CA1149820A - Process for preparing p,p'-biphenol of high purity - Google Patents
Process for preparing p,p'-biphenol of high purityInfo
- Publication number
- CA1149820A CA1149820A CA000342273A CA342273A CA1149820A CA 1149820 A CA1149820 A CA 1149820A CA 000342273 A CA000342273 A CA 000342273A CA 342273 A CA342273 A CA 342273A CA 1149820 A CA1149820 A CA 1149820A
- Authority
- CA
- Canada
- Prior art keywords
- biphenol
- reaction
- product
- dealkylation
- phenol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical compound C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 title claims abstract description 73
- 238000004519 manufacturing process Methods 0.000 title abstract description 5
- 239000003054 catalyst Substances 0.000 claims abstract description 30
- 150000002989 phenols Chemical class 0.000 claims abstract description 26
- 239000007795 chemical reaction product Substances 0.000 claims abstract description 20
- 239000006227 byproduct Substances 0.000 claims abstract description 19
- 239000000047 product Substances 0.000 claims abstract description 12
- 150000001336 alkenes Chemical class 0.000 claims abstract description 11
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims abstract description 11
- 239000012298 atmosphere Substances 0.000 claims abstract description 10
- 238000000354 decomposition reaction Methods 0.000 claims abstract description 7
- 238000010438 heat treatment Methods 0.000 claims abstract description 7
- 238000006900 dealkylation reaction Methods 0.000 claims description 62
- 238000000034 method Methods 0.000 claims description 50
- 230000008569 process Effects 0.000 claims description 28
- -1 alkyl carbon Chemical compound 0.000 claims description 20
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 19
- 239000001301 oxygen Substances 0.000 claims description 19
- 229910052760 oxygen Inorganic materials 0.000 claims description 19
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 14
- 239000007789 gas Substances 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 238000001704 evaporation Methods 0.000 claims description 5
- 230000008020 evaporation Effects 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims 2
- 230000020335 dealkylation Effects 0.000 description 41
- 238000006243 chemical reaction Methods 0.000 description 30
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 11
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 8
- DKCPKDPYUFEZCP-UHFFFAOYSA-N 2,6-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=CC(C(C)(C)C)=C1O DKCPKDPYUFEZCP-UHFFFAOYSA-N 0.000 description 7
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 125000000217 alkyl group Chemical group 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000178 monomer Substances 0.000 description 5
- 238000006025 oxidative dimerization reaction Methods 0.000 description 5
- 238000013019 agitation Methods 0.000 description 4
- 239000000539 dimer Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- DDTHMESPCBONDT-UHFFFAOYSA-N 4-(4-oxocyclohexa-2,5-dien-1-ylidene)cyclohexa-2,5-dien-1-one Chemical compound C1=CC(=O)C=CC1=C1C=CC(=O)C=C1 DDTHMESPCBONDT-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000004817 gas chromatography Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000005691 oxidative coupling reaction Methods 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 239000012808 vapor phase Substances 0.000 description 3
- IBRQUKZZBXZOBA-UHFFFAOYSA-N 1-chloro-3-(3-chlorophenyl)sulfonylbenzene Chemical compound ClC1=CC=CC(S(=O)(=O)C=2C=C(Cl)C=CC=2)=C1 IBRQUKZZBXZOBA-UHFFFAOYSA-N 0.000 description 2
- GSOYMOAPJZYXTB-UHFFFAOYSA-N 2,6-ditert-butyl-4-(3,5-ditert-butyl-4-hydroxyphenyl)phenol Chemical compound CC(C)(C)C1=C(O)C(C(C)(C)C)=CC(C=2C=C(C(O)=C(C=2)C(C)(C)C)C(C)(C)C)=C1 GSOYMOAPJZYXTB-UHFFFAOYSA-N 0.000 description 2
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical compound CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- MHABMANUFPZXEB-UHFFFAOYSA-N O-demethyl-aloesaponarin I Natural products O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=C(O)C(C(O)=O)=C2C MHABMANUFPZXEB-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 238000006471 dimerization reaction Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000012264 purified product Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000011084 recovery Methods 0.000 description 2
- CPRMKOQKXYSDML-UHFFFAOYSA-M rubidium hydroxide Chemical compound [OH-].[Rb+] CPRMKOQKXYSDML-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- FHTGJZOULSYEOB-UHFFFAOYSA-N 2,6-di(butan-2-yl)phenol Chemical compound CCC(C)C1=CC=CC(C(C)CC)=C1O FHTGJZOULSYEOB-UHFFFAOYSA-N 0.000 description 1
- VHNKTXXKQBOFGI-UHFFFAOYSA-N 2-butyl-4-(4-hydroxyphenyl)phenol Chemical compound C1=C(O)C(CCCC)=CC(C=2C=CC(O)=CC=2)=C1 VHNKTXXKQBOFGI-UHFFFAOYSA-N 0.000 description 1
- XTAKTGALCAEZKI-UHFFFAOYSA-N 2-butyl-6-cyclohexylphenol Chemical compound CCCCC1=CC=CC(C2CCCCC2)=C1O XTAKTGALCAEZKI-UHFFFAOYSA-N 0.000 description 1
- JGKCUPRQXQQKPX-UHFFFAOYSA-N 4-(4-hydroxy-2-propan-2-ylphenyl)-3-propan-2-ylphenol Chemical compound CC(C)C1=CC(O)=CC=C1C1=CC=C(O)C=C1C(C)C JGKCUPRQXQQKPX-UHFFFAOYSA-N 0.000 description 1
- FXZKVSIDLMNZAQ-UHFFFAOYSA-N 4-[3-(3,5-diethylphenyl)-4-hydroxyphenyl]-3,5-diethylphenol Chemical compound C(C)C=1C=C(C=C(C=1)CC)C1=C(C=CC(=C1)C1=C(C=C(C=C1CC)O)CC)O FXZKVSIDLMNZAQ-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 229920000491 Polyphenylsulfone Polymers 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000004035 construction material Substances 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- BHZRJJOHZFYXTO-UHFFFAOYSA-L potassium sulfite Chemical compound [K+].[K+].[O-]S([O-])=O BHZRJJOHZFYXTO-UHFFFAOYSA-L 0.000 description 1
- 235000019252 potassium sulphite Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000011027 product recovery Methods 0.000 description 1
- OLBCVFGFOZPWHH-UHFFFAOYSA-N propofol Chemical compound CC(C)C1=CC=CC(C(C)C)=C1O OLBCVFGFOZPWHH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- WPFGFHJALYCVMO-UHFFFAOYSA-L rubidium carbonate Chemical compound [Rb+].[Rb+].[O-]C([O-])=O WPFGFHJALYCVMO-UHFFFAOYSA-L 0.000 description 1
- 229910000026 rubidium carbonate Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- OPSWAWSNPREEFQ-UHFFFAOYSA-K triphenoxyalumane Chemical compound [Al+3].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 OPSWAWSNPREEFQ-UHFFFAOYSA-K 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 238000013022 venting Methods 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/11—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions increasing the number of carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/50—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by reactions decreasing the number of carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US000,120 | 1979-01-02 | ||
| US06/000,120 US4205187A (en) | 1979-01-02 | 1979-01-02 | Process for preparing p,p'-biphenol of high purity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1149820A true CA1149820A (en) | 1983-07-12 |
Family
ID=21690013
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000342273A Expired CA1149820A (en) | 1979-01-02 | 1979-12-19 | Process for preparing p,p'-biphenol of high purity |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4205187A (enExample) |
| EP (1) | EP0013436B1 (enExample) |
| JP (1) | JPS5592332A (enExample) |
| CA (1) | CA1149820A (enExample) |
| DE (1) | DE2964185D1 (enExample) |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4447656A (en) * | 1981-03-09 | 1984-05-08 | The Dow Chemical Company | Solvent system for oxidative coupling process |
| US4397785A (en) * | 1981-03-27 | 1983-08-09 | The Dow Chemical Company | Preparation of 3,3'5,5'-tetratertiary butyl diphenoquinone |
| EP0131897B1 (en) * | 1983-07-15 | 1986-11-26 | Ici Americas Inc. | High yield process for preparing 3,3',5,5'-tetraalkyl-4,4'-biphenol |
| US4482755A (en) * | 1983-07-15 | 1984-11-13 | Ici Americas Inc. | High yield process for preparing 4,4'-biphenol and para-alkylbenzenes |
| US4487978A (en) * | 1983-07-15 | 1984-12-11 | Ici Americas Inc. | High yield process for preparing 4,4'-biphenol and tert-alkylated-alkylbenzenes |
| US4487977A (en) * | 1983-07-15 | 1984-12-11 | Ici Americas Inc. | High yield process for preparing 3,3',5,5'-tetraalkyl-4,4'-biphenol |
| JPS63119432A (ja) * | 1986-11-07 | 1988-05-24 | Kureha Chem Ind Co Ltd | 4,4′−ジヒドロキシビフエニルの製造方法 |
| CA1334978C (en) * | 1987-09-22 | 1995-03-28 | Michio Tanaka | Process for producing p,p'-biphenol |
| DE3819963A1 (de) * | 1988-06-11 | 1989-12-14 | Huels Chemische Werke Ag | Verfahren zur herstellung von 4,4'-dihydroxybiphenyl |
| EP0546639B1 (en) * | 1991-12-11 | 1997-04-09 | Shell Internationale Researchmaatschappij B.V. | A process for the preparation of bisphenols |
| US6689921B2 (en) | 2000-02-23 | 2004-02-10 | Wiley Organics, Inc. | Preparation of biphenols by oxidative coupling of alkylphenols using a recyclable copper catalyst |
| US6441248B1 (en) | 2000-02-23 | 2002-08-27 | Wiley Organics, Inc. | Preparation of biphenols by oxidative coupling of alkylphenols using copper catalyst |
| JP3976470B2 (ja) * | 2000-04-13 | 2007-09-19 | 本州化学工業株式会社 | ブチルフェノール類の脱ブチル化方法 |
| KR100425646B1 (ko) * | 2001-03-02 | 2004-04-03 | 송원산업 주식회사 | 4,4'-비페놀의 제조 방법 |
| US7002046B2 (en) * | 2003-10-07 | 2006-02-21 | General Electric Company | Process for the recovery of dihydroxybiaryl compounds |
| CN105330518A (zh) * | 2015-11-30 | 2016-02-17 | 江门市优巨新材料有限公司 | 一种高纯度联苯二酚类化合物工业化合成方法 |
Family Cites Families (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2366497A (en) * | 1943-02-08 | 1945-01-02 | Standard Oil Dev Co | Dealkylation of alkylated phenols |
| US2792427A (en) * | 1953-10-16 | 1957-05-14 | Universal Oil Prod Co | Dealkylation of 2, 5-tert-alkylphenols |
| US2885444A (en) * | 1958-03-05 | 1959-05-05 | Dow Chemical Co | Oxidation of 2, 4-di-tertiary-alkyl-phenols with oxygen |
| US3153098A (en) * | 1959-05-28 | 1964-10-13 | Ethyl Corp | Bis phenols |
| US3091646A (en) * | 1960-04-18 | 1963-05-28 | Koppers Co Inc | Preparation of mu-cresol by a dealkylation process |
| US3284514A (en) * | 1962-12-19 | 1966-11-08 | Gulf Research Development Co | Process for the hydrodealkylation of a polyalkylated phenol |
| GB1118287A (en) * | 1965-10-28 | 1968-06-26 | Gulf Research Development Co | Process for converting polyalkylated phenol to obtain a phenol |
| NL6514147A (enExample) * | 1965-11-01 | 1967-05-02 | ||
| GB1133405A (en) * | 1966-05-26 | 1968-11-13 | Ethyl Corp | A process for the production of bisphenols |
| US3631208A (en) * | 1966-06-10 | 1971-12-28 | Gen Electric | Coupling of phenols with diphenoquinones |
| US3575815A (en) * | 1969-01-29 | 1971-04-20 | Charles E Sech | Apparatus for the distillation purification of diphenyl compounds |
| US3813445A (en) * | 1969-09-12 | 1974-05-28 | Universal Oil Prod Co | Preparation of dihydroxybiphenyls |
| JPS5191238A (en) * | 1975-02-10 | 1976-08-10 | 4*4** jiokishibifueniru no seizoho | |
| US4085124A (en) * | 1975-11-24 | 1978-04-18 | Ici Americas Inc. | Oxidative coupling of alkylphenols, alkoxyphenols and 1-naphthols catalyzed by metal complexes of amino compounds |
| US4086253A (en) * | 1976-07-08 | 1978-04-25 | The Dow Chemical Company | 3,3',5,5'-Tetra-substituted diphenoquinone from 2,6-disubstituted phenol by phase-transfer catalysis |
| US4096190A (en) * | 1976-11-26 | 1978-06-20 | Ici Americas Inc. | Oxidative coupling of alkylphenols catalyzed by metal ammonia complexes |
| US4101561A (en) * | 1976-11-26 | 1978-07-18 | Ici Americas Inc. | Oxidative coupling of alkylphenols catalyzed by metal complexes of imino acid compounds |
| US4093598A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Oxidative coupling of phenolic monomers in the presence of manganese complexes of manganese phenyl benzoin oxime catalysts |
| US4098830A (en) * | 1977-02-18 | 1978-07-04 | Ici Americas Inc. | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of dicarboxylic acid compounds |
| US4100205A (en) * | 1977-02-18 | 1978-07-11 | Ici Americas Inc. | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of aminoketo compounds |
| US4100204A (en) * | 1977-02-18 | 1978-07-11 | Ici Americas Inc. | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of a hydroxy- or keto-acid compound |
| US4100203A (en) * | 1977-02-18 | 1978-07-11 | Ici Americas Inc. | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of an oxime of a keto or aldehyde compound |
| US4100202A (en) * | 1977-02-18 | 1978-07-11 | Ici Americas Inc. | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by cupric complexes |
| US4100206A (en) * | 1977-02-18 | 1978-07-11 | Ici Americas Inc. | Oxidative coupling of alkylphenols or 1-naphthols catalyzed by metal complexes of keto alcohol compounds |
| US4098766A (en) * | 1977-04-14 | 1978-07-04 | Ici Americas Inc. | Method of oxidatively coupling alkyl phenols utilizing a tetravalent manganese-carbon catalyst |
-
1979
- 1979-01-02 US US06/000,120 patent/US4205187A/en not_active Expired - Lifetime
- 1979-12-19 CA CA000342273A patent/CA1149820A/en not_active Expired
- 1979-12-28 JP JP17054679A patent/JPS5592332A/ja active Granted
- 1979-12-31 DE DE7979105405T patent/DE2964185D1/de not_active Expired
- 1979-12-31 EP EP79105405A patent/EP0013436B1/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5592332A (en) | 1980-07-12 |
| DE2964185D1 (en) | 1983-01-05 |
| EP0013436A1 (en) | 1980-07-23 |
| EP0013436B1 (en) | 1982-12-01 |
| JPS6261575B2 (enExample) | 1987-12-22 |
| US4205187A (en) | 1980-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1149820A (en) | Process for preparing p,p'-biphenol of high purity | |
| US5629456A (en) | Method of preparing a fluorene derivative and the method of purifying thereof | |
| CA1137518A (en) | Oxidative process for preparing substituted biphenols | |
| US5099076A (en) | Method for preparing p,p'-biphenol | |
| JPS5829285B2 (ja) | フエノ−ルルイ ノ セイゾウホウホウ | |
| US4482755A (en) | High yield process for preparing 4,4'-biphenol and para-alkylbenzenes | |
| CA1334978C (en) | Process for producing p,p'-biphenol | |
| US4354048A (en) | Copper chromite catalysts for oxidative coupling of phenols | |
| US4487978A (en) | High yield process for preparing 4,4'-biphenol and tert-alkylated-alkylbenzenes | |
| JPS5879941A (ja) | メチルフェノ−ルの調製方法 | |
| KR0179040B1 (ko) | 레졸신올 제조방법 | |
| US4487977A (en) | High yield process for preparing 3,3',5,5'-tetraalkyl-4,4'-biphenol | |
| US4804788A (en) | Preparation process of 4,4-dihydroxybiphenyl | |
| CA1293265C (en) | Preparation process of 4,4'-biphenol, precursor of same and preparation process of precursor | |
| CA2005320C (en) | Process for preparing para-hydroxybenzoic acid | |
| Mikrovannidis | Synthesis and characterization of polycarbonates derived from N, N′-m-phenylenebis (3-hydroxybenzamide) and 4, 4-bis (4-hydroxyphenyl) pentanoic acid anilide | |
| KR890005300B1 (ko) | 4,4-비스(4-히드록시페닐)시클로헥산카르복실산유도체의 제조방법 | |
| US4163116A (en) | Process for producing bisphenols | |
| EP0131897B1 (en) | High yield process for preparing 3,3',5,5'-tetraalkyl-4,4'-biphenol | |
| US4149019A (en) | Process for the transalkylation of nuclear methylated phenols | |
| JP2004352713A (ja) | 1,3−プロパンジオールの製造方法 | |
| US4978797A (en) | Process for the preparation of 2-hydroxy-4-(hydroxyalkoxy)-benzophenone | |
| JPH0515702B2 (enExample) | ||
| EP0343798A1 (en) | Preparation of aromatic compounds and derivatives thereof | |
| US3422154A (en) | Process for producing dinitrodiphenyl ethers |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |