CA1133041A - Radioactive starting aids for electrodeless light sources - Google Patents
Radioactive starting aids for electrodeless light sourcesInfo
- Publication number
- CA1133041A CA1133041A CA344,898A CA344898A CA1133041A CA 1133041 A CA1133041 A CA 1133041A CA 344898 A CA344898 A CA 344898A CA 1133041 A CA1133041 A CA 1133041A
- Authority
- CA
- Canada
- Prior art keywords
- lamp
- radioactive
- discharge apparatus
- envelope
- fined
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 230000002285 radioactive effect Effects 0.000 title claims abstract description 39
- 239000012857 radioactive material Substances 0.000 claims abstract description 68
- 239000000463 material Substances 0.000 claims abstract description 66
- 230000000694 effects Effects 0.000 claims abstract description 25
- 230000000977 initiatory effect Effects 0.000 claims abstract description 10
- LXQXZNRPTYVCNG-YPZZEJLDSA-N americium-241 Chemical compound [241Am] LXQXZNRPTYVCNG-YPZZEJLDSA-N 0.000 claims abstract description 9
- 239000004020 conductor Substances 0.000 claims description 30
- 230000005284 excitation Effects 0.000 claims description 14
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 12
- 230000005540 biological transmission Effects 0.000 claims description 10
- 239000000126 substance Substances 0.000 claims description 7
- BDOSMKKIYDKNTQ-OUBTZVSYSA-N Cadmium-113 Chemical compound [113Cd] BDOSMKKIYDKNTQ-OUBTZVSYSA-N 0.000 claims description 6
- WATWJIUSRGPENY-AKLPVKDBSA-N antimony-125 Chemical compound [125Sb] WATWJIUSRGPENY-AKLPVKDBSA-N 0.000 claims description 6
- ZCYVEMRRCGMTRW-NJFSPNSNSA-N iodine-129 atom Chemical compound [129I] ZCYVEMRRCGMTRW-NJFSPNSNSA-N 0.000 claims description 5
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 5
- 229910052753 mercury Inorganic materials 0.000 claims description 5
- BKVIYDNLLOSFOA-IGMARMGPSA-N thallium-204 Chemical compound [204Tl] BKVIYDNLLOSFOA-IGMARMGPSA-N 0.000 claims description 5
- ZSLUVFAKFWKJRC-AHCXROLUSA-N thorium-228 Chemical compound [228Th] ZSLUVFAKFWKJRC-AHCXROLUSA-N 0.000 claims description 5
- 239000011261 inert gas Substances 0.000 claims description 4
- HUIHCQPFSRNMNM-UHFFFAOYSA-K scandium(3+);triiodide Chemical compound [Sc+3].[I-].[I-].[I-] HUIHCQPFSRNMNM-UHFFFAOYSA-K 0.000 claims description 4
- 235000009518 sodium iodide Nutrition 0.000 claims description 4
- TVFDJXOCXUVLDH-RNFDNDRNSA-N cesium-137 Chemical compound [137Cs] TVFDJXOCXUVLDH-RNFDNDRNSA-N 0.000 claims description 3
- KJZYNXUDTRRSPN-OUBTZVSYSA-N holmium-166 Chemical compound [166Ho] KJZYNXUDTRRSPN-OUBTZVSYSA-N 0.000 claims description 3
- 230000001902 propagating effect Effects 0.000 claims description 3
- FRNOGLGSGLTDKL-NJFSPNSNSA-N thulium-171 Chemical compound [171Tm] FRNOGLGSGLTDKL-NJFSPNSNSA-N 0.000 claims description 3
- 229940041669 mercury Drugs 0.000 claims 3
- 235000008645 Chenopodium bonus henricus Nutrition 0.000 claims 2
- 244000138502 Chenopodium bonus henricus Species 0.000 claims 2
- PXHVJJICTQNCMI-RNFDNDRNSA-N nickel-63 Chemical compound [63Ni] PXHVJJICTQNCMI-RNFDNDRNSA-N 0.000 claims 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- 239000002245 particle Substances 0.000 abstract description 53
- 239000008188 pellet Substances 0.000 abstract description 4
- DNNSSWSSYDEUBZ-OUBTZVSYSA-N krypton-85 Chemical compound [85Kr] DNNSSWSSYDEUBZ-OUBTZVSYSA-N 0.000 abstract description 3
- 230000005251 gamma ray Effects 0.000 description 10
- 239000007789 gas Substances 0.000 description 10
- 230000005684 electric field Effects 0.000 description 9
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 8
- 230000015556 catabolic process Effects 0.000 description 8
- 230000005855 radiation Effects 0.000 description 8
- 229910052722 tritium Inorganic materials 0.000 description 8
- 230000035515 penetration Effects 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 235000012239 silicon dioxide Nutrition 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 230000000149 penetrating effect Effects 0.000 description 3
- 239000010453 quartz Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 238000010891 electric arc Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 229910052743 krypton Inorganic materials 0.000 description 2
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 description 2
- 239000011164 primary particle Substances 0.000 description 2
- 230000005258 radioactive decay Effects 0.000 description 2
- 208000030507 AIDS Diseases 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- GUTLYIVDDKVIGB-OUBTZVSYSA-N Cobalt-60 Chemical compound [60Co] GUTLYIVDDKVIGB-OUBTZVSYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-VVKOMZTBSA-N Dideuterium Chemical compound [2H][2H] UFHFLCQGNIYNRP-VVKOMZTBSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 238000001994 activation Methods 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000002844 continuous effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 229910052734 helium Inorganic materials 0.000 description 1
- 239000001307 helium Substances 0.000 description 1
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052754 neon Inorganic materials 0.000 description 1
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 239000005314 uranium glass Substances 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- -1 ~hallium 204 Chemical compound 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J65/00—Lamps without any electrode inside the vessel; Lamps with at least one main electrode outside the vessel
- H01J65/06—Lamps in which a gas filling is excited to luminesce by radioactive material structurally associated with the lamp, e.g. inside the vessel
Landscapes
- Physics & Mathematics (AREA)
- Engineering & Computer Science (AREA)
- Plasma & Fusion (AREA)
- Discharge Lamps And Accessories Thereof (AREA)
- Circuit Arrangements For Discharge Lamps (AREA)
- Non-Portable Lighting Devices Or Systems Thereof (AREA)
- Discharge Lamp (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US008,807 | 1979-02-02 | ||
| US06/008,807 US4247800A (en) | 1979-02-02 | 1979-02-02 | Radioactive starting aids for electrodeless light sources |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1133041A true CA1133041A (en) | 1982-10-05 |
Family
ID=21733788
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA344,898A Expired CA1133041A (en) | 1979-02-02 | 1980-02-01 | Radioactive starting aids for electrodeless light sources |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4247800A (enExample) |
| JP (1) | JPS55104063A (enExample) |
| CA (1) | CA1133041A (enExample) |
| DE (1) | DE3002901A1 (enExample) |
| FR (1) | FR2448224A1 (enExample) |
| GB (1) | GB2043334B (enExample) |
| NL (1) | NL7907319A (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4721888A (en) * | 1984-12-27 | 1988-01-26 | Gte Laboratories Incorporated | Arc discharge lamp with ultraviolet enhanced starting circuit |
| US4922157A (en) * | 1987-06-26 | 1990-05-01 | U.S. Philips Corp. | Electrodeless low-pressure discharge lamp with thermally isolated magnetic core |
| US4927217A (en) * | 1987-06-26 | 1990-05-22 | U.S. Philips Corp. | Electrodeless low-pressure discharge lamp |
| US4812714A (en) * | 1987-10-22 | 1989-03-14 | Gte Products Corporation | Arc discharge lamp with electrodeless ultraviolet radiation starting source |
| US4890042A (en) * | 1988-06-03 | 1989-12-26 | General Electric Company | High efficacy electrodeless high intensity discharge lamp exhibiting easy starting |
| US4926435A (en) * | 1988-08-22 | 1990-05-15 | Benjamin Kazan | Radioactive light sources |
| US5798611A (en) * | 1990-10-25 | 1998-08-25 | Fusion Lighting, Inc. | Lamp having controllable spectrum |
| US5670842A (en) * | 1990-10-25 | 1997-09-23 | Fusion Lighting Inc | Method and apparatus for igniting electroeless lamp discharge |
| US5345814A (en) * | 1990-12-28 | 1994-09-13 | Whirlpool Corporation | Method and apparatus for testing vacuum insulation panel quality |
| JPH06223789A (ja) * | 1992-12-23 | 1994-08-12 | Philips Electron Nv | 無電極低圧放電ランプ |
| US5838108A (en) * | 1996-08-14 | 1998-11-17 | Fusion Uv Systems, Inc. | Method and apparatus for starting difficult to start electrodeless lamps using a field emission source |
| US6107752A (en) * | 1998-03-03 | 2000-08-22 | Osram Sylvania Inc. | Coaxial applicators for electrodeless high intensity discharge lamps |
| RU2156517C1 (ru) * | 1999-06-25 | 2000-09-20 | Корчагин Юрий Владимирович | Способ возбуждения и поддержания разряда в безэлектродной лампе и устройство для его осуществления |
| GB0105491D0 (en) * | 2001-03-06 | 2001-04-25 | Univ Sheffield | Mercury discharge lamps |
| US6806646B2 (en) | 2001-09-24 | 2004-10-19 | Osram Sylvania Inc. | UV enhancer for a metal halide lamp |
| KR100531907B1 (ko) * | 2003-08-22 | 2005-11-29 | 엘지전자 주식회사 | 무전극 램프의 무전극 전구 |
| WO2010069122A1 (zh) * | 2008-12-19 | 2010-06-24 | 上海源明照明科技有限公司 | 无极荧光灯 |
| US20120014118A1 (en) * | 2009-06-10 | 2012-01-19 | Topanga Technologies, Inc. | Method and System for Replacing a Plasma Lamp Using a Removable Base Member from a Resonator Assembly |
| DE102011122857A1 (de) * | 2011-12-20 | 2013-06-20 | Max Mahn | Magnetfeldtritiumgasentladungsröhre |
| CN114361009B (zh) * | 2021-12-02 | 2024-05-14 | 中国原子能科学研究院 | 一种磁约束式长寿命同位素光源 |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US750889A (en) * | 1904-02-02 | Gas or vapor electric lamp | ||
| US1651308A (en) * | 1922-04-10 | 1927-11-29 | Winkelmann Louis | Audio amplifier |
| US2953684A (en) * | 1957-06-20 | 1960-09-20 | United States Radium Corp | Self-luminous light sources |
| US3109960A (en) * | 1960-09-16 | 1963-11-05 | Varian Associates | Electrodeless discharge lamp apparatus |
| US3110834A (en) * | 1960-10-27 | 1963-11-12 | Schneider Sol | Long life hydrogen thyratron |
| US3648100A (en) * | 1969-03-24 | 1972-03-07 | Westinghouse Electric Corp | Electrodeless pulsed illuminator |
| GB1392597A (en) * | 1971-05-08 | 1975-04-30 | Lovelock J E | Electron capture detectors |
| US3705319A (en) * | 1971-08-18 | 1972-12-05 | Westinghouse Electric Corp | Electrodeless gas discharge devices employing tritium as a source of ions to prime the discharge |
| US3787705A (en) * | 1972-04-28 | 1974-01-22 | Gen Electric | Microwave-excited light emitting device |
| GB1504741A (en) * | 1975-01-28 | 1978-03-22 | Radiochemical Centre Ltd | Iron-55- a source for use in ionisation chambers |
| US3943401A (en) * | 1975-04-21 | 1976-03-09 | Gte Laboratories Incorporated | Electrodeless light source having a lamp holding fixture which has a separate characteristic impedance for the lamp starting and operating mode |
| US3997816A (en) * | 1975-04-21 | 1976-12-14 | Gte Laboratories Incorporated | Starting assist device for an electrodeless light source |
| US4002944A (en) * | 1975-04-21 | 1977-01-11 | Gte Laboratories Incorporated | Internal match starter for termination fixture lamps |
| US3942058A (en) * | 1975-04-21 | 1976-03-02 | Gte Laboratories Incorporated | Electrodeless light source having improved arc shaping capability |
| US3993927A (en) * | 1975-04-21 | 1976-11-23 | Gte Laboratories Incorporated | Electrodeless light source |
| US3943402A (en) * | 1975-04-21 | 1976-03-09 | Gte Laboratories Incorporated | Termination fixture for an electrodeless lamp |
| US4001631A (en) * | 1975-04-21 | 1977-01-04 | Gte Laboratories Incorporated | Adjustable length center conductor for termination fixtures for electrodeless lamps |
| US3943404A (en) * | 1975-04-21 | 1976-03-09 | Gte Laboratories Incorporated | Helical coupler for use in an electrodeless light source |
| US3942068A (en) * | 1975-04-21 | 1976-03-02 | Gte Laboratories Incorporated | Electrodeless light source with a termination fixture having an improved center conductor for arc shaping capability |
| US4001632A (en) * | 1975-04-21 | 1977-01-04 | Gte Laboratories Incorporated | High frequency excited electrodeless light source |
| US3943403A (en) * | 1975-04-21 | 1976-03-09 | Gte Laboratories Incorporated | Electrodeless light source utilizing a lamp termination fixture having parallel capacitive impedance matching capability |
| US4002943A (en) * | 1975-07-22 | 1977-01-11 | Gte Laboratories Incorporated | Tunable microwave cavity |
| US3995195A (en) * | 1975-11-17 | 1976-11-30 | Gte Laboratories Incorporated | Eccentric termination fixture for an electrodeless light |
| US4065701A (en) * | 1976-07-14 | 1977-12-27 | Gte Laboratories Incorporated | Electrodeless light source with reduced heat losses |
| US4041352A (en) * | 1976-07-14 | 1977-08-09 | Gte Laboratories Incorporated | Automatic starting system for solid state powered electrodeless lamps |
| US4053814A (en) * | 1976-07-14 | 1977-10-11 | Gte Laboratories Incorporated | Continuous automatic starting assist uv circuit for microwave powered electrodeless lamps |
| US4070603A (en) * | 1976-07-14 | 1978-01-24 | Gte Laboratories Incorporated | Solid state microwave power source for use in an electrodeless light source |
-
1979
- 1979-02-02 US US06/008,807 patent/US4247800A/en not_active Expired - Lifetime
- 1979-10-02 NL NL7907319A patent/NL7907319A/nl not_active Application Discontinuation
-
1980
- 1980-01-28 DE DE19803002901 patent/DE3002901A1/de not_active Withdrawn
- 1980-02-01 GB GB8003448A patent/GB2043334B/en not_active Expired
- 1980-02-01 CA CA344,898A patent/CA1133041A/en not_active Expired
- 1980-02-01 JP JP1018780A patent/JPS55104063A/ja active Pending
- 1980-02-01 FR FR8002272A patent/FR2448224A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| NL7907319A (nl) | 1980-08-05 |
| DE3002901A1 (de) | 1980-08-07 |
| JPS55104063A (en) | 1980-08-09 |
| FR2448224A1 (fr) | 1980-08-29 |
| FR2448224B3 (enExample) | 1981-12-11 |
| US4247800A (en) | 1981-01-27 |
| GB2043334A (en) | 1980-10-01 |
| GB2043334B (en) | 1983-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1133041A (en) | Radioactive starting aids for electrodeless light sources | |
| US4359668A (en) | Method and apparatus for igniting electrodeless discharge lamp | |
| EP0293525B1 (en) | Fluorescent lighting system | |
| US3227923A (en) | Electrodeless vapor discharge lamp with auxiliary radiation triggering means | |
| Fairley et al. | Neutron scintillating glasses part III pulse decay time measurements at room temperature | |
| JPS57174847A (en) | Fluorescent discharge lamp | |
| US5682080A (en) | Method and apparatus for igniting electrodeless lamp discharge | |
| US5191460A (en) | UV source for high data rate secure communication | |
| US5418424A (en) | Vacuum ultraviolet light source utilizing rare gas scintillation amplification sustained by photon positive feedback | |
| Lavoie | Liquid xenon scintillators for imaging of positron emitters | |
| US3648100A (en) | Electrodeless pulsed illuminator | |
| JPS59169053A (ja) | 無電極放電灯 | |
| Charlton et al. | The production oflow energy positrons and positronium | |
| US2990491A (en) | Far ultraviolet light source | |
| US3781719A (en) | Passive tr tubes | |
| US2973444A (en) | Neutron source for well logging apparatus | |
| Kavetsky et al. | Conversion of radioactive decay energy to electricity | |
| US2983820A (en) | Well logging apparatus | |
| GB2391108A (en) | Radiation detector | |
| US4926435A (en) | Radioactive light sources | |
| US3146366A (en) | Neutron generation | |
| Kerwin et al. | Energy dependence of E’spin production in x-irradiated vitreous SiO 2 | |
| SE7901877L (sv) | Forfarande for separering av olika isotoper i foreningar medelst laserstralning | |
| SU1368924A1 (ru) | Способ получени ренгеновского излучени | |
| US3244914A (en) | Thermoelectric conversion process and apparatus |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |