CA1135273A - Method of preparing di-organo-magnesium compounds - Google Patents
Method of preparing di-organo-magnesium compoundsInfo
- Publication number
- CA1135273A CA1135273A CA000345873A CA345873A CA1135273A CA 1135273 A CA1135273 A CA 1135273A CA 000345873 A CA000345873 A CA 000345873A CA 345873 A CA345873 A CA 345873A CA 1135273 A CA1135273 A CA 1135273A
- Authority
- CA
- Canada
- Prior art keywords
- magnesium
- compound
- hydride
- olefin
- transition metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 27
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 53
- 239000011777 magnesium Substances 0.000 claims abstract description 44
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims abstract description 40
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 27
- 229910012375 magnesium hydride Inorganic materials 0.000 claims abstract description 23
- 238000006243 chemical reaction Methods 0.000 claims abstract description 21
- 239000003054 catalyst Substances 0.000 claims abstract description 20
- 150000001336 alkenes Chemical class 0.000 claims abstract description 19
- 239000001257 hydrogen Substances 0.000 claims abstract description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 18
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 13
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims abstract description 11
- 229910052723 transition metal Inorganic materials 0.000 claims abstract description 9
- 150000003624 transition metals Chemical class 0.000 claims abstract description 9
- -1 polycyclic aromatic compound Chemical class 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 125000003118 aryl group Chemical group 0.000 claims abstract description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims abstract description 7
- 239000012190 activator Substances 0.000 claims abstract description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 6
- 150000004678 hydrides Chemical class 0.000 claims abstract description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims abstract description 5
- 239000002904 solvent Substances 0.000 claims abstract description 5
- 150000003512 tertiary amines Chemical class 0.000 claims abstract description 5
- 229910052751 metal Inorganic materials 0.000 claims abstract description 4
- 239000002184 metal Substances 0.000 claims abstract description 4
- 229910052987 metal hydride Inorganic materials 0.000 claims abstract description 4
- 150000004681 metal hydrides Chemical class 0.000 claims abstract description 4
- 150000002902 organometallic compounds Chemical class 0.000 claims abstract description 4
- 230000000737 periodic effect Effects 0.000 claims abstract description 4
- 150000003623 transition metal compounds Chemical class 0.000 claims abstract description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims abstract 2
- 229910052799 carbon Inorganic materials 0.000 claims abstract 2
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims description 26
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 4
- YNPNZTXNASCQKK-UHFFFAOYSA-N phenanthrene Chemical compound C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 claims description 4
- XBDYBAVJXHJMNQ-UHFFFAOYSA-N Tetrahydroanthracene Natural products C1=CC=C2C=C(CCCC3)C3=CC2=C1 XBDYBAVJXHJMNQ-UHFFFAOYSA-N 0.000 claims description 2
- SLIUAWYAILUBJU-UHFFFAOYSA-N pentacene Chemical compound C1=CC=CC2=CC3=CC4=CC5=CC=CC=C5C=C4C=C3C=C21 SLIUAWYAILUBJU-UHFFFAOYSA-N 0.000 claims description 2
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 claims description 2
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 claims description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 2
- IFLREYGFSNHWGE-UHFFFAOYSA-N tetracene Chemical compound C1=CC=CC2=CC3=CC4=CC=CC=C4C=C3C=C21 IFLREYGFSNHWGE-UHFFFAOYSA-N 0.000 claims description 2
- 239000000376 reactant Substances 0.000 claims 2
- 238000003756 stirring Methods 0.000 description 27
- 235000001055 magnesium Nutrition 0.000 description 21
- 229940091250 magnesium supplement Drugs 0.000 description 21
- 239000005977 Ethylene Substances 0.000 description 14
- 229940093470 ethylene Drugs 0.000 description 14
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 13
- 239000000725 suspension Substances 0.000 description 13
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 10
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 9
- 239000011521 glass Substances 0.000 description 7
- DLPASUVGCQPFFO-UHFFFAOYSA-N magnesium;ethane Chemical compound [Mg+2].[CH2-]C.[CH2-]C DLPASUVGCQPFFO-UHFFFAOYSA-N 0.000 description 6
- IUYHWZFSGMZEOG-UHFFFAOYSA-M magnesium;propane;chloride Chemical group [Mg+2].[Cl-].C[CH-]C IUYHWZFSGMZEOG-UHFFFAOYSA-M 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 4
- 229940077744 antacid containing magnesium compound Drugs 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 229910003074 TiCl4 Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- GRJWDJVTZAUGDZ-UHFFFAOYSA-N anthracene;magnesium Chemical compound [Mg].C1=CC=CC2=CC3=CC=CC=C3C=C21 GRJWDJVTZAUGDZ-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 150000002681 magnesium compounds Chemical class 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- KWKAKUADMBZCLK-UHFFFAOYSA-N methyl heptene Natural products CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 229910010066 TiC14 Inorganic materials 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 2
- 239000000347 magnesium hydroxide Substances 0.000 description 2
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 2
- 235000012254 magnesium hydroxide Nutrition 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- 239000004711 α-olefin Substances 0.000 description 2
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- JXDXANRCLTZYDP-UHFFFAOYSA-N 2-[3-(1,4-diazepan-1-ylmethyl)-4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound N1(CCNCCC1)CC1=NN(C=C1C=1C=NC(=NC=1)NC1CC2=CC=CC=C2C1)CC(=O)N1CC2=C(CC1)NN=N2 JXDXANRCLTZYDP-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- 101100345589 Mus musculus Mical1 gene Proteins 0.000 description 1
- JQGGAELIYHNDQS-UHFFFAOYSA-N Nic 12 Natural products CC(C=CC(=O)C)c1ccc2C3C4OC4C5(O)CC=CC(=O)C5(C)C3CCc2c1 JQGGAELIYHNDQS-UHFFFAOYSA-N 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 238000001632 acidimetric titration Methods 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- YMNCCEXICREQQV-UHFFFAOYSA-L cyclopenta-1,3-diene;titanium(4+);dichloride Chemical compound [Cl-].[Cl-].[Ti+4].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 YMNCCEXICREQQV-UHFFFAOYSA-L 0.000 description 1
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 150000004796 dialkyl magnesium compounds Chemical class 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004998 naphthylethyl group Chemical group C1(=CC=CC2=CC=CC=C12)CC* 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 150000002896 organic halogen compounds Chemical class 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000012721 stereospecific polymerization Methods 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F3/00—Compounds containing elements of Groups 2 or 12 of the Periodic Table
- C07F3/02—Magnesium compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ATA1314/79 | 1979-02-20 | ||
| AT0131479A AT369012B (de) | 1979-02-20 | 1979-02-20 | Verfahren zur herstellung von diorganomagnesium- verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1135273A true CA1135273A (en) | 1982-11-09 |
Family
ID=3511211
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000345873A Expired CA1135273A (en) | 1979-02-20 | 1980-02-18 | Method of preparing di-organo-magnesium compounds |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4329301A (esLanguage) |
| EP (1) | EP0014983B1 (esLanguage) |
| JP (1) | JPS55115890A (esLanguage) |
| AT (1) | AT369012B (esLanguage) |
| AU (1) | AU534488B2 (esLanguage) |
| BR (1) | BR8000970A (esLanguage) |
| CA (1) | CA1135273A (esLanguage) |
| DD (1) | DD149219A5 (esLanguage) |
| DE (1) | DE3065967D1 (esLanguage) |
| DK (1) | DK69680A (esLanguage) |
| ES (1) | ES488709A0 (esLanguage) |
| IE (1) | IE49514B1 (esLanguage) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3205550A1 (de) * | 1982-02-17 | 1983-08-25 | Studiengesellschaft Kohle mbH, 4330 Mülheim | Herstellung von uebergangsmetallkomplexen |
| US4447369A (en) * | 1982-04-16 | 1984-05-08 | Ethyl Corporation | Organomagnesium compounds |
| US7205265B2 (en) * | 1990-11-05 | 2007-04-17 | Ekc Technology, Inc. | Cleaning compositions and methods of use thereof |
| DE4116382C1 (esLanguage) * | 1991-05-18 | 1992-06-11 | Th. Goldschmidt Ag, 4300 Essen, De | |
| DE19757499A1 (de) * | 1997-12-23 | 1999-06-24 | Studiengesellschaft Kohle Mbh | Verfahren zur Synthese von Organomagnesium-Verbindungen unter Einsatz von Katalysatoren |
| US9499880B2 (en) * | 2015-03-06 | 2016-11-22 | Battelle Memorial Institute | System and process for production of magnesium metal and magnesium hydride from magnesium-containing salts and brines |
| KR102557065B1 (ko) | 2015-04-02 | 2023-07-18 | 알베마를 저머니 게엠베하 | 고 반응성 금속 수소화물, 이들의 제조 방법 및 용도 |
| MA41837A (fr) * | 2015-04-02 | 2018-02-06 | Albemarle Germany Gmbh | Procédé de production de composés organométalliques |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2959625A (en) * | 1959-01-12 | 1960-11-08 | Ethyl Corp | Manufacture of alkyl magnesium compounds |
| US2985692A (en) * | 1959-01-27 | 1961-05-23 | Ethyl Corp | Manufacture of alkyl magnesium compounds |
| US3354190A (en) * | 1965-01-04 | 1967-11-21 | Exxon Research Engineering Co | Magnesium and tin derivatives of fusedring hydrocarbons and the preparation thereof |
| US3388179A (en) * | 1965-01-04 | 1968-06-11 | Exxon Research Engineering Co | Organomagnesium addition compounds, process therefor, and derivatives thereof |
| US3706809A (en) * | 1970-09-17 | 1972-12-19 | Takasago Perfumery Co Ltd | Process for preparing highly reactive organo-magnesium compounds |
| DE2804445A1 (de) * | 1978-02-02 | 1979-08-09 | Studiengesellschaft Kohle Mbh | Verfahren zur herstellung von magnesiumhydriden |
-
1979
- 1979-02-20 AT AT0131479A patent/AT369012B/de not_active IP Right Cessation
-
1980
- 1980-02-15 BR BR8000970A patent/BR8000970A/pt unknown
- 1980-02-18 DK DK69680A patent/DK69680A/da not_active Application Discontinuation
- 1980-02-18 EP EP80100809A patent/EP0014983B1/de not_active Expired
- 1980-02-18 ES ES488709A patent/ES488709A0/es active Granted
- 1980-02-18 DE DE8080100809T patent/DE3065967D1/de not_active Expired
- 1980-02-18 CA CA000345873A patent/CA1135273A/en not_active Expired
- 1980-02-18 IE IE308/80A patent/IE49514B1/en not_active IP Right Cessation
- 1980-02-19 JP JP2037780A patent/JPS55115890A/ja active Granted
- 1980-02-19 AU AU55680/80A patent/AU534488B2/en not_active Ceased
- 1980-02-19 DD DD80219136A patent/DD149219A5/de not_active IP Right Cessation
- 1980-02-21 US US06/123,157 patent/US4329301A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0014983A2 (de) | 1980-09-03 |
| EP0014983B1 (de) | 1983-12-28 |
| IE49514B1 (en) | 1985-10-16 |
| ATA131479A (de) | 1982-04-15 |
| EP0014983A3 (en) | 1980-09-17 |
| AT369012B (de) | 1982-11-25 |
| DK69680A (da) | 1980-08-21 |
| IE800308L (en) | 1980-08-20 |
| DE3065967D1 (en) | 1984-02-02 |
| AU534488B2 (en) | 1984-02-02 |
| ES8103106A1 (es) | 1981-02-16 |
| JPS639518B2 (esLanguage) | 1988-02-29 |
| AU5568080A (en) | 1980-08-28 |
| ES488709A0 (es) | 1981-02-16 |
| BR8000970A (pt) | 1980-10-29 |
| JPS55115890A (en) | 1980-09-06 |
| DD149219A5 (de) | 1981-07-01 |
| US4329301A (en) | 1982-05-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0574597B1 (en) | Process for the preparation of bridged, chiral metallocene catalysts of the bisindenyl type | |
| EP0606125A2 (en) | Use of titanium and zirconium compounds as homogeneous catalyst and novel titanium and zirconium compounds | |
| US5786495A (en) | Bridged bis-fluorenyl metallocenes, process for the preparation thereof and use thereof in catalysts for the polymerization of olefins | |
| CA1313859C (en) | Production of halide- and alkoxy-containing magnesium compositions | |
| CA2122378A1 (en) | Organo-aluminoxy product and use | |
| US5962714A (en) | Monocyclopentadienyl transition metal catalyst and olefin polymerization process | |
| US6825296B2 (en) | Catalyst component for olefin polymerization | |
| CA1135273A (en) | Method of preparing di-organo-magnesium compounds | |
| US5523435A (en) | Process for the synthesis of monomethylmetallocenes and dimethylmetallocenes and their solutions specifically for use in the polymerization of olefins | |
| EP0582114B1 (en) | Process for preparing metallocenes | |
| US5244991A (en) | Olefin polymerization process | |
| US6072067A (en) | Cyclopentadiene compound substituted with a hetero atom-containing group | |
| US7105690B2 (en) | Method for producing transition metal compounds and their use for the polymerization of olefins | |
| US6774253B1 (en) | Process for the preparation of titanium complexes | |
| CA1143381A (en) | Hydrocarbon-soluble diorganomagnesium compounds, hydrocarbon solutions containing the same and processes for preparation thereof | |
| US4147709A (en) | Zirconium halohydride preparation | |
| Jutzi et al. | Mixed Bent Sandwich Titanium Complexes with the [2‐(Diisopropylamino) ethyl] cyclopentadienyl Ligand—Catalysts for the Polymerization of Ethylene and the Dehydrocoupling of Phenylsilane | |
| EP0900193B1 (en) | Process for cyclopentadiene substitution with groups differing from each other | |
| US6218557B1 (en) | Synthesis of titanocenes | |
| CA2308160A1 (en) | Process for preparing group vi metal-based olefin polymerization catalyst component | |
| CN100354283C (zh) | 共价结合的非茂金属、其制备方法及其在烯烃聚合中的应用 | |
| US5883277A (en) | Metallocene complexes with cationic bridges | |
| RU2162852C2 (ru) | Способ получения 1-(n,n-диалкиламин)-1-хлор-1-алкилаланов | |
| RU2129559C1 (ru) | Способ получения 1-(2-(циклогекс-3-ен-1-ил)этил)-1,1-диэтилалана | |
| AU719067B2 (en) | Synthesis of titanocenes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |