CA1244601A - Convertible sunvisor cap - Google Patents
Convertible sunvisor capInfo
- Publication number
- CA1244601A CA1244601A CA000482104A CA482104A CA1244601A CA 1244601 A CA1244601 A CA 1244601A CA 000482104 A CA000482104 A CA 000482104A CA 482104 A CA482104 A CA 482104A CA 1244601 A CA1244601 A CA 1244601A
- Authority
- CA
- Canada
- Prior art keywords
- crown
- band
- visor
- lower edge
- portions
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 210000003128 head Anatomy 0.000 claims description 6
- 230000000295 complement effect Effects 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 description 25
- JXASPPWQHFOWPL-UHFFFAOYSA-N Tamarixin Natural products C1=C(O)C(OC)=CC=C1C1=C(OC2C(C(O)C(O)C(CO)O2)O)C(=O)C2=C(O)C=C(O)C=C2O1 JXASPPWQHFOWPL-UHFFFAOYSA-N 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 241000251468 Actinopterygii Species 0.000 description 1
- 241000761389 Copa Species 0.000 description 1
- 101000693444 Homo sapiens Zinc transporter ZIP2 Proteins 0.000 description 1
- 241000845077 Iare Species 0.000 description 1
- 102100025451 Zinc transporter ZIP2 Human genes 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 101150085091 lat-2 gene Proteins 0.000 description 1
- PXUQTDZNOHRWLI-OXUVVOBNSA-O malvidin 3-O-beta-D-glucoside Chemical compound COC1=C(O)C(OC)=CC(C=2C(=CC=3C(O)=CC(O)=CC=3[O+]=2)O[C@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)O)=C1 PXUQTDZNOHRWLI-OXUVVOBNSA-O 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A42—HEADWEAR
- A42B—HATS; HEAD COVERINGS
- A42B1/00—Hats; Caps; Hoods
- A42B1/201—Collapsible or foldable
Landscapes
- Helmets And Other Head Coverings (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/612,884 US4556993A (en) | 1984-05-22 | 1984-05-22 | Convertible sunvisor cap |
| US612,884 | 1984-05-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1244601A true CA1244601A (en) | 1988-11-15 |
Family
ID=24455006
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000482104A Expired CA1244601A (en) | 1984-05-22 | 1985-05-22 | Convertible sunvisor cap |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4556993A (enExample) |
| EP (1) | EP0181925A4 (enExample) |
| JP (1) | JPS6124428U (enExample) |
| AU (1) | AU580066B2 (enExample) |
| CA (1) | CA1244601A (enExample) |
| WO (1) | WO1985005255A1 (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8416884D0 (en) * | 1984-07-03 | 1984-08-08 | Procter & Gamble | Liquid cleansing composition |
| US4741053A (en) * | 1987-03-27 | 1988-05-03 | Okamura Sr Edward T | Convertible sunvisor cap |
| CA1258551A (en) * | 1988-06-20 | 1989-08-22 | Charles W. Murray | Article of headwear |
| JPH0627612Y2 (ja) * | 1988-08-12 | 1994-07-27 | 株式会社大喜商会 | サンバイザー |
| GB2240029A (en) * | 1989-12-15 | 1991-07-24 | Peter Eynon Smart | Cap and sun visor |
| US5177811A (en) * | 1991-02-04 | 1993-01-12 | Jan Ulrich | Flexible visor-like head covering |
| US5116288A (en) * | 1991-07-18 | 1992-05-26 | Kondo Kyle K | Headshade |
| US5325540A (en) * | 1992-12-02 | 1994-07-05 | American Needle | Headwear piece with crown opening |
| AU648493B3 (en) * | 1993-12-17 | 1994-04-21 | Really Useful Product Company (Australia) Pty Ltd; The | Collapsible sunshade |
| US5507205A (en) * | 1994-05-11 | 1996-04-16 | Auto-Shade, Inc. | Hat shaped back pack steering wheel cover |
| FR2735663B1 (fr) * | 1995-06-26 | 1997-09-12 | Beauchene Frederic | Coiffure modulable |
| US6453475B1 (en) | 2000-11-17 | 2002-09-24 | Jim Johnson | Convertible visor/cap with a plurality of crown supports |
| USD462508S1 (en) | 2001-04-04 | 2002-09-10 | Sara L. Jones | Detachable visor hood |
| US6560785B1 (en) * | 2001-11-13 | 2003-05-13 | Nike International Ltd. | Visor having a retractable cap |
| FR2837071B1 (fr) * | 2002-03-18 | 2004-06-18 | Isabelle Py | Visiere avec compartiment de rangement associe |
| US20060015984A1 (en) * | 2004-07-20 | 2006-01-26 | Liu Chien H | Sun visor |
| CN100438788C (zh) * | 2005-02-08 | 2008-12-03 | 张贵岳 | 一种遮阳帽 |
| US8020218B2 (en) * | 2008-02-12 | 2011-09-20 | Richard Stingone | Baseball cap with neck protection visor |
| US20090241239A1 (en) * | 2008-03-25 | 2009-10-01 | Mad Bomber Company | Integrated reversible cap |
| USD607629S1 (en) | 2009-05-04 | 2010-01-12 | Dolawat Puangprasert | Ventilated hat |
| US20110016613A1 (en) * | 2009-07-27 | 2011-01-27 | Warrick Sherri J | Headband with retractable visor |
| US20130212776A1 (en) * | 2010-11-01 | 2013-08-22 | Seon Sang Kim | Cap with improved ventilation |
| USD682513S1 (en) * | 2012-03-13 | 2013-05-21 | Davon Thomas House | Backless sports cap |
| JP5420799B1 (ja) * | 2012-12-26 | 2014-02-19 | 順一 桑原 | 帽子 |
| USD738596S1 (en) * | 2013-06-11 | 2015-09-15 | Davisage Beauty Limited | Foldable visor |
| USD756612S1 (en) * | 2015-01-07 | 2016-05-24 | Lisa A. Broderick | Hood for personal privacy |
| WO2017003369A1 (en) * | 2015-06-30 | 2017-01-05 | Chong Shong Voon Bonnie | A wearable accessory |
| USD780412S1 (en) | 2015-07-20 | 2017-03-07 | André T. Winton | Baseball-style hat with rear opening |
| US20170020220A1 (en) * | 2015-07-22 | 2017-01-26 | Richard Stanley Plon | Securable Hat |
| US10897946B2 (en) * | 2015-07-22 | 2021-01-26 | Richard Stanley Plon | Securable hat |
| USD962548S1 (en) * | 2016-10-31 | 2022-08-30 | memBrain Safety Solutions, LLC | Helmet |
| KR20210009164A (ko) * | 2019-07-16 | 2021-01-26 | 주식회사 오토스윙 | 용접용 보호 장치 |
| US12501957B2 (en) * | 2020-09-29 | 2025-12-23 | John Rutigliano | Method and assembly for cushioning a person's head from headphones |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE484398C (de) * | 1929-10-15 | Gretchen Seibt Geb Mater | Kopfbedeckung | |
| US1105400A (en) * | 1913-07-19 | 1914-07-28 | John William Burke | Cap. |
| US1598313A (en) * | 1922-12-05 | 1926-08-31 | Rosenberg Solomon | Cap |
| US1533624A (en) * | 1924-10-24 | 1925-04-14 | Emil B Weinrott | Ventilated head garment |
| US1665750A (en) * | 1927-08-15 | 1928-04-10 | Frank E Walling | Cap attachment for visors |
| US2765472A (en) * | 1952-03-22 | 1956-10-09 | Schoen-Wolski Wlodzimierz | Collapsible headgear |
| US2896218A (en) * | 1956-01-17 | 1959-07-28 | Louisville Cap Corp | Foldable cap |
| US3514787A (en) * | 1968-06-24 | 1970-06-02 | Kennedy Alvin B Jun | Collapsible protective hat |
| US4023212A (en) * | 1974-08-19 | 1977-05-17 | Huffman Erline L | Adjustable visored cap with interchangeable crown |
| US4277847A (en) * | 1980-04-01 | 1981-07-14 | Jose Estrada | Headband for joggers |
-
1984
- 1984-05-22 US US06/612,884 patent/US4556993A/en not_active Expired - Fee Related
-
1985
- 1985-05-15 JP JP1985072147U patent/JPS6124428U/ja active Granted
- 1985-05-22 WO PCT/US1985/000958 patent/WO1985005255A1/en not_active Ceased
- 1985-05-22 CA CA000482104A patent/CA1244601A/en not_active Expired
- 1985-05-22 AU AU43600/85A patent/AU580066B2/en not_active Ceased
- 1985-05-22 EP EP19850902862 patent/EP0181925A4/en not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| WO1985005255A1 (en) | 1985-12-05 |
| JPS6124428U (ja) | 1986-02-13 |
| EP0181925A1 (en) | 1986-05-28 |
| AU580066B2 (en) | 1988-12-22 |
| JPH0232663Y2 (enExample) | 1990-09-04 |
| AU4360085A (en) | 1985-12-13 |
| EP0181925A4 (en) | 1987-04-29 |
| US4556993A (en) | 1985-12-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1244601A (en) | Convertible sunvisor cap | |
| US6802083B2 (en) | Cap with improved sunshade | |
| US6499146B2 (en) | Ear protection device | |
| US5448778A (en) | Detachable sun shield for caps | |
| US5197150A (en) | Visor cap with retractable protective visor and method of construction therefore | |
| US4793006A (en) | Visor cap with movable protective visor | |
| KR100355008B1 (ko) | 헤드웨어 | |
| US4845782A (en) | Cap | |
| US4872218A (en) | Cap attachment to prevent protruding hair | |
| US5062163A (en) | Head protector for use with hard head gear | |
| US5901371A (en) | Cap with adjustable side visors | |
| US6952841B2 (en) | Sports goggles | |
| US5421037A (en) | Combined goggles and headband assembly | |
| US20040231030A1 (en) | Sport cap | |
| US20030097706A1 (en) | Apparatus and method for making an ear warmer and an ear warmer frame | |
| US20040000332A1 (en) | Head Mounted umbrella and method of manufacturing the same | |
| EP0625875A1 (en) | Combined visored cap type protective helmet and pouch for bicyclists or the like | |
| US5528774A (en) | Earmuff assembly | |
| US4927063A (en) | Combination cap hanger and visor press | |
| US5704062A (en) | Sun visor | |
| US5103503A (en) | Adjustable-fit flat top hat | |
| JP3050024U (ja) | 雨用帽子 | |
| CA1288548C (en) | Presettable zip-open necktie with zipper restraining means | |
| JP2559213Y2 (ja) | 防寒用フェースマスク | |
| JPH0345932Y2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |