyl-5-hydroxyethylaminophenol 767. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g methylresorcinol 768. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g amino-4-hydroxyethylaminoanisole 769. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g naphthol 770. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g chlororesorcinol 771. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g amino-3-hydroxypyridine 772. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 773. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol +
0.210g 2-methyl-5-hydroxyethylaminophenol 774. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2-methylresorcinol 775. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2-amino-4-hydroxyethylaminoanisole 776. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol +
2.100g 1-naphthol 777. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol +
0.210g 4-chlororesorcinol 778. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2-amino-3 -hydroxypyridine 779. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2,4-diaminophenoxyethanol 780. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 781. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 782. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1 -naphthol 783. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 784. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 785. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 786. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole 787. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 1-naphthol 788. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 789. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-amino-3 -hydroxypyridine 790. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2,4-diaminophenoxyethanol 791. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 792. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 793. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 794. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 795. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1-naphthol + 2.100g chlororesorcinol 796. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine 797. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 798. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 799. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 800. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 801. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g resorcinol 802. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g m-aminophenol 803. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol 804. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g resorcinol + 0.263g 2-methylresorcinol 805. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 806. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 1-naphthol 807. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g resorcinol + 2.625g 4-chlororesorcinol 808. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g resorcinol + 0.263g 2-amino-3-hydroxypyridine 809. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 2,4-diaminophenoxyethanol 810. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 811. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 812. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 813. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 1-naphthol 814. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 815. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 816. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 817. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 818. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-hydroxyethylaminoanisole 819. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 820. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 821. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-hydroxypyridine 822. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 823. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 824. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol 825. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 826. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 827. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 828. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 829. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 830. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-hydroxypyridine 831. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 832. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 833. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 834. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 835. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 836. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 837. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 838. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g m-aminophenol 839. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 840. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g m-aminophenol + 2.625g 2-methylresorcinol 841. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 842. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 1-naphthol 843. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g m-aminophenol + 2.625g 4-chlororesorcinol 844. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2-amino-3-hydroxypyridine 845. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2,4-diaminophenoxyethanol 846. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 847. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 848. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 849. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 850. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 851. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 852. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 853. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1 -naphthol 854. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 855. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 856. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 857. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 858. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 859. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine 860. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 861. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 862. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 863. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 864. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 865. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 866. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 867. 0.500g methoxymethyl-p-phenylenediamine + 0.525g 4-amino-2-hydroxytoluene 868. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 4-amino-2-hydroxytoluene +
1.750g 2-methyl-5-hydroxyethylaminophenol 869. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 4-amino-2-hydroxytoluene +
1.750g 2-methylresorcinol 870. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g 2-amino-4-hydroxyethylaminoanisole 871. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g 1-naphthol 872. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g 4-chlororesorcinol 873. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 4-amino-2-hydroxytoluene +
0.3 50g 2-amino-3 -hydroxypyridine 874. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 4-amino-2-hydroxytoluene +
0.350g 2,4-diaminophenoxyethanol 875. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol 876. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 877. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1 -naphthol 878. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-chlororesorcinol 879. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 880. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 881. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methylresorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 882. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 2-methylresorcinol + 2.625g 1-naphthol 883. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methylresorcinol + 0.263g 4-chlororesorcinol 884. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 885. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methylresorcinol + 0.263g 2,4-diaminophenoxyethanol 886. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1 -naphthol 887. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-chlororesorcinol 888. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-amino-3-hydroxypyridine 889. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2,4-diaminophenoxyethanol 890. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 1-naphthol + 2.625g 4-chlororesorcinol 891. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 1-naphthol + 2.625g 2-amino-3-hydroxypyridine 892. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 1-naphthol + 0.263g 2,4-diaminophenoxyethanol 893. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 894. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 4-chlororesorcinol + 2.625g 2,4-diaminophenoxyethanol 895. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-amino-3-hydroxypyridine + 0.263g 2,4-diaminophenoxyethanol 896. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g amino-4-hydroxyethylaminoanisole 897. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g naphthol 898. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g chlororesorcinol 899. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g amino-3 -hydroxypyridine 900. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 901. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1 -naphthol 902. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 903. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 904. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 905. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 906. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2-amino-hydroxypyridine 907. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 908. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g amino-3-hydroxypyridine 909. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 910. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 911. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g naphthol 912. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g chlororesorcinol 913. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g amino-3-hydroxypyridine 914. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 915. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 916. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 917. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methylresorcinol + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 918. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 919. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 920. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 921. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2. l 00g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2. l 00g 4-chlororesorcinol 922. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2-amino-hydroxypyridine 923. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 924. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol + 0.210g amino-3 -hydroxypyridine 925. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 926. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine +
2 .100 g 2,4-diaminophenoxyethanol 927. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 1-naphthol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 928. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 1-naphthol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 929. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 930. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 931. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 932. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g m-aminophenol 933. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-amino-2-hydroxytoluene 934. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methylresorcinol 935. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-amino-4-hydroxyethylaminoanisole 936. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 937. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-chlororesorcinol 938. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3 -hydroxypyridine 939. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 940. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 941. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 942. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methylresorcinol 943. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 944. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 1 -naphthol 945. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-chlororesorcinol 946. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 947. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 948. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 949. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 950. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 951. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 1-naphthol 952. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 953. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-3 -hydroxypyridine 954. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 955. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 956. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 957. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 958. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 959. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 960. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5 -diaminopyrazole + 2.100g amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 961. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 962. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 963. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 964. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 965. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 966. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 967. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 968. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 969. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 970. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 971. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 972. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 973. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 974. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 975. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 976. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g resorcinol 977. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g p-aminophenol + 0.263g m-aminophenol 978. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 979. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g p-aminophenol + 0.263g 2-methylresorcinol 980. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 981. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g p-aminophenol + 0.263g 1 -naphthol 982. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g 4-chlororesorcinol 983. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 984. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 985. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g m-aminophenol 986. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 987. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol 988. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 989. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 1-naphthol 990. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 991. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 992. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 993. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g amino-2-hydroxytoluene 994. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g methylresorcinol 995. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g amino-4-hydroxyethylaminoanisole 996. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g naphthol 997. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g chlororesorcinol 998. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g amino-3-hydroxypyridine 999. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1000. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1001. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1002. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol 1003. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1004. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 1005. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1006. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole 1007. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 1-naphthol 1008. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 1009. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 2-amino-3 -hydroxypyridine 1010. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol +
2.100g 2,4-diaminophenoxyethanol 1011. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1012. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1013. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1014. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1015. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1016. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 1 -naphthol + 1.050g 2-amino-3 -hydroxypyridine 1017. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1018. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol +
0.210g 2-amino-3 -hydroxypyridine 1019. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol +
2.100g 2,4-diaminophenoxyethanol 1020. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1021. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g resorcinol 1022. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g m-aminophenol 1023. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 3-methyl-p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 1024. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 1025. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 1026. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 1-naphthol 1027. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-chlororesorcinol 1028. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1029. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1030. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g m-aminophenol 1031. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene 1032. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol +
0.210g 2-methylresorcinol 1033. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1034. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 1-naphthol 1035. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol +
0.210g 4-chlororesorcinol 1036. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3 -methyl-p-aminophenol + 2.100g resorcinol +
2.100g 2-amino-3-hydroxypyridine 1037. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 2,4-diaminophenoxyethanol 1038. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2.100g 4-amino-2-hydroxytoluene 1039. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2.100g 2-methylresorcinol 1040. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1041. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 1-naphthol 1042. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 4-chlororesorcinol 1043. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 2-amino-3-hydroxypyridine 1044. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2. l 00g 2,4-diaminophenoxyethanol 1045. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1046. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3 -methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1047. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1048. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1049. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 1050. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1051. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3 -methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1052. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 1053. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1054. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 1055. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1056. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1057. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1058. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1059. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1060. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol +
0.210g 4-chlororesorcinol 1061. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine 1062. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol +
2.100g 2,4-diaminophenoxyethanol 1063. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1064. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1065. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1066. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g resorcinol 1067. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g m-aminophenol 1068. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 4-amino-2-hydroxytoluene 1069. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-methylresorcinol 1070. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-amino-4-hydroxyethylaminoanisole 1071. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 1-naphthol 1072. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 4-chlororesorcinol 1073. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.313g 2-amino-3-hydroxypyridine 1074. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 2,4-diaminophenoxyethanol 1075. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g m-aminophenol 1076. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1077. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g 2-methylresorcinol 1078. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1079. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 1-naphthol 1080. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-chlororesorcinol 1081. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1082. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 1083. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene 1084. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g m-aminophenol + 0.210g 2-methylresorcinol 1085. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1086. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2. l 00g m-aminophenol + 2.100g 1-naphthol 1087. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1088. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1089. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1090. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1091. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1092. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 1093. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1094. 1.000g methoxymethyl-p-phenylenediamine + 0.500g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.050g 2-amino-3-hydroxypyridine 1095. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1096. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1097. 0.200g methoxymethyl-p-phenylenediamine + 0.100g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.200g 1-naphthol + 0.050g HC Red No. 10 + 0.050g HC Red No. 11 1098. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1099. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 1100. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1101. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1102. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1103. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1104. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1105. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1106. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 1-naphthol + 2.100g 2-amino-3 -hydroxypyridine 1107. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1108. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-chlororesorcinol + 2.100g 2-amino-3 -hydroxypyridine 1109. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1110. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1111. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methyl-5-hydroxyethylaminophenol + 3.500g resorcinol 1112. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g resorcinol + 0.263g m-aminophenol 1113. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 1114. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g resorcinol + 1.313g 2-methylresorcinol 1115. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1116. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g resorcinol + 1.313g 1-naphthol 1117. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g resorcinol + 2.625g 4-chlororesorcinol 1118. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine 1119. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g resorcinol + 0.263g 2,4-diaminophenoxyethanol 1120. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1121. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 1122. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1123. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1-naphthol 1124. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1125. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1126. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1127. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol 1128. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-4-hydroxyethylaminoanisole 1129. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 1-naphthol 1130. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 1131. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-3-hydroxypyridine + 0.150 5-amino-6-chloro-o-cresol 1132. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2,4-diaminophenoxyethanol 1133. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole 1134. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.220g Hydroxypropyl-bis(N-hydroxyethyl-p-phenylenediamine HC10.210g 1-naphthol 1135. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 4-chlororesorcinol 1136. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3-hydroxypyridine 1137. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol +
2.100g 2,4-diaminophenoxyethanol 1138. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1139. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol + 0.340 g 1140. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine 1141. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1142. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1143. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1144. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1145. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol +
2.100g 2-amino-3-hydroxypyridine + 0.420 g Hydroxyethyl-3,4-Methylenedioxyanilie HCl 1146. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol +
0.180g 2,4-diaminophenoxyethanol + 0.300g 1,3-bis(2,4-diaminophenoxypropane 1147. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine +
1.500g 2-(2,4-diaminophenoxy)ethanol 1148. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g m-aminophenol 1149. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g m-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1150. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g m-aminophenol + 0.263g 2-methylresorcinol 1151. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g m-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1152. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g m-aminophenol + 0.263g 1-naphthol 1153. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g m-aminophenol + 2.625g 4-chlororesorcinol 1154. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g m-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1155. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g m-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1156. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1157. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1158. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 1159. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1160. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1161. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 1162. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1163. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 1-naphthol 1164. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 1165. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3 -hydroxypyridine 1166. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2,4-diaminophenoxyethanol 1167. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1168. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 1169. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1170. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1171. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 1172. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3 -hydroxypyridine 1173. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l 00g m-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1174. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1175. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol +
2.100g 2,4-diaminophenoxyethanol 1176. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 0.100g p-phenylenediamine +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1177. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methyl-5-hydroxyethylaminophenol + 1.750g 4-amino-2-hydroxytoluene 1178. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methylresorcinol 1179. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-4-hydroxyethylaminoanisole 1180. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 1 -naphthol 1181. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 1182. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-3-hydroxypyridine 1183. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2,4-diaminophenoxyethanol 1184. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1185. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 1186. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 1187. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 1188. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1189. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1190. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 1191. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1192. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1193. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol +
0.210g 4-chlororesorcinol 1194. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol +
2. 1 00g 2-amino-3 -hydroxypyridine 1195. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol +
0.210g 2,4-diaminophenoxyethanol 1196. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1197. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1198. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1199. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol 1200. 3.000g methoxymethyl-p-phenylenediamine + 1.000g 2-methyl-5-hydroxyethylaminophenol + 1.000g 2-methylresorcinol + 1.000 hydroxyethyl-3,4-methylendioxyaniline 1201. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g 2-amino-4-hydroxyethylaminoanisole 1202. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methyl-5-hydroxyethylaminophenol + 1.750g 1-naphthol 1203. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g 4-chlororesorcinol 1204. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methyl-5-hydroxyethylaminophenol + 3.500g 2-amino-3-hydroxypyridine 1205. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g 2,4-diaminophenoxyethanol 1206. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2-methylresorcinol + 0.263g 2-amino-4-hydroxyethylaminoanisole 1207. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol + 2.625g 1-naphthol 1208. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol + 2.625g 4-chlororesorcinol 1209. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 1210. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2-methylresorcinol + 0.263g 2,4-diaminophenoxyethanol 1211. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1-naphthol 1212. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-chlororesorcinol 1213. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-amino-3-hydroxypyridine 1214. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2,4-diaminophenoxyethanol 1215. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 1-naphthol + 2.625g 4-chlororesorcinol 1216. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1 -naphthol + 0.263g 2-amino-3-hydroxypyridine 1217. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 1-naphthol + 2.625g 2,4-diaminophenoxyethanol 1218. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-chlororesorcinol + 1.313g 2-amino-3-hydroxypyridine 1219. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-chlororesorcinol + 1.313g 2,4-diaminophenoxyethanol 1220. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-3-hydroxypyridine + 2.625g 2,4-diaminophenoxyethanol 1221. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1 -naphthol 1222. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 1223. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1224. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1225. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol +
0.210g 4-chlororesorcinol 1226. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol +
1.050g 2-amino-3-hydroxypyridine 1227. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol +
2.100g 2,4-diaminophenoxyethanol 1228. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1229. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1230. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1231. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1232. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1233. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1234. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1235. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1236. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1237. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1238. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1239. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine +
1.050g 2,4-diaminophenoxyethanol 1240. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1241. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 1242. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g m-aminophenol 1243. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-amino-2-hydroxytoluene 1244. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methyl-5-hydroxyethylaminophenol 1245. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-4-hydroxyethylaminoanisole 1246. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 1247. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-chlororesorcinol 1248. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-3-hydroxypyridine 1249. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 1250. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g m-aminophenol 1251. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1252. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1253. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1254. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 1-naphthol 1255. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1256. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 1257. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 1258. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene 1259. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1260. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.l00g m-aminophenol + 2.l00g 2-amino-4-hydroxyethylaminoanisole 1261. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 1 -naphthol 1262. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1263. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1264. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1265. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1266. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1267. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2. l00g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol 1268. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1269. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3 -hydroxypyridine 1270. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1271. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1272. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 1-naphthol 1273. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 4-chlororesorcinol 1274. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-3 -hydroxypyridine 1275. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2,4-diaminophenoxyethanol 1276. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 1-naphthol 1277. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 4-chlororesorcinol 1278. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 1279. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 1280. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1 -naphthol + 0.2109 4-chlororesorcinol 1281. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2. l00g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1282. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1283. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-chlororesorcinol + 0.210g 2-amino-hydroxypyridine 1284. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1285. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1286. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g p-aminophenol + 0.263g resorcinol 1287. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g p-aminophenol + 2.625g m-aminophenol 1288. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313 g 4-amino-2-hydroxytoluene 1289. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 1290. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1291. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g p-aminophenol + 0.263g 1 -naphthol 1292. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313g 4-chlororesorcinol 1293. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 1294. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1295. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 1296. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1297. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1298. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1299. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 1-naphthol 1300. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol 1301. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3 -hydroxypyridine 1302. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1303. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1304. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1305. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1306. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 1 -naphthol 1307. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1308. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 1309. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1310. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1311. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1312. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1313. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1314. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 1315. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1316. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1317. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1318. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1319. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1320. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1321. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1322. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1323. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1324. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1325. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 1326. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 1327. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 1328. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1329. 1.000g methoxymethyl-p-phenylenediamine + 1. 050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1330. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1331. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g resorcinol 1332. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 1333. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 1334. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1335. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1336. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313 g 1-naphthol 1337. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 1338. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 1339. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 1340. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 1341. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1342. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1343. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1344. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 1345. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1346. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1347. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1348. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.1 OOg 4-amino-2-hydroxytoluene 1349. 2.000g methoxyrnethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1350. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1351. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 1-naphthol 1352. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1353. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1354. 2.000g methoxymethyl-p-phenylenediamine + 2. lOOg 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1355. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1356. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 1357. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2. l 00g 1-naphthol 1358. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1359. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 1360. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1361. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1362. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1363. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1364. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1365. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1366. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1367. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1368. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 1369. 1.500g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1370. 0.700g methoxymethyl-p-phenylenediamine + 0.110g 2-methylresorcinol +
1.300g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1371. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1372. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 1373. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1374. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1375. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1376. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g resorcinol 1377. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g m-aminophenol 1378. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 1379. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol 1380. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole 1381. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 1 -naphthol 1382. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-chlororesorcinol 1383. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-amino-3-hydroxypyridine 1384. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2,4-diaminophenoxyethanol 1385. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol 1386. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1387. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1388. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1389. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 1 -naphthol 1390. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-chlororesorcinol 1391. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 1392. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1393. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-hydroxytoluene 1394. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1395. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-hydroxyethylaminoanisole 1396. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-naphthol 1397. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1398. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-hydroxypyridine 1399. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1400. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol 1401. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-4-hydroxyethylaminoanisole 1402. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 1-naphthol 1403. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 1404. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-3-hydroxypyridine 1405. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2,4-diaminophenoxyethanol 1406. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1407. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1408. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1409. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1410. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1411. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1412. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2. l 00g 4-chlororesorcinol 1413. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3 -hydroxypyridine 1414. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1415. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 1416. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 1417. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 1418. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 1419. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1420. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-3-hydroxypyridine +
1.050g 2,4-diaminophenoxyethanol 1421. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g resorcinol 1422. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g m-aminophenol 1423. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 1424. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1425. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1426. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g resorcinol + 2.625g 1-naphthol 1427. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g resorcinol + 0.263g 4-chlororesorcinol 1428. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine 1429. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g 2,4-diaminophenoxyethanol 1430. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene 1431. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1432. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1433. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 1-naphthol 1434. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1435. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1436. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1437. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1438. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.
l00g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1439. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1440. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1441. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1442. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1443. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2. lOOg resorcinol + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2. l00g 2-amino-4-hydroxyethylaminoanisole 1444. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1 -naphthol 1445. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1446. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1447. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1448. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1449. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1450. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1451. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1452. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 1-naphthol + 2.1009 4-chlororesorcinol 1453. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1454. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 1 -naphthol + 1.0509 2,4-diaminophenoxyethanol 1455. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 1456. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1457. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1458. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g m-aminophenol 1459. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g m-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1460. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g m-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 1461. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g m-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1462. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g m-aminophenol + 2.625g 1 -naphthol 1463. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g m-aminophenol + 0.263g 4-chlororesorcinol 1464. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g m-aminophenol + 2.625g 2-amino-3-hydroxypyridine 1465. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g m-aminophenol + 2.625g 2,4-diaminophenoxyethanol 1466. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 1467. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1468. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1469. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1470. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1471. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1472. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1473. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1474. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l00g 4-chlororesorcinol 1475. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 1476. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1477. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1478. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1479. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1480. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1481. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1482. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 1483. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1484. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1485. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1486. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1487. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 4-amino-2-hydroxytoluene 1488. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methyl-5-hydroxyethylaminophenol 1489. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-4-hydroxyethylaminoanisole 1490. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 4-amino-2-hydroxytoluene + 2.625g 1-naphthol 1491. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 1492. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 4-amino-2-hydroxytoluene + 2.625g 2-amino-3-hydroxypyridine 1493. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 2,4-diaminophenoxyethanol 1494. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1495. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1496. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1497. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3 -hydroxypyridine 1498. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1499. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1500. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1501. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1502. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1503. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 1504. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 1505. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 1 -naphthol + 0.210g 2,4-diaminophenoxyethanol 1506. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1507. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1508. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1509. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 2-methyl-5-hydroxyethylaminophenol 1510. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1511. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 1-naphthol 1512. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 4-chlororesorcinol 1513. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 1514. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 1515. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 1-naphthol 1516. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 4-chlororesorcinol 1517. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 1518. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2,4-diaminophenoxyethanol 1519. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 1520. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1521. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2. l 00g 2,4-diaminophenoxyethanol 1522. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-hydroxypyridine 1523. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1524. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1525. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol 1526. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methylresorcinol +
1.750g 2-amino-4-hydroxyethylaminoanisole 1527. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methylresorcinol +
1.750g 1-naphthol 1528. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 4-chlororesorcinol 1529. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methylresorcinol +
1.750g 2-amino-3 -hydroxypyridine 1530. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 2,4-diaminophenoxyethanol 1531. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1 -naphthol 1532. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-chlororesorcinol 1533. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-amino-3-hydroxypyridine 1534. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2,4-diaminophenoxyethanol 1535. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 1-naphthol + 2.625g 4-chlororesorcinol 1536. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 1-naphthol + 2.625g 2-amino-3-hydroxypyridine 1537. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 1-naphthol + 1.313g 2,4-diaminophenoxyethanol 1538. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 1539. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-chlororesorcinol + 1.313g 2,4-diaminophenoxyethanol 1540. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 1541. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1542. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1543. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 1544. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol + 0.210g 2-amino-hydroxypyridine 1545. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1546. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1547. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 1-naphthol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1548. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 1-naphthol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1549. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1550. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1551. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 1552. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g m-aminophenol 1553. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g amino-2-hydroxytoluene 1554. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g methyl-5-hydroxyethylaminophenol 1555. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g methylresorcinol 1556. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g naphthol 1557. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g chlororesorcinol 1558. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g amino-3 -hydroxypyridine 1559. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 1560. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g m-aminophenol 1561. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1562. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1563. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 1564. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 1-naphthol 1565. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1566. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 1567. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1 -hydroxyethyl-4,5 -diaminopyrazole +
2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1568. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 1569. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1570. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 1571. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 1 -naphthol 1572. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1573. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1574. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1575. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 1576. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1577. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g amino-2-hydroxytoluene + 0.210g 1-naphthol 1578. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1579. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 1580. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1581. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1582. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1583. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1584. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1585. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1586. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methylresorcinol + 1.050g 1-naphthol 1587. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methylresorcinol + 1.050g 4-chlororesorcinol 1588. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1589. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1590. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g naphthol + 2.100g 4-chlororesorcinol 1591. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g naphthol + 0.210g 2-amino-3-hydroxypyridine 1592. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g naphthol + 0.210g 2,4-diaminophenoxyethanol 1593. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1594. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 1.050g chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1595. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g amino-3 -hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1596. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g resorcinol 1597. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g m-aminophenol 1598. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1599. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1600. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2-methylresorcinol 1601. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g 1-naphthol 1602. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g p-aminophenol + 2.625g 4-chlororesorcinol 1603. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1604. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1605. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g m-aminophenol 1606. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 1607. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1608. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol 1609. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 1-naphthol 1610. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 1611. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1612. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1613. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 4-amino-2-hydroxytoluene 1614. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 2-methyl-5-hydroxyethylaminophenol 1615. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g m-aminophenol +
0.210g 2-methylresorcinol 1616. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 1-naphthol 1617. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g m-aminophenol +
2.100g 4-chlororesorcinol 1618. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 2-amino-3-hydroxypyridine 1619. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g m-aminophenol +
0.210g 2,4-diaminophenoxyethanol 1620. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 1621. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1622. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1623. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1624. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 1625. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1626. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1627. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 1628. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1629. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 1630. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1631. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methylresorcinol +
2.100g 1-naphthol 1632. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 4-chlororesorcinol 1633. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 2-amino-3 -hydroxypyridine 1634. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 2,4-diaminophenoxyethanol 1635. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1636. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 1 -naphthol + 1.050g amino-3-hydroxypyridine 1637. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1638. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol +
0.210g 2-amino-3-hydroxypyridine 1639. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2,4-diaminophenoxyethanol 1640. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1641. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g resorcinol 1642. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 1643. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 1644. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 1645. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 2-methylresorcinol 1646. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g 1 -naphthol 1647. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 1648. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 2-amino-3-hydroxypyridine 1649. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1650. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g m-aminophenol 1651. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol +
0.210g 4-amino-2-hydroxytoluene 1652. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol 1653. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2. l 00g 2-methylresorcinol 1654. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 1-naphthol 1655. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3 -methyl-p-aminophenol + 2.100g resorcinol +
2. l 00g 4-chlororesorcinol 1656. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2. l 00g 2-amino-3-hydroxypyridine 1657. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g 2,4-diaminophenoxyethanol 1658. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 4-amino-2-hydroxytoluene 1659. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 2-methyl-5-hydroxyethylaminophenol 1660. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3 -methyl-p-aminophenol + 2.100g m-aminophenol +
2. l 00g 2-methylresorcinol 1661. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3 -methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 1-naphthol 1662. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino- 4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 4-chlororesorcinol 1663. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2. l 00g 2-amino-3-hydroxypyridine 1664. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 2,4-diaminophenoxyethanol 1665. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1666. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1667. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1668. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1669. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1670. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1671. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 1672. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0. 200g 3 -methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1673. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1674. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1675. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1676. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol 1677. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 1678. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 1679. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1680. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 1-naphthol +
1.050g 4-chlororesorcinol 1681. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol +
0.210g 2-amino-3-hydroxypyridine 1682. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol +
0.210g 2,4-diaminophenoxyethanol 1683. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1684. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1685. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1686. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g resorcinol 1687. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g m-aminophenol 1688. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 4-amino-2-hydroxytoluene 1689. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 2-methyl-5-hydroxyethylaminophenol 1690. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-methylresorcinol 1691. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.313g 1-naphthol 1692. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 4-chlororesorcinol 1693. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-amino-3-hydroxypyridine 1694. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2,4-diaminophenoxyethanol 1695. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g m-aminophenol 1696. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1697. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1698. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g 2-methylresorcinol 1699. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 1-naphthol 1700. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-chlororesorcinol 1701. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 1702. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1703. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1704. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1705. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 2-methylresorcinol 1706. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 1-naphthol 1707. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1708. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1709. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1710. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1711. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1712. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 1713. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1714. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1715. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1716. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 1717. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 1718. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1719. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1720. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 1721. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methylresorcinol + 1.050g 1 -naphthol 1722. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 1723. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1724. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 1725. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1726. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1727. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1728. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1729. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1730. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-amino-3 -hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1731. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-amino-4-hydroxyethylaminoanisole + 3.500g resorcinol 1732. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g m-aminophenol 1733. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 1734. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1735. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g 2-methylresorcinol 1736. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g resorcinol + 1.313g 1-naphthol 1737. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g resorcinol + 2.625g 4-chlororesorcinol 1738. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g resorcinol + 2.625g 2-amino-3-hydroxypyridine 1739. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g 2,4-diaminophenoxyethanol 1740. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1741. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1742. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 1743. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1-naphthol 1744. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1745. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-3 -hydroxypyridine 1746. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1747. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol 1748. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol 1749. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 1-naphthol 1750. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 1751. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene +
2. l 00g 2-amino-3-hydroxypyridine 1752. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2,4-diaminophenoxyethanol 1753. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1754. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1755. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1756. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 1757. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1758. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 1-naphthol 1759. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 2-methylresorcinol +
1.050g 4-chlororesorcinol 1760. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3-hydroxypyridine 1761. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2,4-diaminophenoxyethanol 1762. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 1 -naphthol + 2.100g 4-chlororesorcinol 1763. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 1764. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1765. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 4-chlororesorcinol +
2.100g 2-amino-3 -hydroxypyridine 1766. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1767. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine +
0.210g 2,4-diaminophenoxyethanol 1768. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-amino-4-hydroxyethylaminoanisole + 3.500g m-aminophenol 1769. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene 1770. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1771. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 2-methylresorcinol 1772. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g m-aminophenol + 0.263g 1-naphthol 1773. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g m-aminophenol + 0.263g 4-chlororesorcinol 1774. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1775. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g m-aminophenol + 0.263g 2,4-diaminophenoxyethanol 1776. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1777. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1778. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1779. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1780. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1781. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1782. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1783. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1784. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1785. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1786. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1787. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 1-naphthol 1788. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 1789. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3 -hydroxypyridine 1790. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2,4-diaminophenoxyethanol 1791. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1792. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1793. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1794. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1795. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2,4-diaminophenoxyethanol 1796. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1797. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-amino-4-hydroxyethylaminoanisole + 0.350g 4-amino-2-hydroxytoluene 1798. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methyl-5-hydroxyethylaminophenol 1799. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methylresorcinol 1800. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-amino-2-hydroxytoluene + 0.263g 1-naphthol 1801. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-amino-2-hydroxytoluene + 0.263g 4-chlororesorcinol 1802. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2-amino-3-hydroxypyridine 1803. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2,4-diaminophenoxyethanol 1804. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 1805. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1806. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1807. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1808. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1809. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 1810. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1811. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 1812. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1813. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol +
2. l 00g 4-chlororesorcinol 1814. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine 1815. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol +
1.050g 2,4-diaminophenoxyethanol 1816. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1817. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1818. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1819. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 2-methyl-5-hydroxyethylaminophenol 1820. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g methylresorcinol 1821. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g naphthol 1822. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g chlororesorcinol 1823. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g amino-3 -hydroxypyridine 1824. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 1825. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g methylresorcinol + 0.210g 1-naphthol 1826. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g methylresorcinol + 0.210g 4-chlororesorcinol 1827. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1828. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1829. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g naphthol + 1.050g 4-chlororesorcinol 1830. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g naphthol + 0.210g 2-amino-3-hydroxypyridine 1831. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g naphthol + 1.050g 2,4-diaminophenoxyethanol 1832. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1833. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1834. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1835. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 2-methylresorcinol 1836. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-methylresorcinol + 0.263g 1 -naphthol 1837. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2-methylresorcinol + 1.313g 4-chlororesorcinol 1838. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methylresorcinol + 2.625g 2-amino-3-hydroxypyridine 1839. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methylresorcinol + 2.625g 2,4-diaminophenoxyethanol 1840. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol +
1.050g 4-chlororesorcinol 1841. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol +
0.210g 2-amino-3-hydroxypyridine 1842. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol +
0.210g 2,4-diaminophenoxyethanol 1843. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol +
0.210g 2-amino-3-hydroxypyridine 1844. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol +
1.050g 2,4-diaminophenoxyethanol 1845. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1846. 5.000g methoxymethyl-p-phenylenediamine + 5.250g 2-amino-4-hydroxyethylaminoanisole 1847. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-amino-4-hydroxyethylaminoanisole + 0.350g 1-naphthol 1848. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 4-chlororesorcinol 1849. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-amino-4-hydroxyethylaminoanisole + 0.350g 2-amino-3-hydroxypyridine 1850. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 2,4-diaminophenoxyethanol 1851. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1-naphthol + 1.313g 4-chlororesorcinol 1852. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1 -naphthol + 2.625g 2-amino-3-hydroxypyridine 1853. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1 -naphthol + 1.313g 2,4-diaminophenoxyethanol 1854. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 1855. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-chlororesorcinol + 1.313g 2,4-diaminophenoxyethanol 1856. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 1857. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol +
2.100g 2-amino-3 -hydroxypyridine 1858. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1859. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 2-amino-3 -hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 1860. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1861. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 1862. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g m-aminophenol 1863. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 4-amino-2-hydroxytoluene 1864. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methyl-5-hydroxyethylaminophenol 1865. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methylresorcinol 1866. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-amino-4-hydroxyethylaminoanisole 1867. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 4-chlororesorcinol 1868. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3-hydroxypyridine 1869. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 1870. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 1871. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1872. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1873. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 1874. 0.200g methoxymethyl-p-phenylenediamine + 0.21 Og 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1875. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1876. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1877. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 1878. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 1879. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2. l00g 2-methyl-5-hydroxyethylaminophenol 1880. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 1881. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1882. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1883. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1884. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1885. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1886. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1887. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1888. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1889. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3 -hydroxypyridine 1890. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1891. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-methylresorcinol 1892. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-4-hydroxyethylaminoanisole 1893. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 1894. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-amino-3-hydroxypyridine 1895. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2,4-diaminophenoxyethanol 1896. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 1897. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1898. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxypyridine 1899. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1900. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 4-chlororesorcinol 1901. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 1902. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2,4-diaminophenoxyethanol 1903. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-chlororesorcinol + 0.210g 2-amino-hydroxypyridine 1904. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1905. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1906. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g p-aminophenol + 1.313g resorcinol 1907. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g p-aminophenol + 2.625g m-aminophenol 1908. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1909. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 1910. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g p-aminophenol + 2.625g 2-methylresorcinol 1911. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 1912. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 4-chlororesorcinol 1913. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 1914. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1915. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g m-aminophenol 1916. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1917. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1918. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 1919. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1920. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 1921. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-3 -hydroxypyridine 1922. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1923. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1924. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1925. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 1926. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1927. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1928. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 1929. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1930. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1931. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 1932. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1933. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1934. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1935. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1936. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1937. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1938. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1939. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 1940. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1941. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1942. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 1943. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1944. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 1945. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1946. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 1947. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1948. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1949. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1950. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1951. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g resorcinol 1952. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 1953. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 1954. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1955. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 1956. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 3-methyl-p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1957. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 1958. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1959. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1960. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 1961. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 1962. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1963. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol 1964. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1965. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol 1966. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 1967. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1968. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 1969. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1970. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 1971. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1972. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1973. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1974. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1975. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1976. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1977. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1978. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1979. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1980. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1981. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 1982. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1983. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1984. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 1985. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 1986. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1987. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 1988. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 1989. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1990. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3 -methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1991. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1 -naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1992. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1993. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1994. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1995. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1996. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g resorcinol 1997. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g m-aminophenol 1998. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene 1999. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol 2000. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methylresorcinol 2001. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 2002. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 4-chlororesorcinol 2003. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 2004. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2,4-diaminophenoxyethanol 2005. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol 2006. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 2007. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2008. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol 2009. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2010. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-chlororesorcinol 2011. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 2012. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 2013. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2014. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2015. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 2016. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2017. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 2018. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 2019. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2020. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2021. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 2022. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 2023. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 2024. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3 -hydroxypyridine 2025. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2026. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-methylresorcinol 2027. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-4-hydroxyethylaminoanisole 2028. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 2029. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-3-hydroxypyridine 2030. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2,4-diaminophenoxyethanol 2031. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxyethylaminoanisole 2032. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2033. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxypyridine 2034. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 2035. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2. 1 00g 4-chlororesorcinol 2036. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 2037. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2,4-diaminophenoxyethanol 2038. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2-amino-hydroxypyridine 2039. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 2040. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2041. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g resorcinol 2042. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g resorcinol +
2.625g m-aminophenol 2043. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 4-amino-2-hydroxytoluene 2044. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 2-methyl-5-hydroxyethylaminophenol 2045. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g resorcinol +
2.625g 2-methylresorcinol 2046. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 2-amino-4-hydroxyethylaminoanisole 2047. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 4-chlororesorcinol 2048. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g resorcinol +
1.313 g 2-amino-3-hydroxypyridine 2049. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g resorcinol +
2.625g 2,4-diaminophenoxyethanol 2050. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 2051. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2052. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g m-aminophenol + 2.100g 2-methylresorcinol 2053. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2054. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 4-chlororesorcinol 2055. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 2056. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2057. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.100g resorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2058. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 2059. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 2060. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 2061. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2062. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 2063. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 2064. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2065. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 2066. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 2067. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2068. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2069. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2070. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2071. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2072. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 2073. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2074. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2075. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 2076. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2077. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2078. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 1-naphthol + 1.750g m-aminophenol 2079. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene 2080. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 2081. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g m-aminophenol + 1.313g 2-methylresorcinol 2082. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g m-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 2083. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g m-aminophenol + 0.263g 4-chlororesorcinol 2084. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g m-aminophenol + 0.263g 2-amino-3-hydroxypyridine 2085. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.313g m-aminophenol + 1.313g 2,4-diaminophenoxyethanol 2086. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2087. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 2088. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 2089. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 2090. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2091. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 2092. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2093. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2094. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 2095. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 2096. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2097. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2098. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2099. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 2100. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 2101. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 2102. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2103. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2104. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 2105. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 2106. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 2107. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 1-naphthol + 1.750g 4-amino-2-hydroxytoluene 2108. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methyl-5-hydroxyethylaminophenol 2109. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methylresorcinol 2110. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-4-hydroxyethylaminoanisole 2111. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 2112. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-3-hydroxypyridine 2113. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2,4-diaminophenoxyethanol 2114. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2115. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2116. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 2117. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 2118. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 2119. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2. l 00g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2120. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 2121. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2. l 00g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-3 -hydroxypyridine 2122. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 2123. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 2124. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 2125. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 2126. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 2127. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2128. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2129. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 1-naphthol + 0.350g 2-methyl-5-hydroxyethylaminophenol 2130. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-methylresorcinol 2131. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 2132. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 4-chlororesorcinol 2133. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 2134. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 2135. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2136. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2137. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 2138. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2139. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 2140. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine 2141. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2142. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 2143. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 2144. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2145. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 1-naphthol + 0.350g 2-methylresorcinol 2146. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methylresorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 2147. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methylresorcinol + 1.313g 4-chlororesorcinol 2148. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 2149. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-methylresorcinol + 0.263g 2,4-diaminophenoxyethanol 2150. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 2151. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-hydroxypyridine 2152. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 2153. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 2154. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2155. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2156. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 1-naphthol + 0.350g 2-amino-4-hydroxyethylaminoanisole 2157. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-chlororesorcinol 2158. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-amino-3-hydroxypyridine 2159. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2,4-diaminophenoxyethanol 2160. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 2161. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2162. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2163. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol 2164. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g 4-chlororesorcinol 2165. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g 2-amino-3-hydroxypyridine 2166. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g 2,4-diaminophenoxyethanol 2167. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 2168. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-chlororesorcinol + 0.263g 2,4-diaminophenoxyethanol 2169. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 2170. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2171. 2.500g methoxymethyl- p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 2172. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g m-aminophenol 2173. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-amino-2-hydroxytoluene 2174. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methyl-5-hydroxyethylaminophenol 2175. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-methylresorcinol 2176. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-amino-4-hydroxyethylaminoanisole 2177. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 2178. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3-hydroxypyridine 2179. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 2180. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 2181. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 2182. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2183. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 2184. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2185. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 1-naphthol 2186. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 2187. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 2188. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2189. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 2190. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 2191. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2192. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 1 -naphthol 2193. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 2194. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 2195. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 2196. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 2197. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 2198. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 2199. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 2200. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 2201. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-methylresorcinol 2202. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.1 OOg 2-amino-4-hydroxyethylaminoanisole 2203. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 1-naphthol 2204. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-amino-3-hydroxypyridine 2205. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2,4-diaminophenoxyethanol 2206. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 2207. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 1 -naphthol 2208. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxypyridine 2209. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 2210. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 1-naphthol 2211. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 2212. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 2213. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.1009 2-amino-3-hydroxypyridine 2214. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1-naphthol + 0.2109 2,4-diaminophenoxyethanol 2215. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2216. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g p-aminophenol + 0.263g resorcinol 2217. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g p-aminophenol + 1.313g m-aminophenol 2218. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 2219. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 2220. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.2509 p-aminophenol + 1.313g 2-methylresorcinol 2221. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.2509 p-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 2222. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g p-aminophenol + 1.313g 1-naphthol 2223. 1.250g methoxymethyl-p-phenylenediamine + 0.906g 4-chlororesorcinol +
1.250g p-aminophenol + 0.712g 2-amino-3-hydroxypyridine 2224. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 2225. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 2226. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 2227. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2228. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 2229. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2230. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 1 -naphthol 2231. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 2232. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 2233. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2234. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2235. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 2236. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2237. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 1-naphthol 2238. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 2239. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 2240. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 2241. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 2242. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 2243. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1 -naphthol 2244. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 2245. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2246. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2247. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2248. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 2249. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 2250. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 2251. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2252. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1 -naphthol 2253. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2254. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 2255. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1 -naphthol 2256. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2257. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2258. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 2259. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 2260. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2261. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 3-methyl-p-aminophenol + 0.263g resorcinol 2262. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 2263. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 2264. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 2265. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2-methylresorcinol 2266. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 2267. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 1-naphthol 2268. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 2269. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 2270. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 2271. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 2272. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 2273. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 2274. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2275. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 1 -naphthol 2276. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 2277. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 2278. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2279. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2280. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 2281. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2282. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 1-naphthol 2283. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 2284. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2285. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 2286. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 2287. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 2288. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 2289. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2290. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2291. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 2292. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2293. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 2294. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3 -hydroxypyridine 2295. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2296. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2297. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1 -naphthol 2298. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2299. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 2300. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 2301. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 2302. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2303. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 2304. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 2305. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2306. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g resorcinol 2307. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g m-aminophenol 2308. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 2309. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol 2310. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methylresorcinol 2311. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole 2312. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 1 -naphthol 2313. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 2314. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2,4-diaminophenoxyethanol 2315. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol 2316. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 2317. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2318. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol 2319. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2320. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 1-naphthol 2321. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 2322. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 2323. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-hydroxytoluene 2324. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2325. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 2326. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-hydroxyethylaminoanisole 2327. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 1-naphthol 2328. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-hydroxypyridine 2329. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2330. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol 2331. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol 2332. 2.000g methoxymethyl-p-phenylenediamine + 2. lOOg 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole 2333. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 1 -naphthol 2334. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-3-hydroxypyridine 2335. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2,4-diaminophenoxyethanol 2336. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l 00g 2-methylresorcinol 2337. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2338. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 2339. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 2340. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2341. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2342. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 2343. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2344. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2345. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 2346. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2347. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 2348. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 2349. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 2350. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-3-hydroxypyridine +
0.210g 2,4-diaminophenoxyethanol 2351. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-chlororesorcinol +
3.500g resorcinol 2352. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.313g resorcinol + 1.313g m-aminophenol 2353. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 2354. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g resorcinol + 2.625g 2-methyl-5-hydroxyethylaminophenol 2355. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g resorcinol + 2.625g 2-methylresorcinol 2356. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g resorcinol + 0.263g 2-amino-4-hydroxyethylaminoanisole 2357. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.313g resorcinol + 1.313g 1-naphthol 2358. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine 2359. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g resorcinol + 2.625g 2,4-diaminophenoxyethanol 2360. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 2361. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 2362. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 2363. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2364. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1 -naphthol 2365. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 2366. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2. l00g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 2367. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2368. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 2369. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 2370. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 2371. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2372. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2373. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2374. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2375. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 2376. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 2377. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2378. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2379. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 2380. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2381. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2382. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 2383. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 2384. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol + 2.
l 00g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2385. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 2386. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 1 -naphthol + 0.2109 2,4-diaminophenoxyethanol 2387. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2388. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 4-chlororesorcinol +
1.750g m-aminophenol 2389. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene 2390. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 2391. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g m-aminophenol + 0.263g 2-methylresorcinol 2392. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g m-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 2393. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 1-naphthol 2394. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 2-amino-3-hydroxypyridine DEMANDES OU BREVETS VOLUMINEUX
LA PRESENTE PARTIE DE CETTE DEMANDE OU CE BREVETS
COMPREND PLUS D'UN TOME.
NOTE: Pour les tomes additionels, veillez contacter le Bureau Canadien des Brevets.
JUMBO APPLICATIONS / PATENTS
THIS SECTION OF THE APPLICATION / PATENT CONTAINS MORE
THAN ONE VOLUME.
NOTE: For additional volumes please contact the Canadian Patent Office.
radicals, wherein p is equal to 0 or an integer ranging from 1 to 6, wherein R6, R7, R8 and R9 do not all simultaneously represent a hydrogen atom. R and s which maybe identical or different are each an integer ranging from 1 to 6, q is equal to 0 or an integer ranging from 1 to 34 and X- is an anion such as a halide. T is an integer chosen to be equal to 0 or 1. A is chosen from divalent radicals such as -CH2-CH2-O-CH2-CH2-. Examples of which include Polymers known via the INCI nomenclature as polyquaternium-2, where r=s=3, q=0,t=0, R6, R', R 8 and R9 are methyl groups, and A is -CH2-CH2-O-CH2-CH2, such as the products sold under the name Ethpol PQ-2 from Ethox and Mirapol A-15 by the company Rhodia.
Polymers known via the INCI nomenclature as polyquaternium-17 where r=s=3, q=4, t=1, R6, R7, R8 and R9 are methyl groups, and A is --CH2-CH2-O-CH2--CH2.
Polymers known via the INCI nomenclature as Polyquaternium 18, where r=s=3, q=7, t=1, R6, R7, R8 and R9 are methyl groups, and A is -CH2-CH2-0-CH2-CH2 Polymers known via the INCI nomenclature as the block copolymer formed by the reaction of Polyquaternium-2 with Polyquatemium- 17, known as Polyquatemium 27, such as the products sold under the name Mirapol 175 by the company Rhodia.
(8) Copolymers of vinylpyrrolidones and of vinylimidazoles and optionally vinylcaprolactums, examples of which include polymers known via the INCI nomenclature as Polyquaternary-16 formed from methylvinylimidazolium chlorides and vinylpyrrolidones, such as the products sold under the name Luviquat FC370, Luviquat FC550, Luviquat FC905, Luviquat HM-552 by the company BASF. Or copolymers of vinylcaprolactams and vinylpyrrolidones with methylvinylimidazolium methosulfates, examples of which include polymers known via the INCI nomenclature as Polyquatemium-46, such as the products sold under the name Luviquat Hold by the company BASF. Or copolymers of vinylpyrrolidones and quatemized imidazolines, examples of which include polymers known via the INCI nomenclature poylquaterary 44, such as the products sold under the name Luviquat Care by the company BASF
(9) Polyamines such as the product Polyquart H sold by Cognis under the reference name polyethylene glycol (15) tallow polyamine in the CTFA dictionary.
(10) Cross linked methacryloyloxy(C 1-C4)alkyltri(C 1-C4)alkylammonium salt polymers such as the polymers obtained by homopolymerisation of dimethylaminoethyl methacrylates quatemized with methyl chloride, or by copolymerisation of acrylamides with dimethylaminoethyl methacrylates quatemized with methyl chloride, the homo or copolymerisation being followed by crosslinking with a compound comprising olefinic unsaturation, such as methylenebisacrylamides, examples of which include polymers known via the INCI
nomenclature as Polyquatemium-37, such as the products sold under the name Synthalen, CN
Synthalen CR, Synthalen CU, sold by 3V sigma, or as a dispersion in another media such as the products sold under the name Salcare SC95 and Salcare SC96 by the company Ciba or Rheocare CTH(E) by the company Cosmetic Rheologies. Or in another example of which include polymers known via the INCI nomenclature as Polyquatemium-32, or when sold as a dispersion in mineral oil such as the products sold under the name Salcare SC92 by the company Ciba.
(11) Further examples of cationic polymers include polymers known via the INCI
nomenclature as Polyquaternium 51, such as the products sold under the name Lipidure-PMB by the company NOF, via the INCI nomenclature as Polyquatemium 54, such as the products sold under the name Qualty-Hy by the company Mitsui, and via the INCI nomenclature as Polyquatemium 56 such as the products sold under the name Hairrol UC-4 by the company Sanyo chemicals.
(12) silicone polymers comprising cationic groups and/or groups which may be ionised into cationic groups. For example: cationic silicones of the general formula (R10-N+(CH3)2)-R"-(Si(CH3)2-O)x-R"-(N+(CH3)2)-Rl0), where Rl0 is an alkyl derived from coconut oil, and R" is (CH2CHOCH2O(CH2)3 and x is a number between 20 and 2000, examples of which include polymers known by the INCI nomenclature as Quaternium 80, such as the products sold under the name as Abil Quat 3272 and Abil Quat 3474 sold commercially by Goldschmidt.
Silicones containing groups which may be ionised into cationic groups, for example aminosilicones containing at least 10 repeating siloxane -(Si(CH3)2-0) units within the polymer chain, with either terminal, graft or a mixture of terminal and graft aminofunctional groups.
Example functional groups are not limited to aminoethylaminopropyl, aminoethylaminoisobutly, aminopropyl. In the case of graft polymers, the terminal siloxane units may either be (CH3)3Si-O or R12(CH3)2Si-O, where R12 may be either OH or OR13, where R' 3 is a CI-C8 alky group, or a mixture of both functional terminal groups. These silicones are also available as preformed emulsions. Polymer with terminal siloxane units of (CH3)3Si-O examples of which include polymers known by the INCI nomenclature as trimethylsilylamodimethicone, such as the products sold under the name as DC-2-8566, DC 7224 and DC-2-8220 sold commercially by Dow Coming and SF1708 and SM 2125 sold commercially by GE Silicones and Wacker Belsil ADM 653 sold commercially by Wacker silicones. Further examples include polymers with terminal siloxane units of (R12O)(CH3)2Si-O where R1z may be either OH or OR13, where R13 is a C 1-C8 alky group, or a mixture of both functional terminal groups, known by the INCI
nomenclature as amodimethicone, such as the products sold under the name as Wacker Belsil ADM 1100, Wacker Belsil ADM 1600, Wacker Belsil ADM 652, Wacker Belsil ADM
6057E, Wacker Belsil ADM 8020 sold commercial by Wacker Silicones, DC929, DC939 and sold commercially by Dow Coming and SM2059 sold commercially by GE silicones.
Silicones containing groups which may be ionised into cationic groups - for example silicones containing at least 10 repeating siloxane -(Si(CH3)2-O) units within the polymer chain, with either terminal, graft or a mixture of terminal and graft aminofunctional groups, together with additional functional groups. Additional functional groups may include polyoxyalkylene, the reaction product of amines and carbinols, alky chains. For example products know by the INCI
nomenclature as methoxy PEG/PPG-7/3 Aminopropyl Dimethicone, such as the product sold under the name of Abil Soft AF100 sold commercially by Degussa. For example products know by the INCI nomenclature as Bis (C13-15 Alkoxy) PG Amodimethicone, such as the product sold under the name of DC 8500 sold commercially by Dow Coming.
Surfactants: The compositions according to the present invention may further comprise one or more surfactants. Surfactants suitable for use herein generally have a lipophilic chain length of from about 8 to about 30 carbon atoms and may be selected from anionic, nonionic, amphoteric and cationic surfactants and mixtures thereof. The total level of surfactant is from about 0.5% to about 60% by weight, preferably from about 2% to about 30% by weight, more preferably from about 8% to about 25% by weight and especially from about 10% to about 20% by weight.
The compositions of the invention preferably comprise a mixture of anionic and amphoteric surfactants with one or more nonionic surfactants. Anionic components, where may be present in the range of from about 0.1 % to about 20% by weight, preferably from about 0.1 % to about 15% by weight, and more preferably from about 5% to about 15% by weight of the composition;
amphoteric or nonionic components, may independently be present is in the range from about 0.1 % to about 15% by weight, preferably from about 0.5% to about 10% by weight, more preferably from about 1% to about 8% by weight.
As examples of anionic surfactants, which may be used, alone or as mixtures, mention may be made, for example, of salts (such as alkaline salts, for example, sodium salts, ammonium salts, amine salts, amino alcohol salts and magnesium salts) of the following compounds: alkyl sulphates, alkyl ether sulphates, alkylamido ether sulphates, alkylarylpolyether sulphates, monoglyceride sulphates; alkyl sulphonates, alkyl phosphates, alkylamide sulphonates, alkylaryl sulphonates, a-olefin sulphonates, paraffin sulphonates; alkyl sulphosuccinates, alkyl ether sulphosuccinates, alkylamide sulphosuccinates; alkyl sulphosuccinamates; alkyl sulphoacetates;
alkyl ether phosphates; acyl sarcosinates; acyl isethionates and N-acyltaurates. The alkyl or acyl radical of all of these various compounds, for example, comprises from 8 to 24 carbon atoms, and the aryl radical, for example, is chosen from phenyl and benzyl groups.
Among the anionic surfactants, which may also be used, mention may also be made of fatty acid salts such as the salts of oleic, ricinoleic, palmitic and stearic acids, coconut oil acid or hydrogenated coconut oil acid; acyl lactylates in which the acyl radical comprises from 8 to 20 carbon atoms. Weakly anionic surfactants may also be used, such as alkyl-D-galactosiduronic acids and their salts, as well as polyoxyalkylenated (C6-C24) alkyl ether carboxylic acids, polyoxyalkylenated (C6-C24) alkylaryl ether carboxylic acids, polyoxyalkylenated (C6-C24) alkylamido ether carboxylic acids and their salts, for example, those comprising from 2 to 50 ethylene oxide groups, and mixtures thereof. Anionic derivatives of polysaccharides, for example carboxyalkyl ether of alkyl polyglucosides, may be also used.
The nonionic surfactants are compounds that are well known (see, for example, in this respect "Handbook of Surfactants" by M. R. Porter, published by Blackie & Son (Glasgow and London), 1991, pp. 116-178). They may be chosen, for example, from polyethoxylated, polypropoxylated and polyglycerolated fatty acids, alkyl phenols, c~-diols and alcohols comprising a fatty chain comprising, for example, from 8 to 18 carbon atoms, it being possible for the number of ethylene oxide or propylene oxide groups to range, for example, from 2 to 200 and for the number of glycerol groups to range, for example, from 2 to 30. Mention may also be made of copolymers of ethylene oxide and of propylene oxide, condensates of ethylene oxide and of propylene oxide with fatty alcohols; polyethoxylated fatty amides preferably having from 2 to 30 mol of ethylene oxide and their momoethanolamine and diethanolamine derivatives, polyglycerolated fatty amides, for example, comprising on average from 1 to 5, and such as from 1.5 to 4, glycerol groups; polyethoxylated fatty amines such as those containing from 2 to 30 mol of ethylene oxide; oxyethylenated fatty acid esters of sorbitan having from 2 to 30 mol of ethylene oxide;
fatty acid esters of sucrose, fatty acid esters of polyethylene glycol, alkylpolyglycosides, N-alkylglucamine derivatives, amine oxides such as (CIo-C14)alkylamine oxides or N-acylaminopropylmorpholine oxides.
The amphoteric surfactants may be chosen, for example, from aliphatic secondary and tertiary amine derivatives in which the aliphatic radical is chosen from linear and branched chains comprising from 8 to 22 carbon atoms and comprising at least one water-soluble anionic group (for example carboxylate, sulphonate, sulphate, phosphate or phosphonate); mention may also be made of (C8-C20)alkylbetaines, sulphobetaines, (C8-C20)alkylamido(C1-C6)alkylbetaines or (C8-C20)alkylamido(C1-C6)alkylsulphobetaines.
Among the amine derivatives, mention may be made of the products sold under the name Miranol, as described, for example, in U.S. Pat. Nos. 2,528,378 and 2,781,354 and having the structures of: R2-CON HCHZCHZ N+(R3)(R4)(CHZCOO )(VI) 5 in which: R2 is chosen from alkyl radicals derived from an acid R2-COOH
present in hydrolysed coconut oil, and heptyl, nonyl and undecyl radicals, R3 is a(3-hydroxyethyl group and R4 is a carboxymethyl group; and of R$-CONHCHZCH2-N(B)(C) (VII) wherein B represents -CH2CH2OX', C represents -(CH2)Z Y', with z=1 or 2, X' is chosen from the -CH2CH2-COOH group and a hydrogen atom, Y' is chosen from -COOH and 10 -CHZ-CHOH-SO3H radicals, R5 is chosen from alkyl radicals of an acid R5-COOH present in coconut oil or in hydrolysed linseed oil, alkyl radicals, such as C7, C9, C11 and C13 alkyl radicals, a C17 alkyl radical and its iso form, and unsaturated C 17 radical.
These compounds are classified in the CTFA dictionary, 5th edition, 1993, under the names disodium cocoamphodiacetate, disodium lauroamphodiacetate, disodium caprylamphodiacetate, disodium 15 capryloamphodiacetate, disodium cocoamphodipropionate, disodium lauroamphodipropionate, disodium caprylamphodipropionate, disodium capryloamphodipropionate, lauroamphodipropionic acid, and cocoamphodipropionic acid. Salts of diethyl aminopropyl cocoaspartamid may be also used.
The cationic surfactants may be chosen from: A) the quatemary ammonium salts of general 20 formula (VIII): [NR'R2R3R4]+ X- (VIII) wherein X- is an anion chosen from halides (chloride, bromide and iodide), (CZ-C6)alkyl sulphates, such as methyl sulphate, phosphates, alkyl and alkylaryl sulphonates, and anions derived from organic acids, such as acetate and lactate, and (i) the radicals R' to R3, which may be identical or different, are chosen from linear and branched 25 aliphatic radicals comprising from 1 to 4 carbon atoms, and aromatic radicals such as aryl and alkylaryl. The aliphatic radicals may comprise at least one hetero atom such as oxygen, nitrogen, sulphur and halogens. The aliphatic radicals are chosen, for example, from alkyl, alkoxy and alkylamide radicals, R4 is chosen from linear and branched alkyl radicals comprising from 16 to 30 carbon atoms.
30 The cationic surfactant is, for example, a behenyltrimethylammonium salt (for example a chloride or bromide).
(ii) the radicals Rl and R2, which may be identical or different, are chosen from linear and branched aliphatic radicals comprising from 1 to 4 carbon atoms, and aromatic radicals such as aryl and alkylaryl. The aliphatic radicals may comprise at least one hetero atom such as oxygen, nitrogen, sulphur and halogens. The aliphatic radicals are chosen, for example, from alkyl, alkoxy, alkylamide and hydroxyalkyl radicals comprising from about 1 to 4 carbon atoms;
R3 and R4, which may be identical or different, are chosen from linear and branched alkyl radicals comprising from 12 to 30 carbon atoms, the said alkyl radicals comprise at least one function chosen from ester and amide functions.
R3 and R4 are chosen, for example, from (C12-CZ2)alkylamido(C2-C6)alkyl and (C12-C22)alkylacetate radicals.
The cationic surfactant is, for example, a dicetyldimethyl ammonium salt (for example chloride);
B) the quatemary ammonium salts of imidazolinium, such as that of formula (IX) below:
Ro J
CEt~i-C. C-i1 -N(tt*)-CO-t{3 X.
(IX) in which R5 is chosen from alkenyl and alkyl radicals comprising from 8 to 30 carbon atoms, for example fatty acid derivatives of tallow, R6 is chosen from a hydrogen atom, CI -C4 alkyl radicals and alkenyl and alkyl radicals comprising from 8 to 30 carbon atoms, R7 is chosen from Cl-C4 alkyl radicals, R8 is chosen from a hydrogen atom and C1-C4 alkyl radicals, and X is an anion chosen from halides, phosphates, acetates, lactates, alkyl sulphates, alkyl sulphonates and alkylaryl sulphonates.
In one embodiment, R5 and R6 are, for example, a mixture of radicals chosen from alkenyl and alkyl radicals comprising from 12 to 21 carbon atoms, such as fatty acid derivatives of tallow, R7 is methyl and R8 is hydrogen. Such a product is, for example, Quatemium-27 (CTFA 1997) or Quaternium-83 (CTFA 1997), which are sold under the names "Rewoquat " W75, W90, W75PG and W75HPG by the company Witco, C) the diquaternary ammonium salts of formula (X):
Rjj:j Rii (Cfi1)_y-N-RJ4 R,a (X) in which R9 is chosen from aliphatic radicals comprising from about 16 to 30 carbon atoms, R10, R11, R12, R13 and R14, which may be identical or different, are chosen from hydrogen and alkyl radicals comprising from 1 to 4 carbon atoms, and X is an anion chosen from halides, acetates, phosphates, nitrates and methyl sulphates. Such diquatemary ammonium salts, for example, include propanetallowdiammonium dichloride; and D) the quatemary ammonium salts comprising at least one ester function, of formula (XI) below:
'R 17-~ (OCsH .1 4t-(Cft,140)xR,.6 X-is (XI) in which:
R15 is chosen from C 1-C6 alkyl radicals and C 1-C6 hydroxyalkyl and dihydroxyalkyl radicals;
R16 is chosen from: a radical Rl9C(O)-, linear and branched, saturated and unsaturated C1-C22 hydrocarbon-based radicals R20, and a hydrogen atom, R18 is chosen from: a radical R21C(O)-, linear and branched, saturated and unsaturated Cl-C6 hydrocarbon-based radicals R22, and a hydrogen atom, R 17, R19 and R2 1, which may be identical or different, are chosen from linear and branched, saturated and unsaturated C7-C21 hydrocarbon-based radicals; n, p and r, which may be identical or different, are chosen from integers ranging from 2 to 6; y is chosen from integers ranging from 1 to 10; x and z, which may be identical or different, are chosen from integers ranging from 0 to 10; X- is an anion chosen from simple and complex, organic and inorganic anions; with the proviso that the sum x+y+z is from 1 to 15, that when x is 0, then R16 is R20 and that when z is 0, then R18 is R22.
In one embodiment, the ammonium salts of formula (XV) may be used, in which:
R15 is chosen from methyl and ethyl radicals, x and y are equal to 1; z is equal to 0 or 1; n, p and r are equal to 2; R16 is chosen from: a radical R19C(O)-,methyl, ethyl and C14-hydrocarbon-based radicals, and a hydrogen atom; R17, R19 and R2 1, which may be identical or different, are chosen from linear and branched, saturated and unsaturated C7-C2 1, hydrocarbon-based radicals; R18 is chosen from: a radical R21C(O)- and a hydrogen atom.
Such compounds are sold, for example, under the names Dehyquart by the company Cognis, Stepanquat by the company Stepan, Noxamium by the company Ceca, and Rewoquat WE 18 by the company Rewo-Witco.
Chelants: According to the present invention the compositions may comprise chelants.
Chelants are well known in the art and refer to a molecule or a mixture of different molecules each capable of forming a chelate with a metal ion. Chelants are well known in the art and a non-exhaustive list thereof can be found in AE Martell & RM Smith, Critical Stability Constants, Vol. 1, Plenum Press, New York & London (1974) and AE Martell & RD Hancock, Metal Complexes in Aqueous Solution, Plenum Press, New York & London (1996) both incorporated herein by reference.
Chelants suitable for use herein are carboxylic acids (in particular aminocarboxylic acids), polyamines, phosphonic acids (in particular aminophosphonic acids) and polyphosphoric acids (in particular linear polyphosphoric acids), their salts and derivatives.
Examples of preferred chelants include ethylenediaminotetraacetic acid (EDTA), nitrilotriacetic acid, diethylenetriamine pentaacetic acid (DTPA), ethylenediamine disuccinic acid (EDDS), ethylenediamine diglutaric acid (EDGA), 2-hydroxypropylenediamine disuccinic acid (HPDS), glycinamide-N,N'-disuccinic acid (GADS), ethylenediamine-N-N'-diglutaric acid (EDDG), 2-hydroxypropylenediamine-N-N'-disuccinic acid (HPDDS), salts thereof and derivatives thereof.
Chelants may be incorporated into the composition of the present invention as stabilizers and or preservatives. In addition it has also been found that chelants provide hair fibre damage benefits and thus they may be utilized in order to further improve the hair damage profile of the present invention. Levels of chelants in the present invention may be as low as about 0.1 % by weight, preferably at least about 0.25% by weight, more preferably about 0.5% by weight, for the most effective chelants such as diamine-N,N'-dipolyacid chelants and monoamine monoamide-N,N'-dipolyacid chelants (for example EDDS). Less effective chelants will be more preferably used at levels of at least about 1% by weight, even more preferably above about 2% by weight of the composition, depending of the efficiency of the chelant. Levels as high as about 10% by weight may be used, but above this level significant formulation issues may arise.
Solvents: Suitable solvents for use in the compositions of the present invention include, but are not limited to, water, butoxydiglycol, 1,2-propylene glycol, glycerol, lower aliphatic alcohols (e.g. ethanol, n-propanol or isoproanol), ethoxydiglycol, isopropylalcohol, hexylene glycol, benzyl alcohol and dipropylene glycol.
Antioxidants or reducing a eg nts: Suitable antioxidants or reducing agents for use in the compositions of the present invention include, but are not limited to, ascorbic acid, thioglycolic acid and sodium sulfite.
The form of the oxidation dye precursor composition and also for the ready-to-apply dye mixture may be, for example, a solution, especially an aqueous or aqueous-alcoholic solution. However a particularly preferred form of the composition according to the invention is a cream, a gel or an emulsion. Its composition comprises a mixture of the dye ingredients with the conventional additive ingredients usually used in this type of preparation.
According to a preferred embodiment of the present invention dye powders or granules are mixed with an appropriate dye carrier mass prior to use to form the oxidation dye precursor composition. Particularly preferred is the use of the dye-containing pellets according to WO 2005/044208 which are mixed with an appropriate dye carrier mass prior to use to form the oxidation dye precursor composition. WO 2005/044208 herewith is explicitly incorporated herein by reference.
The ready-to-apply hair dye mixture according to the invention is preferably made by a method comprising mixing the oxidation dye precursor composition with a liquid oxidizing agent immediately prior to application.
Hydrogen peroxide, or its addition compounds with urea, melamine or sodium bromate, in the form of a 1 to 12 percent by weight, preferably 6 percent by weight, aqueous solution, is preferred as the oxidizing agent. Hydrogen peroxide is especially preferred.
The oxidation dye precursor composition and the oxidizing agent are mixed with each other in a weight ratio of from 5:1 to 1:3. A weight ratio of 1:1 to 1:2 is especially preferred.
The pH of the ready-to-apply hair dye mixture according to the invention is adjusted during the mixing of the preferred alkaline oxidation dye precursor composition with the mostly acidic oxidizing agent. The resulting pH value of the mixture is determined by the alkali content of the dye-carrying or oxidation dye precursor composition, the acid content of the oxidizing agent and the mixing ratio. The pH of the ready-to-apply hair dye composition amounts to 3 to 11, preferably from 6 to 10.5.
The pH values of both the oxidation dye precursor composition and the oxidizing agent-containing composition may both be adjusted by adding dilute organic or inorganic acids, such as phosphoric acid, ascorbic acid and lactic acid, or bases, such as monoethanolamine, triethanolamine, 2-amino-2-methyl-l-propanol, ammonia, sodium hydroxide, potassium hydroxide or tris(hydroxymethyl)aminomethane.
After mixing the above-described oxidation dye precursor composition with an oxidizing agent, an amount of the ready-to-apply hair dye mixture sufficient for dyeing the hair, generally from 60 to 200 grams, is applied to the hair.
5 The hair dye mixture is allowed to act on the hair after application for 10 to 45 minutes at 15 to C, preferably for 30 to 40 minutes at 30 C to 40 C. It is subsequently rinsed from the hair with water. If necessary the hair is washed with a shampoo after rinsing with water and perhaps with a dilute weak organic acid, for example citric or tartaric acid.
Subsequently the hair is dried.
10 The new p-phenylenediamine derivatives of formula (I) allow the creation of non-sensitizing oxidative hair dyes with good dyeing properties.
The examples below are intended to illustrate the subject-matter of the invention in more detail without limiting it thereto.
EXAMPLES
Example 1A to 3100A: Hair Dye Solution Dye carrier mass A: 10.0 g Sodium lauryl ether sulfate (28 % strength aqueous solution) 7.8 g Ethanol 0.3 g Ascorbic acid 0.3 g Sodium sulfite, anhydrous 0.3 g Ethylenediaminetetraacetic acid disodium salt hydrate 9.0 g Ammonium hydroxide (22 % strength aqueous solution) X g Dyes (according to the below-mentioned table 1) ad 100.0 g Water, demineralized The pH of the solution was between 10 and 10.5.
Immediately prior to application 50 g of the above-described dye carrier mass A were mixed with 50 grams of a 6% by weight aqueous hydrogen peroxide solution. The resulting ready-to-apply hair dye mixture was applied to the hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 B to 3100B: Hair Dye Cream Dye carrier mass B: 15.00 g Cetylstearylalcohol 2.30 g Glycerinmonostearate 0.80 g Lanolin 3,80 g Lanolinalcohol 3.50 g Sodium lauryl diglykolether sulfate (28 % strength aqueous solution) 1.42 g Steareth-20 7.80 g Ethanol 0.30 g Ascorbic acid 0.30 g Sodium sulfite, anhydrous 0.30 g ethylenediaminetetraacetic acid disodium salt hydrate 10.00 g Ammonium hydroxide (22 % strength aqueous solution) 0.20 g Perfume X g Dyes (according to the below-mentioned table 1) ad 100.00 g Water, demineralized The pH of the cream was between 9.5 and 10.5.
Immediately prior to application 75 g of the above-described dye carrier mass B were mixed with 50 grams of a 9% by weight aqueous hydrogen peroxide solution. The resulting ready-to-use hair dye mixture was applied to the hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 C to 3100C: Hair Dye Gel Dye carrier mass C: 15,00 g Oleic acid 3,00 g Glycerol 7,00 g Isopropanol 0,50 g Ascorbic acid 0,40 g Sodium sulfite, anhydrous 0,40 g Sodium hydroxide 10,00 g Ammonium hydroxide (25 % strength aqueous solution) X g Dyes (according to the below-mentioned table 1) ad 100,00 g Water, demineralized Immediately prior to application 100 g of the above-described dye carrier mass C were mixed with 100 grams of a 6% by weight aqueous hydrogen peroxide solution. The resulting ready-to-apply hair dye mixture was applied to the hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 D to 3100D: Hair Dye Dye carrier mass D: 9.500 g Propylene glycol 5.000 g Ammonium hydroxide 4.000 g Ethoxydiglycol 4.500 g Ethanolamine 1.000 g Oleic acid 6.000 g Hexylene glycol 3.500 g Cocamidopropyl betaine 0.300 g Oleth-10 0.300 g Oleth-2 1.500 g Dilinoleic acid 0.500 g C 12-C 15 Pareth-3 7.000 g Soytrimonium chloride 0.005 g Sodium metasilicate 0.500 g Erythorbic acid 0.300 g Ethylenediaminetetraacetic acid disodium salt 0.300 g Sodium sulfite X g Dyes (according to the below-mentioned table 1) ad 100.000 g Water, demineralized Immediately prior to application 75 g of the above-described dye carrier mass D were mixed with 50 grams of a 9% by weight aqueous hydrogen peroxide solution. The resulting ready-to-use hair dye mixture was applied to bleached hair in the required amount.
After an acting time of 40 minutes at 30 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 E to 3100E: Nonionic Hair Dye Dye carrier mass E: 7.00 g Cetylstearyl alcohol 2.00 g Glyceryl oleate 13.00 g Polysorbate 40 6.00 g Ceteareth-50 0.50 g Sodium sulfite, anhydrous 0.10 g Ethylenediaminetetraacetic acid disodium salt 8.00 g Ammonia (25% strength aqueous solution) X g Dyes (according to the below-mentioned table 1) ad 100.00 g Water Hydrogen peroxide emulsion 3.0 g Cetylstearyl alcohol 0.8 g PEG-25 cetyl/stearyl ether 0.3 g Lanolin alcohol 6.0 g Hydrogen peroxide 0.1 g Phosphoric acid (85% strength aqueous solution) ad 100.0 g Water 60 g of the above non-ionic dye carrier mass E were mixed prior to application with 60 g of the above hydrogen peroxide emulsion (pH = 2.5). The pH of the resulting ready-to-use hair dye composition was about 10. The resulting ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 F to 3100F: Hair Dye Dye carrier mass F: 0.100 g Sodium sulphite 0.200 g Ascorbic Acid 0.003 g Ethylenediaminetetraacetic acid disodium salt 0.200 g Citric Acid 4.000 g Ammonia (30% strength aqueous solution) 1.000 g Acrylates Copolymer (Aculyn(V 33A) 0.500 g Oleth 5 1.000 g Oleth 2 0.900 g Oleic Acid 3.000 g Cocamidopropyl betaine 0.050 g Etidronic Acid 1.000 g Trisodium Ethylenediamine disuccinate 2.500 g Isopropyl alcohol 8.600 g Hydrogen Peroxide (35% aqueous solution) 3.000 g Soytrimonium Chloride and propylene glycol 0.003 g Simethicone 1.000 g Steareth-21 0.500 g PEG-50 Hydrogenated Palmamide 0.200 g Oleyl Alcohol 0.500 g Acrylates Steareth-20 Methacrylate Copolymer (Aculyn 22) 2.000 g Propylene Glycol 4.200 g Ethoxy Diglycol 0.500 g C 11-15 Pareth-9 0.800 g C12-15 Pareth-3 X g Dyes (according to the below-mentioned table 1) ad 100.000 g Water The pH of the ready-to-use hair dye composition was about 10. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 40 minutes at 30 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 G to 3100G: Hair Dye Dye carrier mass G: 0.100 g Sodium sulphite 0.200 g Ascorbic Acid 0.003 g Ethylenediaminetetraacetic acid disodium salt 0.200 g Citric Acid 4.000 g Ammonia (30% strength aqueous solution) 1.000 g Acrylates Copolymer (Aculyn 33A) 0.500 g Oleth 5 1.000 g Oleth 2 0.900 g Oleic Acid 5 3.000 g Cocamidopropyl betaine 0.050 g Etidronic Acid 1.000 g Trisodium Ethylenediamine disuccinate 2.500 g Isopropyl alcohol 13.000 g Hydrogen Peroxide (35% aqueous solution) 10 3.000 g Soytrimonium Chloride and propylene glycol 0.003 g Simethicone 1.000 g Steareth-21 0.500 g PEG-50 Hydrogenated Palmamide 0.200 g Oleyl Alcohol 15 1.000 g Acrylates Steareth-20 Methacrylate Copolymer (Aculyn 22) 2.000 g Propylene Glycol 4.200 g Ethoxy Diglycol 0.500 g C 11-15 Pareth-9 0.800 g C12-15 Pareth-3 20 X g Dyes (according to the below-mentioned table 1) ad 100.000 g Water The pH of the ready-to-use hair dye composition was about 10. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 30 minutes 25 at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 H to 3100H: Hair Dye Dye carrier mass H: 0.1 g Sodium sulphite 30 0.1 g Ascorbic Acid 5.0 g Ammonium Carbonate 0.1 g Potassium Hydrogen Carbonate 0.2 g Ammonium Acetate 2.0 g Crodafos CES
1.0 g Ceteareth-25 (Volpo CS25) 2.0 g Stearyl Alcohol 0.3 g Sodium Hydroxide (50% aqueous solution) 0.1 g Ethylenediaminetetraacetic acid tetrasodium salt 0.5 g Etidronic Acid 8.6 g Hydrogen Peroxide (35% aqueous solution) 0.2 g Polyquatemium-22 (Merquat 295) 0.2 g Polyquaternium-37 & Mineral oil (Salcare SC95) 0.1 g Styrene-PVP Copolymer (Polectron 430) 0.1 g Xanthan gum 2.0 g Cetyl Alcohol 1.0 g Acrylates copolymer (Aculyn 33) X g Dyes (according to the below-mentioned table 1) ad 100.0 g Water The pH of the ready-to-use hair dye composition was about 9. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 40 minutes at 30 C
the hair was washed with a shampoo, rinsed with water and dried.
Example lI to 31001: Hair Dye Dye carrier mass I: 0.1 g Sodium sulphite 0.1 g Ascorbic Acid 6.0 g Ammonium Carbonate 0.1 g Potassium Hydrogen Carbonate 0.2 g Ammonium Acetate 2.0 g Cetearyl Alcohol (and) Dicetyl Phosphate (and) Ceteth-10 Phosphate (Crodafos CES) 0.3 g Sodium Hydroxide (50% aqueous solution) 0.1 g Ethylenediaminetetraacetic acid tetrasodium salt 0.5 g Etidronic Acid 8.6 g Hydrogen Peroxide (35% aqueous solution) 1.0 g Amodimethicone (Belsil ADM1100) 0.5 g Styrene-PVP Copolymer (Polectron 430) 0.5 g Acrylates/C 10-30 Alkyl Acrylate Crosspolymer 1.0 g Acrylates Steareth-20 Methacrylate Copolymer (Aculyn 22) 1.0 g Acrylates copolymer (Aculyn 33) X g Dyes (according to the below-mentioned table 1) ad 100.0 g Water The pH of the ready-to-use hair dye composition was about 9. The ready-to-use hair dye mixture was applied to bleached hair in the required amount. After an acting time of 30 minutes at 40 C
the hair was washed with a shampoo, rinsed with water and dried.
Example 1 K to 3100K: Hair Dye Synthesis of dye pellets accordiniz to WO 2005/044208 (general method for producing pellets of each dye mixture 1 to 3100): In a Glatt fluidized bed granulator and coater, 400 g of the respective dye mixture 1 to 3100 according to table 1 were heated to a product temperature of 34 C with air at an incoming air temperature of 90 C and an air flow rate of 18 m3/h. A 20 %
aqueous polyvinylpyrrolidone solution ("spraying solution") was then sprayed onto this mixture at an initial spraying rate of 8 g/min and at a spraying air pressure of 0.5 bar. In the course of the granulation process, the spraying rate was increased to 12 g/min and the incoming air temperature was increased to 100 C, while the air flow rate was raised to a maximum of 30 m3/h. The product temperature was kept at about 30-31 C throughout the entire procedure. After 310 g of the polyvinylpyrrolidone solution had been sprayed on, the pellets were dried at a maximum product temperature of 57 C and then cooled to about 30 C and screened.
Before use these pellets (comprising the dye combinations 1 to 3100 as described in the below-mentioned table 1) were mixed with the following peroxide solution or emulsion in a 1:1 ratio.
Hydrogen Peroxide Emulsion: 9.00 g Hydrogen peroxide 1.80 g Cetylstearyl alcohol 3.30 g Polyvinylpyrrolidone-styrene copolymer 0.20 g Disodium phosphate 0.20 g Sodium laurylsulfate 0.10 g Salicylic acid 0.08 g Phosphoric acid to 100.00 g Water, demineralized The resulting ready-to-apply dye mixture was applied to the hair in the required amount. After an acting time of 40 minutes at 30 C the hair was washed with a shampoo, rinsed with water and dried.
Example 1 L to 3100 L: Hair Dye Synthesis of dye pellets accordiniz to WO 2005/044208 (general method for producing pellets of each dye mixture 1 to 3100): In a Glatt fluidized bed granulator and coater, 400 g of the respective dye mixture 1 to 3100 according to table 1 were heated to a product temperature of 34 C with air at an incoming air temperature of 90 C and an air flow rate of 18 m3/h. A 20 %
aqueous polyvinylpyrrolidone solution ("spraying solution") was then sprayed onto this mixture at an initial spraying rate of 8 g/min and at a spraying air pressure of 0.5 bar. In the course of the granulation process, the spraying rate was increased to 12 g/min and the incoming air temperature was increased to 100 C, while the air flow rate was raised to a maximum of 30 m3/h. The product temperature was kept at about 30-31 C throughout the entire procedure. After 310 g of the polyvinylpyrrolidone solution had been sprayed on, the pellets were dried at a maximum product temperature of 57 C and then cooled to about 30 C and screened.
Before use these pellets (comprising one of the dye combinations 1 to 3100 as described in the below-mentioned table 1) were included in one of the above dye carrier masses A to I as the "Xg Dyes (according to the below-mentioned table 1)" in the needed ratio. Then 60 g of the resulting composition were mixed with 60 grams of a 6% by weight aqueous hydrogen peroxide solution.
The resulting ready-to-apply hair dye mixture was applied to the hair in the required amount.
After an acting time of 30 minutes at 40 C the hair was washed with a shampoo, rinsed with water and dried.
Table 1: Dye Combinations 1 to 3100 Example No. Dye Combination 1. 0.250g methoxymethyl-p-phenylenediamine + 0.120g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g m-aminophenol 2. 2.500g methoxymethyl-p-phenylenediamine + 1.250g resorcinol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-amino-2-hydroxytoluene 3. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-methyl-5-hydroxyethylaminophenol 4. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methylresorcinol 5. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-4-hydroxyethylaminoanisole 6. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 1-naphthol 7. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-chlororesorcinol 8. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3-hydroxypyridine 9. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 10. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 11. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 12. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 13. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 14. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 1-naphthol 15. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 5 16. 0.296g methoxymethyl-p-phenylenediamine dihydrochloride + 0. 145g resorcinol +
0.317g 1-hydroxyethyl-4,5-diaminopyrazole sulfate + 0.080g m-aminophenol +
0.720g 2-amino-3-hydroxypyridine 17. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-10 diaminophenoxyethanol 18. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 19. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-15 hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g methylresorcinol 20. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 20 21. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 22. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-25 chlororesorcinol 23. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 24. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-30 hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 25. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-methylresorcinol 26. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-4-hydroxyethylaminoanisole 27. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 1-naphthol 28. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 4-chlororesorcinol 29. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-3-hydroxypyridine 30. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2,4-diaminophenoxyethanol 31. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 32. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 33. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 34. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxypyridine 35. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 36. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 1-naphthol 37. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 4-chlororesorcinol 38. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 39. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2,4-diaminophenoxyethanol 40. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 41. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 42. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 43. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-hydroxypyridine 44. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 45. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 46. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g m-aminophenol 47. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 48. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 49. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g p-aminophenol + 1.313g 2-methylresorcinol 50. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 51. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g p-aminophenol + 0.263g 1-naphthol 52. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g p-aminophenol + 0.263g 4-chlororesorcinol 53. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g p-aminophenol + 2.625g 2-amino-3-hydroxypyridine 54. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 55. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 56. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 57. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 58. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 59. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 1-naphthol 60. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 61. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 62. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 63. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 64. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 65. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 66. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 67. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 68. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 69. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 70. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 71. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethyl-aminoanisole 72. 0.822g methoxymethyl-p-phenylenediamine sulfate + 1.050g resorcinol +
2.162g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 73. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 74. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 75. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 76. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 77. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 78. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 79. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 80. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 5 81. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 82. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 83. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol 10 + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 84. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 85. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 15 86. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 87. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 88. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol 20 + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 89. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 90. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 25 91. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 92. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 4-amino-2-hydroxytoluene 93. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g 3-methyl-p-30 aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 94. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 95. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 96. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 3-methyl-p-aminophenol + 1.313g 1-naphthol 97. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-chlororesorcinol 98. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 99. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g 3-methyl-p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 100. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 101. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 102. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 103. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 104. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 1-naphthol 105. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 106. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 107. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 108. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 109. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 110. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 111. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1 -naphthol 112. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 113. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 114. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 115. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 116. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 117. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1 -naphthol 118. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 119. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 120. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 121. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 122. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1 -naphthol 123. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 124. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 125. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 126. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 127. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 128. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 129. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 130. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 131. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 132. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 133. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 134. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 135. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 136. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g m-aminophenol 137. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 138. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol 139. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methylresorcinol 140. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 141. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 1-naphthol 142. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-chlororesorcinol 143. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-amino-3-hydroxypyridine 144. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2,4-diaminophenoxyethanol 145. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 146. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 147. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 148. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 149. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1 -naphthol 150. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 151. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 152. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 153. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-5 hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g methyl-5-hydroxyethylaminophenol 154. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 10 155. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 156. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-15 naphthol 157. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 158. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g resorcinol + 2.000g N,N-Bis(2-20 hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g amino-3-hydroxypyridine 159. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 25 160. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-methylresorcinol 161. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
30 2.100g 2-amino-4-hydroxyethylaminoanisole 162. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 1-naphthol 163. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 164. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-3-hydroxypyridine 165. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2,4-diaminophenoxyethanol 166. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 167. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 168. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 169. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxypyridine 170. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 171. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 1-naphthol 172. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 4-chlororesorcinol 173. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 174. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2,4-diaminophenoxyethanol 175. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 176. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 177. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 178. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2-amino-hydroxypyridine 179. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 180. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 181. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol 182. 1.667g methoxymethyl-p-phenylenediamine + 1.750g resorcinol + 1.750g m-aminophenol 183. 3.333g methoxymethyl-p-phenylenediamine + 0.500g resorcinol + 2.320g 4-amino-2-hydroxytoluene + 0.100g 2-amino-5-ethylphenol hydrochloride 184. 1.667g methoxymethyl-p-phenylenediamine + 1.750g resorcinol + 1.750g 2-methyl-5-hydroxyethylaminophenol 185. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 2-methylresorcinol 186. 1.667g methoxymethyl-p-phenylenediamine + 1.750g resorcinol + 1.750g 2-amino-4-hydroxyethylaminoanisole 187. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 1-naphthol 188. 3.333g methoxymethyl-p-phenylenediamine + 3.500g resorcinol + 3.500g 4-chlororesorcinol 189. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 2-amino-3-hydroxypyridine 190. 0.333g methoxymethyl-p-phenylenediamine + 0.350g resorcinol + 0.350g 2,4-diaminophenoxyethanol 191. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene 192. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 193. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g m-aminophenol + 2.625g 2-methylresorcinol 194. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g m-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 195. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g m-aminophenol + 0.263g 1-naphthol 196. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g m-aminophenol + 0.263g 4-chlororesorcinol 197. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g m-aminophenol + 1.313g 2-amino-3-hydroxypyridine 198. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g m-aminophenol + 1.313 g 2,4-diaminophenoxyethanol 199. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2-methyl-5-hydroxyethylaminophenol 200. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methylresorcinol 201. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-4-hydroxyethylaminoanisole 202. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 1-naphthol 203. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 4-chlororesorcinol 204. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-3-hydroxypyridine 205. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2,4-diaminophenoxyethanol 206. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol 207. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 208. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1-naphthol 209. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-chlororesorcinol 210. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 211. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 212. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 2-methylresorcinol + 0.263g 2-amino-4-hydroxyethylaminoanisole 213. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methylresorcinol + 1.313g 1 -naphthol 214. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methylresorcinol + 1.313g 4-chlororesorcinol 215. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 216. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-methylresorcinol + 2.625g 2,4-diaminophenoxyethanol 217. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1 -naphthol 218. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-chlororesorcinol 219. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-amino-3-hydroxypyridine 220. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2,4-diaminophenoxyethanol 221. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 1-naphthol +
1.313g 4-chlororesorcinol 5 222. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 1 -naphthol +
1.313g 2-amino-3-hydroxypyridine 223. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 1 -naphthol +
1.313g 2,4-diaminophenoxyethanol 224. 0.250g methoxymethyl-p-phenylenediamine + 0.263g resorcinol + 0.263g 4-10 chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 225. 2.500g methoxymethyl-p-phenylenediamine + 2.625g resorcinol + 2.625g 4-chlororesorcinol + 2.625g 2,4-diaminophenoxyethanol 226. 1.250g methoxymethyl-p-phenylenediamine + 1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 15 227. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 228. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 20 229. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 230. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol 25 231. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 232. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 233. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-30 aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 234. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 235. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 236. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 237. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 238. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 239. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 240. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 241. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 242. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 243. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 244. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 245. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 246. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 247. 0.200g methoxymethyl-p-phenylenediamine + 0.050g resorcinol + 0.012g m-aminophenol + 0.077g 2-amino-4-hydroxyethylaminoanisole sulfate + 0.021 g 2-amino-3-hydroxypyridine 248. 1.000g methoxymethyl-p-phenylenediamine + 0.050g resorcinol + 1.050g m-aminophenol + 0.079g 2-amino-4-hydroxyethylaminoanisole + 0.095g 2,4-diaminophenoxyethanol sulfate 249. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 250. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 251. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 252. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 253. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 254. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 255. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 256. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.214g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 257. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1 -naphthol 258. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 259. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 260. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 261. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 262. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 263. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 264. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-3 -hydroxypyridine 265. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 266. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 267. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 268. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 269. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 270. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 271. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 272. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 273. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol +.1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 274. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 275. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 276. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 277. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 278. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 279. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 280. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 281. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 282. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 283. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 284. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 285. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 286. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 5 287. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 288. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 10 289. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 290. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-15 diaminophenoxyethanol 291. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 292. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-20 chlororesorcinol 293. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-hydroxypyridine 294. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-25 methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 295. 2.000g methoxymethyl-p-phenylenediamine + 2. 1 00g resorcinol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 296. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-30 methylresorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 297. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 298. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 299. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 300. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2, l00g 2-amino-3-hydroxypyridine + 2. lOOg 2,4-diaminophenoxyethanol 301. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 302. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 303. 0.200g methoxymethyl-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 304. 2.000g methoxymethyl-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 305. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 306. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 307. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 1-naphthol +
1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 308. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g resorcinol + 2. l00g 1-naphthol +
2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 309. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 310. 1.000g methoxymethyl-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 311. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 312. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-amino-2-hydroxytoluene 313. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-methyl-5-hydroxyethylaminophenol 314. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methylresorcinol 315. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-4-hydroxyethylaminoanisole 316. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 317. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-chlororesorcinol 318. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-3-hydroxypyridine 319. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 320. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 321. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 322. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 323. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 324. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 1-naphthol 325. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-chlororesorcinol 326. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 327. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 328. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 329. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 330. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 331. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 332. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 0.150g 4-[(2-hydroxyethyl)-amino]-3-nitrophenol 333. 1.000g methoxymethyl-p-phenylenediamine + 0.850g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 3-amino-2,6-dimethylphenol + 0.750g amino-3-hydroxypyridine + 0.100g 4-[(3-hydroxypropyl)amino]-3-nitrophenol 334. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 335. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-methylresorcinol 336. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-4-hydroxyethylaminoanisole 337. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 1-naphthol 338. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 4-chlororesorcinol 339. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-3 -hydroxypyridine 340. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2,4-diaminophenoxyethanol 341. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxyethylaminoanisole 342. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 1-naphthol 343. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 344. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxypyridine 345. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 346. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 1-naphthol 347. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 4-chlororesorcinol 348. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-5 hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2-amino-3 -hydroxypyridine 349. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 10 350. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 351. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 15 352. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1 -naphthol + 1.050g 2,4-diaminophenoxyethanol 353. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-20 hydroxypyridine 354. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 355. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 1-25 hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-3-hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 356. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g p-aminophenol + 2.625g resorcinol 357. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g p-30 aminophenol + 2.625g 4-amino-2-hydroxytoluene 358. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 359. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g p-aminophenol + 1.313g 2-methylresorcinol 360. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 361. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g p-aminophenol + 0.263g 1-naphthol 362. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g p-aminophenol + 1.313g 4-chlororesorcinol 363. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 364. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 365. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 366. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 367. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 368. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 369. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 370. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 371. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 372. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 373. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 374. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 375. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 376. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 377. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 378. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 379. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 380. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 381. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 382. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 383. 1.500g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 0.200g phenyl-methylpyrazolone 384. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 385. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 386. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 387. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 388. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 389. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 390. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 391. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 392. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 393. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 394. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 395. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 396. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 397. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 1 -naphthol + 0.210g 2,4-diaminophenoxyethanol 398. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 399. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 400. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 401. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 3-methyl-p-aminophenol + 2.625g resorcinol 402. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 403. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 404. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 405. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 406. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g 3-methyl-p-aminophenol + 2.625g 1-naphthol 407. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-chlororesorcinol 408. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 409. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 410. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 411. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 412. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 413. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 414. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 415. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 416. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 417. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 418. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-5 hydroxyethylaminophenol 419. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 420. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-10 hydroxyethylaminoanisole 421. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g m-aminophenol + 2.000g methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1 -naphthol 422. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 15 423. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 424. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-20 diaminophenoxyethanol 425. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 426. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-25 methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 427. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 30 428. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 429. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 430. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 431. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 432. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 433. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 434. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 435. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 436. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 437. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 438. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 439. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 440. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 441. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 442. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 1 -naphthol + 1.050g 2,4-diaminophenoxyethanol 443. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 444. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 445. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 446. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g resorcinol 447. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 448. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol 449. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-methylresorcinol 450. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 451. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 1 -naphthol 452. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 4-chlororesorcinol 453. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 454. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2,4-diaminophenoxyethanol 455. 0.879g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 456. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 457. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 2.830g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methylresorcinol 458. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 459. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 1-naphthol 460. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-chlororesorcinol 461. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 462. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 463. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol 464. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol 465. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole 466. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 1-naphthol 467. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 468. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-3-hydroxypyridine 469. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2,4-diaminophenoxyethanol 470. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 471. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 472. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 473. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 474. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l 00g 2-amino-3 -hydroxypyridine 475. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 476. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 477. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 478. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 479. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-5 Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 480. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 10 481. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 482. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole 15 + 1.050g 4-chlororesorcinol 483. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 484. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.200g N,N-20 Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 485. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 25 486. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 487. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2,4-30 diaminophenoxyethanol 488. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 489. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 490. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-3-hydroxypyridine +
1.050g 2,4-diaminophenoxyethanol 491. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g resorcinol 492. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 493. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g resorcinol + 2.625g 2-methyl-5-hydroxyethylaminophenol 494. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g resorcinol + 1.313g 2-methylresorcinol 495. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g resorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 496. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g resorcinol + 1.313g 1-naphthol 497. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g resorcinol + 2.625g 4-chlororesorcinol 498. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g resorcinol + 0.263g 2-amino-3-hydroxypyridine 499. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g resorcinol + 2.625g 2,4-diaminophenoxyethanol 500. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 501. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 502. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 503. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol 504. 1.000g methoxyrnethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 505. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 506. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 507. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 508. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 509. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 510. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 511. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 512. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 513. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 514. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 515. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 516. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 517. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 518. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 519. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 520. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 521. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 522. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 523. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 524. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 525. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 526. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 527. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 528. 0.500g methoxymethyl-p-phenylenediamine + 0.525g m-aminophenol 529. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 4-amino-2-hydroxytoluene 530. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 2-methyl-5-hydroxyethylaminophenol 531. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 2-methylresorcinol 532. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 2-amino-4-hydroxyethylaminoanisole 533. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 1-naphthol 534. 1.667g methoxymethyl-p-phenylenediamine + 1.750g m-aminophenol + 1.750g 4-chlororesorcinol 535. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 2-amino-3-hydroxypyridine 536. 3.333g methoxymethyl-p-phenylenediamine + 3.500g m-aminophenol + 3.500g 2,4-diaminophenoxyethanol 537. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2-methyl-5-hydroxyethylaminophenol 538. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methylresorcinol 539. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-4-hydroxyethylaminoanisole 540. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 1-naphthol 541. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 542. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-3-hydroxypyridine 543. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2,4-diaminophenoxyethanol 544. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-methylresorcinol 545. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 546. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1-naphthol 547. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 4-chlororesorcinol 548. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-3-hydroxypyridine 549. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2,4-diaminophenoxyethanol 5 550. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g methylresorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 551. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-methylresorcinol + 1.313g 1-naphthol 552. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-10 methylresorcinol + 1.313g 4-chlororesorcinol 553. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methylresorcinol + 2.625g 2-amino-3-hydroxypyridine 554. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-methylresorcinol + 2.625g 2,4-diaminophenoxyethanol 15 555. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1-naphthol 556. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-chlororesorcinol 557. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 2-amino-20 4-hydroxyethylaminoanisole + 1.313g 2-amino-3-hydroxypyridine 558. 0.250g methoxymethyl-p-phenylenediamine + 0.263g m-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2,4-diaminophenoxyethanol 559. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 1-naphthol + 1.313g 4-chlororesorcinol 25 560. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol +
1.313g 1-naphthol + 1.313g 2-amino-3-hydroxypyridine 561. 1.250g methoxymethyl-p-phenylenediamine + 1.313g m-aminophenol + 1.313g 1-naphthol + 1.313g 2,4-diaminophenoxyethanol 562. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-30 chlororesorcinol + 2.625g 2-amino-3-hydroxypyridine 563. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 4-chlororesorcinol + 2.625g 2,4-diaminophenoxyethanol 564. 2.500g methoxymethyl-p-phenylenediamine + 2.625g m-aminophenol + 2.625g 2-amino-3-hydroxypyridine + 2.625g 2,4-diaminophenoxyethanol 565. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g m-aminophenol + 2.l00g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 566. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-hydroxyethylaminoanisole 567. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 568. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 569. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-hydroxypyridine 570. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 571. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 572. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 573. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 574. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 575. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 576. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 577. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 578. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-hydroxypyridine 579. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 580. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 581. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 582. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 583. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 584. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 585. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 586. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxyethylaminoanisole 587. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 588. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 589. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxypyridine 590. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 591. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 1 -naphthol 592. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 4-chlororesorcinol 593. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 594. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2,4-diaminophenoxyethanol 595. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 596. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 597. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 598. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-hydroxypyridine 599. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 600. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 601. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 602. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 603. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-hydroxypyridine 604. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 605. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 606. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 607. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 608. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3 -hydroxypyridine 609. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 610. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 611. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 612. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 613. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 614. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-5 hydroxypyridine 615. 2.000g methoxymethyl-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 616. 4.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-10 4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 617. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 618. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-15 naphthol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 619. 1.000g methoxymethyl-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 620. 0.200g methoxymethyl-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-20 diaminophenoxyethanol 621. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 622. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g m-aminophenol 25 623. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methyl-5-hydroxyethylaminophenol 624. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methylresorcinol 30 625. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-4-hydroxyethylaminoanisole 626. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 1 -naphthol 627. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-chlororesorcinol 628. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-3-hydroxypyridine 629. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 630. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 631. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.l00g resorcinol + 2.l00g 2-methyl-5-hydroxyethylaminophenol 632. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methylresorcinol + 0.090g 4-[(2-hydroxyethyl)amino]-3-nitrophenol 633. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 634. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.l00g resorcinol + 2.100g 1-naphthol 635. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 4-chlororesorcinol 636. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-amino-hydroxypyridine 637. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 638. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 639. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 640. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 641. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 1-naphthol 642. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 643. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 644. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 645. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 646. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 647. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1 -naphthol 648. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 649. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 650. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 651. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g amino-4-hydroxyethylaminoanisole 652. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g naphthol 653. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g chlororesorcinol 654. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g amino-3-hydroxypyridine 655. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 656. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 657. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 658. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 659. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 660. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 661. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 662. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1 -naphthol + 1.050g 2,4-diaminophenoxyethanol 663. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g amino-3 -hydroxypyridine 664. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 665. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-3-hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 666. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g p-aminophenol + 1.313g resorcinol 667. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g m-aminophenol 668. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 669. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g 2-methylresorcinol 670. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 671. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 1-naphthol 672. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 4-chlororesorcinol 673. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g p-aminophenol + 2.625g 2-amino-3-hydroxypyridine 674. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g p-aminophenol + 0.263g 2,4-diaminophenoxyethanol 675. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g m-aminophenol 676. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 677. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol 678. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 679. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 680. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 681. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 682. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 683. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 684. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 685. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 686. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 1-naphthol 687. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 688. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 689. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 690. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 691. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 692. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 693. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 694. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 695. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 696. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.100g 2-amino-6-chloro-4-nitrophenol 697. 1.000g methoxymethyl-p-phenylenediamine + 0.600g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 0.300g 2-methylresorcinol + 1.050g 1-acetoxy-2-methylnaphthalene + 0.100g 2-chloro-6-ethylamino-4-nitrophenol 698. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 699. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3 -hydroxypyridine 700. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 701. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 702. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 703. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 704. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 705. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 706. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 707. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 708. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 709. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 710. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 711. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g resorcinol 712. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 713. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 714. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 715. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 716. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 1-naphthol 717. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 718. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 719. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g 3-methyl-p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 720. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 721. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 722. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol 723. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 724. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3 -methyl-p-aminophenol + 2.100g resorcinol + 2.100g 1 -naphthol 725. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 726. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 727. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2. l00g resorcinol + 2. l00g 2,4-diaminophenoxyethanol 728. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2. l00g m-aminophenol + 2.l04g 2-methyl-5-hydroxyethylaminophenol 729. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.l00g m-aminophenol + 2.l00g 2-methylresorcinol 730. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 731. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 1 -naphthol 732. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 733. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 734. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 735. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-methylresorcinol 736. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-amino-4-hydroxyethylaminoanisole 737. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 1-naphthol 738. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 739. 2.000g methoxymethyl-p-phenylenediamine + 0.600g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 0.500g 2-methyl-5-hydroxyethylaminophenol +
