CA1299185C - Borated reaction products of succinic compounds as lubricant dispersants and antioxidants - Google Patents
Borated reaction products of succinic compounds as lubricant dispersants and antioxidantsInfo
- Publication number
- CA1299185C CA1299185C CA000529159A CA529159A CA1299185C CA 1299185 C CA1299185 C CA 1299185C CA 000529159 A CA000529159 A CA 000529159A CA 529159 A CA529159 A CA 529159A CA 1299185 C CA1299185 C CA 1299185C
- Authority
- CA
- Canada
- Prior art keywords
- product
- composition
- compound
- carbon atoms
- amine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 28
- 239000000314 lubricant Substances 0.000 title claims abstract description 14
- 239000002270 dispersing agent Substances 0.000 title claims abstract description 8
- 239000003963 antioxidant agent Substances 0.000 title claims abstract description 5
- 239000007795 chemical reaction product Substances 0.000 title abstract description 6
- 239000000203 mixture Substances 0.000 claims abstract description 32
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 22
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 10
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 6
- 125000003118 aryl group Chemical group 0.000 claims abstract description 6
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims abstract description 6
- 239000004327 boric acid Substances 0.000 claims abstract description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 5
- 239000001257 hydrogen Substances 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 5
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- 230000003078 antioxidant effect Effects 0.000 claims abstract description 3
- 101100232295 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) GLK1 gene Proteins 0.000 claims abstract 3
- 239000003921 oil Substances 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 15
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical group C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 14
- 150000001412 amines Chemical class 0.000 claims description 11
- 150000008064 anhydrides Chemical class 0.000 claims description 11
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical group OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- 239000010687 lubricating oil Substances 0.000 claims description 7
- 239000000376 reactant Substances 0.000 claims description 6
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical compound C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- -1 alkenyl succinic acid Chemical compound 0.000 claims description 5
- 239000004519 grease Substances 0.000 claims description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 2
- 239000002480 mineral oil Substances 0.000 claims description 2
- 235000010446 mineral oil Nutrition 0.000 claims 1
- 150000003335 secondary amines Chemical class 0.000 claims 1
- 239000001384 succinic acid Substances 0.000 claims 1
- 239000000047 product Substances 0.000 abstract description 16
- 239000000654 additive Substances 0.000 abstract description 3
- 150000004982 aromatic amines Chemical class 0.000 abstract description 3
- 239000012530 fluid Substances 0.000 description 9
- 125000005266 diarylamine group Chemical group 0.000 description 8
- 230000007797 corrosion Effects 0.000 description 6
- 238000005260 corrosion Methods 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 4
- 239000003599 detergent Substances 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 239000010802 sludge Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 230000003064 anti-oxidating effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000356 contaminant Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 150000002763 monocarboxylic acids Chemical class 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical class OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- WMYJOZQKDZZHAC-UHFFFAOYSA-H trizinc;dioxido-sulfanylidene-sulfido-$l^{5}-phosphane Chemical class [Zn+2].[Zn+2].[Zn+2].[O-]P([O-])([S-])=S.[O-]P([O-])([S-])=S WMYJOZQKDZZHAC-UHFFFAOYSA-H 0.000 description 2
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1 -dodecene Natural products CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- PTJWCLYPVFJWMP-UHFFFAOYSA-N 2-[[3-hydroxy-2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)COCC(CO)(CO)CO PTJWCLYPVFJWMP-UHFFFAOYSA-N 0.000 description 1
- YAXXOCZAXKLLCV-UHFFFAOYSA-N 3-dodecyloxolane-2,5-dione Chemical class CCCCCCCCCCCCC1CC(=O)OC1=O YAXXOCZAXKLLCV-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 239000004642 Polyimide Substances 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical class CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000001204 arachidyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000002199 base oil Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000005885 boration reaction Methods 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- BRTALTYTFFNPAC-UHFFFAOYSA-N boroxin Chemical compound B1OBOBO1 BRTALTYTFFNPAC-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ZMRQTIAUOLVKOX-UHFFFAOYSA-L calcium;diphenoxide Chemical compound [Ca+2].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 ZMRQTIAUOLVKOX-UHFFFAOYSA-L 0.000 description 1
- 125000005587 carbonate group Chemical group 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 229940069096 dodecene Drugs 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000010696 ester oil Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 229920000140 heteropolymer Polymers 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 238000005461 lubrication Methods 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- AFFLGGQVNFXPEV-UHFFFAOYSA-N n-decene Natural products CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006384 oligomerization reaction Methods 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- VGTPKLINSHNZRD-UHFFFAOYSA-N oxoborinic acid Chemical compound OB=O VGTPKLINSHNZRD-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M133/00—Lubricating compositions characterised by the additive being an organic non-macromolecular compound containing nitrogen
- C10M133/52—Lubricating compositions characterised by the additive being an organic non-macromolecular compound containing nitrogen having a carbon chain of 30 or more atoms
-
- C—CHEMISTRY; METALLURGY
- C10—PETROLEUM, GAS OR COKE INDUSTRIES; TECHNICAL GASES CONTAINING CARBON MONOXIDE; FUELS; LUBRICANTS; PEAT
- C10M—LUBRICATING COMPOSITIONS; USE OF CHEMICAL SUBSTANCES EITHER ALONE OR AS LUBRICATING INGREDIENTS IN A LUBRICATING COMPOSITION
- C10M2227/00—Organic non-macromolecular compounds containing atoms of elements not provided for in groups C10M2203/00, C10M2207/00, C10M2211/00, C10M2215/00, C10M2219/00 or C10M2223/00 as ingredients in lubricant compositions
- C10M2227/06—Organic compounds derived from inorganic acids or metal salts
- C10M2227/061—Esters derived from boron
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Chemistry (AREA)
- Lubricants (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US890,680 | 1986-07-30 | ||
| US06/890,680 US4652387A (en) | 1986-07-30 | 1986-07-30 | Borated reaction products of succinic compounds as lubricant dispersants and antioxidants |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1299185C true CA1299185C (en) | 1992-04-21 |
Family
ID=25396993
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000529159A Expired - Lifetime CA1299185C (en) | 1986-07-30 | 1987-02-06 | Borated reaction products of succinic compounds as lubricant dispersants and antioxidants |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4652387A (enExample) |
| EP (1) | EP0255192B1 (enExample) |
| JP (1) | JPS6337199A (enExample) |
| AT (1) | ATE74360T1 (enExample) |
| BR (1) | BR8700840A (enExample) |
| CA (1) | CA1299185C (enExample) |
| DE (1) | DE3777907D1 (enExample) |
| ES (1) | ES2039231T3 (enExample) |
| GR (1) | GR3004563T3 (enExample) |
Families Citing this family (106)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4741848A (en) * | 1986-03-13 | 1988-05-03 | The Lubrizol Corporation | Boron-containing compositions, and lubricants and fuels containing same |
| US4828740A (en) * | 1987-07-29 | 1989-05-09 | Mobil Oil Corporation | Mixed hydroquinone-hydroxyester borates as antioxidants |
| DE3808372A1 (de) * | 1988-03-12 | 1989-09-21 | Rewo Chemische Werke Gmbh | Reaktionsprodukte aus borsaeure und alkanoletheraminen und deren verwendung als korrosionsschutzmittel |
| US4985156A (en) * | 1989-10-24 | 1991-01-15 | Mobil Oil Corporation | Production of borated ashless dispersants |
| US5225093A (en) * | 1990-02-16 | 1993-07-06 | Ethyl Petroleum Additives, Inc. | Gear oil additive compositions and gear oils containing the same |
| US5955404A (en) * | 1991-04-17 | 1999-09-21 | Mobil Oil Corporation | Lubricant and fuel compositions containing an organo-substituted diphenyl sulfide |
| US5328619A (en) * | 1991-06-21 | 1994-07-12 | Ethyl Petroleum Additives, Inc. | Oil additive concentrates and lubricants of enhanced performance capabilities |
| EP0804526A4 (en) * | 1993-02-08 | 1997-12-29 | Mobil Oil Corp | CARBONIC ACID / ESTER PRODUCTS AS MULTIFUNCTIONAL ADDITIVES FOR LUBRICANTS |
| CA2148975C (en) | 1994-05-18 | 2005-07-12 | Andrew G. Papay | Lubricant additive compositions |
| US6015776A (en) | 1998-09-08 | 2000-01-18 | Chevron Chemical Company | Polyalkylene polysuccinimides and post-treated derivatives thereof |
| US6627584B2 (en) | 2002-01-28 | 2003-09-30 | Ethyl Corporation | Automatic transmission fluid additive comprising reaction product of hydrocarbyl acrylates and dihydrocarbyldithiophosphoric acids |
| US6797677B2 (en) | 2002-05-30 | 2004-09-28 | Afton Chemical Corporation | Antioxidant combination for oxidation and deposit control in lubricants containing molybdenum and alkylated phenothiazine |
| JP2004217797A (ja) * | 2003-01-15 | 2004-08-05 | Ethyl Japan Kk | 長寿命で熱安定性に優れたギア油組成物 |
| US20050065043A1 (en) * | 2003-09-23 | 2005-03-24 | Henly Timothy J. | Power transmission fluids having extended durability |
| US20050101494A1 (en) * | 2003-11-10 | 2005-05-12 | Iyer Ramnath N. | Lubricant compositions for power transmitting fluids |
| US7947636B2 (en) * | 2004-02-27 | 2011-05-24 | Afton Chemical Corporation | Power transmission fluids |
| CA2496100A1 (en) * | 2004-03-10 | 2005-09-10 | Afton Chemical Corporation | Power transmission fluids with enhanced extreme pressure characteristics |
| US20060003905A1 (en) * | 2004-07-02 | 2006-01-05 | Devlin Cathy C | Additives and lubricant formulations for improved corrosion protection |
| US20060025314A1 (en) * | 2004-07-28 | 2006-02-02 | Afton Chemical Corporation | Power transmission fluids with enhanced extreme pressure and antiwear characteristics |
| US20060122073A1 (en) * | 2004-12-08 | 2006-06-08 | Chip Hewette | Oxidation stable gear oil compositions |
| US7485734B2 (en) * | 2005-01-28 | 2009-02-03 | Afton Chemical Corporation | Seal swell agent and process therefor |
| JP4677359B2 (ja) * | 2005-03-23 | 2011-04-27 | アフトン・ケミカル・コーポレーション | 潤滑組成物 |
| US8138130B2 (en) * | 2005-03-31 | 2012-03-20 | Chevron Oronite Company Llc | Fused-ring aromatic amine based wear and oxidation inhibitors for lubricants |
| US20060223716A1 (en) * | 2005-04-04 | 2006-10-05 | Milner Jeffrey L | Tractor fluids |
| US20060252660A1 (en) * | 2005-05-09 | 2006-11-09 | Akhilesh Duggal | Hydrolytically stable viscosity index improves |
| US20070004603A1 (en) * | 2005-06-30 | 2007-01-04 | Iyer Ramnath N | Methods for improved power transmission performance and compositions therefor |
| US20070042916A1 (en) * | 2005-06-30 | 2007-02-22 | Iyer Ramnath N | Methods for improved power transmission performance and compositions therefor |
| US20070000745A1 (en) * | 2005-06-30 | 2007-01-04 | Cameron Timothy M | Methods for improved power transmission performance |
| US20070078066A1 (en) * | 2005-10-03 | 2007-04-05 | Milner Jeffrey L | Lubricant formulations containing extreme pressure agents |
| US20070105728A1 (en) * | 2005-11-09 | 2007-05-10 | Phillips Ronald L | Lubricant composition |
