CA1178745A - Process for the preparation of polyarylene sulphides - Google Patents
Process for the preparation of polyarylene sulphidesInfo
- Publication number
- CA1178745A CA1178745A CA000357043A CA357043A CA1178745A CA 1178745 A CA1178745 A CA 1178745A CA 000357043 A CA000357043 A CA 000357043A CA 357043 A CA357043 A CA 357043A CA 1178745 A CA1178745 A CA 1178745A
- Authority
- CA
- Canada
- Prior art keywords
- alkali metal
- phosphonic acid
- sulphide
- mol
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 29
- 229920000412 polyarylene Polymers 0.000 title claims abstract description 20
- 238000002360 preparation method Methods 0.000 title abstract description 15
- 150000003568 thioethers Chemical class 0.000 title abstract 2
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 41
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims abstract description 18
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 16
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 claims abstract description 13
- 239000002798 polar solvent Substances 0.000 claims abstract description 6
- 239000000203 mixture Substances 0.000 claims description 21
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 238000006068 polycondensation reaction Methods 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 150000002431 hydrogen Chemical class 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Chemical group 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 239000011630 iodine Chemical group 0.000 claims description 2
- 229910052740 iodine Chemical group 0.000 claims description 2
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 150000001491 aromatic compounds Chemical class 0.000 abstract description 2
- 230000003197 catalytic effect Effects 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- 238000006243 chemical reaction Methods 0.000 description 23
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 21
- -1 alkaline earth metal sulphides Chemical class 0.000 description 21
- 150000004763 sulfides Chemical class 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 235000013350 formula milk Nutrition 0.000 description 13
- 229940116254 phosphonic acid Drugs 0.000 description 13
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 12
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 208000005156 Dehydration Diseases 0.000 description 9
- 230000018044 dehydration Effects 0.000 description 9
- 238000006297 dehydration reaction Methods 0.000 description 9
- 150000003009 phosphonic acids Chemical class 0.000 description 9
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 229920000642 polymer Polymers 0.000 description 8
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- YACKEPLHDIMKIO-UHFFFAOYSA-N methylphosphonic acid Chemical compound CP(O)(O)=O YACKEPLHDIMKIO-UHFFFAOYSA-N 0.000 description 7
- 150000001408 amides Chemical class 0.000 description 6
- 239000000470 constituent Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229920000069 polyphenylene sulfide Polymers 0.000 description 6
- 150000003951 lactams Chemical class 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- 229910052979 sodium sulfide Inorganic materials 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 150000004677 hydrates Chemical class 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- GWCFTYITFDWLAY-UHFFFAOYSA-N 1-ethylazepan-2-one Chemical compound CCN1CCCCCC1=O GWCFTYITFDWLAY-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- 230000036571 hydration Effects 0.000 description 2
- 238000006703 hydration reaction Methods 0.000 description 2