0.900g 2-amino-3-hydroxypyridine + 0.010g picramic acid +0.040g HC Yellow No. 13 740. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2,4-diaminophenoxyethanol + 0.200g 2-hydroxyethyl picramic acid 741. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 742. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 743. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 744. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 745. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 746. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 1-naphthol 747. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 4-chlororesorcinol 748. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3 -hydroxypyridine 749. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 750. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 751. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 752. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 753. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 754. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 755. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 756. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g resorcinol 757. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g m-aminophenol 758. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol 759. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-methylresorcinol 760. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 761. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 1-naphthol 762. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 4-chlororesorcinol 763. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 764. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2,4-diaminophenoxyethanol 765. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol 766. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g methyl-5-hydroxyethylaminophenol 767. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g methylresorcinol 768. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g amino-4-hydroxyethylaminoanisole 769. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g naphthol 770. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g chlororesorcinol 771. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g amino-3-hydroxypyridine 772. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 773. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol +
0.210g 2-methyl-5-hydroxyethylaminophenol 774. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2-methylresorcinol 775. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2-amino-4-hydroxyethylaminoanisole 776. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol +
2.100g 1-naphthol 777. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol +
0.210g 4-chlororesorcinol 778. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2-amino-3 -hydroxypyridine 779. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol +
1.050g 2,4-diaminophenoxyethanol 780. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 781. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 782. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1 -naphthol 783. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 784. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 785. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 786. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole 787. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 1-naphthol 788. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 789. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-amino-3 -hydroxypyridine 790. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2,4-diaminophenoxyethanol 791. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 792. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 793. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 794. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 795. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1-naphthol + 2.100g chlororesorcinol 796. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine 797. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 798. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 799. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 800. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 801. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g resorcinol 802. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g m-aminophenol 803. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol 804. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g resorcinol + 0.263g 2-methylresorcinol 805. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 806. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 1-naphthol 807. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g resorcinol + 2.625g 4-chlororesorcinol 808. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g resorcinol + 0.263g 2-amino-3-hydroxypyridine 809. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g resorcinol + 1.313g 2,4-diaminophenoxyethanol 810. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 811. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 812. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 813. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 1-naphthol 814. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 815. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 816. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 817. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 818. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-hydroxyethylaminoanisole 819. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 820. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 821. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-hydroxypyridine 822. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 823. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 824. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol 825. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 826. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 827. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 828. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 829. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 830. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-hydroxypyridine 831. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 832. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 833. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 834. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 835. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 836. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 837. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 838. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g m-aminophenol 839. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 840. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g m-aminophenol + 2.625g 2-methylresorcinol 841. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 842. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 1-naphthol 843. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g m-aminophenol + 2.625g 4-chlororesorcinol 844. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2-amino-3-hydroxypyridine 845. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g m-aminophenol + 0.263g 2,4-diaminophenoxyethanol 846. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 847. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 848. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 849. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 850. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 851. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 852. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 853. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1 -naphthol 854. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 855. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 856. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 857. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 858. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 859. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine 860. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 861. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 862. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 863. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 864. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 865. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 866. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 867. 0.500g methoxymethyl-p-phenylenediamine + 0.525g 4-amino-2-hydroxytoluene 868. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 4-amino-2-hydroxytoluene +
1.750g 2-methyl-5-hydroxyethylaminophenol 869. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 4-amino-2-hydroxytoluene +
1.750g 2-methylresorcinol 870. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g 2-amino-4-hydroxyethylaminoanisole 871. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g 1-naphthol 872. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-amino-2-hydroxytoluene +
3.500g 4-chlororesorcinol 873. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 4-amino-2-hydroxytoluene +
0.3 50g 2-amino-3 -hydroxypyridine 874. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 4-amino-2-hydroxytoluene +
0.350g 2,4-diaminophenoxyethanol 875. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol 876. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 877. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1 -naphthol 878. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-chlororesorcinol 879. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 880. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 881. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methylresorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 882. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 2-methylresorcinol + 2.625g 1-naphthol 883. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methylresorcinol + 0.263g 4-chlororesorcinol 884. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 885. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-methylresorcinol + 0.263g 2,4-diaminophenoxyethanol 886. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1 -naphthol 887. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-chlororesorcinol 888. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-amino-3-hydroxypyridine 889. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2,4-diaminophenoxyethanol 890. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 1-naphthol + 2.625g 4-chlororesorcinol 891. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 1-naphthol + 2.625g 2-amino-3-hydroxypyridine 892. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 1-naphthol + 0.263g 2,4-diaminophenoxyethanol 893. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 894. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene +
2.625g 4-chlororesorcinol + 2.625g 2,4-diaminophenoxyethanol 895. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-amino-2-hydroxytoluene +
0.263g 2-amino-3-hydroxypyridine + 0.263g 2,4-diaminophenoxyethanol 896. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g amino-4-hydroxyethylaminoanisole 897. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g naphthol 898. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g chlororesorcinol 899. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g amino-3 -hydroxypyridine 900. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 901. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1 -naphthol 902. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 903. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 904. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 905. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 906. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2-amino-hydroxypyridine 907. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 908. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g amino-3-hydroxypyridine 909. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 910. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 911. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g naphthol 912. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g chlororesorcinol 913. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g amino-3-hydroxypyridine 914. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 915. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 916. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 917. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methylresorcinol + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 918. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 919. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 920. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 921. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2. l 00g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2. l 00g 4-chlororesorcinol 922. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2-amino-hydroxypyridine 923. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 924. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol + 0.210g amino-3 -hydroxypyridine 925. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 926. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine +
2 .100 g 2,4-diaminophenoxyethanol 927. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 1-naphthol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 928. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 1-naphthol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 929. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 930. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 931. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 932. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g m-aminophenol 933. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-amino-2-hydroxytoluene 934. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methylresorcinol 935. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-amino-4-hydroxyethylaminoanisole 936. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 937. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-chlororesorcinol 938. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3 -hydroxypyridine 939. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 940. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 941. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 942. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methylresorcinol 943. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 944. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 1 -naphthol 945. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-chlororesorcinol 946. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 947. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 948. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 949. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 950. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 951. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 1-naphthol 952. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 953. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-3 -hydroxypyridine 954. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 955. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 956. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 957. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 958. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 959. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 960. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1 -hydroxyethyl-4,5 -diaminopyrazole + 2.100g amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 961. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 962. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 963. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 964. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 965. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 966. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 967. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 968. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 969. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 970. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 971. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 972. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 973. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 974. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 975. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 976. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g resorcinol 977. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g p-aminophenol + 0.263g m-aminophenol 978. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 979. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g p-aminophenol + 0.263g 2-methylresorcinol 980. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 981. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g p-aminophenol + 0.263g 1 -naphthol 982. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g p-aminophenol + 2.625g 4-chlororesorcinol 983. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 984. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 985. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g m-aminophenol 986. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 987. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol 988. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 989. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 1-naphthol 990. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 991. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 992. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 993. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g amino-2-hydroxytoluene 994. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g methylresorcinol 995. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g amino-4-hydroxyethylaminoanisole 996. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g naphthol 997. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g chlororesorcinol 998. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g amino-3-hydroxypyridine 999. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1000. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1001. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1002. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol 1003. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1004. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 1005. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1006. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole 1007. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 1-naphthol 1008. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 1009. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 2-amino-3 -hydroxypyridine 1010. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol +
2.100g 2,4-diaminophenoxyethanol 1011. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1012. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1013. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1014. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1015. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1016. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g p-aminophenol + 1.050g 1 -naphthol + 1.050g 2-amino-3 -hydroxypyridine 1017. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1018. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol +
0.210g 2-amino-3 -hydroxypyridine 1019. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol +
2.100g 2,4-diaminophenoxyethanol 1020. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1021. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g resorcinol 1022. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g m-aminophenol 1023. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g 3-methyl-p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 1024. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 1025. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 1026. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 1-naphthol 1027. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-chlororesorcinol 1028. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1029. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g 3-methyl-p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1030. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g m-aminophenol 1031. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene 1032. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol +
0.210g 2-methylresorcinol 1033. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1034. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 1-naphthol 1035. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol +
0.210g 4-chlororesorcinol 1036. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3 -methyl-p-aminophenol + 2.100g resorcinol +
2.100g 2-amino-3-hydroxypyridine 1037. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 2,4-diaminophenoxyethanol 1038. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2.100g 4-amino-2-hydroxytoluene 1039. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2.100g 2-methylresorcinol 1040. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1041. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 1-naphthol 1042. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 4-chlororesorcinol 1043. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 2-amino-3-hydroxypyridine 1044. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2. l 00g 2,4-diaminophenoxyethanol 1045. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1046. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3 -methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1047. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1048. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1049. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine 1050. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1051. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3 -methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1052. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 1053. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1054. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 1055. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1056. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1057. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1058. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1059. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1060. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol +
0.210g 4-chlororesorcinol 1061. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g 3-methyl-p-aminophenol + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine 1062. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol +
2.100g 2,4-diaminophenoxyethanol 1063. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1064. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1065. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1066. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g resorcinol 1067. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g m-aminophenol 1068. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 4-amino-2-hydroxytoluene 1069. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-methylresorcinol 1070. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-amino-4-hydroxyethylaminoanisole 1071. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 1-naphthol 1072. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 4-chlororesorcinol 1073. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.313g 2-amino-3-hydroxypyridine 1074. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 2,4-diaminophenoxyethanol 1075. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g m-aminophenol 1076. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1077. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g 2-methylresorcinol 1078. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1079. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 1-naphthol 1080. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-chlororesorcinol 1081. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1082. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 1083. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene 1084. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g m-aminophenol + 0.210g 2-methylresorcinol 1085. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1086. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2. l 00g m-aminophenol + 2.100g 1-naphthol 1087. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1088. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1089. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1090. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1091. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1092. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 1093. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1094. 1.000g methoxymethyl-p-phenylenediamine + 0.500g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.050g 2-amino-3-hydroxypyridine 1095. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1096. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1097. 0.200g methoxymethyl-p-phenylenediamine + 0.100g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.200g 1-naphthol + 0.050g HC Red No. 10 + 0.050g HC Red No. 11 1098. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1099. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 1100. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1101. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1102. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1103. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1104. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1105. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1106. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 1-naphthol + 2.100g 2-amino-3 -hydroxypyridine 1107. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1108. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-chlororesorcinol + 2.100g 2-amino-3 -hydroxypyridine 1109. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1110. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1111. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methyl-5-hydroxyethylaminophenol + 3.500g resorcinol 1112. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g resorcinol + 0.263g m-aminophenol 1113. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 1114. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g resorcinol + 1.313g 2-methylresorcinol 1115. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1116. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g resorcinol + 1.313g 1-naphthol 1117. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g resorcinol + 2.625g 4-chlororesorcinol 1118. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine 1119. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g resorcinol + 0.263g 2,4-diaminophenoxyethanol 1120. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1121. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 1122. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1123. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1-naphthol 1124. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1125. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1126. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1127. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol 1128. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-4-hydroxyethylaminoanisole 1129. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 1-naphthol 1130. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 1131. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-3-hydroxypyridine + 0.150 5-amino-6-chloro-o-cresol 1132. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2,4-diaminophenoxyethanol 1133. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole 1134. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.220g Hydroxypropyl-bis(N-hydroxyethyl-p-phenylenediamine HC10.210g 1-naphthol 1135. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 4-chlororesorcinol 1136. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3-hydroxypyridine 1137. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol +
2.100g 2,4-diaminophenoxyethanol 1138. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1139. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol + 0.340 g 1140. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine 1141. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1142. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1143. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1144. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1145. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol +
2.100g 2-amino-3-hydroxypyridine + 0.420 g Hydroxyethyl-3,4-Methylenedioxyanilie HCl 1146. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol +
0.180g 2,4-diaminophenoxyethanol + 0.300g 1,3-bis(2,4-diaminophenoxypropane 1147. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine +
1.500g 2-(2,4-diaminophenoxy)ethanol 1148. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g m-aminophenol 1149. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g m-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1150. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g m-aminophenol + 0.263g 2-methylresorcinol 1151. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g m-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1152. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g m-aminophenol + 0.263g 1-naphthol 1153. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g m-aminophenol + 2.625g 4-chlororesorcinol 1154. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g m-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1155. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g m-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1156. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1157. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1158. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 1159. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1160. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1161. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2,4-diaminophenoxyethanol 1162. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1163. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 1-naphthol 1164. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 1165. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3 -hydroxypyridine 1166. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2,4-diaminophenoxyethanol 1167. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1168. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 1169. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1170. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1171. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 1172. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 1-naphthol + 1.050g 2-amino-3 -hydroxypyridine 1173. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l 00g m-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1174. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1175. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol +
2.100g 2,4-diaminophenoxyethanol 1176. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g m-aminophenol + 0.100g p-phenylenediamine +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1177. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methyl-5-hydroxyethylaminophenol + 1.750g 4-amino-2-hydroxytoluene 1178. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methylresorcinol 1179. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-4-hydroxyethylaminoanisole 1180. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 1 -naphthol 1181. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 1182. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-3-hydroxypyridine 1183. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2,4-diaminophenoxyethanol 1184. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1185. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol 1186. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 1187. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 1188. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1189. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1190. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 1191. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1192. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1193. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol +
0.210g 4-chlororesorcinol 1194. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol +
2. 1 00g 2-amino-3 -hydroxypyridine 1195. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol +
0.210g 2,4-diaminophenoxyethanol 1196. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1197. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1198. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1199. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol 1200. 3.000g methoxymethyl-p-phenylenediamine + 1.000g 2-methyl-5-hydroxyethylaminophenol + 1.000g 2-methylresorcinol + 1.000 hydroxyethyl-3,4-methylendioxyaniline 1201. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g 2-amino-4-hydroxyethylaminoanisole 1202. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methyl-5-hydroxyethylaminophenol + 1.750g 1-naphthol 1203. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g 4-chlororesorcinol 1204. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methyl-5-hydroxyethylaminophenol + 3.500g 2-amino-3-hydroxypyridine 1205. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-methyl-5-hydroxyethylaminophenol + 0.350g 2,4-diaminophenoxyethanol 1206. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2-methylresorcinol + 0.263g 2-amino-4-hydroxyethylaminoanisole 1207. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol + 2.625g 1-naphthol 1208. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-methylresorcinol + 2.625g 4-chlororesorcinol 1209. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 1210. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2-methylresorcinol + 0.263g 2,4-diaminophenoxyethanol 1211. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1-naphthol 1212. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-chlororesorcinol 1213. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-amino-3-hydroxypyridine 1214. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2,4-diaminophenoxyethanol 1215. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 1-naphthol + 2.625g 4-chlororesorcinol 1216. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 1 -naphthol + 0.263g 2-amino-3-hydroxypyridine 1217. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 1-naphthol + 2.625g 2,4-diaminophenoxyethanol 1218. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-chlororesorcinol + 1.313g 2-amino-3-hydroxypyridine 1219. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 4-chlororesorcinol + 1.313g 2,4-diaminophenoxyethanol 1220. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-3-hydroxypyridine + 2.625g 2,4-diaminophenoxyethanol 1221. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1 -naphthol 1222. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 1223. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1224. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1225. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 1-naphthol +
0.210g 4-chlororesorcinol 1226. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol +
1.050g 2-amino-3-hydroxypyridine 1227. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol +
2.100g 2,4-diaminophenoxyethanol 1228. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1229. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1230. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1231. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1232. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1233. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1234. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1235. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1236. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1237. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1238. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1239. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine +
1.050g 2,4-diaminophenoxyethanol 1240. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1241. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 1242. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g m-aminophenol 1243. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-amino-2-hydroxytoluene 1244. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methyl-5-hydroxyethylaminophenol 1245. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-4-hydroxyethylaminoanisole 1246. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 1247. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 4-chlororesorcinol 1248. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-amino-3-hydroxypyridine 1249. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 1250. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g m-aminophenol 1251. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1252. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1253. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1254. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 1-naphthol 1255. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1256. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 1257. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 1258. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene 1259. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1260. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.l00g m-aminophenol + 2.l00g 2-amino-4-hydroxyethylaminoanisole 1261. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 1 -naphthol 1262. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1263. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1264. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1265. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1266. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1267. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2. l00g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol 1268. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1269. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3 -hydroxypyridine 1270. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1271. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-4-hydroxyethylaminoanisole 1272. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 1-naphthol 1273. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 4-chlororesorcinol 1274. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-3 -hydroxypyridine 1275. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2,4-diaminophenoxyethanol 1276. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 1-naphthol 1277. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 4-chlororesorcinol 1278. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 1279. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 1280. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1 -naphthol + 0.2109 4-chlororesorcinol 1281. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2. l00g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1282. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1283. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-chlororesorcinol + 0.210g 2-amino-hydroxypyridine 1284. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1285. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1286. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g p-aminophenol + 0.263g resorcinol 1287. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g p-aminophenol + 2.625g m-aminophenol 1288. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313 g 4-amino-2-hydroxytoluene 1289. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 1290. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1291. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g p-aminophenol + 0.263g 1 -naphthol 1292. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313g 4-chlororesorcinol 1293. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 1294. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1295. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 1296. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1297. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1298. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1299. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 1-naphthol 1300. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol 1301. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3 -hydroxypyridine 1302. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1303. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1304. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1305. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1306. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 1 -naphthol 1307. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1308. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 1309. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1310. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1311. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1312. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1313. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1314. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 1315. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1316. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1317. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1318. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1319. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1320. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1321. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1322. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1323. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1324. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1325. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 1326. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 1327. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 1328. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1329. 1.000g methoxymethyl-p-phenylenediamine + 1. 050g 2-methylresorcinol +
1.000g p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1330. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1331. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g resorcinol 1332. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 1333. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 1334. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1335. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1336. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g 3-methyl-p-aminophenol + 1.313 g 1-naphthol 1337. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 1338. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 1339. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 1340. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 1341. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1342. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1343. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1344. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 1-naphthol 1345. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1346. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1347. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1348. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.1 OOg 4-amino-2-hydroxytoluene 1349. 2.000g methoxyrnethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1350. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1351. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 1-naphthol 1352. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1353. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1354. 2.000g methoxymethyl-p-phenylenediamine + 2. lOOg 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1355. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1356. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 1357. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2. l 00g 1-naphthol 1358. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1359. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 1360. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1361. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1362. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1363. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1364. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1365. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1366. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1367. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1368. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 1369. 1.500g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1370. 0.700g methoxymethyl-p-phenylenediamine + 0.110g 2-methylresorcinol +
1.300g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1371. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1372. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 1373. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1374. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1375. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1376. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g resorcinol 1377. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g m-aminophenol 1378. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 1379. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol 1380. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole 1381. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 1 -naphthol 1382. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-chlororesorcinol 1383. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-amino-3-hydroxypyridine 1384. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2,4-diaminophenoxyethanol 1385. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol 1386. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1387. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1388. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1389. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 1 -naphthol 1390. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-chlororesorcinol 1391. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 1392. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1393. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 4-amino-hydroxytoluene 1394. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1395. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-hydroxyethylaminoanisole 1396. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 1-naphthol 1397. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1398. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-hydroxypyridine 1399. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1400. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol 1401. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-amino-4-hydroxyethylaminoanisole 1402. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 1-naphthol 1403. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 1404. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-3-hydroxypyridine 1405. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2,4-diaminophenoxyethanol 1406. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1407. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1408. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1409. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1410. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1411. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 1412. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2. l 00g 4-chlororesorcinol 1413. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3 -hydroxypyridine 1414. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1415. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol 1416. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 1417. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 1418. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 1419. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1420. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-amino-3-hydroxypyridine +
1.050g 2,4-diaminophenoxyethanol 1421. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g resorcinol 1422. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g m-aminophenol 1423. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 1424. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1425. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g resorcinol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1426. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g resorcinol + 2.625g 1-naphthol 1427. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g resorcinol + 0.263g 4-chlororesorcinol 1428. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine 1429. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g resorcinol + 1.313g 2,4-diaminophenoxyethanol 1430. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene 1431. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1432. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1433. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 1-naphthol 1434. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1435. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1436. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1437. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1438. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.
l00g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1439. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1440. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1441. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1442. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1443. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2. lOOg resorcinol + 2. l00g 2-methyl-5-hydroxyethylaminophenol + 2. l00g 2-amino-4-hydroxyethylaminoanisole 1444. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1 -naphthol 1445. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1446. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1447. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1448. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1449. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1450. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1451. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1452. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 1-naphthol + 2.1009 4-chlororesorcinol 1453. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1454. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 1 -naphthol + 1.0509 2,4-diaminophenoxyethanol 1455. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 1456. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g resorcinol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1457. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1458. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g m-aminophenol 1459. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g m-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1460. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g m-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 1461. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g m-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 1462. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g m-aminophenol + 2.625g 1 -naphthol 1463. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g m-aminophenol + 0.263g 4-chlororesorcinol 1464. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g m-aminophenol + 2.625g 2-amino-3-hydroxypyridine 1465. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g m-aminophenol + 2.625g 2,4-diaminophenoxyethanol 1466. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 1467. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1468. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1469. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1470. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1471. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1472. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1473. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1474. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l00g 4-chlororesorcinol 1475. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 1476. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1477. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 1478. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1479. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1480. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 1481. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1482. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 1483. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1484. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1485. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1486. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1487. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 4-amino-2-hydroxytoluene 1488. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methyl-5-hydroxyethylaminophenol 1489. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 2-amino-4-hydroxyethylaminoanisole 1490. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 4-amino-2-hydroxytoluene + 2.625g 1-naphthol 1491. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 1492. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 4-amino-2-hydroxytoluene + 2.625g 2-amino-3-hydroxypyridine 1493. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-amino-2-hydroxytoluene + 1.313g 2,4-diaminophenoxyethanol 1494. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1495. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1496. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1497. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3 -hydroxypyridine 1498. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1499. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol 1500. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1501. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine 1502. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2,4-diaminophenoxyethanol 1503. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 1504. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol + 1.050g 2-amino-3-hydroxypyridine 1505. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 1 -naphthol + 0.210g 2,4-diaminophenoxyethanol 1506. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1507. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1508. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1509. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 2-methyl-5-hydroxyethylaminophenol 1510. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1511. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 1-naphthol 1512. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 4-chlororesorcinol 1513. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 1514. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 1515. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 1-naphthol 1516. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 4-chlororesorcinol 1517. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 1518. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2,4-diaminophenoxyethanol 1519. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1 -naphthol + 0.210g 4-chlororesorcinol 1520. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1521. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol + 2. l 00g 2,4-diaminophenoxyethanol 1522. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-hydroxypyridine 1523. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1524. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1525. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol 1526. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methylresorcinol +
1.750g 2-amino-4-hydroxyethylaminoanisole 1527. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methylresorcinol +
1.750g 1-naphthol 1528. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 4-chlororesorcinol 1529. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-methylresorcinol +
1.750g 2-amino-3 -hydroxypyridine 1530. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-methylresorcinol +
3.500g 2,4-diaminophenoxyethanol 1531. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1 -naphthol 1532. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-chlororesorcinol 1533. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-amino-3-hydroxypyridine 1534. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2,4-diaminophenoxyethanol 1535. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 1-naphthol + 2.625g 4-chlororesorcinol 1536. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-methylresorcinol +
2.625g 1-naphthol + 2.625g 2-amino-3-hydroxypyridine 1537. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 1-naphthol + 1.313g 2,4-diaminophenoxyethanol 1538. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-methylresorcinol +
0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 1539. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 4-chlororesorcinol + 1.313g 2,4-diaminophenoxyethanol 1540. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-methylresorcinol +
1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 1541. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1542. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1543. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 1544. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol + 0.210g 2-amino-hydroxypyridine 1545. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1546. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1547. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-methylresorcinol +
0.210g 1-naphthol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1548. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 1-naphthol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1549. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-methylresorcinol +
2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1550. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-methylresorcinol +
1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1551. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 1552. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g m-aminophenol 1553. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g amino-2-hydroxytoluene 1554. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g methyl-5-hydroxyethylaminophenol 1555. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g methylresorcinol 1556. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g naphthol 1557. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g chlororesorcinol 1558. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g amino-3 -hydroxypyridine 1559. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 1560. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g m-aminophenol 1561. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1562. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1563. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 1564. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 1-naphthol 1565. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1566. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 1567. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1 -hydroxyethyl-4,5 -diaminopyrazole +
2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1568. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 1569. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1570. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 1571. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 1 -naphthol 1572. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1573. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1574. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1575. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 1576. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1577. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g amino-2-hydroxytoluene + 0.210g 1-naphthol 1578. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1579. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 1580. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1581. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1582. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1583. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1584. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1585. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1586. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methylresorcinol + 1.050g 1-naphthol 1587. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g methylresorcinol + 1.050g 4-chlororesorcinol 1588. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1 -hydroxyethyl-4,5-diaminopyrazole + 0.210g methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1589. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1590. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 2.100g naphthol + 2.100g 4-chlororesorcinol 1591. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g naphthol + 0.210g 2-amino-3-hydroxypyridine 1592. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g naphthol + 0.210g 2,4-diaminophenoxyethanol 1593. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1594. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 1 -hydroxyethyl-4,5-diaminopyrazole + 1.050g chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1595. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g amino-3 -hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1596. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g resorcinol 1597. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g m-aminophenol 1598. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1599. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1600. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2-methylresorcinol 1601. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g p-aminophenol + 0.263g 1-naphthol 1602. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g p-aminophenol + 2.625g 4-chlororesorcinol 1603. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1604. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1605. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g m-aminophenol 1606. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 1607. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1608. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol 1609. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 1-naphthol 1610. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 1611. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1612. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1613. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 4-amino-2-hydroxytoluene 1614. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 2-methyl-5-hydroxyethylaminophenol 1615. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g m-aminophenol +
0.210g 2-methylresorcinol 1616. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 1-naphthol 1617. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g m-aminophenol +
2.100g 4-chlororesorcinol 1618. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g m-aminophenol +
1.050g 2-amino-3-hydroxypyridine 1619. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g m-aminophenol +
0.210g 2,4-diaminophenoxyethanol 1620. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 1621. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1622. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1623. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1624. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 1625. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1626. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1627. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 1628. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1629. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 1630. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1631. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g p-aminophenol + 2.100g 2-methylresorcinol +
2.100g 1-naphthol 1632. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 4-chlororesorcinol 1633. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 2-amino-3 -hydroxypyridine 1634. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-methylresorcinol +
1.050g 2,4-diaminophenoxyethanol 1635. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1636. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 1 -naphthol + 1.050g amino-3-hydroxypyridine 1637. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1638. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol +
0.210g 2-amino-3-hydroxypyridine 1639. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2,4-diaminophenoxyethanol 1640. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g p-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1641. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g resorcinol 1642. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 1643. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 4-amino-2-hydroxytoluene 1644. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methyl-5-hydroxyethylaminophenol 1645. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 2-methylresorcinol 1646. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g 1 -naphthol 1647. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 1648. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g 3-methyl-p-aminophenol + 2.625g 2-amino-3-hydroxypyridine 1649. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g 3-methyl-p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1650. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g m-aminophenol 1651. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol +
0.210g 4-amino-2-hydroxytoluene 1652. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g 2-methyl-5-hydroxyethylaminophenol 1653. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2. l 00g 2-methylresorcinol 1654. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2.100g 1-naphthol 1655. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3 -methyl-p-aminophenol + 2.100g resorcinol +
2. l 00g 4-chlororesorcinol 1656. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol +
2. l 00g 2-amino-3-hydroxypyridine 1657. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol +
1.050g 2,4-diaminophenoxyethanol 1658. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 4-amino-2-hydroxytoluene 1659. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 2-methyl-5-hydroxyethylaminophenol 1660. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3 -methyl-p-aminophenol + 2.100g m-aminophenol +
2. l 00g 2-methylresorcinol 1661. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3 -methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 1-naphthol 1662. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino- 4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol +
0.210g 4-chlororesorcinol 1663. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol +
2. l 00g 2-amino-3-hydroxypyridine 1664. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol +
1.050g 2,4-diaminophenoxyethanol 1665. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1666. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1667. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1668. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1669. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1670. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1671. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 1672. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0. 200g 3 -methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1673. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1674. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1675. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1676. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 1-naphthol 1677. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 1678. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 1679. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1680. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 1-naphthol +
1.050g 4-chlororesorcinol 1681. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol +
0.210g 2-amino-3-hydroxypyridine 1682. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol +
0.210g 2,4-diaminophenoxyethanol 1683. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g 3-methyl-p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 1684. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1685. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1686. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g resorcinol 1687. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g m-aminophenol 1688. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 4-amino-2-hydroxytoluene 1689. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.263g 2-methyl-5-hydroxyethylaminophenol 1690. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-methylresorcinol 1691. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.313g 1-naphthol 1692. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 4-chlororesorcinol 1693. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2-amino-3-hydroxypyridine 1694. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.625g 2,4-diaminophenoxyethanol 1695. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g m-aminophenol 1696. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 1697. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1698. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g 2-methylresorcinol 1699. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 1-naphthol 1700. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 4-chlororesorcinol 1701. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 1702. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 1703. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1704. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1705. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g m-aminophenol + 2.100g 2-methylresorcinol 1706. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 1-naphthol 1707. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1708. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 1709. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 1710. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1711. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 1712. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 4-amino-2-hydroxytoluene + 1.050g 1-naphthol 1713. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1714. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1715. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1716. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 1717. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 1718. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1719. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 1720. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 1721. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 2-methylresorcinol + 1.050g 1 -naphthol 1722. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 1723. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1724. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 1725. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
1.050g 1-naphthol + 1.050g 4-chlororesorcinol 1726. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 1727. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1728. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1729. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1730. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine +
0.210g 2-amino-3 -hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1731. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-amino-4-hydroxyethylaminoanisole + 3.500g resorcinol 1732. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g m-aminophenol 1733. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 1734. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g resorcinol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1735. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g 2-methylresorcinol 1736. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g resorcinol + 1.313g 1-naphthol 1737. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g resorcinol + 2.625g 4-chlororesorcinol 1738. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g resorcinol + 2.625g 2-amino-3-hydroxypyridine 1739. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g resorcinol + 0.263g 2,4-diaminophenoxyethanol 1740. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1741. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1742. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 1743. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1-naphthol 1744. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1745. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-3 -hydroxypyridine 1746. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 1747. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol 1748. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methylresorcinol 1749. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 1-naphthol 1750. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 4-chlororesorcinol 1751. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene +
2. l 00g 2-amino-3-hydroxypyridine 1752. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2,4-diaminophenoxyethanol 1753. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1754. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1755. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 1756. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 1757. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1758. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 1-naphthol 1759. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 2-methylresorcinol +
1.050g 4-chlororesorcinol 1760. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3-hydroxypyridine 1761. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-methylresorcinol +
0.210g 2,4-diaminophenoxyethanol 1762. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 1 -naphthol + 2.100g 4-chlororesorcinol 1763. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g resorcinol + 1.050g 1-naphthol + 1.050g 2-amino-3-hydroxypyridine 1764. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2,4-diaminophenoxyethanol 1765. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g resorcinol + 2.100g 4-chlororesorcinol +
2.100g 2-amino-3 -hydroxypyridine 1766. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1767. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine +
0.210g 2,4-diaminophenoxyethanol 1768. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 2-amino-4-hydroxyethylaminoanisole + 3.500g m-aminophenol 1769. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene 1770. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1771. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 2-methylresorcinol 1772. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g m-aminophenol + 0.263g 1-naphthol 1773. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g m-aminophenol + 0.263g 4-chlororesorcinol 1774. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g m-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1775. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g m-aminophenol + 0.263g 2,4-diaminophenoxyethanol 1776. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1777. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1778. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 1779. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 1780. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1781. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1782. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1783. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 1784. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1785. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1786. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 1787. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 1-naphthol 1788. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol +
2.100g 4-chlororesorcinol 1789. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2-amino-3 -hydroxypyridine 1790. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol +
0.210g 2,4-diaminophenoxyethanol 1791. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol 1792. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 1793. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g m-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 1794. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2-amino-3-hydroxypyridine 1795. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol +
1.050g 2,4-diaminophenoxyethanol 1796. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1797. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-amino-4-hydroxyethylaminoanisole + 0.350g 4-amino-2-hydroxytoluene 1798. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methyl-5-hydroxyethylaminophenol 1799. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methylresorcinol 1800. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-amino-2-hydroxytoluene + 0.263g 1-naphthol 1801. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-amino-2-hydroxytoluene + 0.263g 4-chlororesorcinol 1802. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2-amino-3-hydroxypyridine 1803. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-amino-2-hydroxytoluene + 2.625g 2,4-diaminophenoxyethanol 1804. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 1805. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 1-naphthol 1806. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 4-chlororesorcinol 1807. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 1808. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1809. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 1-naphthol 1810. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1811. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 1812. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1813. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1-naphthol +
2. l 00g 4-chlororesorcinol 1814. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol +
1.050g 2-amino-3-hydroxypyridine 1815. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 1 -naphthol +
1.050g 2,4-diaminophenoxyethanol 1816. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1817. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1818. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3 -hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1819. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 2-methyl-5-hydroxyethylaminophenol 1820. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g methylresorcinol 1821. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g naphthol 1822. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g chlororesorcinol 1823. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g amino-3 -hydroxypyridine 1824. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 1825. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g methylresorcinol + 0.210g 1-naphthol 1826. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g methylresorcinol + 0.210g 4-chlororesorcinol 1827. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1828. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1829. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g naphthol + 1.050g 4-chlororesorcinol 1830. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g naphthol + 0.210g 2-amino-3-hydroxypyridine 1831. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g naphthol + 1.050g 2,4-diaminophenoxyethanol 1832. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1833. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1834. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1835. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 2-methylresorcinol 1836. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-methylresorcinol + 0.263g 1 -naphthol 1837. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2-methylresorcinol + 1.313g 4-chlororesorcinol 1838. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methylresorcinol + 2.625g 2-amino-3-hydroxypyridine 1839. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 2-methylresorcinol + 2.625g 2,4-diaminophenoxyethanol 1840. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methylresorcinol + 1.050g 1 -naphthol +
1.050g 4-chlororesorcinol 1841. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol +
0.210g 2-amino-3-hydroxypyridine 1842. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 1-naphthol +
0.210g 2,4-diaminophenoxyethanol 1843. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol +
0.210g 2-amino-3-hydroxypyridine 1844. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol +
1.050g 2,4-diaminophenoxyethanol 1845. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1846. 5.000g methoxymethyl-p-phenylenediamine + 5.250g 2-amino-4-hydroxyethylaminoanisole 1847. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-amino-4-hydroxyethylaminoanisole + 0.350g 1-naphthol 1848. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 4-chlororesorcinol 1849. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 2-amino-4-hydroxyethylaminoanisole + 0.350g 2-amino-3-hydroxypyridine 1850. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 2-amino-4-hydroxyethylaminoanisole + 1.750g 2,4-diaminophenoxyethanol 1851. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1-naphthol + 1.313g 4-chlororesorcinol 1852. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 1 -naphthol + 2.625g 2-amino-3-hydroxypyridine 1853. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 1 -naphthol + 1.313g 2,4-diaminophenoxyethanol 1854. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 1855. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 4-chlororesorcinol + 1.313g 2,4-diaminophenoxyethanol 1856. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole + 1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 1857. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 4-chlororesorcinol +
2.100g 2-amino-3 -hydroxypyridine 1858. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol +
0.210g 2,4-diaminophenoxyethanol 1859. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 1-naphthol + 2.100g 2-amino-3 -hydroxypyridine +
2.100g 2,4-diaminophenoxyethanol 1860. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 1861. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 1862. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g m-aminophenol 1863. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 4-amino-2-hydroxytoluene 1864. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-methyl-5-hydroxyethylaminophenol 1865. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methylresorcinol 1866. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-amino-4-hydroxyethylaminoanisole 1867. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 4-chlororesorcinol 1868. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3-hydroxypyridine 1869. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2,4-diaminophenoxyethanol 1870. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 1871. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1872. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 1873. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 1874. 0.200g methoxymethyl-p-phenylenediamine + 0.21 Og 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 1875. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-chlororesorcinol 1876. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 1877. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2,4-diaminophenoxyethanol 1878. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 1879. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2. l00g 2-methyl-5-hydroxyethylaminophenol 1880. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 1881. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1882. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 1883. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1884. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1885. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1886. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1887. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1888. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 1889. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3 -hydroxypyridine 1890. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1891. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-methylresorcinol 1892. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-4-hydroxyethylaminoanisole 1893. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 1894. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-amino-3-hydroxypyridine 1895. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2,4-diaminophenoxyethanol 1896. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 1897. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol 1898. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxypyridine 1899. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 1900. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 4-chlororesorcinol 1901. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-amino-4-hydroxyethylaminoanisole +
1.050g 2-amino-3-hydroxypyridine 1902. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2,4-diaminophenoxyethanol 1903. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-chlororesorcinol + 0.210g 2-amino-hydroxypyridine 1904. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 1-naphthol + 2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 1905. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1906. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g p-aminophenol + 1.313g resorcinol 1907. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g p-aminophenol + 2.625g m-aminophenol 1908. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 4-amino-2-hydroxytoluene 1909. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 1910. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g p-aminophenol + 2.625g 2-methylresorcinol 1911. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 1912. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 4-chlororesorcinol 1913. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 1914. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1915. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g m-aminophenol 1916. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 1917. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1918. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 1919. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1920. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g resorcinol + 0.210g 4-chlororesorcinol 1921. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-3 -hydroxypyridine 1922. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1923. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 1924. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1925. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 1926. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1927. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol 1928. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 1929. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1930. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1931. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 1932. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 1933. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1934. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1935. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 1936. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 1937. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1938. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1939. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 1940. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 1941. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1942. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 1943. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 1944. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 1945. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 1946. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 1947. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1948. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1949. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 1950. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 1951. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g resorcinol 1952. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 1953. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 1954. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 1955. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g 3-methyl-p-aminophenol + 0.263g 2-methylresorcinol 1956. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 3-methyl-p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 1957. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g 3-methyl-p-aminophenol + 2.625g 4-chlororesorcinol 1958. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 2-amino-3-hydroxypyridine 1959. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g 3-methyl-p-aminophenol + 1.313g 2,4-diaminophenoxyethanol 1960. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 1961. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 1962. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 1963. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-methylresorcinol 1964. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1965. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 4-chlororesorcinol 1966. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 1967. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 1968. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 1969. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 1970. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 1971. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1972. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-chlororesorcinol 1973. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 1974. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 1975. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 1976. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 1977. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 1978. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 4-chlororesorcinol 1979. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-3-hydroxypyridine 1980. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 1981. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 1982. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 1983. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 1984. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 1985. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 1986. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 1987. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 1988. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 1989. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 1990. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3 -methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 1991. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1 -naphthol + 0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 1992. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 1993. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 1994. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g 3-methyl-p-aminophenol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 1995. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 1996. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g resorcinol 1997. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g m-aminophenol 1998. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 4-amino-2-hydroxytoluene 1999. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methyl-5-hydroxyethylaminophenol 2000. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methylresorcinol 2001. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-4-hydroxyethylaminoanisole 2002. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 4-chlororesorcinol 2003. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 2004. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2,4-diaminophenoxyethanol 2005. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g m-aminophenol 2006. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene 2007. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2008. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol 2009. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2010. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 4-chlororesorcinol 2011. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 2012. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 2013. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2014. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2015. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 2016. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2017. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol 2018. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 2019. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2020. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2021. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 2022. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 2023. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol 2024. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3 -hydroxypyridine 2025. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2026. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-methylresorcinol 2027. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-amino-4-hydroxyethylaminoanisole 2028. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 4-chlororesorcinol 2029. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 2-amino-3-hydroxypyridine 2030. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2,4-diaminophenoxyethanol 2031. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxyethylaminoanisole 2032. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2033. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methylresorcinol + 0.210g 2-amino-hydroxypyridine 2034. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 2035. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2. 1 00g 4-chlororesorcinol 2036. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 2037. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2,4-diaminophenoxyethanol 2038. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-chlororesorcinol + 1.050g 2-amino-hydroxypyridine 2039. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 2040. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2041. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g resorcinol 2042. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g resorcinol +
2.625g m-aminophenol 2043. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 4-amino-2-hydroxytoluene 2044. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 2-methyl-5-hydroxyethylaminophenol 2045. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g resorcinol +
2.625g 2-methylresorcinol 2046. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 2-amino-4-hydroxyethylaminoanisole 2047. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g resorcinol +
0.263g 4-chlororesorcinol 2048. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g resorcinol +
1.313 g 2-amino-3-hydroxypyridine 2049. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g resorcinol +
2.625g 2,4-diaminophenoxyethanol 2050. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 2051. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2052. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g m-aminophenol + 2.100g 2-methylresorcinol 2053. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g m-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2054. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 4-chlororesorcinol 2055. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 2056. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2057. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1 -naphthol + 2.100g resorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2058. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 2059. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 2060. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 2061. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2062. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 2063. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol 2064. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2065. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 2066. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 2067. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2068. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2069. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2070. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2071. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2072. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 2073. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g resorcinol +
0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2074. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2075. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g resorcinol +
2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 2076. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g resorcinol +
1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2077. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g resorcinol +
1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2078. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 1-naphthol + 1.750g m-aminophenol 2079. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.313g m-aminophenol + 1.313g 4-amino-2-hydroxytoluene 2080. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g m-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 2081. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g m-aminophenol + 1.313g 2-methylresorcinol 2082. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g m-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 2083. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g m-aminophenol + 0.263g 4-chlororesorcinol 2084. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g m-aminophenol + 0.263g 2-amino-3-hydroxypyridine 2085. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1 -naphthol + 1.313g m-aminophenol + 1.313g 2,4-diaminophenoxyethanol 2086. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2087. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol 2088. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 2089. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol 2090. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2091. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 2092. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2093. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2094. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol 2095. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3-hydroxypyridine 2096. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2097. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2098. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2099. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine 2100. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 2101. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 2102. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2103. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2104. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g m-aminophenol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 2105. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 4-chlororesorcinol + 2.100g 2,4-diaminophenoxyethanol 2106. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine + 2.100g 2,4-diaminophenoxyethanol 2107. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 1-naphthol + 1.750g 4-amino-2-hydroxytoluene 2108. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-methyl-5-hydroxyethylaminophenol 2109. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2-methylresorcinol 2110. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-4-hydroxyethylaminoanisole 2111. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 4-chlororesorcinol 2112. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-amino-2-hydroxytoluene + 0.263g 2-amino-3-hydroxypyridine 2113. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 4-amino-2-hydroxytoluene + 1.313g 2,4-diaminophenoxyethanol 2114. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2115. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2116. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol 2117. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-3 -hydroxypyridine 2118. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2,4-diaminophenoxyethanol 2119. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2. l 00g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2120. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol 2121. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2. l 00g 4-amino-2-hydroxytoluene + 2.100g 2-methylresorcinol + 2.100g 2-amino-3 -hydroxypyridine 2122. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 2123. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 4-chlororesorcinol 2124. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 2125. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 2126. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 4-chlororesorcinol + 2.100g 2-amino-3-hydroxypyridine 2127. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2128. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2129. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 1-naphthol + 0.350g 2-methyl-5-hydroxyethylaminophenol 2130. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-methylresorcinol 2131. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 2132. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g 2-methyl-5-hydroxyethylaminophenol + 2.625g 4-chlororesorcinol 2133. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methyl-5-hydroxyethylaminophenol + 1.313g 2-amino-3-hydroxypyridine 2134. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-methyl-5-hydroxyethylaminophenol + 0.263g 2,4-diaminophenoxyethanol 2135. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1 -naphthol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2136. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol + 2.100g 4-chlororesorcinol 2137. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-methylresorcinol + 0.210g 2-amino-3-hydroxypyridine 2138. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2139. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 4-chlororesorcinol 2140. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-3 -hydroxypyridine 2141. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2142. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 2143. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 4-chlororesorcinol + 0.210g 2,4-diaminophenoxyethanol 2144. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2145. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 1-naphthol + 0.350g 2-methylresorcinol 2146. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methylresorcinol + 1.313g 2-amino-4-hydroxyethylaminoanisole 2147. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methylresorcinol + 1.313g 4-chlororesorcinol 2148. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-methylresorcinol + 1.313g 2-amino-3-hydroxypyridine 2149. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-methylresorcinol + 0.263g 2,4-diaminophenoxyethanol 2150. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol 2151. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 1-naphthol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2-amino-hydroxypyridine 2152. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 2153. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-methylresorcinol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine 2154. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methylresorcinol + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2155. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-methylresorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2156. 0.333g methoxymethyl-p-phenylenediamine + 0.350g 1-naphthol + 0.350g 2-amino-4-hydroxyethylaminoanisole 2157. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol + 2.625g 2-amino-4-hydroxyethylaminoanisole + 2.625g 4-chlororesorcinol 2158. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2-amino-3-hydroxypyridine 2159. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 2-amino-4-hydroxyethylaminoanisole + 0.263g 2,4-diaminophenoxyethanol 2160. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2-amino-3-hydroxypyridine 2161. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 4-chlororesorcinol + 1.050g 2,4-diaminophenoxyethanol 2162. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 1-naphthol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2163. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 1-naphthol 2164. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g 4-chlororesorcinol 2165. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g 2-amino-3-hydroxypyridine 2166. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 1-naphthol + 3.500g 2,4-diaminophenoxyethanol 2167. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-chlororesorcinol + 0.263g 2-amino-3-hydroxypyridine 2168. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 1-naphthol + 0.263g 4-chlororesorcinol + 0.263g 2,4-diaminophenoxyethanol 2169. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 1-naphthol + 1.313g 2-amino-3-hydroxypyridine + 1.313g 2,4-diaminophenoxyethanol 2170. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 4-chlororesorcinol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2171. 2.500g methoxymethyl- p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g resorcinol 2172. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g m-aminophenol 2173. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 4-amino-2-hydroxytoluene 2174. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-methyl-5-hydroxyethylaminophenol 2175. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2-methylresorcinol 2176. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 1-hydroxyethyl-4,5-diaminopyrazole + 2.625g 2-amino-4-hydroxyethylaminoanisole 2177. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 1-naphthol 2178. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 1-hydroxyethyl-4,5-diaminopyrazole + 0.263g 2-amino-3-hydroxypyridine 2179. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 1-hydroxyethyl-4,5-diaminopyrazole + 1.313g 2,4-diaminophenoxyethanol 2180. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g m-aminophenol 2181. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 2182. 2.000g methoxymethyl-p-phenylenediamine + 2.l00g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2183. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-methylresorcinol 2184. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2185. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g resorcinol + 2.100g 1-naphthol 2186. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 2187. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 2188. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2189. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 2190. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 2191. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2192. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g m-aminophenol + 0.210g 1 -naphthol 2193. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 2194. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g m-aminophenol + 1.050g 2,4-diaminophenoxyethanol 2195. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methyl-5-hydroxyethylaminophenol 2196. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 2197. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-amino-4-hydroxyethylaminoanisole 2198. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 2199. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 2200. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2,4-diaminophenoxyethanol 2201. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.100g 2-methylresorcinol 2202. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methyl-5-hydroxyethylaminophenol +
2.1 OOg 2-amino-4-hydroxyethylaminoanisole 2203. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-methyl-5-hydroxyethylaminophenol +
0.210g 1-naphthol 2204. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2-amino-3-hydroxypyridine 2205. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methyl-5-hydroxyethylaminophenol +
1.050g 2,4-diaminophenoxyethanol 2206. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2-amino-hydroxyethylaminoanisole 2207. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 1 -naphthol 2208. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 1-hydroxyethyl-4,5-diaminopyrazole + 1.050g 2-methylresorcinol + 1.050g 2-amino-hydroxypyridine 2209. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 2210. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 1-naphthol 2211. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-4-hydroxyethylaminoanisole +
0.210g 2-amino-3-hydroxypyridine 2212. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 2-amino-4-hydroxyethylaminoanisole +
2.100g 2,4-diaminophenoxyethanol 2213. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 1-hydroxyethyl-4,5-diaminopyrazole + 2.100g 1-naphthol + 2.1009 2-amino-3-hydroxypyridine 2214. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 1-naphthol + 0.2109 2,4-diaminophenoxyethanol 2215. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 1-hydroxyethyl-4,5-diaminopyrazole + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2216. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g p-aminophenol + 0.263g resorcinol 2217. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g p-aminophenol + 1.313g m-aminophenol 2218. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 2219. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g p-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 2220. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.2509 p-aminophenol + 1.313g 2-methylresorcinol 2221. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.2509 p-aminophenol + 1.313g 2-amino-4-hydroxyethylaminoanisole 2222. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g p-aminophenol + 1.313g 1-naphthol 2223. 1.250g methoxymethyl-p-phenylenediamine + 0.906g 4-chlororesorcinol +
1.250g p-aminophenol + 0.712g 2-amino-3-hydroxypyridine 2224. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 2225. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 2226. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene 2227. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2228. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 2229. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2230. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 1 -naphthol 2231. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine 2232. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 2233. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2234. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2235. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methylresorcinol 2236. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2237. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 1-naphthol 2238. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g m-aminophenol + 0.210g 2-amino-3-hydroxypyridine 2239. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 2240. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 2241. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 2242. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 2243. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 1 -naphthol 2244. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-3-hydroxypyridine 2245. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2246. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2247. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2248. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 2249. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3-hydroxypyridine 2250. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2,4-diaminophenoxyethanol 2251. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2252. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1 -naphthol 2253. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2254. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 2,4-diaminophenoxyethanol 2255. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1 -naphthol 2256. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2257. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2258. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g p-aminophenol + 2.100g 1 -naphthol + 2.100g 2-amino-3-hydroxypyridine 2259. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g p-aminophenol + 1.050g 1-naphthol + 1.050g 2,4-diaminophenoxyethanol 2260. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g p-aminophenol + 0.210g 2-amino-3-hydroxypyridine + 0.210g 2,4-diaminophenoxyethanol 2261. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 3-methyl-p-aminophenol + 0.263g resorcinol 2262. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g m-aminophenol 2263. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 4-amino-2-hydroxytoluene 2264. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 2-methyl-5-hydroxyethylaminophenol 2265. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2-methylresorcinol 2266. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2-amino-4-hydroxyethylaminoanisole 2267. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g 3-methyl-p-aminophenol + 1.313g 1-naphthol 2268. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g 3-methyl-p-aminophenol + 0.263g 2-amino-3-hydroxypyridine 2269. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g 3-methyl-p-aminophenol + 2.625g 2,4-diaminophenoxyethanol 2270. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g m-aminophenol 2271. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 2272. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol 2273. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 2-methylresorcinol 2274. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2275. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g resorcinol + 1.050g 1 -naphthol 2276. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g resorcinol + 0.210g 2-amino-3-hydroxypyridine 2277. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g resorcinol + 2.100g 2,4-diaminophenoxyethanol 2278. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g m-aminophenol + 1.050g 4-amino-2-hydroxytoluene 2279. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2280. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-methylresorcinol 2281. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2282. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 1-naphthol 2283. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g m-aminophenol + 2.100g 2-amino-3-hydroxypyridine 2284. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2285. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methyl-5-hydroxyethylaminophenol 2286. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-methylresorcinol 2287. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-4-hydroxyethylaminoanisole 2288. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 2289. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2290. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2291. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-methylresorcinol 2292. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2293. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 2294. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-amino-3 -hydroxypyridine 2295. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2296. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-methylresorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2297. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-methylresorcinol + 0.210g 1 -naphthol 2298. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2299. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-methylresorcinol + 2.100g 2,4-diaminophenoxyethanol 2300. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 2301. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 2302. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2303. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g 3-methyl-p-aminophenol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 2304. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g 3-methyl-p-aminophenol + 0.210g 1-naphthol + 0.210g 2,4-diaminophenoxyethanol 2305. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g 3-methyl-p-aminophenol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2306. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g resorcinol 2307. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g m-aminophenol 2308. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 4-amino-2-hydroxytoluene 2309. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-methyl-5-hydroxyethylaminophenol 2310. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2-methylresorcinol 2311. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.313g 2-amino-4-hydroxyethylaminoanisole 2312. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 1 -naphthol 2313. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.500g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.625g 2-amino-3-hydroxypyridine 2314. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.250g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.263g 2,4-diaminophenoxyethanol 2315. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g m-aminophenol 2316. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene 2317. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol 2318. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 2-methylresorcinol 2319. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole 2320. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g resorcinol + 0.210g 1-naphthol 2321. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g resorcinol + 2.100g 2-amino-3-hydroxypyridine 2322. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g resorcinol + 1.050g 2,4-diaminophenoxyethanol 2323. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 4-amino-hydroxytoluene 2324. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-methyl-5-hydroxyethylaminophenol 2325. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 2326. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g m-aminophenol + 2.100g 2-amino-hydroxyethylaminoanisole 2327. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 1-naphthol 2328. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2-amino-hydroxypyridine 2329. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g m-aminophenol + 0.210g 2,4-diaminophenoxyethanol 2330. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-methyl-5-hydroxyethylaminophenol 2331. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 2-methylresorcinol 2332. 2.000g methoxymethyl-p-phenylenediamine + 2. lOOg 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 4-amino-2-hydroxytoluene +
2.100g 2-amino-4-hydroxyethylaminoanisole 2333. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 4-amino-2-hydroxytoluene +
1.050g 1 -naphthol 2334. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2-amino-3-hydroxypyridine 2335. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 4-amino-2-hydroxytoluene +
0.210g 2,4-diaminophenoxyethanol 2336. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2. l 00g 2-methylresorcinol 2337. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2338. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 1-naphthol 2339. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 2340. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2341. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2342. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 2343. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2344. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2345. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 1-naphthol 2346. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2-amino-3-hydroxypyridine 2347. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-4-hydroxyethylaminoanisole + 0.210g 2,4-diaminophenoxyethanol 2348. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 1-naphthol + 0.210g 2-amino-3-hydroxypyridine 2349. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.000g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 2.100g 1 -naphthol + 2.100g 2,4-diaminophenoxyethanol 2350. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.200g N,N-Bis(2-hydroxyethyl)-p-phenylenediamine + 0.210g 2-amino-3-hydroxypyridine +
0.210g 2,4-diaminophenoxyethanol 2351. 3.333g methoxymethyl-p-phenylenediamine + 3.500g 4-chlororesorcinol +
3.500g resorcinol 2352. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.313g resorcinol + 1.313g m-aminophenol 2353. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g resorcinol + 0.263g 4-amino-2-hydroxytoluene 2354. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g resorcinol + 2.625g 2-methyl-5-hydroxyethylaminophenol 2355. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g resorcinol + 2.625g 2-methylresorcinol 2356. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g resorcinol + 0.263g 2-amino-4-hydroxyethylaminoanisole 2357. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.313g resorcinol + 1.313g 1-naphthol 2358. 1.250g methoxymethyl-p-phenylenediamine + 1.313g 4-chlororesorcinol +
1.313g resorcinol + 1.313g 2-amino-3-hydroxypyridine 2359. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g resorcinol + 2.625g 2,4-diaminophenoxyethanol 2360. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g m-aminophenol + 0.210g 4-amino-2-hydroxytoluene 2361. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methyl-5-hydroxyethylaminophenol 2362. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-methylresorcinol 2363. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g m-aminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2364. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 1 -naphthol 2365. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g m-aminophenol + 1.050g 2-amino-3-hydroxypyridine 2366. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2. l00g resorcinol + 2.100g m-aminophenol + 2.100g 2,4-diaminophenoxyethanol 2367. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 4-amino-2-hydroxytoluene + 2.100g 2-methyl-5-hydroxyethylaminophenol 2368. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-methylresorcinol 2369. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2-amino-4-hydroxyethylaminoanisole 2370. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 1-naphthol 2371. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 4-amino-2-hydroxytoluene + 1.050g 2-amino-3-hydroxypyridine 2372. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 4-amino-2-hydroxytoluene + 0.210g 2,4-diaminophenoxyethanol 2373. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-methyl-5-hydroxyethylaminophenol + 1.050g 2-methylresorcinol 2374. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 2-amino-4-hydroxyethylaminoanisole 2375. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 2-methyl-5-hydroxyethylaminophenol + 2.100g 1-naphthol 2376. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2-amino-3-hydroxypyridine 2377. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 2-methyl-5-hydroxyethylaminophenol + 0.210g 2,4-diaminophenoxyethanol 2378. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 2-methylresorcinol + 0.210g 2-amino-4-hydroxyethylaminoanisole 2379. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 1-naphthol 2380. 2.000g methoxymethyl-p-phenylenediamine + 2. l00g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 2-methylresorcinol + 2.100g 2-amino-3-hydroxypyridine 2381. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-methylresorcinol + 1.050g 2,4-diaminophenoxyethanol 2382. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 1-naphthol 2383. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-amino-4-hydroxyethylaminoanisole + 1.050g 2-amino-3-hydroxypyridine 2384. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol + 2.
l 00g resorcinol + 2.100g 2-amino-4-hydroxyethylaminoanisole + 2.100g 2,4-diaminophenoxyethanol 2385. 2.000g methoxymethyl-p-phenylenediamine + 2.100g 4-chlororesorcinol +
2.100g resorcinol + 2.100g 1-naphthol + 2.100g 2-amino-3-hydroxypyridine 2386. 0.200g methoxymethyl-p-phenylenediamine + 0.210g 4-chlororesorcinol +
0.210g resorcinol + 0.210g 1 -naphthol + 0.2109 2,4-diaminophenoxyethanol 2387. 1.000g methoxymethyl-p-phenylenediamine + 1.050g 4-chlororesorcinol +
1.050g resorcinol + 1.050g 2-amino-3-hydroxypyridine + 1.050g 2,4-diaminophenoxyethanol 2388. 1.667g methoxymethyl-p-phenylenediamine + 1.750g 4-chlororesorcinol +
1.750g m-aminophenol 2389. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 4-amino-2-hydroxytoluene 2390. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 2-methyl-5-hydroxyethylaminophenol 2391. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g m-aminophenol + 0.263g 2-methylresorcinol 2392. 0.250g methoxymethyl-p-phenylenediamine + 0.263g 4-chlororesorcinol +
0.263g m-aminophenol + 0.263g 2-amino-4-hydroxyethylaminoanisole 2393. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 1-naphthol 2394. 2.500g methoxymethyl-p-phenylenediamine + 2.625g 4-chlororesorcinol +
2.625g m-aminophenol + 2.625g 2-amino-3-hydroxypyridine DEMANDES OU BREVETS VOLUMINEUX
LA PRESENTE PARTIE DE CETTE DEMANDE OU CE BREVETS
COMPREND PLUS D'UN TOME.
NOTE: Pour les tomes additionels, veillez contacter le Bureau Canadien des Brevets.
JUMBO APPLICATIONS / PATENTS
THIS SECTION OF THE APPLICATION / PATENT CONTAINS MORE
THAN ONE VOLUME.
NOTE: For additional volumes please contact the Canadian Patent Office.
Claims (6)
1. An aqueous or aqueous-alcoholic oxidation dye precursor composition comprising water, at least one coupler compound and at least one developer compound, said at least one developer compound including at least one member selected from 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt.
2. The aqueous or aqueous-alcoholic oxidation dye precursor composition as defined in claim 1, wherein said at least one developer compound and said at least one coupler compound are present in a total amount of from 0.001 to 15 percent by weight.
3. A ready-to-apply hair dye mixture made by a method comprising the steps of:
a) providing an oxidation dye precursor composition containing at least one coupler compound and at least one developer compound, said at least one developer compound including at least one member selected from 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt;
b) mixing the oxidation dye precursor composition provided in step a) with an oxidizing agent immediately prior to application to form the ready-to-apply hair dye mixture.
a) providing an oxidation dye precursor composition containing at least one coupler compound and at least one developer compound, said at least one developer compound including at least one member selected from 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt;
b) mixing the oxidation dye precursor composition provided in step a) with an oxidizing agent immediately prior to application to form the ready-to-apply hair dye mixture.
4. The ready-to-apply hair dye mixture as defined in claim 3, wherein the oxidation dye precursor composition and the oxidizing agent are mixed with each other in a weight ratio of from 5:1 to 1:3 during the mixing.
5. A method of dyeing keratin fibers, said method comprising the steps of:
a) providing an oxidation dye precursor composition containing at least one coupler compound and at least one developer compound, said at least one developer compound including at least one member selected from the group consisting of 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt;
b) mixing the oxidation dye precursor composition provided in step a) with an oxidizing agent to form a ready-to-apply dye mixture;
c) applying the ready-to-apply dye mixture to the keratin fibers to dye the keratin fibers
a) providing an oxidation dye precursor composition containing at least one coupler compound and at least one developer compound, said at least one developer compound including at least one member selected from the group consisting of 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt;
b) mixing the oxidation dye precursor composition provided in step a) with an oxidizing agent to form a ready-to-apply dye mixture;
c) applying the ready-to-apply dye mixture to the keratin fibers to dye the keratin fibers
6. A method of dyeing keratin fibers, said method comprising the steps of:
a) providing a dye-carrying composition comprising at least one member selected from the group consisting of oxidation dye precursor compounds and direct-dyeing dye compounds, said dye-carrying composition including at least one ingredient selected from the group consisting of 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt; and b) applying the dye-carrying composition to the keratin fibers in order to dye the keratin fibers.
a) providing a dye-carrying composition comprising at least one member selected from the group consisting of oxidation dye precursor compounds and direct-dyeing dye compounds, said dye-carrying composition including at least one ingredient selected from the group consisting of 1,4-diamino-2-methoxymethylbenzenes of formula (I) wherein n is a number from 0 to 2 and HX represents an inorganic or organic salt; and b) applying the dye-carrying composition to the keratin fibers in order to dye the keratin fibers.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CA 2576189 CA2576189A1 (en) | 2007-01-29 | 2007-01-29 | Hair dyes comprising 1,4-diamino-2-methoxymethylbenzene |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CA 2576189 CA2576189A1 (en) | 2007-01-29 | 2007-01-29 | Hair dyes comprising 1,4-diamino-2-methoxymethylbenzene |
Publications (1)
Publication Number | Publication Date |
---|---|
CA2576189A1 true CA2576189A1 (en) | 2007-06-11 |
Family
ID=38162430
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA 2576189 Abandoned CA2576189A1 (en) | 2007-01-29 | 2007-01-29 | Hair dyes comprising 1,4-diamino-2-methoxymethylbenzene |
Country Status (1)
Country | Link |
---|---|
CA (1) | CA2576189A1 (en) |
Cited By (44)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2013049575A2 (en) | 2011-09-30 | 2013-04-04 | The Procter & Gamble Company | Foam oxidative hair colorant composition with the free-base of 1, 4-diamino-2-methoxmethyl benzene |
US8608810B2 (en) | 2012-03-27 | 2013-12-17 | The Procter & Gamble Company | Hair colorant compositions comprising 3-amino-2,6-dimethylphenol and 1,4-phenylenediamine-type developers, methods, and kits comprising the compositions |
US8617256B2 (en) | 2012-03-27 | 2013-12-31 | The Procter & Gamble Company | Hair colorant compositions comprising 3-amino-2,6-dimethylphenol and 4-aminophenol-type developers, methods, and kits comprising the compositions |
US8663341B2 (en) | 2012-06-25 | 2014-03-04 | The Procter & Gamble Company | Hair colorant compositions comprising 2-Methoxymethy1-1,4-diaminobenzene, methods, and kits comprising the compositions |
US9012691B2 (en) | 2012-10-26 | 2015-04-21 | The Procter & Gamble Company | Process for preparing primary intermediates for dyeing keratin fibers |
WO2015081942A1 (en) * | 2013-12-06 | 2015-06-11 | Henkel Ag & Co. Kgaa | Agent for oxidatively dyeing hair containing specific combinations of developers and couplers |
US20150250701A1 (en) * | 2013-03-11 | 2015-09-10 | The Procter & Gamble Company | Method for Colouring Hair |
WO2015195592A1 (en) | 2014-06-17 | 2015-12-23 | The Procter & Gamble Company | A cosmetic composition comprising a thickening polymer having hydrophobic and hydrophilic portions |
EP2977041A1 (en) | 2014-07-23 | 2016-01-27 | The Procter and Gamble Company | A cosmetic composition comprising a thickening polymer |
FR3026006A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING AT LEAST TWO DIFFERENT OXIDATION BASES |
FR3026005A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING AT LEAST FOUR PRECURSORS OF OXIDATION DYES |
FR3026007A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING AT LEAST 30% BY WEIGHT OF LIQUID FATTY BODIES |
FR3026004A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING DIRECT CATIONIC COLORANTS AND 2- (METHOXYMETHYL) BENZENE-1,4-DIAMINE |
US9309185B2 (en) | 2012-10-26 | 2016-04-12 | The Procter & Gamble Company | Process for preparing primary intermediates for dyeing keratin fibers |
WO2016073277A1 (en) | 2014-11-04 | 2016-05-12 | The Procter & Gamble Company | Process for the preparation of 2-substituted-1,4-benzenediamines and salts thereof |
US9539192B2 (en) | 2014-04-02 | 2017-01-10 | Noxell Corporation | Hair colouring compositions, kits, method, and use thereof |
US9587116B2 (en) | 2014-11-04 | 2017-03-07 | Noxell Corporation | Azo direct dyes and method for dyeing hair using these dyes |
EP3175837A1 (en) | 2015-12-01 | 2017-06-07 | Noxell Corporation | Method for treating hair |
WO2017095677A1 (en) | 2015-12-03 | 2017-06-08 | The Procter & Gamble Company | Process for the preparation of 2-alkoxymethyl-1, 4-benzenediamines |
US20170165173A1 (en) * | 2015-12-14 | 2017-06-15 | The Procter & Gamble Company | Hair Coloring Composition Comprising One or More Acrylic Compounds |
EP3181115A1 (en) | 2015-12-14 | 2017-06-21 | The Procter and Gamble Company | Hair coloring composition comprising one or more acrylate monomers |
US9688609B2 (en) | 2014-11-04 | 2017-06-27 | Noxell Corporation | Telescoping synthesis of 2-methoxymethyl-P-phenylenediamine |
US9695109B2 (en) | 2014-11-04 | 2017-07-04 | Noxell Corporation | Telescoping synthesis of 2-methoxymethyl-p-phenylenediamine |
EP3263180A1 (en) | 2016-06-30 | 2018-01-03 | The Procter and Gamble Company | Method for coloring hair fibers into a first and a second patterns |
EP3281623A1 (en) | 2016-08-12 | 2018-02-14 | Noxell Corporation | Hair coloring composition for providing a film on keratin fibers |
EP3287119A1 (en) | 2016-08-24 | 2018-02-28 | Noxell Corporation | Method for treating hair |
EP3287120A1 (en) | 2016-08-24 | 2018-02-28 | Noxell Corporation | Method for coloring hair |
EP3295924A1 (en) | 2016-09-14 | 2018-03-21 | The Procter and Gamble Company | Composition for lightening or dyeing keratin fibers with a low amount of oxidizing agent |
EP3295923A1 (en) | 2016-09-14 | 2018-03-21 | The Procter and Gamble Company | Composition for lightening or dyeing keratin fibers with a low amount of alkalizing agent |
EP3388050A1 (en) | 2017-04-12 | 2018-10-17 | Coty Inc. | Method for treating hair, kit, and use of the kit |
WO2018191362A1 (en) | 2017-04-12 | 2018-10-18 | Coty Inc. | Method for treating hair, kit, and use of the kit |
WO2019199779A1 (en) | 2018-04-12 | 2019-10-17 | Muniz Dena | Hair treatment compositions, systems, devices and methods |
IT201900024126A1 (en) * | 2019-12-16 | 2021-06-16 | Beauty & Business S P A | COMPOSITIONS FOR HAIR DYEING FREE OF M-AMINOPHENOL |
US11129782B2 (en) | 2017-11-15 | 2021-09-28 | National University Of Singapore | Derivatives of PPD useful for coloring hair and skin |
WO2022129389A1 (en) | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one particular coupler and at least one fatty substance |
WO2022129394A1 (en) | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base and at least two particular couplers |
WO2022129386A1 (en) * | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one guar gum and at least one fatty substance |
WO2022129393A1 (en) | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one associative polymer and at least one fatty substance |
WO2023052512A1 (en) * | 2021-09-30 | 2023-04-06 | Kao Corporation | Composition comprising an oxidative dye salt |
WO2023152322A1 (en) | 2022-02-10 | 2023-08-17 | Wella Germany Gmbh | Hair coloring using oxidative dye precursors comprising pyrazole primaries and couplers, in combination with solubilized vat dyes, for improving color wash fastness |
US12097274B2 (en) | 2022-02-25 | 2024-09-24 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
US12102704B2 (en) | 2022-02-25 | 2024-10-01 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
US12109291B2 (en) | 2022-02-25 | 2024-10-08 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
US12178897B2 (en) | 2022-02-25 | 2024-12-31 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
-
2007
- 2007-01-29 CA CA 2576189 patent/CA2576189A1/en not_active Abandoned
Cited By (81)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
WO2013049575A2 (en) | 2011-09-30 | 2013-04-04 | The Procter & Gamble Company | Foam oxidative hair colorant composition with the free-base of 1, 4-diamino-2-methoxmethyl benzene |
JP2014527987A (en) * | 2011-09-30 | 2014-10-23 | ザ プロクター アンド ギャンブルカンパニー | Foamed oxidative hair dye composition containing a free base of 1,4-diamino-2-methoxymethylbenzene |
US8608810B2 (en) | 2012-03-27 | 2013-12-17 | The Procter & Gamble Company | Hair colorant compositions comprising 3-amino-2,6-dimethylphenol and 1,4-phenylenediamine-type developers, methods, and kits comprising the compositions |
US8617256B2 (en) | 2012-03-27 | 2013-12-31 | The Procter & Gamble Company | Hair colorant compositions comprising 3-amino-2,6-dimethylphenol and 4-aminophenol-type developers, methods, and kits comprising the compositions |
CN104394840A (en) * | 2012-06-25 | 2015-03-04 | 宝洁公司 | Hair colorant compositions comprising 2-m ethoxym ethyl- 1,4-diaminobenzene, methods, and kits |
CN104394841A (en) * | 2012-06-25 | 2015-03-04 | 宝洁公司 | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 5-amino-4-chloro-o-cresol, methods, and kits comprising the compositions |
WO2014004449A3 (en) * | 2012-06-25 | 2014-04-17 | The Procter & Gamble Company | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 5-amino-4-chloro-o-cresol, methods, and kits comprising the compositions |
US8702814B2 (en) | 2012-06-25 | 2014-04-22 | The Procter & Gamble Company | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6-diaminopyridine, methods, and kits comprising the compositions |
WO2014004438A3 (en) * | 2012-06-25 | 2014-04-24 | The Procter & Gamble Company | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6-diaminopyridine, methods, and kits comprising the compositions |
US8709100B2 (en) | 2012-06-25 | 2014-04-29 | The Procter & Gamble Company | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 5-amino-4-chloro-o-cresol, methods, and kits comprising the compositions |
WO2014004451A3 (en) * | 2012-06-25 | 2014-04-17 | The Procter & Gamble Company | Hair colorant compositions comprising 2-m ethoxym ethyl- 1,4-diaminobenzene, methods, and kits |
CN104394842A (en) * | 2012-06-25 | 2015-03-04 | 宝洁公司 | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6-diaminopyridine, methods, and kits comprising the compositions |
US8663341B2 (en) | 2012-06-25 | 2014-03-04 | The Procter & Gamble Company | Hair colorant compositions comprising 2-Methoxymethy1-1,4-diaminobenzene, methods, and kits comprising the compositions |
WO2014004459A3 (en) * | 2012-06-25 | 2014-04-17 | The Procter & Gamble Company | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6-dihydroxyethylaminotoluene, methods, and kits comprising the compositions |
CN104411293A (en) * | 2012-06-25 | 2015-03-11 | 宝洁公司 | Hair colorant compositions comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6-dihydroxyethylaminotoluene, methods, and kits comprising the compositions |
JP2015527979A (en) * | 2012-06-25 | 2015-09-24 | ザ プロクター アンド ギャンブルカンパニー | Hair dye composition comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6-dihydroxyethylaminotoluene, method comprising the composition, and kit |
CN110200836A (en) * | 2012-06-25 | 2019-09-06 | 诺赛尔股份有限公司 | Hair colourant compositions, method and the box set comprising the composition |
JP2015519406A (en) * | 2012-06-25 | 2015-07-09 | ザ プロクター アンド ギャンブルカンパニー | Hair dye composition comprising 2-methoxymethyl-1,4-diaminobenzene and 5-amino-4-chloro-o-cresol, method and kit comprising this composition |
JP2015520245A (en) * | 2012-06-25 | 2015-07-16 | ザ プロクター アンド ギャンブルカンパニー | Hair dye composition, method and kit comprising 2-methoxymethyl-1,4-diaminobenzene |
JP2015520244A (en) * | 2012-06-25 | 2015-07-16 | ザ プロクター アンド ギャンブルカンパニー | Hair dye composition comprising 2-methoxymethyl-1,4-diaminobenzene and 2,6 diaminopyridine, method comprising the composition, and kit |
CN104394841B (en) * | 2012-06-25 | 2017-05-31 | 诺赛尔股份有限公司 | Hair colourant compositions, method comprising the diaminobenzene of 2 methoxy 1,4 and the chlorine orthoresol of 5 amino 4 and the box set comprising said composition |
US9309185B2 (en) | 2012-10-26 | 2016-04-12 | The Procter & Gamble Company | Process for preparing primary intermediates for dyeing keratin fibers |
US9012691B2 (en) | 2012-10-26 | 2015-04-21 | The Procter & Gamble Company | Process for preparing primary intermediates for dyeing keratin fibers |
US20150250701A1 (en) * | 2013-03-11 | 2015-09-10 | The Procter & Gamble Company | Method for Colouring Hair |
WO2015081942A1 (en) * | 2013-12-06 | 2015-06-11 | Henkel Ag & Co. Kgaa | Agent for oxidatively dyeing hair containing specific combinations of developers and couplers |
US9656101B2 (en) | 2013-12-06 | 2017-05-23 | Henkel Ag & Co. Kgaa | Agent for oxidatively dyeing hair containing specific combinations of developers and couplers |
US9539192B2 (en) | 2014-04-02 | 2017-01-10 | Noxell Corporation | Hair colouring compositions, kits, method, and use thereof |
EP2926802B1 (en) | 2014-04-02 | 2017-09-27 | Noxell Corporation | Hair colouring compositions, kits, method, and use thereof |
EP2957324A1 (en) | 2014-06-17 | 2015-12-23 | The Procter and Gamble Company | A cosmetic composition comprising a thickening polymer having hydrophobic and hydrophilic portions |
WO2015195592A1 (en) | 2014-06-17 | 2015-12-23 | The Procter & Gamble Company | A cosmetic composition comprising a thickening polymer having hydrophobic and hydrophilic portions |
EP2977041A1 (en) | 2014-07-23 | 2016-01-27 | The Procter and Gamble Company | A cosmetic composition comprising a thickening polymer |
WO2016014255A1 (en) | 2014-07-23 | 2016-01-28 | The Procter & Gamble Company | A cosmetic composition comprising a thickening polymer, a non ionic surfactant, a non ionic kosmotrope and water |
FR3026005A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING AT LEAST FOUR PRECURSORS OF OXIDATION DYES |
FR3026004A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING DIRECT CATIONIC COLORANTS AND 2- (METHOXYMETHYL) BENZENE-1,4-DIAMINE |
FR3026007A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING AT LEAST 30% BY WEIGHT OF LIQUID FATTY BODIES |
FR3026006A1 (en) * | 2014-09-18 | 2016-03-25 | Oreal | COMPOSITION FOR COLORING KERATIN FIBERS COMPRISING AT LEAST TWO DIFFERENT OXIDATION BASES |
US9587116B2 (en) | 2014-11-04 | 2017-03-07 | Noxell Corporation | Azo direct dyes and method for dyeing hair using these dyes |
WO2016073277A1 (en) | 2014-11-04 | 2016-05-12 | The Procter & Gamble Company | Process for the preparation of 2-substituted-1,4-benzenediamines and salts thereof |
US9695109B2 (en) | 2014-11-04 | 2017-07-04 | Noxell Corporation | Telescoping synthesis of 2-methoxymethyl-p-phenylenediamine |
US9758469B2 (en) | 2014-11-04 | 2017-09-12 | Noxell Corporation | Process for the preparation of 2-substituted-1,4-benzenediamines and salts thereof |
US9688609B2 (en) | 2014-11-04 | 2017-06-27 | Noxell Corporation | Telescoping synthesis of 2-methoxymethyl-P-phenylenediamine |
EP3175837A1 (en) | 2015-12-01 | 2017-06-07 | Noxell Corporation | Method for treating hair |
WO2017095677A1 (en) | 2015-12-03 | 2017-06-08 | The Procter & Gamble Company | Process for the preparation of 2-alkoxymethyl-1, 4-benzenediamines |
EP3181113A1 (en) | 2015-12-14 | 2017-06-21 | The Procter and Gamble Company | Hair coloring composition comprising one or more acrylic compounds |
US20170165173A1 (en) * | 2015-12-14 | 2017-06-15 | The Procter & Gamble Company | Hair Coloring Composition Comprising One or More Acrylic Compounds |
EP3181115A1 (en) | 2015-12-14 | 2017-06-21 | The Procter and Gamble Company | Hair coloring composition comprising one or more acrylate monomers |
WO2017105833A1 (en) | 2015-12-14 | 2017-06-22 | The Procter & Gamble Company | Hair coloring composition comprising one or more acrylate monomers |
EP3263180A1 (en) | 2016-06-30 | 2018-01-03 | The Procter and Gamble Company | Method for coloring hair fibers into a first and a second patterns |
WO2018005641A1 (en) | 2016-06-30 | 2018-01-04 | Noxell Corporation | Method for coloring hair fibers into a first and a second patterns |
EP3281623A1 (en) | 2016-08-12 | 2018-02-14 | Noxell Corporation | Hair coloring composition for providing a film on keratin fibers |
WO2018031941A1 (en) | 2016-08-12 | 2018-02-15 | Noxell Corporation | Hair coloring composition for providing a film on keratin fibers |
WO2018039290A1 (en) | 2016-08-24 | 2018-03-01 | The Procter & Gamble Company | Method for treating hair |
WO2018039328A1 (en) | 2016-08-24 | 2018-03-01 | Noxell Corporation | Method for treating hair |
EP3287120A1 (en) | 2016-08-24 | 2018-02-28 | Noxell Corporation | Method for coloring hair |
EP3287119A1 (en) | 2016-08-24 | 2018-02-28 | Noxell Corporation | Method for treating hair |
EP3295924A1 (en) | 2016-09-14 | 2018-03-21 | The Procter and Gamble Company | Composition for lightening or dyeing keratin fibers with a low amount of oxidizing agent |
EP3295923A1 (en) | 2016-09-14 | 2018-03-21 | The Procter and Gamble Company | Composition for lightening or dyeing keratin fibers with a low amount of alkalizing agent |
WO2018053177A1 (en) | 2016-09-14 | 2018-03-22 | Noxell Corporation | Composition for lightening or dyeing keratin fibers with a low amount of oxidizing agent |
WO2018053195A1 (en) | 2016-09-14 | 2018-03-22 | Noxell Corporation | Composition for lightening or dyeing keratin fibers with a low amount of alkalizing agent |
EP3388050A1 (en) | 2017-04-12 | 2018-10-17 | Coty Inc. | Method for treating hair, kit, and use of the kit |
WO2018191362A1 (en) | 2017-04-12 | 2018-10-18 | Coty Inc. | Method for treating hair, kit, and use of the kit |
US11129782B2 (en) | 2017-11-15 | 2021-09-28 | National University Of Singapore | Derivatives of PPD useful for coloring hair and skin |
WO2019199779A1 (en) | 2018-04-12 | 2019-10-17 | Muniz Dena | Hair treatment compositions, systems, devices and methods |
IT201900024126A1 (en) * | 2019-12-16 | 2021-06-16 | Beauty & Business S P A | COMPOSITIONS FOR HAIR DYEING FREE OF M-AMINOPHENOL |
US11285091B2 (en) | 2019-12-16 | 2022-03-29 | Beauty & Business S.P.A. | M-aminophenol-free hair-colouring compositions |
FR3117816A1 (en) | 2020-12-17 | 2022-06-24 | L'oreal | Composition comprising a particular oxidation coloring base and at least two particular couplers. |
CN116600778A (en) * | 2020-12-17 | 2023-08-15 | 莱雅公司 | Composition comprising a specific oxidation dyeing base, at least one guar gum and at least one fatty substance |
WO2022129386A1 (en) * | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one guar gum and at least one fatty substance |
WO2022129393A1 (en) | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one associative polymer and at least one fatty substance |
FR3117814A1 (en) | 2020-12-17 | 2022-06-24 | L'oreal | Composition comprising a particular oxidation coloring base, at least one guar gum and at least one fatty substance. |
FR3117830A1 (en) | 2020-12-17 | 2022-06-24 | L'oreal | Composition comprising a particular oxidation coloring base, at least one particular coupler and at least one fatty substance. |
WO2022129394A1 (en) | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base and at least two particular couplers |
FR3117866A1 (en) | 2020-12-17 | 2022-06-24 | L'oreal | Composition comprising a particular oxidation coloring base, at least one associative polymer and at least one fatty substance. |
US12296035B2 (en) | 2020-12-17 | 2025-05-13 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one particular coupler and at least one fatty substance |
WO2022129389A1 (en) | 2020-12-17 | 2022-06-23 | L'oreal | Composition comprising a particular oxidation dyeing base, at least one particular coupler and at least one fatty substance |
WO2023052512A1 (en) * | 2021-09-30 | 2023-04-06 | Kao Corporation | Composition comprising an oxidative dye salt |
WO2023152322A1 (en) | 2022-02-10 | 2023-08-17 | Wella Germany Gmbh | Hair coloring using oxidative dye precursors comprising pyrazole primaries and couplers, in combination with solubilized vat dyes, for improving color wash fastness |
US12097274B2 (en) | 2022-02-25 | 2024-09-24 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
US12102704B2 (en) | 2022-02-25 | 2024-10-01 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
US12109291B2 (en) | 2022-02-25 | 2024-10-08 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
US12178897B2 (en) | 2022-02-25 | 2024-12-31 | Henkel Ag & Co. Kgaa | Oxidative dyeing agent for keratin fibers comprising novel dye precursor combinations |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CA2576189A1 (en) | Hair dyes comprising 1,4-diamino-2-methoxymethylbenzene | |
AU2005289777B2 (en) | Methods of rapid hair dyeing | |
EP1961450A1 (en) | Dyes for keratinic fibers comprising a special anionic thickener | |
CA2527993C (en) | Hair colouring compositions | |
US7597720B2 (en) | Oxidizing hair colourant compositions | |
US8632612B2 (en) | Compositions for dyeing keratin fibers | |
CA2646867A1 (en) | Hair dyes comprising 3-amin0-2,6-dimethylphenol | |
EP2308564B1 (en) | Thickened hair colourant and bleaching compositions | |
CA2613049A1 (en) | Coloring agents for keratin fibers | |
CA2615230A1 (en) | Hair dyes comprising 2-amino-5-ethyl-phenol | |
CA2646866A1 (en) | Hair dyes comprising 2-amino-5-ethyl-phenol | |
EP1484048B1 (en) | Hair colouring compositions | |
EP1642563B1 (en) | Method of rapid hair dyeing | |
CA2621871A1 (en) | Coloring agents for keratin fibers | |
CA2638058A1 (en) | Color consultation system for a hair salon | |
MX2007003485A (en) | Methods of rapid hair dyeing |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
FZDE | Dead |