| US8299003B2 (en) | 2005-11-09 | 2012-10-30 | Afton Chemical Corporation | Composition comprising a sulfur-containing, phosphorus-containing compound, and/or its salt, and uses thereof |
| US20070142660A1 (en) * | 2005-11-09 | 2007-06-21 | Degonia David J | Salt of a sulfur-containing, phosphorus-containing compound, and methods thereof |
| US20070142659A1 (en) * | 2005-11-09 | 2007-06-21 | Degonia David J | Sulfur-containing, phosphorus-containing compound, its salt, and methods thereof |
| US20070111906A1 (en) * | 2005-11-12 | 2007-05-17 | Milner Jeffrey L | Relatively low viscosity transmission fluids |
| US7879775B2 (en) * | 2006-07-14 | 2011-02-01 | Afton Chemical Corporation | Lubricant compositions |
| US20080015127A1 (en) * | 2006-07-14 | 2008-01-17 | Loper John T | Boundary friction reducing lubricating composition |
| US7902133B2 (en) | 2006-07-14 | 2011-03-08 | Afton Chemical Corporation | Lubricant composition |
| US7833953B2 (en) * | 2006-08-28 | 2010-11-16 | Afton Chemical Corporation | Lubricant composition |
| US20080119377A1 (en) * | 2006-11-22 | 2008-05-22 | Devlin Mark T | Lubricant compositions |
| US20080274921A1 (en) | 2007-05-04 | 2008-11-06 | Ian Macpherson | Environmentally-Friendly Lubricant Compositions |
| US20090011963A1 (en) * | 2007-07-06 | 2009-01-08 | Afton Chemical Corporation | Truck fleet fuel economy by the use of optimized engine oil, transmission fluid, and gear oil |
| EP2025737A1 (en) | 2007-08-01 | 2009-02-18 | Afton Chemical Corporation | Environmentally-friendly fuel compositions |
| US20090031614A1 (en) * | 2007-08-01 | 2009-02-05 | Ian Macpherson | Environmentally-Friendly Fuel Compositions |
| US8703669B2 (en) * | 2008-03-11 | 2014-04-22 | Afton Chemical Corporation | Ultra-low sulfur clutch-only transmission fluids |
| DE102009001301A1 (de) | 2008-03-11 | 2009-09-24 | Volkswagen Ag | Verfahren zum Schmieren einer Komponente nur für die Kupplung eines automatischen Getriebes, welche Schmierung erfordert |
| DE102009012567B4 (de) | 2008-03-11 | 2016-11-10 | Afton Chemical Corp. | Getriebeöle mit sehr wenig Schwefel nur für Kupplung und deren Verwendung |
| US9657252B2 (en) | 2014-04-17 | 2017-05-23 | Afton Chemical Corporation | Lubricant additives and lubricant compositions having improved frictional characteristics |
| EP2990469B1 (en) | 2014-08-27 | 2019-06-12 | Afton Chemical Corporation | Use in gasoline direct injection engines |
| US10280383B2 (en) | 2015-07-16 | 2019-05-07 | Afton Chemical Corporation | Lubricants with molybdenum and their use for improving low speed pre-ignition |
| US10421922B2 (en) | 2015-07-16 | 2019-09-24 | Afton Chemical Corporation | Lubricants with magnesium and their use for improving low speed pre-ignition |
| US10336959B2 (en) | 2015-07-16 | 2019-07-02 | Afton Chemical Corporation | Lubricants with calcium-containing detergent and their use for improving low speed pre-ignition |
| US10214703B2 (en) | 2015-07-16 | 2019-02-26 | Afton Chemical Corporation | Lubricants with zinc dialkyl dithiophosphate and their use in boosted internal combustion engines |
| US10550349B2 (en) | 2015-07-16 | 2020-02-04 | Afton Chemical Corporation | Lubricants with titanium and/or tungsten and their use for improving low speed pre-ignition |
| CA3015342A1 (en) | 2016-02-25 | 2017-08-31 | Afton Chemical Corporation | Lubricants for use in boosted engines |
| US10377963B2 (en) | 2016-02-25 | 2019-08-13 | Afton Chemical Corporation | Lubricants for use in boosted engines |
| US9701921B1 (en) | 2016-04-08 | 2017-07-11 | Afton Chemical Corporation | Lubricant additives and lubricant compositions having improved frictional characteristics |
| US9677026B1 (en) | 2016-04-08 | 2017-06-13 | Afton Chemical Corporation | Lubricant additives and lubricant compositions having improved frictional characteristics |
| US10113133B2 (en) | 2016-04-26 | 2018-10-30 | Afton Chemical Corporation | Random copolymers of acrylates as polymeric friction modifiers, and lubricants containing same |
| US11155764B2 (en) | 2016-05-05 | 2021-10-26 | Afton Chemical Corporation | Lubricants for use in boosted engines |
| US10323205B2 (en) | 2016-05-05 | 2019-06-18 | Afton Chemical Corporation | Lubricant compositions for reducing timing chain stretch |
| US10487286B2 (en) * | 2016-05-23 | 2019-11-26 | Infineum International Ltd. | Highly borated dispersant concentrates for lubricating oil compositions and methods for forming same |
| US20180171258A1 (en) | 2016-12-16 | 2018-06-21 | Afton Chemical Corporation | Multi-Functional Olefin Copolymers and Lubricating Compositions Containing Same |
| US10443011B2 (en) | 2017-01-18 | 2019-10-15 | Afton Chemical Corporation | Lubricants with overbased calcium and overbased magnesium detergents and method for improving low-speed pre-ignition |
| US10370615B2 (en) | 2017-01-18 | 2019-08-06 | Afton Chemical Corporation | Lubricants with calcium-containing detergents and their use for improving low-speed pre-ignition |
| US10443558B2 (en) | 2017-01-18 | 2019-10-15 | Afton Chemical Corporation | Lubricants with calcium and magnesium-containing detergents and their use for improving low-speed pre-ignition and for corrosion resistance |
| US10513668B2 (en) | 2017-10-25 | 2019-12-24 | Afton Chemical Corporation | Dispersant viscosity index improvers to enhance wear protection in engine oils |
| US11098262B2 (en) | 2018-04-25 | 2021-08-24 | Afton Chemical Corporation | Multifunctional branched polymers with improved low-temperature performance |
| US11459521B2 (en) | 2018-06-05 | 2022-10-04 | Afton Chemical Coporation | Lubricant composition and dispersants therefor having a beneficial effect on oxidation stability |
| US20200277541A1 (en) | 2019-02-28 | 2020-09-03 | Afton Chemical Corporation | Lubricating compositions for diesel particulate filter performance |
| US11066622B2 (en) | 2019-10-24 | 2021-07-20 | Afton Chemical Corporation | Synergistic lubricants with reduced electrical conductivity |
| CA3106593C (en) | 2020-01-29 | 2023-12-19 | Afton Chemical Corporation | Lubricant formulations with silicon-containing compounds |
| US11584898B2 (en) | 2020-08-12 | 2023-02-21 | Afton Chemical Corporation | Polymeric surfactants for improved emulsion and flow properties at low temperatures |
| US11680222B2 (en) | 2020-10-30 | 2023-06-20 | Afton Chemical Corporation | Engine oils with low temperature pumpability |
| US11634655B2 (en) | 2021-03-30 | 2023-04-25 | Afton Chemical Corporation | Engine oils with improved viscometric performance |
| US11479736B1 (en) | 2021-06-04 | 2022-10-25 | Afton Chemical Corporation | Lubricant composition for reduced engine sludge |
| US11753599B2 (en) | 2021-06-04 | 2023-09-12 | Afton Chemical Corporation | Lubricating compositions for a hybrid engine |
| US12529006B2 (en) | 2021-07-21 | 2026-01-20 | Afton Chemical Corporation | Methods of reducing lead corrosion in an internal combustion engine |
| US11608477B1 (en) | 2021-07-31 | 2023-03-21 | Afton Chemical Corporation | Engine oil formulations for low timing chain stretch |
| US11807827B2 (en) | 2022-01-18 | 2023-11-07 | Afton Chemical Corporation | Lubricating compositions for reduced high temperature deposits |
| US11572523B1 (en) | 2022-01-26 | 2023-02-07 | Afton Chemical Corporation | Sulfurized additives with low levels of alkyl phenols |
| WO2023159095A1 (en) | 2022-02-21 | 2023-08-24 | Afton Chemical Corporation | Polyalphaolefin phenols with high para-position selectivity |
| CN119053681A (zh) | 2022-04-27 | 2024-11-29 | 雅富顿化学公司 | 用于润滑油组合物的高硫化添加剂 |
| US20230383211A1 (en) | 2022-05-26 | 2023-11-30 | Afton Chemical Corporation | Engine oil formluation for controlling particulate emissions |
| US20240026243A1 (en) | 2022-07-14 | 2024-01-25 | Afton Chemical Corporation | Transmission lubricants containing molybdenum |
| US11970671B2 (en) | 2022-07-15 | 2024-04-30 | Afton Chemical Corporation | Detergent systems for oxidation resistance in lubricants |
| US20240059999A1 (en) | 2022-08-02 | 2024-02-22 | Afton Chemical Corporation | Detergent systems for improved piston cleanliness |
| US12098347B2 (en) | 2022-09-21 | 2024-09-24 | Afton Chemical Corporation | Lubricating composition for fuel efficient motorcycle applications |
| US12024687B2 (en) | 2022-09-27 | 2024-07-02 | Afton Chemical Corporation | Lubricating composition for motorcycle applications |
| US11912955B1 (en) | 2022-10-28 | 2024-02-27 | Afton Chemical Corporation | Lubricating compositions for reduced low temperature valve train wear |
| EP4368687B1 (en) | 2022-11-10 | 2025-06-25 | Afton Chemical Corporation | Corrosion inhibitor and industrial lubricant including the same |
| US12157866B2 (en) | 2022-12-09 | 2024-12-03 | Afton Chemical Corporation | Driveline and transmission fluids for low speed wear and scuffing |
| US12146115B2 (en) | 2022-12-20 | 2024-11-19 | Afton Chemical Corporation | Low ash lubricating compositions for controlling steel corrosion |
| US11926804B1 (en) | 2023-01-31 | 2024-03-12 | Afton Chemical Corporation | Dispersant and detergent systems for improved motor oil performance |
| US12110468B1 (en) | 2023-03-22 | 2024-10-08 | Afton Chemical Corporation | Antiwear systems for improved wear in medium and/or heavy duty diesel engines |
| US12448582B2 (en) | 2023-04-06 | 2025-10-21 | Afton Chemical Corporation | Methods of improving the performance of combustion engine after-treatment devices |
| EP4446398B1 (en) | 2023-04-13 | 2025-12-31 | Afton Chemical Corporation | LUBRICANT COMPOUND FOR IMPROVED DURABILITY AND FUEL ECONOMY |
| US12195695B2 (en) | 2023-05-10 | 2025-01-14 | Afton Chemical Corporation | Lubricating oil compositions for improving low-speed pre-ignition |
| US20250002805A1 (en) | 2023-06-23 | 2025-01-02 | Afton Chemical Corporation | Lubricant additives for performance boosting |
| EP4520807A1 (en) | 2023-08-30 | 2025-03-12 | Afton Chemical Corporation | Detergent and dispersant systems for improved steel piston cleanliness in heavy duty lubricants |
| WO2025090369A1 (en) | 2023-10-25 | 2025-05-01 | Afton Chemical Corporation | Additives with high sulfurization for lubricating oil compositions |
| US12291688B1 (en) | 2023-12-12 | 2025-05-06 | Afton Chemical Corporation | Silicon-containing compounds for lubricants |
| US12565625B2 (en) | 2023-12-18 | 2026-03-03 | Afton Chemical Corporation | Thiophosphate esters as antiwear additives for lubricants |
| US20250230375A1 (en) | 2024-01-12 | 2025-07-17 | Afton Chemical Corporation | Magnesium sulfonate detergent having improved compatibility with friction modifiers |
| US12305142B1 (en) | 2024-02-20 | 2025-05-20 | Afton Chemical Corporation | Industrial lubricant |
| US12378493B1 (en) | 2024-03-27 | 2025-08-05 | Afton Chemical Corporation | Lubricating composition for enhanced fuel economy |
| JP2026009797A (ja) | 2024-07-08 | 2026-01-21 | アフトン・ケミカル・コーポレーション | 改善されたピストン清浄性のための清浄剤系 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4071548A (en) * | 1971-11-30 | 1978-01-31 | Toa Nenryo Kogyo Kabushiki Kaisha | Lubricating oil additive, process for the synthesis thereof and lubricating oil additive composition |
| IT1054641B (it) * | 1974-08-05 | 1981-11-30 | Mobil Oil Corp | Prodotti di reazione costituiti da aminoalcoli e composizioni che li contengono |
| US4295983A (en) * | 1980-06-12 | 1981-10-20 | Ethyl Corporation | Lubricating oil composition containing boronated N-hydroxymethyl succinimide friction reducers |
| US4428849A (en) * | 1980-08-25 | 1984-01-31 | Exxon Research & Engineering Co. | Lubricating oil with improved diesel dispersancy |
| US4522736A (en) * | 1982-11-22 | 1985-06-11 | Mobil Oil Corporation | Products of reaction involving alkenylsuccinic anhydrides with aminoalcohols and aromatic secondary amines and lubricants containing same |
| US4455243A (en) * | 1983-02-24 | 1984-06-19 | Chevron Research Company | Succinimide complexes of borated fatty acid esters of glycerol and lubricating oil compositions containing same |
| CA1237959A (en) * | 1983-09-29 | 1988-06-14 | Andrew G. Papay | Boronation process |
| US4698169A (en) * | 1986-05-01 | 1987-10-06 | Mobil Oil Corporation | Reaction products of alkenylsuccinic compounds with aromatic amines and lubricant compositions thereof |
-
1986
- 1986-07-30 US US06/890,680 patent/US4652387A/en not_active Expired - Lifetime
-
1987
- 1987-02-06 CA CA000529159A patent/CA1299185C/en not_active Expired - Lifetime
- 1987-02-19 ES ES198787301426T patent/ES2039231T3/es not_active Expired - Lifetime
- 1987-02-19 AT AT87301426T patent/ATE74360T1/de not_active IP Right Cessation
- 1987-02-19 DE DE8787301426T patent/DE3777907D1/de not_active Expired - Lifetime
- 1987-02-19 EP EP87301426A patent/EP0255192B1/en not_active Expired - Lifetime
- 1987-02-20 JP JP62037675A patent/JPS6337199A/ja active Pending
- 1987-02-23 BR BR8700840A patent/BR8700840A/pt not_active IP Right Cessation
-
1992
- 1992-05-12 GR GR920400911T patent/GR3004563T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EP0255192B1 (en) | 1992-04-01 |
| DE3777907D1 (de) | 1992-05-07 |
| BR8700840A (pt) | 1988-03-15 |
| JPS6337199A (ja) | 1988-02-17 |
| EP0255192A2 (en) | 1988-02-03 |
| GR3004563T3 (enExample) | 1993-04-28 |
| ATE74360T1 (de) | 1992-04-15 |
| EP0255192A3 (en) | 1989-04-19 |
| ES2039231T3 (es) | 1993-09-16 |
| US4652387A (en) | 1987-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1299185C (en) | Borated reaction products of succinic compounds as lubricant dispersants and antioxidants | |
| EP0712834B1 (en) | High oleic polyol esters, compositions and lubricants functional fluids and greases containing the same | |
| EP0217591B1 (en) | Normally liquid c18 to c24 monoalkyl catechols | |
| US4486326A (en) | Copper complexes of oxazolines and lactone oxazolines as lubricating oil additives | |
| US4698169A (en) | Reaction products of alkenylsuccinic compounds with aromatic amines and lubricant compositions thereof | |
| EP0191967B1 (en) | Reaction products of alkenylsuccinic compounds with aromatic amines and lubricant compositions thereof | |
| US6436882B1 (en) | Functional fluids | |
| US4522736A (en) | Products of reaction involving alkenylsuccinic anhydrides with aminoalcohols and aromatic secondary amines and lubricants containing same | |
| US5019282A (en) | Organic ester, amide or amine salts of phosphorodithioate substitute carboxylic anhydrides as multifunctional additives | |
| US5955404A (en) | Lubricant and fuel compositions containing an organo-substituted diphenyl sulfide | |
| US4118328A (en) | Amine phosphate salts | |
| US5132034A (en) | Thioester derived hindered phenols and aryl-amines as antioxidant and antiwear additives | |
| US4895579A (en) | Reaction products of alkenylsuccinic compounds with aromatic amines and hindered alcohols and lubricant and fuel compositions thereof | |
| US4985157A (en) | Mixed alkoxylated alcohol-hydroquinone/resorcinol borates-antioxidants | |
| EP0089844B1 (en) | Boron-containing esters, their preparation and use as antioxidants | |
| US5126063A (en) | Borated hydroxyalkyl esters of dithiocarbamic acids as multifunctional additives for lubricant compositions | |
| US5182036A (en) | Borated hydroxyalkyl esters of alkyl- or alkenylsuccinimide-derived dithiocarbamic acids as multifunctional ashless dispersants | |
| JP3184226B2 (ja) | 有機−置換ジフェニルスルフィドを含む潤滑剤および燃料組成物 | |
| US4599183A (en) | Multifunctional additives | |
| US4157972A (en) | Multipurpose lubricating oil additive and compositions containing same | |
| US4118330A (en) | Amine phosphate salts and phosphoramides | |
| US5215549A (en) | Thioester derived hindered phenols and aryl-amines as antioxidant and antiwear additives | |
| US5254276A (en) | Diol phosphite adducts of olefins as multifunctional lubricants and additives for lubricants | |
| US4992184A (en) | Phosphite sulfonate reaction products as multifunctional additives | |
| US5160650A (en) | Monoalkylamine complexes of borated higher carbon number alkyl catechols and lubricating oil compositions containing the same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |