CA1151337A - Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer, a polycarbonate and an amorphous polyester - Google Patents
Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer, a polycarbonate and an amorphous polyesterInfo
- Publication number
- CA1151337A CA1151337A CA000363812A CA363812A CA1151337A CA 1151337 A CA1151337 A CA 1151337A CA 000363812 A CA000363812 A CA 000363812A CA 363812 A CA363812 A CA 363812A CA 1151337 A CA1151337 A CA 1151337A
- Authority
- CA
- Canada
- Prior art keywords
- composition
- weight
- component
- parts
- polycarbonate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 65
- 229920000515 polycarbonate Polymers 0.000 title claims abstract description 33
- 239000004417 polycarbonate Substances 0.000 title claims abstract description 33
- -1 vinyl aromatic compound Chemical class 0.000 title claims description 43
- 229920002554 vinyl polymer Polymers 0.000 title claims description 6
- 229920000728 polyester Polymers 0.000 title abstract description 37
- 229920001400 block copolymer Polymers 0.000 title abstract description 28
- 229920006285 olefinic elastomer Polymers 0.000 title description 3
- 239000004431 polycarbonate resin Substances 0.000 claims abstract description 8
- 229920005668 polycarbonate resin Polymers 0.000 claims abstract description 8
- 125000003118 aryl group Chemical group 0.000 claims description 26
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 16
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 12
- 229920001577 copolymer Polymers 0.000 claims description 11
- 239000000049 pigment Substances 0.000 claims description 10
- 229920000139 polyethylene terephthalate Polymers 0.000 claims description 10
- 239000005020 polyethylene terephthalate Substances 0.000 claims description 10
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 5
- 239000002243 precursor Substances 0.000 claims description 5
- 229920001169 thermoplastic Polymers 0.000 claims description 5
- 239000004416 thermosoftening plastic Substances 0.000 claims description 5
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 4
- 239000003365 glass fiber Substances 0.000 claims description 4
- WAEOXIOXMKNFLQ-UHFFFAOYSA-N 1-methyl-4-prop-2-enylbenzene Chemical group CC1=CC=C(CC=C)C=C1 WAEOXIOXMKNFLQ-UHFFFAOYSA-N 0.000 claims description 3
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 claims description 3
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 2
- 229920001225 polyester resin Polymers 0.000 claims description 2
- 239000004645 polyester resin Substances 0.000 claims description 2
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 claims description 2
- 239000012744 reinforcing agent Substances 0.000 claims description 2
- 230000003014 reinforcing effect Effects 0.000 claims description 2
- 150000001993 dienes Chemical class 0.000 claims 2
- 239000012763 reinforcing filler Substances 0.000 claims 1
- 238000005336 cracking Methods 0.000 abstract description 9
- 230000006353 environmental stress Effects 0.000 abstract description 5
- 230000006872 improvement Effects 0.000 abstract description 3
- 239000000155 melt Substances 0.000 abstract description 3
- 229920000642 polymer Polymers 0.000 description 26
- 238000000034 method Methods 0.000 description 15
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 13
- 229920002633 Kraton (polymer) Polymers 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 230000002787 reinforcement Effects 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 229920001634 Copolyester Polymers 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 4
- 229950005499 carbon tetrachloride Drugs 0.000 description 4
- 239000003063 flame retardant Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 238000000465 moulding Methods 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 230000035882 stress Effects 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- FACXGONDLDSNOE-UHFFFAOYSA-N buta-1,3-diene;styrene Chemical class C=CC=C.C=CC1=CC=CC=C1.C=CC1=CC=CC=C1 FACXGONDLDSNOE-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 238000011068 loading method Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 239000003381 stabilizer Substances 0.000 description 3
- 238000009864 tensile test Methods 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229920004142 LEXAN™ Polymers 0.000 description 2
- 239000004418 Lexan Substances 0.000 description 2
- 239000005062 Polybutadiene Substances 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229920013623 Solprene Polymers 0.000 description 2
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- 229940106691 bisphenol a Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- KZTYYGOKRVBIMI-UHFFFAOYSA-N diphenyl sulfone Chemical compound C=1C=CC=CC=1S(=O)(=O)C1=CC=CC=C1 KZTYYGOKRVBIMI-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 229920000468 styrene butadiene styrene block copolymer Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000004408 titanium dioxide Substances 0.000 description 2
- LVLNPXCISNPHLE-UHFFFAOYSA-N (2-Hydroxy-phenyl)-(4-hydroxy-phenyl)-methan Natural products C1=CC(O)=CC=C1CC1=CC=CC=C1O LVLNPXCISNPHLE-UHFFFAOYSA-N 0.000 description 1
- ZGSHFDSKHTZINF-UHFFFAOYSA-N (2-methyl-6-phenylphenyl) hydrogen carbonate Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1OC(O)=O ZGSHFDSKHTZINF-UHFFFAOYSA-N 0.000 description 1
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical compound C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- MQCPOLNSJCWPGT-UHFFFAOYSA-N 2,2'-Bisphenol F Chemical compound OC1=CC=CC=C1CC1=CC=CC=C1O MQCPOLNSJCWPGT-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- JHOPNNNTBHXSHY-UHFFFAOYSA-N 2-(4-hydroxyphenyl)phenol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1O JHOPNNNTBHXSHY-UHFFFAOYSA-N 0.000 description 1
- RKSBPFMNOJWYSB-UHFFFAOYSA-N 3,3-Bis(4-hydroxyphenyl)pentane Chemical compound C=1C=C(O)C=CC=1C(CC)(CC)C1=CC=C(O)C=C1 RKSBPFMNOJWYSB-UHFFFAOYSA-N 0.000 description 1
- MMINFSMURORWKH-UHFFFAOYSA-N 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione Chemical compound O=C1OCCOC(=O)C2=CC=C1C=C2 MMINFSMURORWKH-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- DTOMAXGIWFLDMR-UHFFFAOYSA-N 4-[(4-hydroxy-3-nitrophenyl)methyl]-2-nitrophenol Chemical compound C1=C([N+]([O-])=O)C(O)=CC=C1CC1=CC=C(O)C([N+]([O-])=O)=C1 DTOMAXGIWFLDMR-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- WCUDAIJOADOKAW-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCC)C1=CC=C(O)C=C1 WCUDAIJOADOKAW-UHFFFAOYSA-N 0.000 description 1
- KSYGTCNPCHQRKM-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 KSYGTCNPCHQRKM-UHFFFAOYSA-N 0.000 description 1
- MARUHZGHZWCEQU-UHFFFAOYSA-N 5-phenyl-2h-tetrazole Chemical compound C1=CC=CC=C1C1=NNN=N1 MARUHZGHZWCEQU-UHFFFAOYSA-N 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000006057 Non-nutritive feed additive Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- IMHDGJOMLMDPJN-UHFFFAOYSA-N biphenyl-2,2'-diol Chemical group OC1=CC=CC=C1C1=CC=CC=C1O IMHDGJOMLMDPJN-UHFFFAOYSA-N 0.000 description 1
- POZGCGJFBOZPCM-UHFFFAOYSA-N bis(2-methylphenyl) carbonate Chemical compound CC1=CC=CC=C1OC(=O)OC1=CC=CC=C1C POZGCGJFBOZPCM-UHFFFAOYSA-N 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- PWGQHOJABIQOOS-UHFFFAOYSA-N copper;dioxido(dioxo)chromium Chemical compound [Cu+2].[O-][Cr]([O-])(=O)=O PWGQHOJABIQOOS-UHFFFAOYSA-N 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 230000032798 delamination Effects 0.000 description 1
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 1
- CJSBUWDGPXGFGA-UHFFFAOYSA-N dimethyl-butadiene Natural products CC(C)=CC=C CJSBUWDGPXGFGA-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000012757 flame retardant agent Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 239000004088 foaming agent Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- XXMIOPMDWAUFGU-UHFFFAOYSA-N hexane-1,6-diol Chemical compound OCCCCCCO XXMIOPMDWAUFGU-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000009863 impact test Methods 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- MNZMMCVIXORAQL-UHFFFAOYSA-N naphthalene-2,6-diol Chemical compound C1=C(O)C=CC2=CC(O)=CC=C21 MNZMMCVIXORAQL-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920006230 thermoplastic polyester resin Polymers 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229910052882 wollastonite Inorganic materials 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US93,129 | 1979-11-09 | ||
| US06/093,129 US4267096A (en) | 1979-11-09 | 1979-11-09 | Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and a diolefin, a polycarbonate and an amorphous polyester |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1151337A true CA1151337A (en) | 1983-08-02 |
Family
ID=22237363
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000363812A Expired CA1151337A (en) | 1979-11-09 | 1980-10-31 | Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer, a polycarbonate and an amorphous polyester |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4267096A (show.php) |
| JP (1) | JPS5692951A (show.php) |
| AU (1) | AU537332B2 (show.php) |
| BR (1) | BR8007290A (show.php) |
| CA (1) | CA1151337A (show.php) |
| DE (1) | DE3041888A1 (show.php) |
| FR (1) | FR2469433B1 (show.php) |
| GB (1) | GB2061973B (show.php) |
| NL (1) | NL8006082A (show.php) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4562222A (en) * | 1982-09-23 | 1985-12-31 | General Electric Company | Polycarbonate resin mixtures |
| EP0105388A1 (en) * | 1982-09-28 | 1984-04-18 | General Electric Company | Modified thermoplastic polyester molding compositions and articles molded therefrom |
| EP0111810A3 (en) * | 1982-12-20 | 1986-10-22 | General Electric Company | High strength, reduced heat distortion temperature thermoplastic composition |
| US4786692A (en) * | 1982-12-20 | 1988-11-22 | General Electric Company | High strength, reduced heat distortion temperature thermoplastic composition |
| EP0137230A3 (en) * | 1983-08-30 | 1986-09-03 | General Electric Company | Thermoplastic molding compositions |
| US5116905A (en) * | 1983-08-30 | 1992-05-26 | General Electric Company | Polycarbonate resin mixtures |
| US4778853A (en) * | 1983-10-03 | 1988-10-18 | General Electric Company | Polycarbonate resin mixtures |
| US4536538A (en) * | 1983-12-19 | 1985-08-20 | General Electric Company | Impact modified polycarbonate composition |
| US4604423A (en) * | 1983-12-19 | 1986-08-05 | General Electric Company | Composition |
| EP0186050B1 (en) * | 1984-12-19 | 1990-01-31 | General Electric Company | Copolyester-carbonate composition |
| US4684420A (en) * | 1985-08-16 | 1987-08-04 | The Firestone Tire & Rubber Company | Polymer transfer decals comprising saturated elastomers |
| US4710534A (en) * | 1985-12-09 | 1987-12-01 | General Electric Company | Low gloss, flame reterdant, impact resistant polycarbonate composition |
| US4804711A (en) * | 1987-10-26 | 1989-02-14 | General Electric Company | Melt blending of a carboxy terminated polystyrene oligomer with an aromatic polyester |
| EP0320647A3 (en) * | 1987-12-16 | 1990-09-19 | General Electric Company | Polycarbonate composition with low heat distortion |
| US4897448A (en) * | 1988-04-01 | 1990-01-30 | Eastman Kodak Company | Polyester/polycarbonate blends |
| USH1432H (en) * | 1988-08-15 | 1995-04-04 | The Dow Chemical Company | Polycarbonate-block copolymer blend with improved solvent and impact resistance |
| US5189091A (en) * | 1989-05-04 | 1993-02-23 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends modified with a grafted olefin copolymer |
| US5260126A (en) * | 1990-01-10 | 1993-11-09 | Kimberly-Clark Corporation | Low stress relaxation elastomeric nonwoven webs and fibers |
| WO1991016379A1 (en) * | 1990-04-12 | 1991-10-31 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| US5369154A (en) * | 1990-04-12 | 1994-11-29 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| US5308894A (en) * | 1990-04-12 | 1994-05-03 | The Dow Chemical Company | Polycarbonate/aromatic polyester blends containing an olefinic modifier |
| US5124402A (en) * | 1990-08-21 | 1992-06-23 | The Dow Chemical Company | Thermoplastic molding compositions with improved solvent resistance and impact strength, and methods for preparation thereof |
| US5082890A (en) * | 1990-08-21 | 1992-01-21 | The Dow Chemical Company | Filled thermoplastic molding compositions |
| US5159003A (en) * | 1990-10-09 | 1992-10-27 | Ferro Corporation | Polyester-compatible alloys of polycarbonate |
| DE4229642A1 (de) * | 1992-09-04 | 1994-03-10 | Bayer Ag | Pulvermischungen für matte Polycarbonat-Formmassen |
| US5288800A (en) * | 1992-12-28 | 1994-02-22 | Shell Oil Company | Polymer blends |
| US5332613A (en) * | 1993-06-09 | 1994-07-26 | Kimberly-Clark Corporation | High performance elastomeric nonwoven fibrous webs |
| US5414021A (en) * | 1993-08-02 | 1995-05-09 | General Electric Company | Method for salvaging aromatic polycarbonate blend values |
| US5589542A (en) * | 1993-11-03 | 1996-12-31 | Shell Oil Company | Multiblock hydrogenated polymers for adhesives |
| US6005059A (en) * | 1996-12-28 | 1999-12-21 | Eastman Chemical Company | Clear polycarbonate and polyester blends |
| US5942585A (en) * | 1996-12-28 | 1999-08-24 | Eastman Chemical Company | Polycarbonate and polyester blends |
| US6043322A (en) * | 1996-12-28 | 2000-03-28 | Eastman Chemical Company | Clear polycarbonate and polyester blends |
| US6011124A (en) * | 1996-12-28 | 2000-01-04 | Eastman Chemical Company | Blends of bisphenol a polycarbonate and polyesters |
| US6037424A (en) * | 1996-12-28 | 2000-03-14 | Eastman Chemical Company | Clear blends of polycarbonates and polyesters |
| JP3578446B2 (ja) * | 1999-04-02 | 2004-10-20 | カネボウ合繊株式会社 | 熱可塑性樹脂組成物 |
| US20040209985A1 (en) * | 2003-04-18 | 2004-10-21 | Woei-Min Tsai | Resin composition for injection molding |
| US20090054568A1 (en) * | 2005-04-28 | 2009-02-26 | Techno Polymer Co., Ltd. | Thermoplastic resin composition and molding thereof |
| US20080103235A1 (en) * | 2006-11-01 | 2008-05-01 | Wesley Raymond Hale | Clear blends of bisphenol a polycarbonate and copolyesters |
| KR102272782B1 (ko) | 2013-04-19 | 2021-07-08 | 코베스트로 엘엘씨 | 몰드 내 전자 인쇄 회로 기판 캡슐화 및 조립체 |
| CN113170586A (zh) | 2018-10-09 | 2021-07-23 | 科思创有限公司 | 使用导热聚碳酸酯的插入模制电子模块以及模制互锁特征件 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2839356A (en) * | 1954-06-14 | 1958-06-17 | Koppers Co Inc | Process of removing acidic constituents from gases utilizing screened low bulk weight lux means |
| GB951818A (en) * | 1961-08-18 | 1964-03-11 | Kunoshima Kagaku Kogyo Kabushi | Polyester moulding materials |
| NL127529C (show.php) * | 1962-07-04 | |||
| BE634842A (show.php) * | 1962-07-11 | |||
| US3281383A (en) * | 1962-08-09 | 1966-10-25 | Phillips Petroleum Co | Branched polymers prepared from monolithium-terminated polymers and compounds having at least three reactive sites |
| US3333024A (en) * | 1963-04-25 | 1967-07-25 | Shell Oil Co | Block polymers, compositions containing them and process of their preparation |
| US3753936A (en) * | 1970-02-18 | 1973-08-21 | Phillips Petroleum Co | Branched rubbery block copolymer adhesive |
| JPS5038130B2 (show.php) * | 1972-02-29 | 1975-12-08 | Asahi Chemical Ind | |
| US4081424A (en) * | 1976-06-07 | 1978-03-28 | Shell Oil Company | Multicomponent polyolefin - block copolymer - polymer blends |
| CA1098237A (en) * | 1977-05-05 | 1981-03-24 | William P. Gergen | Compositions containing hyrogenated block copolymers and engineering thermoplastic resins |
| GB2004284B (en) * | 1977-09-14 | 1982-04-07 | Gen Electric | Composition of a polycarbonate resin and a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer |
-
1979
- 1979-11-09 US US06/093,129 patent/US4267096A/en not_active Expired - Lifetime
-
1980
- 1980-10-13 AU AU63189/80A patent/AU537332B2/en not_active Ceased
- 1980-10-24 GB GB8034386A patent/GB2061973B/en not_active Expired
- 1980-10-31 CA CA000363812A patent/CA1151337A/en not_active Expired
- 1980-11-05 FR FR8023609A patent/FR2469433B1/fr not_active Expired
- 1980-11-06 BR BR8007290A patent/BR8007290A/pt unknown
- 1980-11-06 DE DE19803041888 patent/DE3041888A1/de active Granted
- 1980-11-06 NL NL8006082A patent/NL8006082A/nl not_active Application Discontinuation
- 1980-11-10 JP JP15713280A patent/JPS5692951A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2469433B1 (fr) | 1986-05-09 |
| JPS648027B2 (show.php) | 1989-02-10 |
| NL8006082A (nl) | 1981-06-01 |
| DE3041888C2 (show.php) | 1991-05-02 |
| JPS5692951A (en) | 1981-07-28 |
| BR8007290A (pt) | 1981-05-19 |
| AU537332B2 (en) | 1984-06-21 |
| US4267096A (en) | 1981-05-12 |
| FR2469433A1 (fr) | 1981-05-22 |
| DE3041888A1 (de) | 1981-05-21 |
| GB2061973A (en) | 1981-05-20 |
| AU6318980A (en) | 1981-05-14 |
| GB2061973B (en) | 1983-06-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1151337A (en) | Composition of a selectively hydrogenated block copolymer of a vinyl aromatic compound and an olefinic elastomer, a polycarbonate and an amorphous polyester | |
| US4786692A (en) | High strength, reduced heat distortion temperature thermoplastic composition | |
| US4246381A (en) | Polyarylate blends with copolyesters | |
| US5478896A (en) | Thermoplastic molding composition | |
| CA1267241A (en) | Polycarbonate resin composition | |
| US4220735A (en) | Modified polyester compositions | |
| EP0291323B1 (en) | Wholly aromatic polyester fiber-reinforced polyetherimide composite and process for preparing same | |
| US4239677A (en) | Modified polyester compositions | |
| JPS5928223B2 (ja) | 強化多相熱可塑性組成物 | |
| JPH02380B2 (show.php) | ||
| US4743650A (en) | Thermoplastic molding blends of polycarbonates and polyurethanes | |
| EP0111810A2 (en) | High strength, reduced heat distortion temperature thermoplastic composition | |
| US4122131A (en) | Polyblend composition comprising aromatic polycarbonate, polyolefin, selectively hydrogenated block copolymer and olefinic copolymer | |
| US4537930A (en) | Composition of a polycarbonate resin and a selectively hydrogenated copolymer of a vinyl aromatic compound and an olefinic elastomer | |
| JPS63159467A (ja) | 高いモジュラスを示すポリカーボネートおよびコポリエステル−カーボネート樹脂組成物 | |
| US5023297A (en) | Impact and solvent resistant polycarbonate composition | |
| JPS62187761A (ja) | ポリアミドとエポキシ官能性化合物を含有する熱可塑性ブレンド | |
| US4373067A (en) | Molded articles of improved impact resistance and compositions therefor | |
| EP0107048A1 (en) | Acrylic modified compositions of polycarbonate and polyethylene terephthalate | |
| JPS6142748B2 (show.php) | ||
| US4184997A (en) | Copolyether-esters as additives for fiber-reinforced polyethylene terephthalate | |
| EP0105388A1 (en) | Modified thermoplastic polyester molding compositions and articles molded therefrom | |
| CA1082394A (en) | Thermoplastc molding composition | |
| EP0320651A2 (en) | Thermoplastic polycarbonate-polyester blends | |
| EP0149192A2 (en) | Epoxidized epdm as impact modifier for thermoplastic polyester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |