CA1267657A - Hydroformylation process - Google Patents
Hydroformylation processInfo
- Publication number
- CA1267657A CA1267657A CA000552968A CA552968A CA1267657A CA 1267657 A CA1267657 A CA 1267657A CA 000552968 A CA000552968 A CA 000552968A CA 552968 A CA552968 A CA 552968A CA 1267657 A CA1267657 A CA 1267657A
- Authority
- CA
- Canada
- Prior art keywords
- aqueous solution
- rhodium
- catalyst system
- phosphines
- catalyst
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000000034 method Methods 0.000 title claims abstract description 18
- 238000007037 hydroformylation reaction Methods 0.000 title claims abstract description 8
- 239000003054 catalyst Substances 0.000 claims abstract description 37
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims abstract description 31
- 229910052703 rhodium Inorganic materials 0.000 claims abstract description 30
- 239000010948 rhodium Substances 0.000 claims abstract description 29
- 239000007864 aqueous solution Substances 0.000 claims abstract description 14
- 150000003003 phosphines Chemical class 0.000 claims abstract description 13
- 230000009466 transformation Effects 0.000 claims abstract description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 12
- -1 aliphatic olefins Chemical class 0.000 claims abstract description 11
- 239000000047 product Substances 0.000 claims abstract description 11
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 10
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- 150000001299 aldehydes Chemical class 0.000 claims abstract description 5
- 239000007791 liquid phase Substances 0.000 claims abstract description 4
- 238000002360 preparation method Methods 0.000 claims abstract description 3
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 35
- 239000000243 solution Substances 0.000 claims description 22
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 abstract description 11
- 150000001875 compounds Chemical class 0.000 description 17
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000005755 formation reaction Methods 0.000 description 7
- 239000002253 acid Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000003446 ligand Substances 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- HECLRDQVFMWTQS-RGOKHQFPSA-N 1755-01-7 Chemical compound C1[C@H]2[C@@H]3CC=C[C@@H]3[C@@H]1C=C2 HECLRDQVFMWTQS-RGOKHQFPSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- OGDVHTQGJVGROD-UHFFFAOYSA-N [Na].[Na].[Na].c1ccc(cc1)P(c1ccccc1)c1ccccc1 Chemical compound [Na].[Na].[Na].c1ccc(cc1)P(c1ccccc1)c1ccccc1 OGDVHTQGJVGROD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 150000001925 cycloalkenes Chemical class 0.000 description 2
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- MHNNAWXXUZQSNM-UHFFFAOYSA-N methylethylethylene Natural products CCC(C)=C MHNNAWXXUZQSNM-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1 -dodecene Natural products CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 description 1
- BMTDZORNBFQUEA-UHFFFAOYSA-K 2-ethylhexanoate;rhodium(3+) Chemical compound [Rh+3].CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O.CCCCC(CC)C([O-])=O BMTDZORNBFQUEA-UHFFFAOYSA-K 0.000 description 1
- FAVBVYLIENPQLG-UHFFFAOYSA-N 2-methyldec-2-ene Chemical compound CCCCCCCC=C(C)C FAVBVYLIENPQLG-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- XZGXUPOKCYVAHT-UHFFFAOYSA-N OP(=O)c1cccc(c1S(O)(=O)=O)S(O)(=O)=O Chemical class OP(=O)c1cccc(c1S(O)(=O)=O)S(O)(=O)=O XZGXUPOKCYVAHT-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000005882 aldol condensation reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- KWKAKUADMBZCLK-UHFFFAOYSA-N methyl heptene Natural products CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 231100000572 poisoning Toxicity 0.000 description 1
- 230000000607 poisoning effect Effects 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003283 rhodium Chemical class 0.000 description 1
- SVOOVMQUISJERI-UHFFFAOYSA-K rhodium(3+);triacetate Chemical compound [Rh+3].CC([O-])=O.CC([O-])=O.CC([O-])=O SVOOVMQUISJERI-UHFFFAOYSA-K 0.000 description 1
- YWFDDXXMOPZFFM-UHFFFAOYSA-H rhodium(3+);trisulfate Chemical compound [Rh+3].[Rh+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O YWFDDXXMOPZFFM-UHFFFAOYSA-H 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- DMEUUKUNSVFYAA-UHFFFAOYSA-N trinaphthalen-1-ylphosphane Chemical compound C1=CC=C2C(P(C=3C4=CC=CC=C4C=CC=3)C=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 DMEUUKUNSVFYAA-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP3640615.5 | 1986-11-27 | ||
| DE19863640615 DE3640615A1 (de) | 1986-11-27 | 1986-11-27 | Verfahren zur herstellung von aldehyden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1267657A true CA1267657A (en) | 1990-04-10 |
Family
ID=6314954
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000552968A Expired - Lifetime CA1267657A (en) | 1986-11-27 | 1987-11-27 | Hydroformylation process |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4801754A (enExample) |
| EP (1) | EP0269011A1 (enExample) |
| JP (1) | JPS63150239A (enExample) |
| KR (1) | KR880006154A (enExample) |
| AU (1) | AU593958B2 (enExample) |
| BR (1) | BR8706408A (enExample) |
| CA (1) | CA1267657A (enExample) |
| DE (1) | DE3640615A1 (enExample) |
| ZA (1) | ZA878715B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3726128A1 (de) * | 1987-08-06 | 1989-02-16 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| US5012008A (en) * | 1990-01-08 | 1991-04-30 | Drago Russell S | Supported amorphous phase heterogeneous catalysts for biphasic hydroformylation |
| US5177019A (en) * | 1991-05-20 | 1993-01-05 | Eastman Kodak Company | Method of quantitative analysis of organophosphorus compounds |
| US5215667A (en) * | 1991-08-20 | 1993-06-01 | Exxon Chemical Patents Inc. | Method for separating water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5288818A (en) * | 1991-08-20 | 1994-02-22 | Exxon Chemical Patents Inc. | Method for separating a water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5360938A (en) * | 1991-08-21 | 1994-11-01 | Union Carbide Chemicals & Plastics Technology Corporation | Asymmetric syntheses |
| DE4135050A1 (de) * | 1991-10-24 | 1993-04-29 | Hoechst Ag | Verfahren zur reaktivierung wasserloeslicher hydroformylierungskatalysatoren |
| DE4242725A1 (de) * | 1992-12-17 | 1994-06-23 | Hoechst Ag | Verfahren zur Herstellung von höheren, vorwiegend unverzweigten, primären Alkoholen |
| DE10352263A1 (de) | 2003-11-08 | 2005-06-23 | Celanese Chemicals Europe Gmbh | Verfahren zur Herstellung von TCD-Monenal |
| CN104045532B (zh) * | 2013-03-15 | 2018-05-25 | 陶氏技术投资有限责任公司 | 加氢甲酰化方法 |
| EP3770144B1 (de) * | 2019-07-24 | 2023-09-06 | OQ Chemicals GmbH | Kontinuierliches hydroformylierungsverfahren mit katalysatorsubstitution |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE216315C (enExample) * | ||||
| US4248802A (en) * | 1975-06-20 | 1981-02-03 | Rhone-Poulenc Industries | Catalytic hydroformylation of olefins |
| GB2048862B (en) * | 1979-05-11 | 1983-06-15 | Mitsubishi Chem Ind | Process for the hydroformylation of olefins |
| US4388476A (en) * | 1981-05-01 | 1983-06-14 | Eastman Kodak Company | Hydroformylation process with rhodium catalyst and oxygen stabilization thereof |
| DE3361212D1 (en) * | 1982-06-11 | 1985-12-19 | Davy Mckee London | Hydroformylation process |
| US4547595A (en) * | 1982-09-02 | 1985-10-15 | Ashland Oil, Inc. | Method of reactivating Group VIII anionic hydroformylation catalysts |
| US4528403A (en) * | 1982-10-21 | 1985-07-09 | Mitsubishi Chemical Industries Ltd. | Hydroformylation process for preparation of aldehydes and alcohols |
| DE3341035A1 (de) * | 1983-11-12 | 1985-05-23 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| CA1259331A (en) * | 1984-03-30 | 1989-09-12 | Gregory J. Dembowski | Process for recovery of phosphorus ligand from vaporized aldehyde |
| DE3413427A1 (de) * | 1984-04-10 | 1985-10-17 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3511428A1 (de) * | 1985-03-29 | 1986-10-02 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3534314A1 (de) * | 1985-09-26 | 1987-04-02 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
-
1986
- 1986-11-27 DE DE19863640615 patent/DE3640615A1/de not_active Withdrawn
-
1987
- 1987-11-04 KR KR870012345A patent/KR880006154A/ko not_active Ceased
- 1987-11-20 ZA ZA878715A patent/ZA878715B/xx unknown
- 1987-11-20 EP EP87117138A patent/EP0269011A1/de not_active Ceased
- 1987-11-25 US US07/125,595 patent/US4801754A/en not_active Expired - Lifetime
- 1987-11-26 AU AU81825/87A patent/AU593958B2/en not_active Ceased
- 1987-11-26 BR BR8706408A patent/BR8706408A/pt not_active IP Right Cessation
- 1987-11-27 JP JP62297911A patent/JPS63150239A/ja active Granted
- 1987-11-27 CA CA000552968A patent/CA1267657A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BR8706408A (pt) | 1988-07-12 |
| ZA878715B (en) | 1988-05-17 |
| AU593958B2 (en) | 1990-02-22 |
| JPH0544935B2 (enExample) | 1993-07-07 |
| DE3640615A1 (de) | 1988-06-09 |
| US4801754A (en) | 1989-01-31 |
| JPS63150239A (ja) | 1988-06-22 |
| AU8182587A (en) | 1988-06-02 |
| EP0269011A1 (de) | 1988-06-01 |
| KR880006154A (ko) | 1988-07-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1307296C (en) | Hydroformylation using low volatile phosphine ligands | |
| US4148830A (en) | Hydroformylation of olefins | |
| US4400548A (en) | Hydroformylation process using bisphosphine monooxide ligands | |
| RU2336261C2 (ru) | Способ каталитического гидроформилирования высших олефинов в присутствии циклических эфиров угольной кислоты | |
| US4528403A (en) | Hydroformylation process for preparation of aldehydes and alcohols | |
| CA1152054A (en) | Hydroformylation catalyst reactivation | |
| US4593126A (en) | Process for preparing aldehydes | |
| US4283304A (en) | Process for removing triorganophosphine from a liquid composition | |
| HU204489B (en) | Hydroformilating process with utilizing transition metal catalyst and hydroformilating catalyst precurzor composition | |
| PL151491B1 (en) | Transition metal complex catalyzed reactions. | |
| CA1267657A (en) | Hydroformylation process | |
| EP0157316B1 (de) | Verfahren zur Herstellung von Aldehyden | |
| KR890003783B1 (ko) | 알데히드의 제조방법 | |
| AU5863296A (en) | Synthesis of and hydroformylation with fluoro-substituted bi dentate phosphine ligands | |
| HUT66778A (en) | Method for reactivation of hydroformylation catalysts | |
| HU204249B (en) | Process for producing aldehydes withcatalytic hydroformilizing olephines | |
| CA1263407A (en) | Process for the preparation of aldehydes | |
| US5367107A (en) | Process for the preparation of aldehydes | |
| AU653073B2 (en) | Process for reactivation of water-soluble hydroformylation catalysts | |
| US4522933A (en) | Hydroformylation catalyst containing bisphosphine monooxide ligands | |
| US4808758A (en) | Hydroformylation process | |
| EP0938379B1 (de) | Katalysator und verfahren zur herstellung von aldehyden durch hydroformylierung von olefinisch ungesättigten verbindungen | |
| US5932770A (en) | Process for recovery of phosphine oxides and alklylsarylphosphines from reaction mixtures of a homogeneous hydroformylation | |
| JPS6253493B2 (enExample) | ||
| Sheldon | Olefin Hydroformylation |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKLA | Lapsed |