CA1171378A - Method of inhibiting polymerization of vinyl aromatic compounds - Google Patents
Method of inhibiting polymerization of vinyl aromatic compoundsInfo
- Publication number
- CA1171378A CA1171378A CA000430326A CA430326A CA1171378A CA 1171378 A CA1171378 A CA 1171378A CA 000430326 A CA000430326 A CA 000430326A CA 430326 A CA430326 A CA 430326A CA 1171378 A CA1171378 A CA 1171378A
- Authority
- CA
- Canada
- Prior art keywords
- distillation
- vinyl aromatic
- inhibitor
- styrene
- polymerization
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 vinyl aromatic compounds Chemical class 0.000 title claims abstract description 46
- 229920002554 vinyl polymer Polymers 0.000 title claims abstract description 39
- 238000000034 method Methods 0.000 title claims abstract description 38
- 238000006116 polymerization reaction Methods 0.000 title abstract description 41
- 230000002401 inhibitory effect Effects 0.000 title description 16
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical class C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims abstract description 53
- 238000004821 distillation Methods 0.000 claims abstract description 53
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims abstract description 47
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical class C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 claims abstract description 6
- XGDRLUOCCGMFEF-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dinitrophenyl)propan-2-yl]-2,6-dinitrophenol Chemical compound C=1C([N+]([O-])=O)=C(O)C([N+]([O-])=O)=CC=1C(C)(C)C1=CC([N+]([O-])=O)=C(O)C([N+]([O-])=O)=C1 XGDRLUOCCGMFEF-UHFFFAOYSA-N 0.000 claims abstract description 4
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims abstract 2
- 150000001875 compounds Chemical class 0.000 claims description 14
- 238000005292 vacuum distillation Methods 0.000 claims description 10
- 239000003112 inhibitor Substances 0.000 abstract description 58
- 125000004432 carbon atom Chemical group C* 0.000 description 15
- 239000000178 monomer Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 10
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical class CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 238000009835 boiling Methods 0.000 description 7
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 6
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical class CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 6
- LISYARSNTHASDG-UHFFFAOYSA-N dinitrobisphenol a Chemical compound C=1C=C(O)C([N+]([O-])=O)=CC=1C(C)(C)C1=CC=C(O)C([N+]([O-])=O)=C1 LISYARSNTHASDG-UHFFFAOYSA-N 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- 239000011593 sulfur Substances 0.000 description 6
- DUMPKRLSSRTFMY-UHFFFAOYSA-N 2-butan-2-yl-3,4-dinitrophenol Chemical compound CCC(C)C1=C(O)C=CC([N+]([O-])=O)=C1[N+]([O-])=O DUMPKRLSSRTFMY-UHFFFAOYSA-N 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000012719 thermal polymerization Methods 0.000 description 5
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- HOYRZHJJAHRMLL-UHFFFAOYSA-N 2,6-dinitro-p-cresol Chemical compound CC1=CC([N+]([O-])=O)=C(O)C([N+]([O-])=O)=C1 HOYRZHJJAHRMLL-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 3
- 241000482268 Zea mays subsp. mays Species 0.000 description 3
- 150000005195 diethylbenzenes Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 229920003051 synthetic elastomer Polymers 0.000 description 3
- 239000005061 synthetic rubber Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 description 2
- BQEXDUKMTVYBRK-UHFFFAOYSA-N 4-methyl-3-nitrophenol Chemical compound CC1=CC=C(O)C=C1[N+]([O-])=O BQEXDUKMTVYBRK-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical group C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- UBUCNCOMADRQHX-UHFFFAOYSA-N N-Nitrosodiphenylamine Chemical compound C=1C=CC=CC=1N(N=O)C1=CC=CC=C1 UBUCNCOMADRQHX-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 239000004157 Nitrosyl chloride Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000006356 dehydrogenation reaction Methods 0.000 description 2
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 2
- 235000019392 nitrosyl chloride Nutrition 0.000 description 2
- 229960003742 phenol Drugs 0.000 description 2
- 229950000688 phenothiazine Drugs 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 150000003440 styrenes Chemical class 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- MHKBMNACOMRIAW-UHFFFAOYSA-N 2,3-dinitrophenol Chemical class OC1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O MHKBMNACOMRIAW-UHFFFAOYSA-N 0.000 description 1
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 1
- UFBJCMHMOXMLKC-UHFFFAOYSA-N 2,4-dinitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O UFBJCMHMOXMLKC-UHFFFAOYSA-N 0.000 description 1
- WUGNDXPTZCCGDM-UHFFFAOYSA-N 2-hydroxy-5-methyl-3-nitrobenzaldehyde Chemical compound CC1=CC(C=O)=C(O)C([N+]([O-])=O)=C1 WUGNDXPTZCCGDM-UHFFFAOYSA-N 0.000 description 1
- MAQGNTACXAOLNE-UHFFFAOYSA-N 2-hydroxy-5-methyl-3-nitrobenzoic acid Chemical compound CC1=CC(C(O)=O)=C(O)C([N+]([O-])=O)=C1 MAQGNTACXAOLNE-UHFFFAOYSA-N 0.000 description 1
- PMTVEXBJLIRTEJ-UHFFFAOYSA-N 2-methyl-4-nitrosophenol Chemical compound CC1=CC(N=O)=CC=C1O PMTVEXBJLIRTEJ-UHFFFAOYSA-N 0.000 description 1
- SYUYTOYKQOAVDW-UHFFFAOYSA-N 2-nitrosonaphthalen-1-ol Chemical compound C1=CC=C2C(O)=C(N=O)C=CC2=C1 SYUYTOYKQOAVDW-UHFFFAOYSA-N 0.000 description 1
- MMVZLDPUBLYNKK-UHFFFAOYSA-N 3-methyl-1-nitroso-6-propan-2-ylcyclohexa-2,4-dien-1-ol Chemical compound CC(C)C1C=CC(C)=CC1(O)N=O MMVZLDPUBLYNKK-UHFFFAOYSA-N 0.000 description 1
- VWGKEVWFBOUAND-UHFFFAOYSA-N 4,4'-thiodiphenol Chemical compound C1=CC(O)=CC=C1SC1=CC=C(O)C=C1 VWGKEVWFBOUAND-UHFFFAOYSA-N 0.000 description 1
- ZXVONLUNISGICL-UHFFFAOYSA-N 4,6-dinitro-o-cresol Chemical compound CC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O ZXVONLUNISGICL-UHFFFAOYSA-N 0.000 description 1
- JSTCPNFNKICNNO-UHFFFAOYSA-N 4-nitrosophenol Chemical compound OC1=CC=C(N=O)C=C1 JSTCPNFNKICNNO-UHFFFAOYSA-N 0.000 description 1
- RNBFLAJNUZQUIK-UHFFFAOYSA-N 5-methoxy-2-nitrosophenol Chemical compound COC1=CC=C(N=O)C(O)=C1 RNBFLAJNUZQUIK-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- YBZNEWDLUIBBFW-UHFFFAOYSA-N CC1=CC(=O)C(C)=C(C)C1=NO Chemical compound CC1=CC(=O)C(C)=C(C)C1=NO YBZNEWDLUIBBFW-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical group C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- JLJWIVHYUCBSRC-UHFFFAOYSA-N benzene;9-[fluoren-9-ylidene(phenyl)methyl]fluorene Chemical group C1=CC=CC=C1.C1=CC=CC=C1C([C]1C2=CC=CC=C2C2=CC=CC=C21)=C1C2=CC=CC=C2C2=CC=CC=C21 JLJWIVHYUCBSRC-UHFFFAOYSA-N 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000006203 ethylation Effects 0.000 description 1
- 238000006200 ethylation reaction Methods 0.000 description 1
- 150000005194 ethylbenzenes Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229920001447 polyvinyl benzene Chemical class 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- IOVGROKTTNBUGK-SJCJKPOMSA-N ritodrine Chemical compound N([C@@H](C)[C@H](O)C=1C=CC(O)=CC=1)CCC1=CC=C(O)C=C1 IOVGROKTTNBUGK-SJCJKPOMSA-N 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 230000002194 synthesizing effect Effects 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C7/00—Purification; Separation; Use of additives
- C07C7/20—Use of additives, e.g. for stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Analytical Chemistry (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Water Supply & Treatment (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US403,192 | 1982-07-29 | ||
| US06/403,192 US4376678A (en) | 1982-07-29 | 1982-07-29 | Method of inhibiting polymerization of vinyl aromatic compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1171378A true CA1171378A (en) | 1984-07-24 |
Family
ID=23594820
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000430326A Expired CA1171378A (en) | 1982-07-29 | 1983-06-14 | Method of inhibiting polymerization of vinyl aromatic compounds |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4376678A (enExample) |
| JP (1) | JPS5976738A (enExample) |
| CA (1) | CA1171378A (enExample) |
| FR (1) | FR2531073B1 (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4558169A (en) * | 1980-12-31 | 1985-12-10 | Cosden Technology, Inc. | Process for the production of vinyltoluene |
| US4439278A (en) * | 1982-06-21 | 1984-03-27 | Eastman Kodak Company | Process inhibitor for readily polymerizable ethylenically unsaturated aromatic compounds |
| US5017567A (en) * | 1983-11-25 | 1991-05-21 | Schering Corporation | Carboxyalkyl dipeptides as antiglaucoma agents |
| US4532011A (en) * | 1984-03-02 | 1985-07-30 | The Goodyear Tire & Rubber Company | Inhibiting polymerization of vinylaromatic monomers |
| US4514261A (en) * | 1984-08-31 | 1985-04-30 | El Paso Products Company | Refining of tertiary butylstyrene |
| IT1217876B (it) * | 1988-06-21 | 1990-03-30 | Donegani Guido Ist | Procedimento per l'alchilazione di fenoli |
| US4982034A (en) * | 1989-12-19 | 1991-01-01 | Amoco Corporation | Production and purification of t-butylstyrene |
| US5254760A (en) * | 1992-07-29 | 1993-10-19 | Ciba-Geigy Corporation | Inhibiting polymerization of vinyl aromatic monomers |
| US5659095A (en) * | 1996-03-13 | 1997-08-19 | Uniroyal Chemical Company, Inc. | Composition for inhibiting the polymerization of aromatic vinyl monomers |
| US6024894A (en) * | 1998-03-25 | 2000-02-15 | Betzdearborn Inc. | Compositions and methods for inhibiting vinyl aromatic monomer polymerization |
| US5907071A (en) * | 1998-04-21 | 1999-05-25 | Betzdearborn Inc. | Compositions and methods for inhibiting vinyl aromatic monomer polymerization |
| US6342648B1 (en) * | 1999-09-30 | 2002-01-29 | Baker Hughes Incorporated | Methods and compositions for inhibiting vinyl aromatic monomer polymerization |
Family Cites Families (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3526673A (en) * | 1968-05-13 | 1970-09-01 | Pennwalt Corp | Inhibiting popcorn polymer formation with tertiary amino dialkyl phenol compound |
| US3520943A (en) * | 1968-05-13 | 1970-07-21 | Pennwalt Corp | Inhibiting popcorn polymer formation with hydroxy benzene tertiary amine oxide compound |
| US3476656A (en) * | 1968-06-07 | 1969-11-04 | Universal Oil Prod Co | Fractional distillation and recovery of styrene containing sulfur with subsequent bottoms separation |
| US3527822A (en) * | 1969-04-16 | 1970-09-08 | Shell Oil Co | Divinylbenzene polymerization inhibitors |
| US3632564A (en) * | 1970-07-08 | 1972-01-04 | Harry Elmer Albert | Process for inhibiting popcorn polymer formation |
| US3804722A (en) * | 1970-09-11 | 1974-04-16 | Montedison Spa | Extractive distillation of pyridine-water azeotrope with a bisphenol |
| DE2148185C3 (de) | 1971-09-27 | 1975-05-28 | Wacker-Chemie Gmbh, 8000 Muenchen | Polymerisationsinhibitor fuer polymerisierbare vinylgruppenhaltige aliphatische, aromatische und heterocyclische verbindungen |
| US3816265A (en) * | 1971-10-13 | 1974-06-11 | Cosden Oil & Chem Co | Distillation of readily polymerizable ethylenically unsaturated aromatic hydrocarbon compounds with n-nitrosodiphenylamine |
| US4050993A (en) * | 1972-09-11 | 1977-09-27 | Cosden Oil & Chemical Company | Distillation of readily polymerizable ethylenically unsaturated compounds |
| US3964978A (en) * | 1974-12-09 | 1976-06-22 | Cosden Technology, Inc. | NO2 polymerization inhibitor for vinyl aromatic compound distillation |
| US3933599A (en) * | 1974-12-09 | 1976-01-20 | Cosden Technology, Inc. | Nitrosyl chloride as a polymerization inhibitor for vinyl aromatic compounds |
| US4040912A (en) * | 1974-12-09 | 1977-08-09 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US3964979A (en) * | 1974-12-09 | 1976-06-22 | Cosden Technology, Inc. | NO polymerization inhibitor for vinyl aromatic compound distillation |
| US3986937A (en) * | 1974-12-09 | 1976-10-19 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US3959395A (en) * | 1974-12-26 | 1976-05-25 | Monsanto Company | Recovery of polymerization inhibitor |
| US4033829A (en) * | 1974-12-26 | 1977-07-05 | Monsanto Company | Process for inhibiting polymerization of styrene during distillation |
| US3993547A (en) * | 1975-01-24 | 1976-11-23 | Cosden Technology, Inc. | Alpha, gamma-bis-diphenylene-beta-phenyl allyl as a polymerization inhibitor for vinyl aromatic compounds |
| US3988212A (en) * | 1975-03-21 | 1976-10-26 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4021476A (en) * | 1975-12-29 | 1977-05-03 | Union Carbide Corporation | Vinyl acetate polymerization inhibitors |
| US4040911A (en) * | 1976-01-02 | 1977-08-09 | Gulf Research & Development Company | Process for inhibiting the polymerization of styrene |
| US4003800A (en) * | 1976-01-02 | 1977-01-18 | Gulf Research & Development Company | Styrene purification process |
| US4061545A (en) * | 1976-02-19 | 1977-12-06 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4086147A (en) * | 1976-12-10 | 1978-04-25 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4105506A (en) * | 1977-02-24 | 1978-08-08 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| SU679589A1 (ru) | 1977-07-14 | 1979-08-15 | Волгоградский Политехнический Институт | Способ ингибировани термической полимеризации стирола |
| US4182658A (en) * | 1977-11-23 | 1980-01-08 | Cosden Technology, Inc. | Emergency polymerization inhibitor system for vinyl aromatic compounds |
| US4132602A (en) * | 1977-11-23 | 1979-01-02 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4132603A (en) * | 1977-11-23 | 1979-01-02 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4132601A (en) * | 1977-11-23 | 1979-01-02 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4177110A (en) * | 1978-07-18 | 1979-12-04 | Cosden Technology, Inc. | Method for the distillation of vinyl aromatic compounds using polymerization inhibitors with low-volatility |
| US4252615A (en) * | 1978-07-18 | 1981-02-24 | Cosden Technology, Inc. | Polymerization inhibitor for vinyl aromatic compounds |
| US4237326A (en) * | 1979-05-30 | 1980-12-02 | Mitsubishi Petrochemical Company Limited | Method of inhibiting polymerization of styrene |
| JPS5630409A (en) | 1979-08-20 | 1981-03-27 | Mitsubishi Petrochem Co Ltd | Method of feeding polymerization inhibitor |
-
1982
- 1982-07-29 US US06/403,192 patent/US4376678A/en not_active Expired - Lifetime
-
1983
- 1983-06-14 CA CA000430326A patent/CA1171378A/en not_active Expired
- 1983-07-01 FR FR8311015A patent/FR2531073B1/fr not_active Expired
- 1983-07-29 JP JP58139313A patent/JPS5976738A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2531073A1 (fr) | 1984-02-03 |
| JPS5976738A (ja) | 1984-05-01 |
| JPS6240339B2 (enExample) | 1987-08-27 |
| FR2531073B1 (fr) | 1985-12-06 |
| US4376678A (en) | 1983-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3988212A (en) | Polymerization inhibitor for vinyl aromatic compounds | |
| US4105506A (en) | Polymerization inhibitor for vinyl aromatic compounds | |
| US4466905A (en) | Polymerization inhibition process for vinyl aromatic compounds | |
| US4468343A (en) | Polymerization co-inhibitors for vinyl aromatic compounds | |
| KR0177045B1 (ko) | 비닐 방향족 단량체의 중합 억제 조성물 및 방법 | |
| CA1171378A (en) | Method of inhibiting polymerization of vinyl aromatic compounds | |
| EP0229515B1 (en) | Inhibiting polymerisation of vinyl aromatic monomers | |
| US4086147A (en) | Polymerization inhibitor for vinyl aromatic compounds | |
| EP0062626B1 (en) | Process for the distillation of vinyltoluene | |
| US3308201A (en) | Purification of hydrocarbons | |
| US2730489A (en) | Use of organic nitrites to inhibit polymerization of hydrocarbons during distillation | |
| US4132603A (en) | Polymerization inhibitor for vinyl aromatic compounds | |
| US3496069A (en) | Purification of unsaturated hydrocarbons by extractive distillation with recycle of stripper overhead | |
| US3274077A (en) | Distillation of crude ar-halomethylstyrenes in presence of an alkylene oxide | |
| US4050993A (en) | Distillation of readily polymerizable ethylenically unsaturated compounds | |
| CA1224811A (en) | Polymerization inhibition process for vinyl aromatic compounds | |
| US4390741A (en) | Process for the purification of diisopropenylbenzene | |
| US4040912A (en) | Polymerization inhibitor for vinyl aromatic compounds | |
| US2963518A (en) | Catalytic thermal treatment of xylene-containing hydrocarbons | |
| US4514261A (en) | Refining of tertiary butylstyrene | |
| US4389285A (en) | Process inhibitor for readily polymerizable ethylenically unsaturated aromatic compounds | |
| GB2056481A (en) | Feeding Nitrosophenols as Polymerization Inhibitors | |
| US3993547A (en) | Alpha, gamma-bis-diphenylene-beta-phenyl allyl as a polymerization inhibitor for vinyl aromatic compounds | |
| CA1234841A (en) | Process for the synthesis and purification of diisopropenylbenzene | |
| US4623431A (en) | Polymerization inhibitor for vinyl aromatic compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEC | Expiry (correction) | ||
| MKEX | Expiry |