CA2106664A1 - Electrochemical synthesis of diaryliodonium salts - Google Patents
Electrochemical synthesis of diaryliodonium saltsInfo
- Publication number
- CA2106664A1 CA2106664A1 CA002106664A CA2106664A CA2106664A1 CA 2106664 A1 CA2106664 A1 CA 2106664A1 CA 002106664 A CA002106664 A CA 002106664A CA 2106664 A CA2106664 A CA 2106664A CA 2106664 A1 CA2106664 A1 CA 2106664A1
- Authority
- CA
- Canada
- Prior art keywords
- electrolyte
- carbon
- compound
- cathode
- anode
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 125000005520 diaryliodonium group Chemical group 0.000 title claims abstract description 15
- 230000015572 biosynthetic process Effects 0.000 title claims description 8
- 238000003786 synthesis reaction Methods 0.000 title description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract description 52
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 46
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims abstract description 43
- 238000000034 method Methods 0.000 claims abstract description 43
- 239000003792 electrolyte Substances 0.000 claims abstract description 32
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 22
- 239000002904 solvent Substances 0.000 claims abstract description 20
- 229910052731 fluorine Inorganic materials 0.000 claims abstract description 7
- 239000011737 fluorine Substances 0.000 claims abstract description 6
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims abstract 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 36
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 30
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 27
- -1 aryl compound Chemical class 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 13
- 229910052697 platinum Inorganic materials 0.000 claims description 12
- 239000011541 reaction mixture Substances 0.000 claims description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- UDHAWRUAECEBHC-UHFFFAOYSA-N 1-iodo-4-methylbenzene Chemical compound CC1=CC=C(I)C=C1 UDHAWRUAECEBHC-UHFFFAOYSA-N 0.000 claims description 7
- 239000002274 desiccant Substances 0.000 claims description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 6
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Chemical group CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 claims description 6
- RINOYHWVBUKAQE-UHFFFAOYSA-N 1-iodo-2-methylbenzene Chemical group CC1=CC=CC=C1I RINOYHWVBUKAQE-UHFFFAOYSA-N 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical group IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 claims description 4
- 229910001220 stainless steel Inorganic materials 0.000 claims description 4
- 239000010935 stainless steel Substances 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 3
- 229910052793 cadmium Inorganic materials 0.000 claims description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 239000011135 tin Substances 0.000 claims description 3
- NHPPIJMARIVBGU-UHFFFAOYSA-N 1-iodonaphthalene Chemical group C1=CC=C2C(I)=CC=CC2=C1 NHPPIJMARIVBGU-UHFFFAOYSA-N 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- SNHMUERNLJLMHN-IDEBNGHGSA-N iodobenzene Chemical group I[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 SNHMUERNLJLMHN-IDEBNGHGSA-N 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 229910052759 nickel Inorganic materials 0.000 claims description 2
- 229910052718 tin Inorganic materials 0.000 claims description 2
- 229910052720 vanadium Inorganic materials 0.000 claims description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 abstract description 5
- 150000003839 salts Chemical class 0.000 description 10
- 235000011149 sulphuric acid Nutrition 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- 239000004743 Polypropylene Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000010405 anode material Substances 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 229910021397 glassy carbon Inorganic materials 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- 239000012955 diaryliodonium Substances 0.000 description 4
- 229910002804 graphite Inorganic materials 0.000 description 4
- 239000010439 graphite Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 150000004820 halides Chemical group 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 239000010963 304 stainless steel Substances 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229910000589 SAE 304 stainless steel Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000010406 cathode material Substances 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 238000005868 electrolysis reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 2
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000002000 Electrolyte additive Substances 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 239000003139 biocide Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 238000010349 cathodic reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000002484 cyclic voltammetry Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical class Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000000122 growth hormone Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 239000012450 pharmaceutical intermediate Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000003115 supporting electrolyte Substances 0.000 description 1
- 230000000929 thyromimetic effect Effects 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B3/00—Electrolytic production of organic compounds
- C25B3/20—Processes
- C25B3/23—Oxidation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US07/681,589 | 1991-04-08 | ||
| US07/681,589 US5277767A (en) | 1991-04-08 | 1991-04-08 | Electrochemical synthesis of diaryliodonium salts |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA2106664A1 true CA2106664A1 (en) | 1992-10-09 |
Family
ID=24735938
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002106664A Abandoned CA2106664A1 (en) | 1991-04-08 | 1992-03-31 | Electrochemical synthesis of diaryliodonium salts |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US5277767A (index.php) |
| EP (1) | EP0579752A1 (index.php) |
| JP (1) | JPH06506728A (index.php) |
| CA (1) | CA2106664A1 (index.php) |
| TW (1) | TW222312B (index.php) |
| WO (1) | WO1992017626A2 (index.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5488147A (en) * | 1994-07-21 | 1996-01-30 | Minnesota Mining And Manufacturing Company | Diaryliodonium fluoroalkyl sulfonate salts and a method of making |
| US6756013B1 (en) | 2000-08-14 | 2004-06-29 | Cornell Development Corporation, Llc | Compositions of iodonium compounds and methods and uses thereof |
| US6419814B1 (en) * | 2000-11-02 | 2002-07-16 | Cornell Development Llc | Methods for electrochemical synthesis of organoiodonium salts and derivatives |
| US6620305B2 (en) | 2001-04-10 | 2003-09-16 | Cornell Development Corporation Llc | Method and apparatus for electrochemical cells with improved anti-fouling characteristics |
| US20030194877A1 (en) * | 2002-04-16 | 2003-10-16 | Applied Materials, Inc. | Integrated etch, rinse and dry, and anneal method and system |
| US7052593B2 (en) | 2004-01-07 | 2006-05-30 | Cornell Development Corporation Llc | Process for the production of diaryl iodonium compounds |
| US20050167283A1 (en) * | 2004-02-03 | 2005-08-04 | Cornell David D. | Electrosynthesis of diaryliodonium compounds |
| CN115161671B (zh) * | 2022-07-08 | 2025-03-21 | 江西师范大学 | 一种精准区域选择性烯烃芳基化的电化学合成方法 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3712920A (en) * | 1968-05-31 | 1973-01-23 | Dow Chemical Co | 2,5-thiophenediyl-bis(iodonium salts) |
| US3734928A (en) * | 1970-08-11 | 1973-05-22 | Dow Chemical Co | Difunctional iodonium salts of diphenyl oxide and preparation |
| DE2100381A1 (en) * | 1971-01-07 | 1972-07-20 | Wendt, Hartmut, 6110 Dieburg | Phenol electrochemical prodn - by anodic oxidn of iodobenzene in presence of benzene |
| DE2154348A1 (de) * | 1971-11-02 | 1973-05-10 | Battelle Institut E V | Elektrochemisches verfahren zur herstellung aromatischer amine |
| US3763187A (en) * | 1972-06-22 | 1973-10-02 | Dow Chemical Co | Thienyliodonium salts |
| US3885036A (en) * | 1972-06-22 | 1975-05-20 | Dow Chemical Co | Antimicrobial thienyliodonium salt methods and compositions |
| US3944498A (en) * | 1972-06-22 | 1976-03-16 | The Dow Chemical Company | Germicidal detergent containing a thienyliodonium salt |
| ZA741203B (en) * | 1973-03-23 | 1975-01-29 | Smithkline Corp | Veterinary feed compositions for inhibiting rumen microbial deamination |
| US3981897A (en) * | 1975-05-02 | 1976-09-21 | General Electric Company | Method for making certain halonium salt photoinitiators |
| US4136102A (en) * | 1974-05-02 | 1979-01-23 | General Electric Company | Photoinitiators |
| IE43648B1 (en) * | 1974-10-30 | 1981-04-22 | Ici Ltd | Methods and compositions for use in animal husbandry |
| DE2825494A1 (de) * | 1978-06-10 | 1979-12-20 | Hoechst Ag | Bipolare elektrode fuer anodische prozesse in ungeteilten zellen |
| US4513137A (en) * | 1981-04-09 | 1985-04-23 | The University Of Akron | Iodonium salts |
| US4623666A (en) * | 1984-11-06 | 1986-11-18 | Kennedy Thomas P | Pharmacological applications of diphenylhalonium ion |
| AU3615484A (en) * | 1983-11-07 | 1985-06-03 | Kennedy, T.P. | Pharmacological applications of diphenylhalonium ion |
| US4759833A (en) * | 1987-11-02 | 1988-07-26 | Eastman Kodak Company | Electrolytic method of simultaneously preparing diaryliodonium salt and alkoxide salt and method of preparing ester of an aromatic acid |
-
1991
- 1991-04-08 US US07/681,589 patent/US5277767A/en not_active Expired - Lifetime
-
1992
- 1992-03-31 EP EP92910725A patent/EP0579752A1/en not_active Ceased
- 1992-03-31 WO PCT/US1992/002571 patent/WO1992017626A2/en not_active Ceased
- 1992-03-31 JP JP4510001A patent/JPH06506728A/ja active Pending
- 1992-03-31 CA CA002106664A patent/CA2106664A1/en not_active Abandoned
- 1992-04-08 TW TW081102696A patent/TW222312B/zh active
Also Published As
| Publication number | Publication date |
|---|---|
| WO1992017626A2 (en) | 1992-10-15 |
| WO1992017626A3 (en) | 1993-02-04 |
| JPH06506728A (ja) | 1994-07-28 |
| EP0579752A1 (en) | 1994-01-26 |
| US5277767A (en) | 1994-01-11 |
| TW222312B (index.php) | 1994-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5362367A (en) | Partial electrolytic dehalogenation of dichloroacetic and trichloroacetic acid and electrolysis solution | |
| US4650553A (en) | Electrolytic recovery of lead from scrap | |
| US3347758A (en) | Electrochemical preparation of aromatic esters | |
| US6391182B2 (en) | Electrochemical fluorination using interrupted current | |
| US2867569A (en) | Electrolysis process | |
| CA2106664A1 (en) | Electrochemical synthesis of diaryliodonium salts | |
| EP1015664B1 (en) | Electrochemical fluorination using interrupted current | |
| Vaze et al. | Electrochemical oxidation of isobutanol to isobutyric acid at nickel oxide electrode: improvement of the anode stability | |
| US5366597A (en) | Process for the preparation of perfluorobutylsulphonyl fluoride | |
| US7052593B2 (en) | Process for the production of diaryl iodonium compounds | |
| US3423299A (en) | Electrochemical fluorination of polymethylene sulfones to produce perfluoroalkylsulfonyl fluorides | |
| Kunugi et al. | Preparation of hydrophobic zinc and lead electrodes and their application to electroreduction of organic compounds electro-organic reactions on organic electrodes. Part 20: Electrolysis using composite-plated electrodes. Part IX. | |
| IL32339A (en) | Process for producing adiponitrile | |
| US4157286A (en) | Production of 1,2-bis(hydroxyphenyl)ethane-1,2-diols by electrolytic reduction | |
| US3193482A (en) | Electrolysis of alpha, beta mono-olefinic carboxylates | |
| JPH05506273A (ja) | ハロゲン化アクリル酸の製法 | |
| US3871976A (en) | Electrochemical adiponitrile process | |
| Uneyama et al. | An electrochemical method specifically directed to the preparation of DL-bisabolol from DL-nerolidol. | |
| JPS5476521A (en) | Preparation of monochloroacetic acid | |
| Ibrišagić et al. | Electrochemical synthesis of tetra-alkylthiuram disulphides in emulsions | |
| Scott et al. | Zirconium and Ebonex® as cathodes for sulphite ion oxidation in sulphuric acid | |
| Torii et al. | A direct phenylselenenylation of alkyl halides, alkenyl sulfonates, and epoxides by an electroreduction of diphenyl diselenide. | |
| RU2079503C1 (ru) | Способ получения алкоксидов титана | |
| WO1999058745A1 (en) | Electrochemical fluorination of alkane substrate | |
| JPS54144313A (en) | Preparation of dl-serine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| FZDE | Discontinued |