CA1156657A - Process for the preparation of pharmacologically active carbostyril derivatives - Google Patents
Process for the preparation of pharmacologically active carbostyril derivativesInfo
- Publication number
- CA1156657A CA1156657A CA000355992A CA355992A CA1156657A CA 1156657 A CA1156657 A CA 1156657A CA 000355992 A CA000355992 A CA 000355992A CA 355992 A CA355992 A CA 355992A CA 1156657 A CA1156657 A CA 1156657A
- Authority
- CA
- Canada
- Prior art keywords
- group
- reaction
- carbon atoms
- carried out
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 26
- 238000002360 preparation method Methods 0.000 title claims abstract description 10
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims abstract description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 28
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 21
- -1 hydroxy, methoxy, amino, acetyl-amino Chemical group 0.000 claims description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- 239000011541 reaction mixture Substances 0.000 claims description 15
- 229960000583 acetic acid Drugs 0.000 claims description 13
- 239000002904 solvent Substances 0.000 claims description 13
- 239000012362 glacial acetic acid Substances 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 238000009835 boiling Methods 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 229910052751 metal Inorganic materials 0.000 claims description 6
- 239000002184 metal Substances 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 238000011065 in-situ storage Methods 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 4
- 125000006839 xylylene group Chemical group 0.000 claims description 4
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 3
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 claims description 3
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 3
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 239000000010 aprotic solvent Substances 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 239000002585 base Substances 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 125000004475 heteroaralkyl group Chemical group 0.000 claims 1
- 230000002785 anti-thrombosis Effects 0.000 abstract description 2
- 230000000144 pharmacologic effect Effects 0.000 abstract description 2
- 230000009090 positive inotropic effect Effects 0.000 abstract description 2
- 125000004095 oxindolyl group Chemical class N1(C(CC2=CC=CC=C12)=O)* 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 230000000875 corresponding effect Effects 0.000 description 17
- 239000000203 mixture Substances 0.000 description 15
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 14
- 230000009467 reduction Effects 0.000 description 11
- 238000006722 reduction reaction Methods 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- 229960001701 chloroform Drugs 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 8
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 description 7
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 239000007921 spray Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 229940095076 benzaldehyde Drugs 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 150000002828 nitro derivatives Chemical class 0.000 description 4
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 4
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 4
- SPWWWLCTUNXBRR-UHFFFAOYSA-N 3-(5-hydroxy-2-nitrophenyl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC(O)=CC=C1[N+]([O-])=O SPWWWLCTUNXBRR-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229940046892 lead acetate Drugs 0.000 description 3
- RGHZFRRLCRAWPU-UHFFFAOYSA-N methyl 3-(5-hydroxy-2-nitrophenyl)prop-2-enoate Chemical compound COC(=O)C=CC1=CC(O)=CC=C1[N+]([O-])=O RGHZFRRLCRAWPU-UHFFFAOYSA-N 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229960001866 silicon dioxide Drugs 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- BXXWFOGWXLJPPA-UHFFFAOYSA-N 2,3-dibromobutane Chemical compound CC(Br)C(C)Br BXXWFOGWXLJPPA-UHFFFAOYSA-N 0.000 description 2
- UNSRBMRZUQKJMV-UHFFFAOYSA-N 2-nitro-5-(4-pyridin-2-ylsulfanylbutoxy)benzaldehyde Chemical compound C1=C(C=O)C([N+](=O)[O-])=CC=C1OCCCCSC1=CC=CC=N1 UNSRBMRZUQKJMV-UHFFFAOYSA-N 0.000 description 2
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 239000011981 lindlar catalyst Substances 0.000 description 2
- KHYJWJQEQGMQOT-UHFFFAOYSA-N methyl 3-[2-nitro-5-(4-pyridin-2-ylsulfonylbutoxy)phenyl]prop-2-enoate Chemical compound COC(C=CC1=C(C=CC(=C1)OCCCCS(=O)(=O)C1=NC=CC=C1)[N+](=O)[O-])=O KHYJWJQEQGMQOT-UHFFFAOYSA-N 0.000 description 2
- RIJAFJFYYMYUJM-UHFFFAOYSA-N methyl 3-[5-(4-bromobutoxy)-2-nitrophenyl]prop-2-enoate Chemical compound COC(=O)C=CC1=CC(OCCCCBr)=CC=C1[N+]([O-])=O RIJAFJFYYMYUJM-UHFFFAOYSA-N 0.000 description 2
- 229960004109 potassium acetate Drugs 0.000 description 2
- 235000011056 potassium acetate Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- WHMDPDGBKYUEMW-UHFFFAOYSA-N pyridine-2-thiol Chemical compound SC1=CC=CC=N1 WHMDPDGBKYUEMW-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011592 zinc chloride Substances 0.000 description 2
- 235000005074 zinc chloride Nutrition 0.000 description 2
- ZHSJYOOSMOOIGM-UHFFFAOYSA-N 2-amino-5-(4-pyridin-2-ylsulfonylbutoxy)benzaldehyde Chemical compound C1=C(C=O)C(N)=CC=C1OCCCCS(=O)(=O)C1=CC=CC=N1 ZHSJYOOSMOOIGM-UHFFFAOYSA-N 0.000 description 1
- UEEMWZOYWPDOKS-UHFFFAOYSA-N 2-nitro-5-(4-pyridin-2-ylsulfonylbutoxy)benzaldehyde Chemical compound C1=C(C=O)C([N+](=O)[O-])=CC=C1OCCCCS(=O)(=O)C1=CC=CC=N1 UEEMWZOYWPDOKS-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 description 1
- ADSNHKTXYJZXDF-UHFFFAOYSA-N 3-hydroxy-2-nitrobenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1[N+]([O-])=O ADSNHKTXYJZXDF-UHFFFAOYSA-N 0.000 description 1
- SRGYBRHWRBDUJM-UHFFFAOYSA-N 4-(4-bromobutylsulfanyl)-1,2-dichlorobenzene Chemical compound ClC1=CC=C(SCCCCBr)C=C1Cl SRGYBRHWRBDUJM-UHFFFAOYSA-N 0.000 description 1
- ICFZWESBQTTYOC-UHFFFAOYSA-N 4-(4-bromobutylsulfinyl)-1,2-dichlorobenzene Chemical compound ClC1=CC=C(S(=O)CCCCBr)C=C1Cl ICFZWESBQTTYOC-UHFFFAOYSA-N 0.000 description 1
- AJRIOFDACOMVOP-UHFFFAOYSA-N 5-(4-bromobutoxy)-2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(OCCCCBr)C=C1C=O AJRIOFDACOMVOP-UHFFFAOYSA-N 0.000 description 1
- UTTJAIFHRUAFED-UHFFFAOYSA-N 5-hydroxy-3,4-dihydro-2(1h)-quinolinone Chemical compound N1C(=O)CCC2=C1C=CC=C2O UTTJAIFHRUAFED-UHFFFAOYSA-N 0.000 description 1
- WMNKNHUCSKDKMK-UHFFFAOYSA-N 6-(4-bromobutoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(OCCCCBr)=CC=C21 WMNKNHUCSKDKMK-UHFFFAOYSA-N 0.000 description 1
- JHUJKRAUGIIXKK-UHFFFAOYSA-N 6-(4-pyridin-2-ylsulfinylbutoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCCS(=O)C1=CC=CC=N1 JHUJKRAUGIIXKK-UHFFFAOYSA-N 0.000 description 1
- UXBIFQZFTVFCDC-UHFFFAOYSA-N 6-(4-pyridin-2-ylsulfonylbutoxy)-1h-quinolin-2-one Chemical compound C1=CC2=NC(O)=CC=C2C=C1OCCCCS(=O)(=O)C1=CC=CC=N1 UXBIFQZFTVFCDC-UHFFFAOYSA-N 0.000 description 1
- KBVIQLRCIJFIMF-UHFFFAOYSA-N 6-(4-pyridin-2-ylsulfonylbutoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCCS(=O)(=O)C1=CC=CC=N1 KBVIQLRCIJFIMF-UHFFFAOYSA-N 0.000 description 1
- RDJSMZHIMWPJCI-UHFFFAOYSA-N 6-[4-(3,4-dichlorophenyl)sulfinylbutoxy]-1h-quinolin-2-one Chemical compound C1=C(Cl)C(Cl)=CC=C1S(=O)CCCCOC1=CC=C(NC(=O)C=C2)C2=C1 RDJSMZHIMWPJCI-UHFFFAOYSA-N 0.000 description 1
- GITZAIRZLBVXDF-UHFFFAOYSA-N 6-[4-(4-amino-3,5-dibromophenyl)sulfinylbutoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(Br)C(N)=C(Br)C=C1S(=O)CCCCOC1=CC=C(NC(=O)CC2)C2=C1 GITZAIRZLBVXDF-UHFFFAOYSA-N 0.000 description 1
- NMUWLPZCRYURDW-UHFFFAOYSA-N 6-[4-(4-cyclohexylphenyl)sulfinylbutoxy]-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCCS(=O)C(C=C1)=CC=C1C1CCCCC1 NMUWLPZCRYURDW-UHFFFAOYSA-N 0.000 description 1
- DVHFRAJZCBPZIP-UHFFFAOYSA-N 6-[4-(benzenesulfinyl)butoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCCS(=O)C1=CC=CC=C1 DVHFRAJZCBPZIP-UHFFFAOYSA-N 0.000 description 1
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 description 1
- LKLSFDWYIBUGNT-UHFFFAOYSA-N 7-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(O)=CC=C21 LKLSFDWYIBUGNT-UHFFFAOYSA-N 0.000 description 1
- UDKMDIKMJWOSJP-UHFFFAOYSA-N 8-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C=CC=C2O UDKMDIKMJWOSJP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BQFYGQSOQVOJAS-UHFFFAOYSA-N C(O)(O)=O.[N+](=O)([O-])C1=C(C=O)C=C(C=C1)O Chemical compound C(O)(O)=O.[N+](=O)([O-])C1=C(C=O)C=C(C=C1)O BQFYGQSOQVOJAS-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- SURQXAFEQWPFPV-UHFFFAOYSA-L iron(2+) sulfate heptahydrate Chemical compound O.O.O.O.O.O.O.[Fe+2].[O-]S([O-])(=O)=O SURQXAFEQWPFPV-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- ILAIRHNIGUVLCZ-UHFFFAOYSA-N methyl 3-[2-nitro-5-(4-pyridin-2-ylsulfanylbutoxy)phenyl]prop-2-enoate Chemical compound COC(C=CC1=C(C=CC(=C1)OCCCCSC1=NC=CC=C1)[N+](=O)[O-])=O ILAIRHNIGUVLCZ-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 229960003975 potassium Drugs 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940001593 sodium carbonate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- CMXPERZAMAQXSF-UHFFFAOYSA-M sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,8-dihydroxyanthracene-9,10-dione Chemical compound [Na+].O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2O.CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC CMXPERZAMAQXSF-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 1
- 125000004962 sulfoxyl group Chemical group 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19792928583 DE2928583A1 (de) | 1979-07-14 | 1979-07-14 | Verfahren zur herstellung von carbostyrilderivaten |
| DEP2928583.4 | 1979-07-14 | ||
| FI792426A FI70408C (fi) | 1979-07-14 | 1979-08-03 | Foerfarande foer framstaellning av terapeutiskt aktiva karbostyrilderivat |
| DE79/2426 | 1979-08-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1156657A true CA1156657A (en) | 1983-11-08 |
Family
ID=25779992
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000355992A Expired CA1156657A (en) | 1979-07-14 | 1980-07-11 | Process for the preparation of pharmacologically active carbostyril derivatives |
Country Status (5)
| Country | Link |
|---|---|
| AT (1) | AT375648B (enExample) |
| CA (1) | CA1156657A (enExample) |
| ES (3) | ES491859A0 (enExample) |
| GR (1) | GR67622B (enExample) |
| PT (1) | PT71530B (enExample) |
-
1980
- 1980-04-21 GR GR61730A patent/GR67622B/el unknown
- 1980-05-27 ES ES491859A patent/ES491859A0/es active Granted
- 1980-06-11 AT AT306480A patent/AT375648B/de not_active IP Right Cessation
- 1980-07-10 PT PT7153080A patent/PT71530B/pt unknown
- 1980-07-11 CA CA000355992A patent/CA1156657A/en not_active Expired
-
1981
- 1981-01-13 ES ES498465A patent/ES498465A0/es active Granted
- 1981-01-13 ES ES498466A patent/ES8201139A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES498466A0 (es) | 1981-12-01 |
| GR67622B (enExample) | 1981-08-31 |
| ES8200660A1 (es) | 1981-11-01 |
| AT375648B (de) | 1984-08-27 |
| ATA306480A (de) | 1984-01-15 |
| ES8201139A1 (es) | 1981-12-01 |
| ES8201138A1 (es) | 1981-12-01 |
| PT71530B (de) | 1981-12-11 |
| ES491859A0 (es) | 1981-11-01 |
| ES498465A0 (es) | 1981-12-01 |
| PT71530A (de) | 1980-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Benincori et al. | New benzimidazole synthesis | |
| NL8001771A (nl) | Nieuwe chinolonverbindingen en deze verbindingen bevattende farmaceutische preparaten. | |
| Black et al. | Reactions of ninhydrin with activated anilines: formation of indole derivatives | |
| CA1156657A (en) | Process for the preparation of pharmacologically active carbostyril derivatives | |
| US3784600A (en) | 4-substituted coumarins | |
| Tominaga et al. | Synthesis of cycl [3.2. 2] azine and benzo [g] cycl [3.2. 2] azine derivatives by use of the [2+ 8] cycloaddition reaction of indolizines and dimethyl acetylenedicarboxylate | |
| Yoneda et al. | Synthesis of 2H‐chromeno [2, 3‐d] pyrimidine‐2, 4‐(3H)‐diones (10‐Oxa‐5‐deazaflavins) and their use in the oxidation of benzyl alcohol | |
| US3772301A (en) | (4-substituted)4-(methylsulfinyl)methylcarbostyrils | |
| Miyamoto et al. | Synthesis and reactions of 7‐substituted 1‐cyclopropyl‐6‐fluoro‐1, 4‐dihydro‐4‐oxo‐1, 8‐naphthyridine‐3‐carboxylic acids as an antibacterial agent | |
| FI70408C (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva karbostyrilderivat | |
| US4769456A (en) | Sulfenamide derivatives and their production | |
| US3046275A (en) | N-substituted 2-phenyl-7-aminoalkoxy chromones | |
| US2558211A (en) | Preparation of 4-hydroxyquinoline compounds | |
| Abramovitch et al. | Base-catalyzed rearrangement of N-(aryloxy) pyridinium salts. Effect of a 3-substituent in the pyridine ring upon orientation. Synthesis of novel tricyclic rings | |
| IL93393A (en) | Process for the preparation of omicron-carboxypyridyl and omicron-carboxyquinolyl- imidazolinones | |
| US5344938A (en) | Indole 3-carboxylic acid derivatives | |
| CA1071634A (en) | Process for the preparation of tetrahydro-thieno (3, 2-c) - and (2, 3-c) pyridine derivatives | |
| US4111942A (en) | 10-Amino-5H-[1]benzopyrano[4,3-c]pyridines | |
| SU1017167A3 (ru) | Способ получени @ -5-ацетамидо-4,5,6,7-тетрагидро-2н-бензо/с/пиррола | |
| US3311641A (en) | Hydrohalides of novel cyclohepta[b]-pyrrole derivatives and a process for preparing the same as well as intermediates and process for their preparations | |
| Morisawa et al. | Studies on anticoccidial agents. 12. Synthesis and anticoccidial activity of methyl-2 (6)-nitro-and-3 (5)-nitropyridinecarboxamides | |
| Uhlmann et al. | Pteridines, LXX, Synthesis and properties of 1, 8-alkylene-bridged lumazines | |
| EP0151319B1 (en) | Hexahydrobenzo[de]quinoline derivatives and their preparation | |
| US3105076A (en) | Pyrrolylpteridine derivatives | |
| US4495354A (en) | Process for bicyclic diketones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |