CA1168242A - Quinone compounds, their production and use - Google Patents
Quinone compounds, their production and useInfo
- Publication number
- CA1168242A CA1168242A CA000375297A CA375297A CA1168242A CA 1168242 A CA1168242 A CA 1168242A CA 000375297 A CA000375297 A CA 000375297A CA 375297 A CA375297 A CA 375297A CA 1168242 A CA1168242 A CA 1168242A
- Authority
- CA
- Canada
- Prior art keywords
- methyl
- compound
- integer
- reaction
- hydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000004053 quinones Chemical class 0.000 title abstract description 8
- 238000004519 manufacturing process Methods 0.000 title description 21
- 150000001875 compounds Chemical class 0.000 claims abstract description 97
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 56
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims abstract description 32
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 23
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 19
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 12
- 239000001257 hydrogen Substances 0.000 claims abstract description 12
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 9
- 125000004423 acyloxy group Chemical group 0.000 claims abstract description 8
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 claims abstract description 7
- 150000003839 salts Chemical class 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract 6
- -1 methoxy, methoxymethyloxy, 2-tetrahydropyranyloxy Chemical group 0.000 claims description 96
- 238000006243 chemical reaction Methods 0.000 claims description 85
- 238000000034 method Methods 0.000 claims description 66
- 230000008569 process Effects 0.000 claims description 34
- 125000006239 protecting group Chemical group 0.000 claims description 17
- 239000000126 substance Substances 0.000 claims description 16
- 238000007254 oxidation reaction Methods 0.000 claims description 13
- XMPZTFVPEKAKFH-UHFFFAOYSA-P ceric ammonium nitrate Chemical compound [NH4+].[NH4+].[Ce+4].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O XMPZTFVPEKAKFH-UHFFFAOYSA-P 0.000 claims description 10
- 230000003647 oxidation Effects 0.000 claims description 10
- 125000004193 piperazinyl group Chemical group 0.000 claims description 10
- 239000011981 lindlar catalyst Substances 0.000 claims description 9
- 125000005806 3,4,5-trimethoxybenzyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1C([H])([H])* 0.000 claims description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 6
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 230000001590 oxidative effect Effects 0.000 claims description 5
- 229940005561 1,4-benzoquinone Drugs 0.000 claims description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 4
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 4
- 229910017604 nitric acid Inorganic materials 0.000 claims description 4
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 4
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 4
- JWCYHGVYVDMHQT-UHFFFAOYSA-N 1-oxidopyridin-1-ium-2,6-dicarboxylic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=[N+]1[O-] JWCYHGVYVDMHQT-UHFFFAOYSA-N 0.000 claims description 3
- 125000001231 benzoyloxy group Chemical group C(C1=CC=CC=C1)(=O)O* 0.000 claims description 3
- 229910001923 silver oxide Inorganic materials 0.000 claims description 3
- XZNSTIQKLTYQRE-UHFFFAOYSA-N 2-(12-hydroxydodeca-5,10-diynyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione Chemical compound COC1=C(OC)C(=O)C(CCCCC#CCCCC#CCO)=C(C)C1=O XZNSTIQKLTYQRE-UHFFFAOYSA-N 0.000 claims 3
- WDEABJKSGGRCQA-UHFFFAOYSA-N docebenone Chemical compound CC1=C(C)C(=O)C(CCCCC#CCCCC#CCO)=C(C)C1=O WDEABJKSGGRCQA-UHFFFAOYSA-N 0.000 claims 3
- 239000000376 reactant Substances 0.000 claims 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 2
- YNAZLSSVTQIAJK-UHFFFAOYSA-N 2-(9-hydroxynon-5-ynyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione Chemical compound COC1=C(OC)C(=O)C(CCCCC#CCCCO)=C(C)C1=O YNAZLSSVTQIAJK-UHFFFAOYSA-N 0.000 claims 2
- LDHKCMMLCXFNGX-NHDWVQLVSA-N 2-[(5z,10z)-12-hydroxydodeca-5,10-dienyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione Chemical compound COC1=C(OC)C(=O)C(CCCC\C=C/CCC\C=C/CO)=C(C)C1=O LDHKCMMLCXFNGX-NHDWVQLVSA-N 0.000 claims 2
- 125000004151 quinonyl group Chemical group 0.000 claims 2
- BYVUAGDUDTYKFS-UHFFFAOYSA-N 12-(2,3,4,5-tetramethoxy-6-methylphenyl)dodeca-2,7-diyn-1-ol Chemical compound COC1=C(C)C(CCCCC#CCCCC#CCO)=C(OC)C(OC)=C1OC BYVUAGDUDTYKFS-UHFFFAOYSA-N 0.000 claims 1
- TTYFPYCIZLFAHZ-UHFFFAOYSA-N 12-(2,5-dimethoxy-3,4,6-trimethylphenyl)dodeca-2,7-diyn-1-ol Chemical compound COC1=C(C)C(C)=C(OC)C(CCCCC#CCCCC#CCO)=C1C TTYFPYCIZLFAHZ-UHFFFAOYSA-N 0.000 claims 1
- CPGXVLHQFIWYME-NHDWVQLVSA-N 2-[(5z,10z)-12-hydroxydodeca-5,10-dienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=C(C)C(=O)C(CCCC\C=C/CCC\C=C/CO)=C(C)C1=O CPGXVLHQFIWYME-NHDWVQLVSA-N 0.000 claims 1
- 239000000924 antiasthmatic agent Substances 0.000 abstract description 4
- 230000003266 anti-allergic effect Effects 0.000 abstract description 3
- 230000001088 anti-asthma Effects 0.000 abstract description 3
- 230000036772 blood pressure Effects 0.000 abstract description 2
- 230000003247 decreasing effect Effects 0.000 abstract description 2
- 230000001766 physiological effect Effects 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 78
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 66
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 42
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 42
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical group CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 41
- 230000002829 reductive effect Effects 0.000 description 38
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 36
- 239000000047 product Substances 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 32
- 238000003756 stirring Methods 0.000 description 29
- 239000012044 organic layer Substances 0.000 description 27
- 239000002904 solvent Substances 0.000 description 27
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 26
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 22
- 235000019341 magnesium sulphate Nutrition 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 19
- 239000000741 silica gel Substances 0.000 description 19
- 229910002027 silica gel Inorganic materials 0.000 description 19
- 229960001866 silicon dioxide Drugs 0.000 description 19
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 18
- 150000002366 halogen compounds Chemical class 0.000 description 16
- 239000011780 sodium chloride Substances 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- 239000000203 mixture Substances 0.000 description 15
- 230000009467 reduction Effects 0.000 description 14
- 238000006722 reduction reaction Methods 0.000 description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 13
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 13
- 238000005859 coupling reaction Methods 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 12
- 101150041968 CDC13 gene Proteins 0.000 description 11
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 11
- 238000010531 catalytic reduction reaction Methods 0.000 description 11
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 150000005208 1,4-dihydroxybenzenes Chemical class 0.000 description 10
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Natural products OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 10
- 238000000605 extraction Methods 0.000 description 10
- 239000003960 organic solvent Substances 0.000 description 10
- AZQWKYJCGOJGHM-UHFFFAOYSA-N para-benzoquinone Natural products O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 10
- 239000003377 acid catalyst Substances 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 150000002989 phenols Chemical class 0.000 description 8
- MIOPJNTWMNEORI-GMSGAONNSA-N (S)-camphorsulfonic acid Chemical compound C1C[C@@]2(CS(O)(=O)=O)C(=O)C[C@@H]1C2(C)C MIOPJNTWMNEORI-GMSGAONNSA-N 0.000 description 7
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 7
- 239000003814 drug Substances 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 7
- 229940086542 triethylamine Drugs 0.000 description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 6
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 229940079593 drug Drugs 0.000 description 6
- 238000006266 etherification reaction Methods 0.000 description 6
- 238000005658 halogenation reaction Methods 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 239000012046 mixed solvent Substances 0.000 description 6
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 6
- 235000017557 sodium bicarbonate Nutrition 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 5
- 150000001299 aldehydes Chemical class 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 230000000875 corresponding effect Effects 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 230000026030 halogenation Effects 0.000 description 5
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 5
- 230000036961 partial effect Effects 0.000 description 5
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 5
- JKTCBAGSMQIFNL-UHFFFAOYSA-N 2,3-dihydrofuran Chemical compound C1CC=CO1 JKTCBAGSMQIFNL-UHFFFAOYSA-N 0.000 description 4
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical class O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 239000011261 inert gas Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 230000004060 metabolic process Effects 0.000 description 4
- 235000020777 polyunsaturated fatty acids Nutrition 0.000 description 4
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 235000009518 sodium iodide Nutrition 0.000 description 4
- YFEXZJKJPFNYKB-UHFFFAOYSA-N 2-(oxolan-2-yloxy)oxolane Chemical compound C1CCOC1OC1OCCC1 YFEXZJKJPFNYKB-UHFFFAOYSA-N 0.000 description 3
- INQVFAKQEDEEKU-UHFFFAOYSA-N 4-(2,3,4,5-tetramethoxy-6-methylphenyl)butan-1-ol Chemical compound COC1=C(C)C(CCCCO)=C(OC)C(OC)=C1OC INQVFAKQEDEEKU-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920002261 Corn starch Polymers 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 206010020772 Hypertension Diseases 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 229940114079 arachidonic acid Drugs 0.000 description 3
- 235000021342 arachidonic acid Nutrition 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- RUQIISJZRVTLRM-UHFFFAOYSA-L disodium;(5,7-dihydroxy-4-oxo-2-phenylchromen-6-yl) phosphate Chemical compound [Na+].[Na+].C=1C(=O)C=2C(O)=C(OP([O-])([O-])=O)C(O)=CC=2OC=1C1=CC=CC=C1 RUQIISJZRVTLRM-UHFFFAOYSA-L 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- MOTRZVVGCFFABN-UHFFFAOYSA-N hexane;2-propan-2-yloxypropane Chemical compound CCCCCC.CC(C)OC(C)C MOTRZVVGCFFABN-UHFFFAOYSA-N 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000007901 soft capsule Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- VNLQNGYIXVTQRR-ZRYTYNJLSA-N (2s,3r,5r,10r,13r,14s,17s)-17-acetyl-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1h-cyclopenta[a]phenanthren-6-one Chemical compound C1[C@@H](O)[C@@H](O)C[C@]2(C)C(CC[C@@]3([C@@H](C(=O)C)CC[C@]33O)C)C3=CC(=O)[C@@H]21 VNLQNGYIXVTQRR-ZRYTYNJLSA-N 0.000 description 2
- ZIOZYRSDNLNNNJ-LQWMCKPYSA-N 12(S)-HPETE Chemical compound CCCCC\C=C/C[C@H](OO)\C=C\C=C/C\C=C/CCCC(O)=O ZIOZYRSDNLNNNJ-LQWMCKPYSA-N 0.000 description 2
- DTLCQPMOXLFDKN-UHFFFAOYSA-N 2-(4-iodobutyl)-1,4-dimethoxy-3-methylnaphthalene Chemical compound C1=CC=C2C(OC)=C(C)C(CCCCI)=C(OC)C2=C1 DTLCQPMOXLFDKN-UHFFFAOYSA-N 0.000 description 2
- ZVAKZVDJIUFFFP-UHFFFAOYSA-N 2-chlorooxolane Chemical compound ClC1CCCO1 ZVAKZVDJIUFFFP-UHFFFAOYSA-N 0.000 description 2
- KZGSCWZYHFRIMQ-UHFFFAOYSA-N 2-octa-2,7-diynoxyoxane Chemical compound C#CCCCC#CCOC1CCCCO1 KZGSCWZYHFRIMQ-UHFFFAOYSA-N 0.000 description 2
- RDEYORKJEDLLDB-DQVHGTJVSA-N 5-Hydroperoxyeicosatetraenoic acid Chemical compound CCCCCCCCCCC\C=C\C=C\C(\OO)=C\C=C\C(O)=O RDEYORKJEDLLDB-DQVHGTJVSA-N 0.000 description 2
- KGIJOOYOSFUGPC-MSFIICATSA-N 5-Hydroxyeicosatetraenoic acid Chemical compound CCCCCC=CCC=CCC=C\C=C\[C@@H](O)CCCC(O)=O KGIJOOYOSFUGPC-MSFIICATSA-N 0.000 description 2
- KGIJOOYOSFUGPC-XRXZHELTSA-N 5-hydroxyeicosatetraenoic acid Natural products CCCCCC=CCC=CCC=C\C=C\C(O)CCCC(O)=O KGIJOOYOSFUGPC-XRXZHELTSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical class [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 201000001320 Atherosclerosis Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 208000035143 Bacterial infection Diseases 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 102000003820 Lipoxygenases Human genes 0.000 description 2
- 108090000128 Lipoxygenases Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- 150000001204 N-oxides Chemical class 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 238000007239 Wittig reaction Methods 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 230000000767 anti-ulcer Effects 0.000 description 2
- 208000006673 asthma Diseases 0.000 description 2
- 208000022362 bacterial infectious disease Diseases 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical class OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 150000003943 catecholamines Chemical class 0.000 description 2
- 210000004027 cell Anatomy 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000002934 diuretic Substances 0.000 description 2
- MGLDCXPLYOWQRP-UHFFFAOYSA-N eicosa-5,8,11,14-tetraynoic acid Chemical compound CCCCCC#CCC#CCC#CCC#CCCCC(O)=O MGLDCXPLYOWQRP-UHFFFAOYSA-N 0.000 description 2
- KAQKFAOMNZTLHT-VVUHWYTRSA-N epoprostenol Chemical compound O1C(=CCCCC(O)=O)C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCC)[C@H](O)C[C@@H]21 KAQKFAOMNZTLHT-VVUHWYTRSA-N 0.000 description 2
- 229960001123 epoprostenol Drugs 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- 210000003630 histaminocyte Anatomy 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000004957 immunoregulator effect Effects 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 230000037353 metabolic pathway Effects 0.000 description 2
- 239000011259 mixed solution Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- IHSLHAZEJBXKMN-UHFFFAOYSA-L potassium nitrosodisulfonate Chemical compound [K+].[K+].[O-]S(=O)(=O)N([O])S([O-])(=O)=O IHSLHAZEJBXKMN-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical class OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 238000006462 rearrangement reaction Methods 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical class OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 238000007142 ring opening reaction Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 229910001494 silver tetrafluoroborate Inorganic materials 0.000 description 2
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- UDYFLDICVHJSOY-UHFFFAOYSA-N sulfur trioxide-pyridine complex Substances O=S(=O)=O.C1=CC=NC=C1 UDYFLDICVHJSOY-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- OYHQOLUKZRVURQ-NTGFUMLPSA-N (9Z,12Z)-9,10,12,13-tetratritiooctadeca-9,12-dienoic acid Chemical compound C(CCCCCCC\C(=C(/C\C(=C(/CCCCC)\[3H])\[3H])\[3H])\[3H])(=O)O OYHQOLUKZRVURQ-NTGFUMLPSA-N 0.000 description 1
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 1
- VRAYJOQQHSEFRW-UHFFFAOYSA-N 1-(12-iodododeca-5,8-diynyl)-2,5-dimethoxy-3,4,6-trimethylbenzene Chemical compound COC1=C(C)C(C)=C(OC)C(CCCCC#CCC#CCCCI)=C1C VRAYJOQQHSEFRW-UHFFFAOYSA-N 0.000 description 1
- DRENQVRREOENIX-UHFFFAOYSA-N 1-(4-iodobutyl)-2,3,4,5-tetramethoxy-6-methylbenzene Chemical compound COC1=C(C)C(CCCCI)=C(OC)C(OC)=C1OC DRENQVRREOENIX-UHFFFAOYSA-N 0.000 description 1
- HZOFBXKBERITFC-UHFFFAOYSA-N 1-(4-iodobutyl)-2,5-dimethoxy-3,4,6-trimethylbenzene Chemical compound COC1=C(C)C(C)=C(OC)C(CCCCI)=C1C HZOFBXKBERITFC-UHFFFAOYSA-N 0.000 description 1
- XUGIOZVPOZAKCW-UHFFFAOYSA-N 1-(6-iodo-3-methylhex-2-enyl)-3,4-dimethoxy-2,5-bis(methoxymethoxy)-6-methylbenzene Chemical compound COCOC1=C(C)C(CC=C(C)CCCI)=C(OCOC)C(OC)=C1OC XUGIOZVPOZAKCW-UHFFFAOYSA-N 0.000 description 1
- IZJBNKRULYAJKJ-UHFFFAOYSA-N 10-(2,3,4,5-tetramethoxy-6-methylphenyl)dec-5-yn-1-ol Chemical compound COC1=C(C)C(CCCCC#CCCCCO)=C(OC)C(OC)=C1OC IZJBNKRULYAJKJ-UHFFFAOYSA-N 0.000 description 1
- XEWUEFSFOQJCHJ-UHFFFAOYSA-N 10-(2,5-dimethoxy-3,4,6-trimethylphenyl)deca-2,5-diyn-1-ol Chemical compound COC1=C(C)C(C)=C(OC)C(CCCCC#CCC#CCO)=C1C XEWUEFSFOQJCHJ-UHFFFAOYSA-N 0.000 description 1
- REYCLLSFMNQHFI-UHFFFAOYSA-N 12-(1,4-dimethoxy-3-methylnaphthalen-2-yl)dodeca-2,7-diyn-1-ol Chemical compound C1=CC=C2C(OC)=C(C)C(CCCCC#CCCCC#CCO)=C(OC)C2=C1 REYCLLSFMNQHFI-UHFFFAOYSA-N 0.000 description 1
- PCJKFOQMVSJNAH-UHFFFAOYSA-N 12-(2,3,4,5-tetramethoxy-6-methylphenyl)dodeca-4,7-diyn-1-ol Chemical compound COC1=C(C)C(CCCCC#CCC#CCCCO)=C(OC)C(OC)=C1OC PCJKFOQMVSJNAH-UHFFFAOYSA-N 0.000 description 1
- PZUWNTKOSNWAJU-UHFFFAOYSA-N 13-(2,5-dimethoxy-3,4,6-trimethylphenyl)trideca-5,8-diynenitrile Chemical compound COC1=C(C)C(C)=C(OC)C(CCCCC#CCC#CCCCC#N)=C1C PZUWNTKOSNWAJU-UHFFFAOYSA-N 0.000 description 1
- VZTNHHQJBMYDSG-UHFFFAOYSA-N 2-(10-hydroxydec-5-ynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=C(C)C(=O)C(CCCCC#CCCCCO)=C(C)C1=O VZTNHHQJBMYDSG-UHFFFAOYSA-N 0.000 description 1
- OBJHVGGCGMODAI-UHFFFAOYSA-N 2-(2,3,4,5-tetramethoxy-6-methylphenyl)oxolane Chemical compound COC1=C(OC)C(OC)=C(C)C(C2OCCC2)=C1OC OBJHVGGCGMODAI-UHFFFAOYSA-N 0.000 description 1
- JJCMVTXJDJQHKA-UHFFFAOYSA-N 2-(4-hydroxybutyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=C(C)C(=O)C(CCCCO)=C(C)C1=O JJCMVTXJDJQHKA-UHFFFAOYSA-N 0.000 description 1
- KDFSPVDOISNFFO-UHFFFAOYSA-N 2-(4-hydroxybutyl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione Chemical compound COC1=C(OC)C(=O)C(CCCCO)=C(C)C1=O KDFSPVDOISNFFO-UHFFFAOYSA-N 0.000 description 1
- PNDBLWYXQSXNKD-UHFFFAOYSA-N 2-(9-hydroxynon-5-ynyl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione Chemical compound CC1=C(C)C(=O)C(CCCCC#CCCCO)=C(C)C1=O PNDBLWYXQSXNKD-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- IWHSQNGGSLOCBM-UHFFFAOYSA-N 4-(1,4-dimethoxy-3-methylnaphthalen-2-yl)butan-1-ol Chemical compound C1=CC=C2C(OC)=C(C)C(CCCCO)=C(OC)C2=C1 IWHSQNGGSLOCBM-UHFFFAOYSA-N 0.000 description 1
- YRKWNLAOKMSIPA-UHFFFAOYSA-N 4-(2,3,4,5-tetramethoxy-6-methylphenyl)butanal Chemical compound COC1=C(C)C(CCCC=O)=C(OC)C(OC)=C1OC YRKWNLAOKMSIPA-UHFFFAOYSA-N 0.000 description 1
- YWKMOJRCHGFBJT-UHFFFAOYSA-N 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)butan-1-ol Chemical compound COC1=C(C)C(C)=C(OC)C(CCCCO)=C1C YWKMOJRCHGFBJT-UHFFFAOYSA-N 0.000 description 1
- SLMIZMHERCJGCI-UHFFFAOYSA-N 4-(2,5-dimethoxy-3,4,6-trimethylphenyl)butanal Chemical compound COC1=C(C)C(C)=C(OC)C(CCCC=O)=C1C SLMIZMHERCJGCI-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- JUWYRPZTZSWLCY-UHFFFAOYSA-N 5-carboxypentyl(triphenyl)phosphanium;bromide Chemical compound [Br-].C=1C=CC=CC=1[P+](C=1C=CC=CC=1)(CCCCCC(=O)O)C1=CC=CC=C1 JUWYRPZTZSWLCY-UHFFFAOYSA-N 0.000 description 1
- LMIQERWZRIFWNZ-UHFFFAOYSA-N 5-hydroxyindole Chemical compound OC1=CC=C2NC=CC2=C1 LMIQERWZRIFWNZ-UHFFFAOYSA-N 0.000 description 1
- OFCPMJGTZUVUSM-UHFFFAOYSA-N 6-heptynoic acid Chemical compound OC(=O)CCCCC#C OFCPMJGTZUVUSM-UHFFFAOYSA-N 0.000 description 1
- YWEUDYGPLZGJPB-UHFFFAOYSA-N 7-(2,3,4,5-tetramethoxy-6-methylphenyl)hept-2-yn-1-ol Chemical compound COC1=C(C)C(CCCCC#CCO)=C(OC)C(OC)=C1OC YWEUDYGPLZGJPB-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 206010008132 Cerebral thrombosis Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- 239000004129 EU approved improving agent Substances 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 201000001429 Intracranial Thrombosis Diseases 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 108010058846 Ovalbumin Proteins 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 102000004005 Prostaglandin-endoperoxide synthases Human genes 0.000 description 1
- 108090000459 Prostaglandin-endoperoxide synthases Proteins 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- JAZBEHYOTPTENJ-JLNKQSITSA-N all-cis-5,8,11,14,17-icosapentaenoic acid Chemical compound CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O JAZBEHYOTPTENJ-JLNKQSITSA-N 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 description 1
- 235000020661 alpha-linolenic acid Nutrition 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000003064 anti-oxidating effect Effects 0.000 description 1
- 239000000043 antiallergic agent Substances 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000000427 antigen Substances 0.000 description 1
- 102000036639 antigens Human genes 0.000 description 1
- 108091007433 antigens Proteins 0.000 description 1
- 239000002220 antihypertensive agent Substances 0.000 description 1
- 229940030600 antihypertensive agent Drugs 0.000 description 1
- 229960004676 antithrombotic agent Drugs 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000006701 autoxidation reaction Methods 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 150000004054 benzoquinones Chemical class 0.000 description 1
- 238000005574 benzylation reaction Methods 0.000 description 1
- 210000001772 blood platelet Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- OTJZCIYGRUNXTP-UHFFFAOYSA-N but-3-yn-1-ol Chemical compound OCCC#C OTJZCIYGRUNXTP-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 150000001785 cerium compounds Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 229910001431 copper ion Inorganic materials 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 210000004351 coronary vessel Anatomy 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007123 defense Effects 0.000 description 1
- 230000006326 desulfonation Effects 0.000 description 1
- 238000005869 desulfonation reaction Methods 0.000 description 1
- HOBAELRKJCKHQD-QNEBEIHSSA-N dihomo-γ-linolenic acid Chemical compound CCCCC\C=C/C\C=C/C\C=C/CCCCCCC(O)=O HOBAELRKJCKHQD-QNEBEIHSSA-N 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229960005135 eicosapentaenoic acid Drugs 0.000 description 1
- JAZBEHYOTPTENJ-UHFFFAOYSA-N eicosapentaenoic acid Natural products CCC=CCC=CCC=CCC=CCC=CCCCC(O)=O JAZBEHYOTPTENJ-UHFFFAOYSA-N 0.000 description 1
- 235000020673 eicosapentaenoic acid Nutrition 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCNWZGXOWHXIJE-UHFFFAOYSA-N ethoxyethane;oxane Chemical compound CCOCC.C1CCOCC1 CCNWZGXOWHXIJE-UHFFFAOYSA-N 0.000 description 1
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 210000000224 granular leucocyte Anatomy 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000003022 immunostimulating agent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 210000000265 leukocyte Anatomy 0.000 description 1
- 229960004488 linolenic acid Drugs 0.000 description 1
- KQQKGWQCNNTQJW-UHFFFAOYSA-N linolenic acid Natural products CC=CCCC=CCC=CCCCCCCCC(O)=O KQQKGWQCNNTQJW-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 208000011906 peptic ulcer disease Diseases 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- 230000002633 protecting effect Effects 0.000 description 1
- CHGYKYXGIWNSCD-UHFFFAOYSA-N pyridine-2,4,6-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=NC(C(O)=O)=C1 CHGYKYXGIWNSCD-UHFFFAOYSA-N 0.000 description 1
- GJAWHXHKYYXBSV-UHFFFAOYSA-N pyridinedicarboxylic acid Natural products OC(=O)C1=CC=CN=C1C(O)=O GJAWHXHKYYXBSV-UHFFFAOYSA-N 0.000 description 1
- 229940079877 pyrogallol Drugs 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 229940100890 silver compound Drugs 0.000 description 1
- 150000003379 silver compounds Chemical class 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- DSBZYDDWLLIJJS-UHFFFAOYSA-N ubiquinol-0 Chemical compound COC1=C(O)C=C(C)C(O)=C1OC DSBZYDDWLLIJJS-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/225—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
- C07C46/02—Preparation of quinones by oxidation giving rise to quinoid structures
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C46/00—Preparation of quinones
- C07C46/02—Preparation of quinones by oxidation giving rise to quinoid structures
- C07C46/06—Preparation of quinones by oxidation giving rise to quinoid structures of at least one hydroxy group on a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/20—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms
- C07C47/277—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C50/00—Quinones
- C07C50/02—Quinones with monocyclic quinoid structure
- C07C50/06—Quinones with monocyclic quinoid structure with unsaturation outside the quinoid structure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C50/00—Quinones
- C07C50/10—Quinones the quinoid structure being part of a condensed ring system containing two rings
- C07C50/14—Quinones the quinoid structure being part of a condensed ring system containing two rings with unsaturation outside the ring system, e.g. vitamin K1
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C50/00—Quinones
- C07C50/26—Quinones containing groups having oxygen atoms singly bound to carbon atoms
- C07C50/28—Quinones containing groups having oxygen atoms singly bound to carbon atoms with monocyclic quinoid structure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C50/00—Quinones
- C07C50/26—Quinones containing groups having oxygen atoms singly bound to carbon atoms
- C07C50/32—Quinones containing groups having oxygen atoms singly bound to carbon atoms the quinoid structure being part of a condensed ring system having two rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C66/00—Quinone carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D309/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings
- C07D309/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D309/08—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only ring hetero atom, not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D309/10—Oxygen atoms
- C07D309/12—Oxygen atoms only hydrogen atoms and one oxygen atom directly attached to ring carbon atoms, e.g. tetrahydropyranyl ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (6)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
JP4943380A JPS56145280A (en) | 1980-04-14 | 1980-04-14 | Production of phenolic compound |
JP49433/1980 | 1980-04-14 | ||
JP5846480A JPS56154433A (en) | 1980-04-30 | 1980-04-30 | Quinone compound and its preparation |
JP58464/1980 | 1980-04-30 | ||
JP186622/1980 | 1980-12-27 | ||
JP55186622A JPS57109739A (en) | 1980-12-27 | 1980-12-27 | Quinone compound and its preparation |
Publications (1)
Publication Number | Publication Date |
---|---|
CA1168242A true CA1168242A (en) | 1984-05-29 |
Family
ID=27293638
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA000375297A Expired CA1168242A (en) | 1980-04-14 | 1981-04-13 | Quinone compounds, their production and use |
Country Status (8)
Country | Link |
---|---|
US (1) | US4393075A (forum.php) |
EP (1) | EP0038160B1 (forum.php) |
AT (1) | ATE9461T1 (forum.php) |
CA (1) | CA1168242A (forum.php) |
DE (1) | DE3166116D1 (forum.php) |
GB (1) | GB2074158B (forum.php) |
HK (1) | HK22187A (forum.php) |
MY (1) | MY8500592A (forum.php) |
Families Citing this family (38)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
JPS58177934A (ja) * | 1982-04-13 | 1983-10-18 | Takeda Chem Ind Ltd | ベンゾキノン誘導体 |
US4808339A (en) * | 1982-04-13 | 1989-02-28 | Takeda Chemical Industries, Ltd. | Benzoquinone derivatives |
EP0103361B1 (en) * | 1982-07-09 | 1986-01-29 | Takeda Chemical Industries, Ltd. | Quinone compounds, their production and use |
JPS5910541A (ja) * | 1982-07-09 | 1984-01-20 | Takeda Chem Ind Ltd | キノン化合物 |
US5135940A (en) * | 1982-09-23 | 1992-08-04 | Merck Frosst Canada, Inc. | Leukotriene antagonists |
US4849445A (en) * | 1983-12-14 | 1989-07-18 | The Upjohn Company | Method for treating or preventing deep vein thrombosis using lipoxygenase inhibitors |
US4791138A (en) * | 1983-12-14 | 1988-12-13 | The Upjohn Company | Method for treating or preventing deep vein thrombosis using lipoxygenase inhibitors |
US4849442A (en) * | 1983-12-14 | 1989-07-18 | The Upjohn Company | Method for treating or preventing deep vein thrombosis using lipoxygenase inhibitors |
US4737519A (en) * | 1983-12-14 | 1988-04-12 | The Upjohn Company | Substituted naphthalenes, indoles, benzofurans, and benzothiophenes as lipoxygenase inhibitors |
ES8702330A1 (es) * | 1984-01-26 | 1986-12-16 | Otsuka Pharma Co Ltd | Un procedimiento para preparar un derivado de 1,4-benzoquinona. |
US5220042A (en) * | 1984-01-26 | 1993-06-15 | Otsuka Pharmaceutical Co., Ltd. | 1,4-benzoquinone derivatives and benzene derivatives, and process for preparing the same |
US5304658A (en) * | 1984-08-01 | 1994-04-19 | Takeda Chemical Industries, Ltd. | Quinone derivatives, their production and use |
MX9203040A (es) * | 1984-08-01 | 1992-07-31 | Takeda Chemical Industries Ltd | Derivados de quinona y composicion farmaceutica que los contiene. |
DE3518655A1 (de) * | 1985-05-24 | 1986-11-27 | Grünenthal GmbH, 5190 Stolberg | Neue phenolderivate, diese enthaltende arzneimittel und verfahren zur herstellung dieser verbindungen und arzneimittel |
WO1987001698A2 (en) * | 1985-09-20 | 1987-03-26 | The Upjohn Company | 1,4-naphthalenediol and 1,4-hydroquinone derivatives |
IL81264A (en) * | 1986-01-30 | 1990-11-05 | Takeda Chemical Industries Ltd | Quinone derivatives,their production and pharmaceutical compositions containing them |
US5229385A (en) * | 1986-01-30 | 1993-07-20 | Takeda Chemical Industries, Ltd. | Quinone derivatives, their production and use |
JPH0637388B2 (ja) * | 1986-02-17 | 1994-05-18 | 千寿製薬株式会社 | 水性液剤 |
US4761403A (en) * | 1986-04-09 | 1988-08-02 | Abbott Laboratories | Lipoxygenase inhibiting compounds |
IL78611A0 (en) * | 1986-04-23 | 1986-08-31 | Yeda Res & Dev | Production of polyprenoid and ubiquinone-type compounds |
EP0304842B1 (en) * | 1987-08-25 | 1994-11-30 | Nisshin Flour Milling Co., Ltd. | Isoprenoid derivatives and anti-ulcer agents containing the same |
US5068251A (en) * | 1988-12-16 | 1991-11-26 | Abbott Laboratories | Lipoxygenase inhibiting compounds |
US4963541A (en) * | 1989-02-22 | 1990-10-16 | Abbott Laboratories | Pyrimido-pyrimidine lipoxygenase inhibiting compounds |
JPH08768B2 (ja) * | 1989-08-24 | 1996-01-10 | 武田薬品工業株式会社 | 神経成長因子分泌誘導剤 |
US5032588A (en) * | 1989-12-08 | 1991-07-16 | Abbott Laboratories | Thiazole lipoxygenase-inhibiting compounds derived from non-steroidal antiinflammatory carboxylic acids |
EP0560568A3 (en) * | 1992-03-13 | 1994-06-29 | Takeda Chemical Industries Ltd | Hydroquinone derivatives and intermediates for production thereof |
GB2309455A (en) * | 1996-01-26 | 1997-07-30 | Dong Kook Pharm Co Ltd | 2-Chloro-3-arylamino-1,4-naphthoquinone derivatives, process for their preparation and their use as an agent for inhibiting platelet aggregation |
GB9613309D0 (en) * | 1996-06-25 | 1996-08-28 | Univ Sheffield | Quinone bacterial inhibitors |
US6653311B1 (en) | 2002-06-25 | 2003-11-25 | Board Of Supervisors Of Louisiana State University | 5-lipoxygenase inhibitors: (2-azinylamino) quinone derivatives |
US20040198800A1 (en) * | 2002-12-19 | 2004-10-07 | Geoffrey Allan | Lipoxygenase inhibitors as hypolipidemic and anti-hypertensive agents |
WO2005122670A2 (en) * | 2004-06-18 | 2005-12-29 | Kardol Indústria Química Ltda. | Biomonitored synthesis route for large scale preparation of cardol (bilobol) and 11δ-cardol |
WO2006130775A2 (en) * | 2005-06-01 | 2006-12-07 | Edison Pharmaceuticals, Inc. | Redox-active therapeutics for treatment of mitochondrial diseases and other conditions and modulation of energy biomakers |
JP2009508867A (ja) * | 2005-09-15 | 2009-03-05 | エジソン ファーマシューティカルズ, インコーポレイテッド | ミトコンドリア病および関連した様態の治療ならびにエネルギーバイオマーカーの調節のための酸化還元活性治療剤のテイル改変体 |
JP5374162B2 (ja) | 2006-02-22 | 2013-12-25 | エジソン ファーマシューティカルズ, インコーポレイテッド | ミトコンドリア病および他の症状の処置のためのレドックス活性化治療の側鎖変異体およびエネルギーバイオマーカーの調節 |
EP3827815B1 (en) | 2008-09-10 | 2023-09-06 | PTC Therapeutics, Inc. | Treatment of pervasive developmental disorders with redox-active therapeutics |
US8263094B2 (en) * | 2008-09-23 | 2012-09-11 | Eastman Chemical Company | Esters of 4,5-disubstituted-oxy-2-methyl-3,6-dioxo-cyclohexa-1,4-dienyl alkyl acids and preparation thereof |
CA2883879A1 (en) | 2012-09-07 | 2014-03-13 | Edison Pharmaceuticals, Inc. | Quinone derivatives for use in the modulation of redox status of individuals |
MX391378B (es) | 2015-12-17 | 2025-03-21 | Ptc Therapeutics Inc | Derivados de fluoroalquil-, fluoroalcoxi-, fenoxi-, heteroariloxi-, alcoxi- y amina-1,4-benzoquinona para tratamiento de trastornos de estres oxidativo. |
Family Cites Families (5)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
NL127780C (forum.php) * | 1959-10-09 | |||
GB1147612A (en) * | 1965-04-07 | 1969-04-02 | Takeda Chemical Industries Ltd | Compositions for the treatment of peptic ulcers |
US3728362A (en) * | 1970-02-07 | 1973-04-17 | Takeda Chemical Industries Ltd | (3-methyl-5-carboxy-2-pentenyl)quinones |
US3894153A (en) * | 1972-11-02 | 1975-07-08 | Eisai Co Ltd | Method of medical treatment of asthma |
JPS5919930B2 (ja) * | 1974-05-02 | 1984-05-09 | 武田薬品工業株式会社 | キノン酸誘導体の製造法 |
-
1981
- 1981-03-26 US US06/248,042 patent/US4393075A/en not_active Expired - Lifetime
- 1981-04-07 DE DE8181301498T patent/DE3166116D1/de not_active Expired
- 1981-04-07 EP EP81301498A patent/EP0038160B1/en not_active Expired
- 1981-04-07 AT AT81301498T patent/ATE9461T1/de not_active IP Right Cessation
- 1981-04-07 GB GB8110909A patent/GB2074158B/en not_active Expired
- 1981-04-13 CA CA000375297A patent/CA1168242A/en not_active Expired
-
1985
- 1985-12-30 MY MY592/85A patent/MY8500592A/xx unknown
-
1987
- 1987-03-12 HK HK221/87A patent/HK22187A/xx not_active IP Right Cessation
Also Published As
Publication number | Publication date |
---|---|
MY8500592A (en) | 1985-12-31 |
GB2074158B (en) | 1984-02-15 |
HK22187A (en) | 1987-03-20 |
GB2074158A (en) | 1981-10-28 |
EP0038160A1 (en) | 1981-10-21 |
EP0038160B1 (en) | 1984-09-19 |
US4393075A (en) | 1983-07-12 |
US4393075B1 (forum.php) | 1989-07-04 |
ATE9461T1 (de) | 1984-10-15 |
DE3166116D1 (en) | 1984-10-25 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CA1168242A (en) | Quinone compounds, their production and use | |
Shiraishi et al. | Quinones. 4. Novel eicosanoid antagonists: synthesis and pharmacological evaluation | |
EP0237986B1 (en) | Flavone carboxylic acid derivatives | |
CA1302417C (en) | 2-substituted-1-naphthols as 5-lipoxygenase inhibitors | |
US5220042A (en) | 1,4-benzoquinone derivatives and benzene derivatives, and process for preparing the same | |
JPS5825651B2 (ja) | 多環状キノノイド抗生物質用中間体 | |
Vankar et al. | Regioselective reductions of 2, 3-epoxy acetals with zinc-chlorotrimethylsilane and lithium aluminium hydride: convenient synthesis of 1, 2 and 1, 3-diones | |
Terao et al. | Quinones. Part 2. General synthetic routes to quinone derivatives with modified polyprenyl side chains and the inhibitory effects of these quinones on the generation of the slow reacting substance of anaphylaxis (SRS-A) | |
US4851586A (en) | 1,4-naphthalenediol and 1,4-hydroquinone derivatives | |
Sviridov et al. | Stereocontrolled synthesis of erythronolides A and B in A (C5-C9)+(C3-C4)+(C1-C2)+(C11-C13) sequence from 1, 6-anhydro-β-D-glucopyranose (levoglucosan). Part 2. | |
Fukumoto et al. | Synthesis and thromboxane A2/prostaglandin H2 receptor antagonistic activity of phenol derivatives | |
US4939169A (en) | 1,4-naphthalenediol and 1,4-hydroquinone derivatives | |
KR840001717B1 (ko) | 퀴논 화합물의 제조 방법 | |
US6057461A (en) | Method for preparing substituted anthraquinone and application to the preparation of rheins | |
EP0000152B1 (en) | Oxaminic acids and esters, process for their preparation and pharmaceutical compositions containing them | |
WO1986004058A1 (en) | Quinone derivatives, process for their preparation, and medicinal composition containing same | |
US5032606A (en) | Novel fluorinated resorcinol ethers and their use as anti-allergics and anti-inflammatories | |
Makriyannis et al. | 3-Phenyl-5-quinolinemethanol antimalarials | |
JPS601292B2 (ja) | ジハイドロコエンザイムq類化合物の合成法 | |
EP0151995B1 (en) | Novel 1,4-benzoquinone derivatives and benzene derivatives, and process for preparing the same | |
JPS61118346A (ja) | ω−(ジヒドロキシフエニル)アルカンカルボン酸誘導体 | |
US3723547A (en) | Polysubstituted dihydropyrenes | |
WO1991005757A1 (en) | Lipoxygenase inhibitors | |
EP0059094B1 (en) | Novel cycloheptanes | |
CA1194021A (en) | Heteroprostaglandin derivatives and processes for preparing them |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
MKEX | Expiry |