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical class [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- CRPRCSYCZWFVED-UHFFFAOYSA-N (4-ethylphenyl)phosphonic acid Chemical compound CCC1=CC=C(P(O)(O)=O)C=C1 CRPRCSYCZWFVED-UHFFFAOYSA-N 0.000 description 1
- LYNDWSARZJHIKU-UHFFFAOYSA-N (4-methylphenyl)phosphonic acid Chemical compound CC1=CC=C(P(O)(O)=O)C=C1 LYNDWSARZJHIKU-UHFFFAOYSA-N 0.000 description 1
- NAQWICRLNQSPPW-UHFFFAOYSA-N 1,2,3,4-tetrachloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 NAQWICRLNQSPPW-UHFFFAOYSA-N 0.000 description 1
- LHOGNQZQKDZOBP-UHFFFAOYSA-N 1,2,3-trichloro-4-methylbenzene Chemical compound CC1=CC=C(Cl)C(Cl)=C1Cl LHOGNQZQKDZOBP-UHFFFAOYSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- QEPTXDCPBXMWJC-UHFFFAOYSA-N 1,2,3-trichloronaphthalene Chemical compound C1=CC=C2C(Cl)=C(Cl)C(Cl)=CC2=C1 QEPTXDCPBXMWJC-UHFFFAOYSA-N 0.000 description 1
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 1
- FWAJPSIPOULHHH-UHFFFAOYSA-N 1,2,4-tribromobenzene Chemical compound BrC1=CC=C(Br)C(Br)=C1 FWAJPSIPOULHHH-UHFFFAOYSA-N 0.000 description 1
- MRJBOPVWPORBKZ-UHFFFAOYSA-N 1,2,4-trichloronaphthalene Chemical compound C1=CC=CC2=C(Cl)C(Cl)=CC(Cl)=C21 MRJBOPVWPORBKZ-UHFFFAOYSA-N 0.000 description 1
- KSXFNGRHPAHIQJ-UHFFFAOYSA-N 1,2,4-triiodobenzene Chemical compound IC1=CC=C(I)C(I)=C1 KSXFNGRHPAHIQJ-UHFFFAOYSA-N 0.000 description 1
- AAUJSCRITBXDJH-UHFFFAOYSA-N 1,2,6-trichloronaphthalene Chemical compound ClC1=C(Cl)C=CC2=CC(Cl)=CC=C21 AAUJSCRITBXDJH-UHFFFAOYSA-N 0.000 description 1
- BSJWDQYZFBYNIM-UHFFFAOYSA-N 1,3,4,5-tetramethylpyrrolidin-2-one Chemical compound CC1C(C)N(C)C(=O)C1C BSJWDQYZFBYNIM-UHFFFAOYSA-N 0.000 description 1
- VMNISWKTOHUZQN-UHFFFAOYSA-N 1,3,5-trichloro-2,4,6-trimethylbenzene Chemical compound CC1=C(Cl)C(C)=C(Cl)C(C)=C1Cl VMNISWKTOHUZQN-UHFFFAOYSA-N 0.000 description 1
- RCTKUIOMKBEGTG-UHFFFAOYSA-N 1,3,5-trichloro-2-methylbenzene Chemical compound CC1=C(Cl)C=C(Cl)C=C1Cl RCTKUIOMKBEGTG-UHFFFAOYSA-N 0.000 description 1
- BCNBMSZKALBQEF-UHFFFAOYSA-N 1,3-dimethylpyrrolidin-2-one Chemical compound CC1CCN(C)C1=O BCNBMSZKALBQEF-UHFFFAOYSA-N 0.000 description 1
- MHQCPXUMZCNOSF-UHFFFAOYSA-N 1,4-dibromo-2-phenylbenzene Chemical compound BrC1=CC=C(Br)C(C=2C=CC=CC=2)=C1 MHQCPXUMZCNOSF-UHFFFAOYSA-N 0.000 description 1
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 1
- PTIQIITULDNGAF-UHFFFAOYSA-N 1,4-dichloro-2,3,5,6-tetramethylbenzene Chemical compound CC1=C(C)C(Cl)=C(C)C(C)=C1Cl PTIQIITULDNGAF-UHFFFAOYSA-N 0.000 description 1
- BFGDCPOTPZOVHM-UHFFFAOYSA-N 1,4-dichloro-2-cyclohexylbenzene Chemical compound ClC1=CC=C(Cl)C(C2CCCCC2)=C1 BFGDCPOTPZOVHM-UHFFFAOYSA-N 0.000 description 1
- GAHDDNITQFTXQC-UHFFFAOYSA-N 1,4-dichloro-2-hexylbenzene Chemical compound CCCCCCC1=CC(Cl)=CC=C1Cl GAHDDNITQFTXQC-UHFFFAOYSA-N 0.000 description 1
- KFAKZJUYBOYVKA-UHFFFAOYSA-N 1,4-dichloro-2-methylbenzene Chemical compound CC1=CC(Cl)=CC=C1Cl KFAKZJUYBOYVKA-UHFFFAOYSA-N 0.000 description 1
- QUGUFLJIAFISSW-UHFFFAOYSA-N 1,4-difluorobenzene Chemical compound FC1=CC=C(F)C=C1 QUGUFLJIAFISSW-UHFFFAOYSA-N 0.000 description 1
- LFMWZTSOMGDDJU-UHFFFAOYSA-N 1,4-diiodobenzene Chemical compound IC1=CC=C(I)C=C1 LFMWZTSOMGDDJU-UHFFFAOYSA-N 0.000 description 1
- NCNWTBAWLAFYDR-UHFFFAOYSA-N 1,6-dimethylpiperidin-2-one Chemical compound CC1CCCC(=O)N1C NCNWTBAWLAFYDR-UHFFFAOYSA-N 0.000 description 1
- ZFPGARUNNKGOBB-UHFFFAOYSA-N 1-Ethyl-2-pyrrolidinone Chemical compound CCN1CCCC1=O ZFPGARUNNKGOBB-UHFFFAOYSA-N 0.000 description 1
- BTGSQYQDTHZFCM-UHFFFAOYSA-N 1-bromo-4-chloro-2-ethylbenzene Chemical compound CCC1=CC(Cl)=CC=C1Br BTGSQYQDTHZFCM-UHFFFAOYSA-N 0.000 description 1
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 1
- GWQSENYKCGJTRI-UHFFFAOYSA-N 1-chloro-4-iodobenzene Chemical compound ClC1=CC=C(I)C=C1 GWQSENYKCGJTRI-UHFFFAOYSA-N 0.000 description 1
- VUQMOERHEHTWPE-UHFFFAOYSA-N 1-ethylpiperidin-2-one Chemical compound CCN1CCCCC1=O VUQMOERHEHTWPE-UHFFFAOYSA-N 0.000 description 1
- GGYVTHJIUNGKFZ-UHFFFAOYSA-N 1-methylpiperidin-2-one Chemical compound CN1CCCCC1=O GGYVTHJIUNGKFZ-UHFFFAOYSA-N 0.000 description 1
- BWIRRVWVFWVVSG-UHFFFAOYSA-N 1-propan-2-ylazepan-2-one Chemical compound CC(C)N1CCCCCC1=O BWIRRVWVFWVVSG-UHFFFAOYSA-N 0.000 description 1
- GHELJWBGTIKZQW-UHFFFAOYSA-N 1-propan-2-ylpyrrolidin-2-one Chemical compound CC(C)N1CCCC1=O GHELJWBGTIKZQW-UHFFFAOYSA-N 0.000 description 1
- QORAVNMWUNPXAO-UHFFFAOYSA-N 2,2',4,4'-tetrachlorobiphenyl Chemical group ClC1=CC(Cl)=CC=C1C1=CC=C(Cl)C=C1Cl QORAVNMWUNPXAO-UHFFFAOYSA-N 0.000 description 1
- UADLUJIUAQAUHR-UHFFFAOYSA-N 2,5-dichloro-5,6-dimethylcyclohexa-1,3-diene Chemical group CC1C=C(Cl)C=CC1(C)Cl UADLUJIUAQAUHR-UHFFFAOYSA-N 0.000 description 1
- KKQWHYGECTYFIA-UHFFFAOYSA-N 2,5-dichlorobiphenyl Chemical compound ClC1=CC=C(Cl)C(C=2C=CC=CC=2)=C1 KKQWHYGECTYFIA-UHFFFAOYSA-N 0.000 description 1
- ZXONXKTYRSSVKY-UHFFFAOYSA-N 2-benzyl-1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C(CC=2C=CC=CC=2)=C1 ZXONXKTYRSSVKY-UHFFFAOYSA-N 0.000 description 1
- TWBJFGPBCGJTSK-UHFFFAOYSA-N 2-phenoxyethylphosphonic acid Chemical compound OP(O)(=O)CCOC1=CC=CC=C1 TWBJFGPBCGJTSK-UHFFFAOYSA-N 0.000 description 1
- BFDYSJCMAFSRDH-UHFFFAOYSA-N 2-phenylethylphosphonic acid Chemical compound OP(O)(=O)CCC1=CC=CC=C1 BFDYSJCMAFSRDH-UHFFFAOYSA-N 0.000 description 1
- DRYYJQYUHPRVBN-UHFFFAOYSA-N 3-ethyl-1-methylpiperidin-2-one Chemical compound CCC1CCCN(C)C1=O DRYYJQYUHPRVBN-UHFFFAOYSA-N 0.000 description 1
- PXAJHFBCNCZXKJ-UHFFFAOYSA-N 4-phenylbuta-1,3-dienylphosphonic acid Chemical compound OP(O)(=O)C=CC=CC1=CC=CC=C1 PXAJHFBCNCZXKJ-UHFFFAOYSA-N 0.000 description 1
- PJOFGDOSMWTOOQ-UHFFFAOYSA-N 4-phenylbutylphosphonic acid Chemical compound OP(O)(=O)CCCCC1=CC=CC=C1 PJOFGDOSMWTOOQ-UHFFFAOYSA-N 0.000 description 1
- OGBVRMYSNSKIEF-UHFFFAOYSA-N Benzylphosphonic acid Chemical compound OP(O)(=O)CC1=CC=CC=C1 OGBVRMYSNSKIEF-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical compound CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 1
- QLZHNIAADXEJJP-UHFFFAOYSA-N Phenylphosphonic acid Chemical compound OP(O)(=O)C1=CC=CC=C1 QLZHNIAADXEJJP-UHFFFAOYSA-N 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Chemical class 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- UOKRBSXOBUKDGE-UHFFFAOYSA-N butylphosphonic acid Chemical compound CCCCP(O)(O)=O UOKRBSXOBUKDGE-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- FBSFTJQYCLLGKH-UHFFFAOYSA-N cyclohexylphosphonic acid Chemical compound OP(O)(=O)C1CCCCC1 FBSFTJQYCLLGKH-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- NBUGGOCWWMRVRX-UHFFFAOYSA-N dioxido-oxo-(2-phenylethynyl)-$l^{5}-phosphane;hydron Chemical compound OP(O)(=O)C#CC1=CC=CC=C1 NBUGGOCWWMRVRX-UHFFFAOYSA-N 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000005530 etching Methods 0.000 description 1
- GATNOFPXSDHULC-UHFFFAOYSA-N ethylphosphonic acid Chemical compound CCP(O)(O)=O GATNOFPXSDHULC-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 238000010101 extrusion blow moulding Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- YVIVRJLWYJGJTJ-UHFFFAOYSA-N gamma-Valerolactam Chemical compound CC1CCC(=O)N1 YVIVRJLWYJGJTJ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- XIXADJRWDQXREU-UHFFFAOYSA-M lithium acetate Chemical compound [Li+].CC([O-])=O XIXADJRWDQXREU-UHFFFAOYSA-M 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 238000005065 mining Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- CKVICYBZYGZLLP-UHFFFAOYSA-N pentylphosphonic acid Chemical compound CCCCCP(O)(O)=O CKVICYBZYGZLLP-UHFFFAOYSA-N 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- ATLPLEZDTSBZQG-UHFFFAOYSA-N propan-2-ylphosphonic acid Chemical compound CC(C)P(O)(O)=O ATLPLEZDTSBZQG-UHFFFAOYSA-N 0.000 description 1
- NSETWVJZUWGCKE-UHFFFAOYSA-N propylphosphonic acid Chemical compound CCCP(O)(O)=O NSETWVJZUWGCKE-UHFFFAOYSA-N 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/0231—Polyarylenethioethers containing chain-terminating or chain-branching agents
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G75/00—Macromolecular compounds obtained by reactions forming a linkage containing sulfur with or without nitrogen, oxygen, or carbon in the main chain of the macromolecule
- C08G75/02—Polythioethers
- C08G75/0204—Polyarylenethioethers
- C08G75/025—Preparatory processes
- C08G75/0254—Preparatory processes using metal sulfides
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polymers With Sulfur, Phosphorus Or Metals In The Main Chain (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEP2930797.9 | 1979-07-28 | ||
| DE19792930797 DE2930797A1 (de) | 1979-07-28 | 1979-07-28 | Verfahren zur herstellung von polyarylensulfiden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1178745A true CA1178745A (en) | 1984-11-27 |
Family
ID=6077103
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000357043A Expired CA1178745A (en) | 1979-07-28 | 1980-07-25 | Process for the preparation of polyarylene sulphides |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4331801A (esLanguage) |
| EP (1) | EP0023314B1 (esLanguage) |
| JP (1) | JPS5620031A (esLanguage) |
| CA (1) | CA1178745A (esLanguage) |
| DE (2) | DE2930797A1 (esLanguage) |
| ES (1) | ES8200132A1 (esLanguage) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3120538A1 (de) * | 1981-05-22 | 1982-12-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von polyarylensulfiden |
| DE3269410D1 (en) | 1981-09-25 | 1986-04-03 | Bayer Ag | Process for producing poly-arylene sulfides |
| DE3215259A1 (de) * | 1982-04-23 | 1983-10-27 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| US4880901A (en) * | 1982-08-03 | 1989-11-14 | Phillips Petroleum Company | Arylene sulfide terpolymers and processes for making them |
| JPS5989327A (ja) * | 1982-09-27 | 1984-05-23 | フイリツプス・ペトロリユ−ム・コンパニ− | 蒸発を利用した粒状ポリアリ−レンサルフアイドの回収方法 |
| DE3243189A1 (de) * | 1982-11-23 | 1984-05-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen gegebenenfalls verzweigten polyarylensulfiden |
| DE3312254A1 (de) * | 1983-04-05 | 1984-10-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
| DE3312284A1 (de) * | 1983-04-05 | 1984-10-11 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden |
| JPS59204657A (ja) * | 1983-05-09 | 1984-11-20 | Toray Ind Inc | ポリフエニレンスルフイド組成物 |
| DE3318401A1 (de) * | 1983-05-20 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE3338501A1 (de) * | 1983-10-22 | 1985-05-02 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE3339233A1 (de) * | 1983-10-28 | 1985-05-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von gegebenenfalls verzweigten polyarylensulfiden mit verminderter korrosivitaet |
| DE3410642A1 (de) * | 1984-03-23 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| US4645826A (en) * | 1984-06-20 | 1987-02-24 | Kureha Kagaku Kogyo Kabushiki Kaisha | Process for production of high to ultra-high molecular weight linear polyarylenesulfides |
| DE3428986A1 (de) * | 1984-08-07 | 1986-02-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| DE3428984A1 (de) * | 1984-08-07 | 1986-02-20 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von hochmolekularen, gegebenenfalls verzweigten polyarylensulfiden |
| US4663431A (en) * | 1985-05-07 | 1987-05-05 | Toyo Boseki Kabushiki Kaisha T/U Toyobo Co, Ltd. | Process for preparing polyarylene sulfide with alkali metal salt of phenolic aromatic sulfonic acid |
| JPS61255933A (ja) * | 1985-05-08 | 1986-11-13 | Kureha Chem Ind Co Ltd | 重合体スラリ−の処理法 |
| JPH07121985B2 (ja) * | 1986-08-04 | 1995-12-25 | 呉羽化学工業株式会社 | ポリアリ−レンスルフイドの製造法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3658753A (en) * | 1970-07-01 | 1972-04-25 | Phillips Petroleum Co | Color stabilized poly(arylene sulfide) resins |
| US3919177A (en) * | 1973-11-19 | 1975-11-11 | Phillips Petroleum Co | P-phenylene sulfide polymers |
-
1979
- 1979-07-28 DE DE19792930797 patent/DE2930797A1/de not_active Withdrawn
-
1980
- 1980-07-16 EP EP80104141A patent/EP0023314B1/de not_active Expired
- 1980-07-16 DE DE8080104141T patent/DE3064256D1/de not_active Expired
- 1980-07-23 US US06/171,364 patent/US4331801A/en not_active Expired - Lifetime
- 1980-07-25 JP JP10141080A patent/JPS5620031A/ja active Granted
- 1980-07-25 CA CA000357043A patent/CA1178745A/en not_active Expired
- 1980-07-28 ES ES493771A patent/ES8200132A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE3064256D1 (en) | 1983-08-25 |
| JPS6324531B2 (esLanguage) | 1988-05-20 |
| EP0023314A1 (de) | 1981-02-04 |
| DE2930797A1 (de) | 1981-02-12 |
| ES493771A0 (es) | 1981-10-16 |
| EP0023314B1 (de) | 1983-07-20 |
| ES8200132A1 (es) | 1981-10-16 |
| JPS5620031A (en) | 1981-02-25 |
| US4331801A (en) | 1982-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1178745A (en) | Process for the preparation of polyarylene sulphides | |
| US4303781A (en) | Process for the preparation of polyarylene sulphides | |
| US4362864A (en) | Process for the preparation of polyarylene sulphides | |
| EP0280274B1 (en) | Arylene sulfide polymers | |
| US4605713A (en) | Process for the production of polyarylene sulphides with functional end groups | |
| US4025496A (en) | Sequenced addition of components in poly(arylene sulfide) production | |
| EP0278276A1 (en) | P-phenylene sulfide polymers | |
| US4433138A (en) | Process for the preparation of polyarylene sulphides | |
| US4424339A (en) | Process for the preparation of polyarylene sulphides | |
| EP0086487B1 (en) | Arylene sulfide polymer preparation | |
| US4525579A (en) | Process for the production of optionally branched polyarylene sulphides with polyhalogenated polyaromatic compound | |
| US4535149A (en) | Process for the production of polyarylene sulphides | |
| US4661584A (en) | Preparation of polyarylene sulphide in presence of amino carboxylic acid | |
| CA1223690A (en) | Process for the production of optionally branched polyarylene sulfides | |
| CA1309549C (en) | Process for producing a polyarylene sulfide | |
| US4501884A (en) | Process for the production of optionally branched polyarylene sulphide with piperazinone solvent | |
| EP0280271A2 (en) | Arylene sulfide polymers | |
| US4837301A (en) | Process for the preparation of high molecular weight optionally branched polyarylenesulphides | |
| US4464507A (en) | Process for the production of high molecular weight, optionally branched, polyarylene sulphides | |
| US4921935A (en) | Preparation of polyarylene sulphides with ketone or pinacone | |
| JPH032178B2 (esLanguage) | ||
| US5331069A (en) | Method of treating poly(arylene sulfide sulfone) polymers and polymers | |
| EP0488268A2 (en) | Removal of water by venting during the polymerization of phenylene sulfide polymers | |
| JPH0160171B2 (esLanguage) | ||
| JPH068350B2 (ja) | 高分子量の、場合によつては枝分れしたポリアリーレンスルフイドの製造方法 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |